[seiscomp, scanloc] Install, add .gitignore

include/seiscomp/gui/core/aboutwidget.h

@@ -0,0 +1,49 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef ABOUTWIDGET
+#define ABOUTWIDGET
+
+#include <QWidget>
+#include <QPixmap>
+
+#include <seiscomp/gui/core/ui_aboutwidget.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class AboutWidget : public QWidget {
+	Q_OBJECT
+
+	public:
+		AboutWidget(QWidget* parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~AboutWidget();
+
+	private:
+		Ui::AboutWidget _ui;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/core/application.h

@@ -0,0 +1,384 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_APPLICATION_H
+#define SEISCOMP_GUI_APPLICATION_H
+
+#include <QApplication>
+#include <QString>
+#include <QRectF>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/client/application.h>
+#endif
+
+#include <seiscomp/gui/core/maps.h>
+#include <seiscomp/gui/core/scheme.h>
+#include <seiscomp/gui/core/messagethread.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/gui/core/messages.h>
+#endif
+
+#include <seiscomp/gui/core/ui_showplugins.h>
+
+
+#define SCApp (Seiscomp::Gui::Application::Instance())
+#define SCScheme (SCApp->scheme())
+
+class QAbstractItemView;
+class QHeaderView;
+class QSplashScreen;
+
+namespace Seiscomp {
+
+namespace Core {
+
+DEFINE_SMARTPOINTER(Message);
+
+}
+
+namespace Communication {
+
+DEFINE_SMARTPOINTER(Connection);
+
+}
+
+namespace IO {
+
+DEFINE_SMARTPOINTER(DatabaseInterface);
+
+}
+
+namespace Logging {
+
+class FileOutput;
+
+}
+
+namespace DataModel {
+
+DEFINE_SMARTPOINTER(DatabaseQuery);
+DEFINE_SMARTPOINTER(Network);
+DEFINE_SMARTPOINTER(Station);
+DEFINE_SMARTPOINTER(Notifier);
+DEFINE_SMARTPOINTER(Object);
+
+}
+
+
+namespace Gui {
+
+
+class ConnectionDialog;
+
+
+struct MessageGroups {
+	std::string pick;
+	std::string amplitude;
+	std::string magnitude;
+	std::string location;
+	std::string focalMechanism;
+	std::string event;
+};
+
+
+class SC_GUI_API Application : public QObject, public Client::Application {
+	Q_OBJECT
+
+	public:
+		//! Application flags
+		enum Flags {
+			//! Show splash screen on startup
+			SHOW_SPLASH            = 0x001,
+			//! The application wants a database connection
+			WANT_DATABASE          = 0x002,
+			//! The application wants a messaging connection
+			WANT_MESSAGING         = 0x004,
+			//! The connection dialog should be opened when
+			//! either one of the connections that has been
+			//! requested with 'WANT_[SERVICE]' failed to create
+			OPEN_CONNECTION_DIALOG = 0x008,
+			//! If WANT_DATABASE is enabled and no custom settings
+			//! are provided in the configuration file it tries to
+			//! fetch the database connection from the messaging
+			FETCH_DATABASE         = 0x010,
+			//! Should received notifier messages be applied or not
+			AUTO_APPLY_NOTIFIER    = 0x020,
+			//! Should received notifier messages be interpreted or not
+			//! When this flag is not set the signals 'addObject',
+			//! 'removeObject' and 'updateObject' are not fired
+			INTERPRETE_NOTIFIER    = 0x040,
+			LOAD_STATIONS          = 0x080,
+			LOAD_INVENTORY         = 0x100,
+			LOAD_CONFIGMODULE      = 0x200,
+			DEFAULT                = SHOW_SPLASH |
+			                         WANT_DATABASE |
+			                         WANT_MESSAGING |
+			                         OPEN_CONNECTION_DIALOG |
+			                         FETCH_DATABASE |
+			                         AUTO_APPLY_NOTIFIER |
+			                         INTERPRETE_NOTIFIER
+		};
+
+		enum Type {
+			//! Console application
+			Tty,
+			//! GUI client application
+			GuiClient
+		};
+
+	public:
+		Application(int& argc, char **argv, int flags = DEFAULT, Type type = GuiClient);
+		virtual ~Application();
+
+
+	public:
+		//! Returns the pointer to the application's instance.
+		static Application *Instance();
+
+		//! Checks if the installed Qt version is at least the
+		//! one passed in 'ver'
+		static bool minQtVersion(const char *ver);
+
+		//! Creates a CSV table into a string.
+		static QString createCSV(const QAbstractItemView* view,
+		                         const QHeaderView *header = nullptr);
+
+		//! Copies all selected items of specified item view to clipboard as CSV
+		static void copyToClipboard(const QAbstractItemView* view,
+		                            const QHeaderView *header = nullptr);
+
+		Type type() const;
+
+		Scheme &scheme();
+
+		QSettings &settings();
+		const QSettings &settings() const;
+
+		bool startFullScreen() const;
+		bool nonInteractive() const;
+
+		bool isReadOnlyMessaging() const { return _readOnlyMessaging; }
+
+		const MapsDesc &mapsDesc() const;
+		const MessageGroups &messageGroups() const;
+
+		Core::TimeSpan maxEventAge() const;
+
+		QColor configGetColor(const std::string& query, const QColor& base) const;
+		Gradient configGetColorGradient(const std::string& query, const Gradient& base) const;
+		QFont configGetFont(const std::string& query, const QFont& base) const;
+		QPen configGetPen(const std::string& query, const QPen& base) const;
+		QBrush configGetBrush(const std::string& query, const QBrush& base) const;
+
+		void configSetColorGradient(const std::string& query, const Gradient &gradient);
+
+		void setFilterCommandsEnabled(bool);
+
+		const std::string &commandTarget() const;
+
+		void sendCommand(Command command, const std::string& parameter);
+		void sendCommand(Command command, const std::string& parameter, Core::BaseObject*);
+
+		//! Sets the mainwidget which is used as hint to close the
+		//! splashscreen when the widget is shown
+		void setMainWidget(QWidget*);
+
+		void showMessage(const char*) override;
+		void showWarning(const char*) override;
+
+		bool notify(QObject *receiver, QEvent *e);
+
+		bool sendMessage(Seiscomp::Core::Message* msg);
+		bool sendMessage(const char* group, Seiscomp::Core::Message* msg);
+
+		//! This method allows to emit notifier locally. They are not being sent over
+		//! the messaging but interpreted and signalled to other local components.
+		void emitNotifier(Seiscomp::DataModel::Notifier* n);
+
+		QFont font() const;
+		void setFont(const QFont &font);
+
+		QPalette palette() const;
+		void setPalette(const QPalette &pal);
+
+
+	protected:
+		bool init() override;
+		bool run() override;
+		void done() override;
+
+		void exit(int returnCode) override;
+
+		bool initConfiguration() override;
+		bool initSubscriptions() override;
+
+		void schemaValidationNames(std::vector<std::string> &modules,
+		                           std::vector<std::string> &plugins) const override;
+
+		bool validateParameters() override;
+
+		bool handleInitializationError(int) override;
+		void handleInterrupt(int) throw() override;
+
+		virtual QString splashImagePath() const;
+
+
+	signals:
+		void changedConnection();
+		void changedDatabase();
+
+		void connectionEstablished();
+		void connectionLost();
+
+		void showNotification(NotificationLevel level, QString message);
+
+		void messageSkipped(Seiscomp::Client::Packet*);
+		void messageAvailable(Seiscomp::Core::Message*, Seiscomp::Client::Packet*);
+
+		void notifierAvailable(Seiscomp::DataModel::Notifier*);
+
+		void addObject(const QString &parentID, Seiscomp::DataModel::Object*);
+		void removeObject(const QString &parentID, Seiscomp::DataModel::Object*);
+		void updateObject(const QString &parentID, Seiscomp::DataModel::Object*);
+
+
+	public slots:
+		void showSettings();
+		void quit();
+
+
+	private slots:
+		void createConnection(QString host, QString user, QString group,
+		                      int TimeOut, QString peerCertificate);
+		void destroyConnection();
+		void databaseChanged();
+
+		void messagesAvailable();
+
+		void onConnectionEstablished();
+		void onConnectionLost();
+		void connectionError(int code);
+
+		void objectDestroyed(QObject*);
+		void closedLastWindow();
+
+		void showAbout();
+		void showHelpIndex();
+		void showAppHelp();
+		void showPlugins();
+
+		void timerSOH();
+		void handleSignalNotification();
+
+
+	private:
+		void startMessageThread();
+		void closeMessageThread();
+		void createSettingsDialog();
+		ConnectionDialog *cdlg();
+
+
+	private:
+		static Application *_instance;
+
+
+	protected:
+		struct _GUI_Core_Settings : System::Application::AbstractSettings {
+			bool        fullScreen{false};
+			bool        interactive{true};
+			std::string guiGroup{"GUI"};
+			std::string commandTargetClient;
+
+			struct _MapsDesc : MapsDesc {
+				_MapsDesc();
+
+				QString format;
+
+				void accept(SettingsLinker &linker);
+			}           mapsDesc;
+
+			void accept(SettingsLinker &linker);
+
+		}                   _settings;
+
+		QApplication       *_app;
+		Type                _type;
+		Scheme             *_scheme;
+		mutable QSettings  *_qSettings;
+		QTimer              _timerSOH;
+
+		bool                _readOnlyMessaging;
+		Core::TimeSpan      _eventTimeAgo;
+		MessageGroups       _messageGroups;
+
+		QWidget            *_mainWidget;
+		QSplashScreen      *_splash;
+		ConnectionDialog   *_dlgConnection;
+		bool                _settingsOpened;
+		bool                _filterCommands;
+
+		MessageThread      *_thread;
+		int                 _flags;
+
+		QSocketNotifier    *_signalNotifier;
+		int                 _signalSocketFd[2];
+};
+
+
+template <typename T>
+class Kicker : public Application {
+	public:
+		Kicker(int& argc, char **argv, int flags = DEFAULT)
+			: Application(argc, argv, flags) {}
+
+
+	protected:
+		virtual void setupUi(T*) {}
+		virtual bool initUi(T*) { return true; }
+
+		virtual bool run() {
+			showMessage("Setup user interface");
+
+			T* w = new T;
+			if ( !initUi(w) ) {
+				showMessage("Kicker initialization failed, abort");
+				delete w;
+				return false;
+			}
+
+			setupUi(w);
+			setMainWidget(w);
+
+			if ( startFullScreen() )
+				w->showFullScreen();
+			else
+				w->showNormal();
+
+			return Application::run();
+		}
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/connectiondialog.h

@@ -0,0 +1,133 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_CONNECTIONDIALOG_H
+#define SEISCOMP_GUI_CONNECTIONDIALOG_H
+
+#include <seiscomp/gui/core/ui_connectiondialog.h>
+#include <seiscomp/gui/qt.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/io/database.h>
+#include <seiscomp/messaging/connection.h>
+#endif
+
+#include <QDialog>
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API ConnectionDialog : public QDialog {
+	Q_OBJECT
+
+	// ------------------------------------------------------------------
+	//  X'truction
+	// ------------------------------------------------------------------
+	public:
+		ConnectionDialog(Seiscomp::Client::ConnectionPtr*,
+		                 Seiscomp::IO::DatabaseInterfacePtr*,
+		                 QWidget* parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~ConnectionDialog();
+
+
+	public:
+		void setUsername(const QString& username);
+
+		void setClientParameters(const QString& server,
+		                         const QString& username,
+		                         const QString& primaryGroup,
+		                         const QStringList& groups,
+		                         int timeout,
+		                         const QString &peerCertificate);
+
+		bool setMessagingEnabled(bool);
+
+		bool setDatabaseParameters(const QString &uri);
+		bool setDatabaseParameters(const QString &type, const QString &connection);
+
+		bool setDefaultDatabaseParameters(const QString &uri);
+		bool setDefaultDatabaseParameters(const QString &type, const QString &connection);
+
+		std::string databaseURI() const;
+
+		bool connectToMessaging();
+		bool connectToDatabase();
+
+		bool hasConnectionChanged() const;
+		bool hasDatabaseChanged() const;
+
+
+	// ------------------------------------------------------------------
+	//  Public signals
+	// ------------------------------------------------------------------
+	signals:
+		void aboutToConnect(QString host, QString user, QString group,
+		                    int timeout, QString peerCertificate);
+		void aboutToDisconnect();
+
+		void databaseChanged();
+
+
+	// ------------------------------------------------------------------
+	//  Public slots
+	// ------------------------------------------------------------------
+	public slots:
+		void onConnectionError(int code);
+		int exec();
+
+
+	// ------------------------------------------------------------------
+	//  Protected slots
+	// ------------------------------------------------------------------
+	protected slots:
+		void onConnect();
+		void onSwitchToReported();
+		void onDatabaseConnect();
+		void onItemChanged(QListWidgetItem *item);
+		void onSelectAll();
+		void onDeselectAll();
+		void onPeerCertificateOpen();
+
+
+	// ------------------------------------------------------------------
+	//  Members
+	// ------------------------------------------------------------------
+	private:
+		::Ui::ConnectionDialog _ui;
+		Seiscomp::Client::ConnectionPtr* _connection;
+		Seiscomp::IO::DatabaseInterfacePtr* _db;
+		QStringList _requestedGroups;
+
+		bool _requestAllGroups;
+		bool _messagingEnabled;
+
+		bool _changedDatabase;
+		bool _changedConnection;
+
+		QString _reportedDbType;
+		QString _reportedDbParameters;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/core/connectionstatelabel.h

@@ -0,0 +1,67 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_CONNECTIONSTATELABEL_H
+#define SEISCOMP_GUI_CONNECTIONSTATELABEL_H
+
+
+#include <seiscomp/gui/qt.h>
+
+#include <QLabel>
+#include <QPixmap>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API ConnectionStateLabel : public QLabel {
+	Q_OBJECT
+
+	public:
+		ConnectionStateLabel(QWidget *parent = nullptr, Qt::WindowFlags f = {});
+
+		void setPixmaps(const QPixmap &connected, const QPixmap &disconnected);
+
+
+	public slots:
+		void start(const QString &source);
+		void stop();
+
+
+	signals:
+		void customInfoWidgetRequested(const QPoint &pos);
+
+
+	protected:
+		void mousePressEvent(QMouseEvent *event);
+
+
+		QPixmap _connected;
+		QPixmap _disconnected;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/diagramwidget.h

@@ -0,0 +1,384 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_DIAGRAMWIDGET_H
+#define SEISCOMP_GUI_DIAGRAMWIDGET_H
+
+
+#include <QWidget>
+#include <QMenu>
+#include <QLabel>
+#include <QDialog>
+#include <QVector>
+#include <QPointF>
+#include <QPen>
+
+#include <seiscomp/gui/core/gradient.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API DiagramWidget : public QWidget {
+	Q_OBJECT
+
+	// ------------------------------------------------------------------
+	//  Enumerations
+	// ------------------------------------------------------------------
+	public:
+		enum Type {
+			Rectangular,
+			Spherical
+		};
+
+		enum SymbolType {
+			Circle,
+			Triangle,
+			TriangleUpsideDown,
+			Rectangle,
+			Diamond
+		};
+
+		enum SelectionMode {
+			SelectActiveState,
+			SelectEnableState
+		};
+
+	// ------------------------------------------------------------------
+	//  X'truction
+	// ------------------------------------------------------------------
+	public:
+		DiagramWidget(QWidget * parent = 0, Type type = Rectangular, Qt::WindowFlags f = Qt::WindowFlags());
+		~DiagramWidget();
+
+
+	// ------------------------------------------------------------------
+	//  Qt event overrides
+	// ------------------------------------------------------------------
+	protected:
+		void resizeEvent(QResizeEvent *event);
+		void paintEvent(QPaintEvent *event);
+
+		void mouseDoubleClickEvent(QMouseEvent *event);
+		void mousePressEvent(QMouseEvent *event);
+		void mouseReleaseEvent(QMouseEvent *event);
+		void mouseMoveEvent(QMouseEvent *event);
+
+		void keyPressEvent(QKeyEvent *event);
+		void keyReleaseEvent(QKeyEvent *event);
+
+		void contextMenuEvent(QContextMenuEvent *event);
+
+
+	// ------------------------------------------------------------------
+	//  Signals
+	// ------------------------------------------------------------------
+	signals:
+		void hover(int id);
+		void clicked(int id);
+
+		void valueActivated(int id);
+		void valueDeactivated(int id);
+		void valueActiveStateChanged(int id, bool state);
+
+		void valueEnabled(int id);
+		void valueDisabled(int id);
+		void valueEnableStateChanged(int id, bool state);
+
+		void beginSelection();
+		void endSelection();
+
+		void adjustZoomRect(QRectF& zoomRect);
+
+
+	// ------------------------------------------------------------------
+	//  Interface
+	// ------------------------------------------------------------------
+	public:
+		void setType(Type);
+
+		void setColumnCount(int);
+		int columnCount() const;
+
+		void setBackgroundColor(const QColor& c);
+		void setErrorBarPens(const QPen &penError, const QPen &penDefaultError);
+
+		void setMargin(int margin);
+
+		void setMarkerDistance(double xDist, double yDist);
+		void setMarkerDistance(QPointF distances);
+
+		void setIndicies(int x, int y);
+
+		void setAbscissaName(const QString&);
+		void setOrdinateName(const QString&);
+
+		void setValueDisabledColor(const QColor&);
+		void setDisabledValuesHidden(bool);
+		void setDrawGridLines(bool);
+
+		void clear();
+		int count() const;
+		bool isEmpty() const;
+
+		void addValue(qreal abzisse, qreal ordinate);
+		void addValue(const QPointF& point);
+		void addValue(const QPointF& point, const QColor& color);
+
+		void addValue(int x, int y, qreal abzisse, qreal ordinate);
+		void addValue(int x, int y, const QPointF& point);
+		void addValue(int x, int y, const QPointF& point, const QColor& color);
+
+		QPointF value(int id) const;
+		float value(int id, int x) const { return _values[id].cols[x].value; }
+
+		void setDisplayRect(const QRectF& rect);
+		QRectF displayRect() const;
+
+		QRectF boundingRect() const;
+
+		const QRect &diagramRect() const { return _diagramArea; }
+
+		QVector<int> getValues(const QRectF& rect) const;
+
+		QVector<int> getSelectedValues() const;
+		QRectF getSelectedValuesRect() const;
+
+		void selectValues(const QRectF& targetRect);
+
+		void setValue(int id, int x, qreal v, qreal lowerError = -1, qreal upperError = -1,
+		              bool defaultError = false);
+		void setValue(int id, const QPointF& p);
+		void setValue(int id, int x, int y, const QPointF& p);
+		void setValueColor(int id, const QColor& c);
+		void setValueColor(int id, int x, const QColor& c);
+		void setValueValid(int id, int x, bool valid);
+		void setValueSymbol(int id, SymbolType type);
+		void setValueSelected(int id, bool selected);
+		void setValueEnabled(int id, bool enabled);
+
+		bool isValueValid(int id, int x) const;
+		bool isValueSelected(int id) const;
+		bool isValueEnabled(int id) const;
+		bool isValueShown(int id) const;
+
+		void showValue(int id, bool = true);
+		void hideValue(int id, bool = true);
+
+		void updateBoundingRect();
+
+		int hoveredValue() const { return _hoverId; }
+
+
+	public slots:
+		void setDrawErrorBars(bool);
+
+
+	// ------------------------------------------------------------------
+	//  Protected interface
+	// ------------------------------------------------------------------
+	protected:
+		virtual void updateContextMenu(QMenu &menu);
+		virtual void handleContextMenuAction(QAction *action);
+		virtual void diagramAreaUpdated(const QRect &);
+		virtual void paintSphericalBackground(QPainter &);
+		virtual void drawValues(QPainter &painter);
+		virtual void drawValue(int id, QPainter& painter, const QPointF& p,
+		                       SymbolType type, bool valid) const;
+
+
+	// ------------------------------------------------------------------
+	//  Implementation
+	// ------------------------------------------------------------------
+	private slots:
+		void zoomIntoSelectedValues();
+		void resetZoom();
+		void selectActiveState();
+		void selectEnableState();
+
+
+	private:
+		QPointF projectRectangular(const QPointF& p) const;
+		QPointF unProjectRectangular(const QPointF& p) const;
+
+		QPointF projectSpherical(const QPointF& p) const;
+		QPointF unProjectSpherical(const QPointF& p) const;
+
+		bool containsRectangular(const QRectF&, const QPointF&) const;
+		bool containsSpherical(const QRectF&, const QPointF&) const;
+
+		void updateBoundingRect(const QPointF& p);
+
+		void changeState(int id, bool state);
+		void toggleState(int id);
+		void restoreState(int id);
+
+		void paintRectangular(QPainter &painter);
+		void paintSpherical(QPainter &painter);
+
+		void clipRectRectangular(QRectF &rect);
+		void clipRectSpherical(QRectF &rect);
+
+		void adjustZoomRectangular(QRectF& zoomRect);
+		void adjustZoomSpherical(QRectF& zoomRect);
+
+		void drawAbscissa(QPainter& painter, int y, bool drawMarker, bool topAligned);
+		void drawOrdinate(QPainter& painter, int x, int abzisseHeight, qreal abzisseValue, bool leftAligned);
+
+		void drawHText(QPainter& painter, int x, int y, qreal value, Qt::Alignment al, bool topAligned) const;
+		void drawVText(QPainter& painter, int x, int y, qreal value, Qt::Alignment al, bool leftAligned) const;
+
+		int findValue(const QPoint& p) const;
+
+		void checkSelection(int id);
+		void updateSelection();
+
+		void saveStates();
+		void updateDiagramArea();
+
+
+	// ------------------------------------------------------------------
+	//  Members
+	// ------------------------------------------------------------------
+	protected:
+		typedef QPointF (DiagramWidget::*ProjectFunc)(const QPointF&) const;
+		typedef QPointF (DiagramWidget::*UnProjectFunc)(const QPointF&) const;
+		typedef bool (DiagramWidget::*ContainsFunc)(const QRectF&, const QPointF&) const;
+		typedef void (DiagramWidget::*AdjustZoomFunc)(QRectF&);
+
+		struct ValueItem {
+			ValueItem() : type(Circle) {}
+
+			ValueItem(int nc, int x, int y, const QPointF& p_, bool active)
+			 : isActive(active), isEnabled(true), isVisible(true), type(Circle) {
+				saveActiveState = isActive;
+				saveEnableState = isEnabled;
+				cols.resize(nc); cols[x].value = p_.x(); cols[y].value = p_.y();
+			}
+
+			ValueItem(int nc, int x, int y, const QPointF& p_, bool active, const QColor& c_)
+			 : isActive(active), isEnabled(true), isVisible(true), type(Circle) {
+				saveActiveState = isActive;
+				saveEnableState = isEnabled;
+				cols.resize(nc); cols[x].value = p_.x(); cols[y].value = p_.y(); cols[y].color = c_;
+			}
+
+			void setColumns(int nc) { cols.resize(nc); }
+
+			QPointF pt(int x, int y) const { return QPointF(cols[x].value, cols[y].value); }
+			void setPt(int x, int y, const QPointF& p_) {
+				cols[x].value = p_.x(); cols[x].lowerError = -1; cols[x].upperError = -1;
+				cols[y].value = p_.y(); cols[y].lowerError = -1; cols[y].upperError = -1;
+			}
+			float ptx(int x) const { return cols[x].value; }
+			bool valid(int x, int y) const { return cols[x].valid && cols[y].valid; }
+
+			struct ColumnValueItem {
+				float  value;
+				float  lowerError{-1}, upperError{-1};
+				bool   defaultError{false};
+				QColor color;
+				bool   valid{true};
+			};
+
+			QVector<ColumnValueItem> cols;
+
+			bool isActive;
+			bool isEnabled;
+			bool isVisible;
+			bool saveActiveState;
+			bool saveEnableState;
+			SymbolType type;
+		};
+
+		enum RubberBandOperation {
+			Select,
+			SelectPlus,
+			SelectMinus
+		};
+
+		QString _nameX;
+		QString _nameY;
+
+		SelectionMode _mode;
+
+		Type   _type;
+		QColor _disabledColor;
+		QColor _background;
+		QPen   _penErrorBar;
+		QPen   _penDefaultErrorBar;
+
+		ProjectFunc project;
+		UnProjectFunc unProject;
+		ContainsFunc contains;
+		AdjustZoomFunc adjustZoom;
+
+		QRect _clientArea;
+		QRect _diagramArea;
+		QPointF _markerDistance;
+
+		QVector<ValueItem> _values;
+		QVector<int> _selected;
+		QRectF _boundingRect;
+		QRectF _displayRect;
+		QRectF _requestRect;
+
+		int _columns;
+		int _xIndex;
+		int _yIndex;
+
+		int _horMargin, _verMargin;    // horizintal/vertical margins
+		int _tickLength, _tickLengthA; // unannotated/annotated tick length
+		int _annotOffset;
+		int _textHeight;
+
+		QRectF _rubberBand;
+		RubberBandOperation _rubberBandOperation;
+
+		bool _hideDisabledValues;
+		bool _drawGridLines;
+		bool _drawErrorBars;
+
+		QPointF _draggingStart;
+		bool _dragStart;
+		bool _dragZoom;
+		bool _dragging;
+		bool _selecting;
+		bool _indicesChanged;
+
+		int _hoverId;
+
+		QAction* _zoomAction;
+		QAction* _resetAction;
+		QAction* _toggleUncertainties;
+
+		QAction* _actionActivate;
+		QAction* _actionEnable;
+};
+
+
+}
+}
+
+
+#endif
+

include/seiscomp/gui/core/flowlayout.h

@@ -0,0 +1,94 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+#ifndef SEISCOMP_GUI_FLOWLAYOUT_H
+#define SEISCOMP_GUI_FLOWLAYOUT_H
+
+
+#include <seiscomp/gui/qt.h>
+
+#include <QLayout>
+#include <QRect>
+#include <QWidgetItem>
+#include <QStyle>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API FlowLayout : public QLayout {
+	// ------------------------------------------------------------------
+	//  X'truction
+	// ------------------------------------------------------------------
+	public:
+		FlowLayout(QWidget *parent, int margin = -1, int hSpacing = -1, int vSpacing = -1);
+		FlowLayout(int margin = -1, int hSpacing = -1, int vSpacing = -1);
+		~FlowLayout();
+
+
+	// ------------------------------------------------------------------
+	//  Public interface
+	// ------------------------------------------------------------------
+	public:
+		int horizontalSpacing() const;
+		int verticalSpacing() const;
+
+
+	// ------------------------------------------------------------------
+	//  QLayout interface
+	// ------------------------------------------------------------------
+	public:
+		void addItem(QLayoutItem *item) override;
+		Qt::Orientations expandingDirections() const override;
+		bool hasHeightForWidth() const override;
+		int heightForWidth(int) const override;
+		int count() const override;
+		QLayoutItem *itemAt(int index) const override;
+		QSize minimumSize() const override;
+		void setGeometry(const QRect &rect) override;
+		QSize sizeHint() const override;
+		QLayoutItem *takeAt(int index) override;
+
+
+	// ------------------------------------------------------------------
+	//  Protected interface
+	// ------------------------------------------------------------------
+	protected:
+		virtual int doLayout(const QRect &rect, bool testOnly) const;
+
+
+	// ------------------------------------------------------------------
+	//  Private members
+	// ------------------------------------------------------------------
+		int smartSpacing(QStyle::PixelMetric pm) const;
+
+	protected:
+		QVector<QLayoutItem *> _itemList;
+
+		int                    _hSpace;
+		int                    _vSpace;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/gradient.h

@@ -0,0 +1,59 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_CORE_GRADIENT_H
+#define SEISCOMP_GUI_CORE_GRADIENT_H
+
+#include <seiscomp/gui/qt.h>
+
+#include <QColor>
+#include <QMap>
+#include <QPair>
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API Gradient : public QMap<qreal, QPair<QColor, QString> > {
+	public:
+		typedef QPair<QColor, QString> ValueType;
+
+	public:
+		Gradient();
+
+	public:
+		//! Sets the color and text at a specified position
+		void setColorAt(qreal position, const QColor &color,
+		                const QString& text = "");
+
+		//! Returns the color at position. If position falls between
+		//! two color positions, the resulting color will be
+		//! interpolated linearly between both colors. When the discrete flag
+		//! is set, the interpolation will be disabled
+		QColor colorAt(qreal position, bool discrete = false) const;
+};
+
+
+}
+}
+
+
+# endif

include/seiscomp/gui/core/infotext.h

@@ -0,0 +1,66 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_INFOTEXT_H
+#define SEISCOMP_GUI_INFOTEXT_H
+
+#include <seiscomp/gui/core/ui_infotext.h>
+#include <seiscomp/gui/qt.h>
+
+#include <QDialog>
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API InfoText : public QDialog {
+	// ------------------------------------------------------------------
+	//  X'truction
+	// ------------------------------------------------------------------
+	public:
+		InfoText(QWidget* parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~InfoText();
+
+
+	// ------------------------------------------------------------------
+	//  Public interface
+	// ------------------------------------------------------------------
+	public:
+		void setText(const QString& text);
+		void appendText(const QString& text);
+
+		void setReadOnly(bool readOnly);
+		bool isReadOnly() const;
+
+
+	// ------------------------------------------------------------------
+	//  Attributes
+	// ------------------------------------------------------------------
+	private:
+		Ui::InfoText _ui;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/inspector.h

@@ -0,0 +1,90 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SC_GUI_INSPECTOR_H
+#define SC_GUI_INSPECTOR_H
+
+
+#include <QTreeWidget>
+#include <QTableWidget>
+#include <QTimer>
+#include <QStack>
+
+#include <seiscomp/gui/core/ui_inspector.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/baseobject.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API Inspector : public QWidget {
+
+	Q_OBJECT
+
+	public:
+		Inspector(QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~Inspector();
+
+
+	public:
+		void setObject(Core::BaseObject *obj);
+		void selectObject(Core::BaseObject *obj);
+
+
+	private:
+		void addObject(QTreeWidgetItem *parent);
+		void addProperty(const std::string &name, const std::string &type,
+		                 const std::string &value, bool isIndex = false,
+		                 bool isOptional = false, bool isReference = false);
+		void selectObject(QTreeWidgetItem *parent, Core::BaseObject *obj);
+		bool filterTree(QTreeWidgetItem *parent, const std::string &type,
+		                const std::string &attr, const std::string &value,
+		                QTreeWidgetItem **firstMatch,
+		                bool parentMatch = false);
+
+
+	private slots:
+		void selectionChanged();
+		void filterChanged(QString);
+		void applyFilter();
+		void linkClicked(QString);
+		void back();
+
+
+	private:
+		typedef QPair<Core::BaseObject*, Core::BaseObject*> State;
+
+		Core::BaseObject *_object;
+		Core::BaseObject *_currentSelection;
+		Ui::Inspector     _ui;
+		QStack<State>     _history;
+		QTimer            _filterTimer;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/locator.h

@@ -0,0 +1,41 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_LOCATOR_H
+#define SEISCOMP_GUI_LOCATOR_H
+
+
+#include <seiscomp/gui/qt.h>
+#include <seiscomp/seismology/locatorinterface.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+DataModel::Origin* relocate(Seismology::LocatorInterface *loc, DataModel::Origin* origin);
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/mainwindow.h

@@ -0,0 +1,137 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_MAINWINDOW_H
+#define SEISCOMP_GUI_MAINWINDOW_H
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/baseobject.h>
+#endif
+#include <seiscomp/gui/core/connectionstatelabel.h>
+#include <seiscomp/gui/core/messages.h>
+
+#include <QMainWindow>
+
+namespace Seiscomp {
+
+namespace Core {
+
+DEFINE_SMARTPOINTER(Message);
+
+}
+
+namespace Client {
+
+DEFINE_SMARTPOINTER(Connection);
+DEFINE_SMARTPOINTER(Packet);
+
+}
+
+namespace IO {
+
+DEFINE_SMARTPOINTER(DatabaseInterface);
+
+}
+
+namespace Logging {
+
+class FileOutput;
+
+}
+
+namespace DataModel {
+
+DEFINE_SMARTPOINTER(DatabaseQuery);
+DEFINE_SMARTPOINTER(Network);
+DEFINE_SMARTPOINTER(Station);
+DEFINE_SMARTPOINTER(Notifier);
+DEFINE_SMARTPOINTER(Object);
+
+}
+
+
+namespace Gui {
+
+
+class SC_GUI_API MainWindow : public QMainWindow {
+	Q_OBJECT
+
+	public:
+		MainWindow(QWidget * parent = 0, Qt::WindowFlags = Qt::WindowFlags());
+		~MainWindow();
+
+
+	public:
+		bool restoreGeometry(const QByteArray & geometry);
+
+
+	protected:
+		void paintEvent(QPaintEvent *e);
+		void showEvent(QShowEvent*);
+		void dropEvent(QDropEvent *);
+		void dragEnterEvent(QDragEnterEvent *);
+
+		virtual void toggledFullScreen(bool);
+
+	signals:
+		void fullScreenToggled(bool);
+
+	public slots:
+		void showNormal();
+		void showFullScreen();
+
+		void setTitle(QString);
+		QString title() const;
+
+
+	private slots:
+		void onChangedConnection();
+		void toggleFullScreen();
+
+		void connectionEstablished();
+		void connectionLost();
+
+		void inspectConfig();
+		void inspectInventory();
+
+		void showNotification(NotificationLevel level, QString message);
+
+
+	protected:
+		QAction* _actionToggleFullScreen;
+		QAction* _actionShowSettings;
+
+
+	private:
+		QMenuBar *_menuBar;
+		QWidget *_menuWidget;
+		ConnectionStateLabel *_connectionState;
+		QString _title;
+		bool _showFullscreen;
+};
+
+
+}
+}
+
+
+#endif
+

include/seiscomp/gui/core/maps.h

@@ -0,0 +1,65 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+#ifndef SEISCOMP_GUI_MAPS_H
+#define SEISCOMP_GUI_MAPS_H
+
+
+#include <seiscomp/gui/qt.h>
+#include <QString>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+/**
+ * ----------------------------------------------------------------------------
+ * TileStore version history
+ * ----------------------------------------------------------------------------
+ * 1
+ *   - Initial version
+ * 2
+ *   - Allow TileStore::load to return null images
+ * 3
+ *   - Do not inherit from MapTree and remove MapTreeNode completely
+ *   - Add maxLevel query
+ *   - Replace TextureID with Tile
+ *   - All parameters with type MapTreeNode are replaced by parameters
+ *     with type Tile
+ * 4 - Add two new methods to notify about asynchronous tile loading
+ *     success and cancellation
+ */
+#define TILESTORE_VERSION 4
+
+
+struct SC_GUI_API MapsDesc {
+	QString location;
+	QString type;
+	bool    isMercatorProjected;
+	size_t  cacheSize;
+};
+
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/messages.h

@@ -0,0 +1,126 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MESSAGE_H
+#define SEISCOMP_GUI_MESSAGE_H
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/message.h>
+#include <seiscomp/core/enumeration.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+MAKEENUM(
+	Command,
+	EVALUES(
+		CM_UNDEFINED,
+		CM_SHOW_ORIGIN,
+		CM_SHOW_STREAMS,
+		CM_SHOW_MAGNITUDE,
+		CM_OBSERVE_LOCATION,
+		CM_SHOW_NOTIFICATION
+	),
+	ENAMES(
+		"undefined",
+		"show origin",
+		"show streams",
+		"show magnitude",
+		"observe location",
+		"show notification"
+	)
+);
+
+
+MAKEENUM(
+	NotificationLevel,
+	EVALUES(
+		NL_UNDEFINED,
+		NL_INFO,
+		NL_WARNING,
+		NL_CRITICAL,
+		NL_FAILURE
+	),
+	ENAMES(
+		"undefined",
+		"info",
+		"warning",
+		"critical",
+		"failure"
+	)
+);
+
+
+DEFINE_SMARTPOINTER(CommandMessage);
+
+class SC_GUI_API CommandMessage : public Seiscomp::Core::Message {
+	DECLARE_SC_CLASS(CommandMessage);
+	DECLARE_SERIALIZATION;
+
+
+	// ------------------------------------------------------------------
+	//  X'truction
+	// ------------------------------------------------------------------
+	private:
+		CommandMessage();
+		CommandMessage(const std::string client, Command command);
+
+
+	// ------------------------------------------------------------------
+	//  Message interface
+	// ------------------------------------------------------------------
+	public:
+		void setParameter(const std::string&);
+		void setObject(Core::BaseObject*);
+
+		const std::string& client() const;
+		Command command() const;
+
+		const std::string& parameter() const;
+		Core::BaseObject* object() const;
+
+		bool empty() const;
+
+
+	// ------------------------------------------------------------------
+	//  Implementation
+	// ------------------------------------------------------------------
+	private:
+		std::string _client;
+		Command _command;
+		std::string _parameter;
+		Core::BaseObjectPtr _object;
+
+
+	DECLARE_SC_CLASSFACTORY_FRIEND(CommandMessage);
+
+	friend class Application;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/messagethread.h

@@ -0,0 +1,66 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_MESSAGETHREAD_H
+#define SEISCOMP_GUI_MESSAGETHREAD_H
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/gui/qt.h>
+#include <seiscomp/messaging/connection.h>
+#endif
+
+#include <QtGui>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API MessageThread : public QThread {
+	Q_OBJECT
+
+	public:
+		MessageThread(Seiscomp::Client::Connection *c);
+		~MessageThread();
+
+		void run();
+
+		Seiscomp::Client::Connection *connection() const;
+		void setReconnectOnErrorEnabled(bool e);
+
+
+	signals:
+		void messagesAvailable();
+		void connectionLost();
+		void connectionEstablished();
+		void connectionError(int code);
+
+
+	private:
+		bool _reconnectOnError;
+		Seiscomp::Client::Connection *_connection;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/core/optionaldoublespinbox.h

@@ -0,0 +1,65 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_OPTIONALDOUBLESPINBOX_H
+#define SEISCOMP_GUI_OPTIONALDOUBLESPINBOX_H
+
+
+#include <seiscomp/gui/qt.h>
+#include <QDoubleSpinBox>
+
+
+class QToolButton;
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API OptionalDoubleSpinBox : public QDoubleSpinBox {
+	Q_OBJECT
+
+	public:
+		OptionalDoubleSpinBox(QWidget *parent = 0);
+
+	public:
+		/**
+		 * @brief Returns whether the value is valid or not. A valid value
+		 *        is larger than the defined minimum of the value range.
+		 * @return Flag indicating validity
+		 */
+		bool isValid() const;
+
+	private slots:
+		void resetContent();
+		void changedContent();
+
+
+	private:
+		QToolButton *_resetButton;
+		int          _spacing;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/questionbox.h

@@ -0,0 +1,79 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_QUESTIONBOX_H
+#define SEISCOMP_GUI_QUESTIONBOX_H
+
+
+#include <seiscomp/gui/core/ui_questionbox.h>
+#include <seiscomp/gui/qt.h>
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API QuestionBox {
+	// ------------------------------------------------------------------
+	//  X'truction
+	// ------------------------------------------------------------------
+	public:
+		QuestionBox(QWidget* parent = 0, Qt::WindowFlags = Qt::WindowFlags());
+
+		~QuestionBox();
+
+
+	// ------------------------------------------------------------------
+	//  Public interface
+	// ------------------------------------------------------------------
+	public:
+		void setText(const QString& text);
+		QString text() const;
+
+		void setInfo(const QString& text);
+		QString info() const;
+
+
+	// ------------------------------------------------------------------
+	//  Reimplemented derived interface
+	// ------------------------------------------------------------------
+	public:
+		int exec();
+
+
+	// ------------------------------------------------------------------
+	//  Attributes
+	// ------------------------------------------------------------------
+	private:
+		QWidget* _parent;
+		Qt::WindowFlags _flags;
+		QString _text;
+		QString _info;
+
+		bool _show;
+		int _lastResult;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/recordpolyline.h

@@ -0,0 +1,195 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_RECORDPOLYLINE_H
+#define SEISCOMP_GUI_RECORDPOLYLINE_H
+
+
+#include <QPen>
+#include <QPolygon>
+#include <QPainter>
+#include <QVector>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/record.h>
+#include <seiscomp/core/typedarray.h>
+#include <seiscomp/core/recordsequence.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+DEFINE_SMARTPOINTER(AbstractRecordPolyline);
+class SC_GUI_API AbstractRecordPolyline : public Seiscomp::Core::BaseObject {
+	public:
+		virtual void draw(QPainter &) = 0;
+		virtual void drawGaps(QPainter &, int yofs, int height, const QBrush &gapBrush, const QBrush &overlapBrush) = 0;
+		virtual void draw(QPainter &, int yofs, int height, const QBrush &gapBrush, const QBrush &overlapBrush) = 0;
+		virtual bool isEmpty() const = 0;
+
+		qreal baseline() const;
+
+	protected:
+		qreal _baseline;
+};
+
+
+DEFINE_SMARTPOINTER(RecordPolyline);
+class SC_GUI_API RecordPolyline : public AbstractRecordPolyline,
+                                  public QVector<QPolygon> {
+	public:
+		RecordPolyline();
+
+
+	public:
+		//! creates the record polyline and returns the virtual height
+		//! of that polyline
+		void create(Record const *, double pixelPerSecond,
+		            double amplMin, double amplMax, double amplOffset,
+		            int height, float *timingQuality = nullptr,
+		            bool optimization = true);
+
+		//! creates the record polyline and returns the virtual height
+		//! of that polyline
+		void create(RecordSequence const *, double pixelPerSecond,
+		            double amplMin, double amplMax, double amplOffset,
+		            int height, float *timingQuality = nullptr,
+		            QVector<QPair<int,int> >* gaps = nullptr,
+		            bool optimization = true);
+
+		void create(RecordSequence const *,
+		            const Core::Time &start,
+		            const Core::Time &end,
+		            double pixelPerSecond,
+		            double amplMin, double amplMax, double amplOffset,
+		            int height, float *timingQuality = nullptr,
+		            QVector<QPair<int,int> >* gaps = nullptr,
+		            bool optimization = true);
+
+		void createStepFunction(RecordSequence const *, double pixelPerSecond,
+		                        double amplMin, double amplMax, double amplOffset,
+		                        int height, float multiplier = 1.0);
+
+		void createSteps(RecordSequence const *, double pixelPerSecond,
+		                 double amplMin, double amplMax, double amplOffset,
+		                 int height, QVector<QPair<int,int> >* gaps = nullptr);
+
+		void createSteps(RecordSequence const *,
+		                 const Core::Time &start,
+		                 const Core::Time &end,
+		                 double pixelPerSecond,
+		                 double amplMin, double amplMax, double amplOffset,
+		                 int height, QVector<QPair<int,int> >* gaps = nullptr);
+
+		// Returns the number of points
+		int points() const;
+
+	public:
+		void draw(QPainter&) override;
+		void drawGaps(QPainter &, int yofs, int height, const QBrush &gapBrush, const QBrush &overlapBrush) override;
+		void draw(QPainter &, int yofs, int height, const QBrush &gapBrush, const QBrush &overlapBrush) override;
+		bool isEmpty() const override { return QVector<QPolygon>::isEmpty(); }
+
+
+	private:
+		template <typename T>
+		void pushRecord(QPolygon *&poly, const T *data, int count,
+		                bool merge,
+		                double yscl, double amplOffset,
+		                bool optimization,
+		                int x0, double sampleWidth,
+		                int &collapsedSamples,
+		                int &y_min, int &y_max,
+		                int &x_out, int &y_out,
+		                int &x_pos, int &y_pos);
+};
+
+
+DEFINE_SMARTPOINTER(RecordPolylineF);
+class SC_GUI_API RecordPolylineF : public AbstractRecordPolyline,
+                                   public QVector<QPolygonF> {
+	public:
+		RecordPolylineF();
+
+
+	public:
+		//! creates the record polyline and returns the virtual height
+		//! of that polyline
+		void create(Record const *, double pixelPerSecond,
+		            double amplMin, double amplMax, double amplOffset,
+		            int height, float *timingQuality = nullptr,
+		            bool optimization = true);
+
+		//! creates the record polyline and returns the virtual height
+		//! of that polyline
+		void create(RecordSequence const *, double pixelPerSecond,
+		            double amplMin, double amplMax, double amplOffset,
+		            int height, float *timingQuality = nullptr,
+		            QVector<QPair<qreal,qreal> >* gaps = nullptr,
+		            bool optimization = true);
+
+		void create(RecordSequence const *,
+		            const Core::Time &start,
+		            const Core::Time &end,
+		            double pixelPerSecond,
+		            double amplMin, double amplMax, double amplOffset,
+		            int height, float *timingQuality = nullptr,
+		            QVector<QPair<qreal,qreal> >* gaps = nullptr,
+		            bool optimization = true);
+
+		// Returns the number of points
+		int points() const;
+
+	public:
+		void draw(QPainter &) override;
+		void drawGaps(QPainter &, int yofs, int height, const QBrush &gapBrush, const QBrush &overlapBrush) override;
+		void draw(QPainter &, int yofs, int height, const QBrush &gapBrush, const QBrush &overlapBrush) override;
+		bool isEmpty() const override { return QVector<QPolygonF>::isEmpty(); }
+
+
+	private:
+		template <typename T>
+		void pushRecord(QPolygonF *&poly, const T *data, int count,
+		                bool merge,
+		                double yscl, double amplOffset,
+		                bool optimization,
+		                qreal x0, double sampleWidth,
+		                int &collapsedSamples,
+		                qreal &y_min, qreal &y_max,
+		                qreal &x_out, qreal &y_out,
+		                qreal &x_pos, qreal &y_pos);
+};
+
+
+inline qreal AbstractRecordPolyline::baseline() const {
+	return _baseline;
+}
+
+
+
+}
+}
+
+
+# endif

include/seiscomp/gui/core/recordstreamthread.h

@@ -0,0 +1,165 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_SLCONNECTION_H
+#define SEISCOMP_GUI_SLCONNECTION_H
+
+#include <string>
+
+#include <QThread>
+#include <QtCore>
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/record.h>
+#include <seiscomp/io/recordinput.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+//! \brief This class provides a thread to receive records from
+//! \brief a stream source.
+class SC_GUI_API RecordStreamThread : public QThread {
+	Q_OBJECT
+
+	public:
+		RecordStreamThread(const std::string& recordStreamURL);
+		~RecordStreamThread();
+
+
+	public:
+		bool connect();
+
+		void setStartTime(const Seiscomp::Core::Time&);
+		void setEndTime(const Seiscomp::Core::Time&);
+		void setTimeWindow(const Seiscomp::Core::TimeWindow&);
+
+		bool setTimeout(int seconds);
+
+		bool addStation(const std::string& network, const std::string& station);
+
+		// Needs to be called after connect()
+		bool addStream(const std::string& network, const std::string& station,
+		               const std::string& location, const std::string& channel);
+		// Needs to be called after connect()
+		bool addStream(const std::string& network, const std::string& station,
+		               const std::string& location, const std::string& channel,
+		               const Seiscomp::Core::Time &stime, const Seiscomp::Core::Time &etime);
+
+		// Needs to be called after connect()
+		bool addStream(const std::string& network, const std::string& station,
+		               const std::string& location, const std::string& channel,
+		               double gain);
+
+		void stop(bool waitForTermination);
+
+		//! Returns the used stream URL
+		const std::string& recordStreamURL() const;
+
+		//! Returns the array data type this record stream thread is
+		//! configured to use (default: Array::FLOAT).
+		Array::DataType dataType() const;
+
+		//! Set the array data type this record stream thread should
+		//! use (default: Array::FLOAT). NOTE: The data type must be
+		//! set before calling run() to have any impact.
+		void setDataType(Array::DataType dataType);
+
+		//! Returns the array data type this record stream thread is
+		//! configured to use (default: Array::FLOAT).
+		Record::Hint recordHint() const;
+
+		//! Set the record save hint (default: Record::DATA_ONLY).
+		//! NOTE: The hint must be set before calling run() to have any impact.
+		void setRecordHint(Record::Hint hint);
+
+		//! Returns the current recordthread ID
+		int ID() const;
+
+
+	signals:
+		//! This signal will be fired whenever a new record has been
+		//! read from the stream source. The receiver has to take care
+		//! to store the record inside a RecordPtr to prevent memory leaks.
+		//! The RecordStreamThread does not destroy any objects read from
+		//! the stream source.
+		void receivedRecord(Seiscomp::Record*);
+
+		//! This signal will be fired if an error occurs.
+		void handleError(const QString &);
+
+
+	protected:
+		void run();
+
+
+	private:
+		typedef std::map<std::string, double> GainMap;
+		int                                   _id;
+		std::string                           _recordStreamURL;
+		bool                                  _requestedClose;
+		bool                                  _readingStreams;
+		Seiscomp::IO::RecordStreamPtr         _recordStream;
+		QMutex                                _mutex;
+		static int                            _numberOfThreads;
+		GainMap                               _gainMap;
+		Array::DataType                       _dataType;
+		Record::Hint                          _recordHint;
+};
+
+
+class SC_GUI_API RecordStreamState : public QObject {
+	Q_OBJECT
+
+	protected:
+		RecordStreamState();
+
+	public:
+		static RecordStreamState& Instance();
+
+		int connectionCount() const;
+		QList<RecordStreamThread*> connections() const;
+
+	private:
+		void openedConnection(RecordStreamThread*);
+		void closedConnection(RecordStreamThread*);
+
+	signals:
+		void connectionEstablished(RecordStreamThread*);
+		void connectionClosed(RecordStreamThread*);
+
+		void firstConnectionEstablished();
+		void lastConnectionClosed();
+
+	private:
+		static RecordStreamState _instance;
+
+		int _connectionCount;
+		QList<RecordStreamThread*> _activeThreads;
+
+	friend class RecordStreamThread;
+};
+
+
+} // namespace Gui
+} // namespace Seiscomp
+
+#endif

include/seiscomp/gui/core/recordview.h

@@ -0,0 +1,675 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_RECORDVIEW_H
+#define SEISCOMP_GUI_RECORDVIEW_H
+
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/gui/core/recordviewitem.h>
+#include <seiscomp/gui/core/timescale.h>
+#include <seiscomp/math/filter.h>
+#endif
+#include <QScrollArea>
+#include <QTimer>
+#include <QSet>
+
+
+namespace Seiscomp {
+namespace DataModel {
+
+SC_GUI_API
+bool operator<(const Seiscomp::DataModel::WaveformStreamID& left,
+               const Seiscomp::DataModel::WaveformStreamID& right);
+
+}
+}
+
+namespace Seiscomp {
+
+class RecordSequence;
+
+namespace Gui {
+
+
+class TimeScale;
+class RecordStreamThread;
+
+
+class SC_GUI_API RecordView : public QWidget {
+	Q_OBJECT
+
+	public:
+		enum SelectionMode {
+			NoSelection = 0,
+			SingleSelection,
+			ExtendedSelection
+		};
+
+		enum SelectionOperationFlag {
+			SelectNone   = 0x00,
+			Select       = 0x01,
+			SelectPlus   = 0x02,
+			SelectMinus  = 0x04,
+			SelectAll    = Select | SelectPlus | SelectMinus
+		};
+
+		Q_DECLARE_FLAGS(SelectionOperation, SelectionOperationFlag)
+
+
+	public:
+		//! Default c'tor
+		//! The mode defaults to ringbuffer with a buffer
+		//! size of 30 minutes
+		RecordView(QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags(),
+		           TimeScale *timeScale = 0);
+
+		//! Creates a RecordView using a time window
+		RecordView(const Seiscomp::Core::TimeWindow&,
+		           QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags(),
+		           TimeScale *timeScale = 0);
+
+		//! Creates a RecordView using a timespan and
+		//! a ringbuffer
+		RecordView(const Seiscomp::Core::TimeSpan&,
+		           QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags(),
+		           TimeScale *timeScale = 0);
+
+		~RecordView();
+
+
+	public:
+		//! Sets the timewindow used for the stream data.
+		//! Incoming records will only be inserted when they
+		//! fit into the timewindow.
+		void setTimeWindow(const Seiscomp::Core::TimeWindow& tw);
+
+		//! Sets the buffersize used for the stream data.
+		//! When setting the buffersize, incoming records will be
+		//! appended to the end of the stream. Records that do not
+		//! fit into the buffer will be removed from the front of
+		//! the buffer: ringbuffer mode
+		void setBufferSize(const Seiscomp::Core::TimeSpan& ts);
+
+		//! Returns the number of record stream
+		int rowCount() const;
+
+		//! Returns the number of visible streams
+		int visibleRowCount() const;
+
+		//! Returns the stream ID used for a row
+		DataModel::WaveformStreamID streamID(int row) const;
+
+		//! Returns whether a row is enabled or not
+		bool isEnabled(int row) const;
+
+		//! Returns the item in row 'row'
+		RecordViewItem* itemAt(int row) const;
+
+		//! Returns the item for streamID
+		RecordViewItem* item(const DataModel::WaveformStreamID& streamID) const;
+
+		//! Adds a new item to the view.
+		//! If there already has been added an item
+		//! for streamID, nullptr is returned.
+		RecordViewItem* addItem(const DataModel::WaveformStreamID&,
+		                        const QString& stationCode,
+		                        int slotCount = 0);
+
+		//! Adds an existing item to the view
+		bool addItem(RecordViewItem* item);
+
+		//! Removes a particular row
+		bool removeItem(int row);
+
+		//! Removes a RecordViewItem
+		bool removeItem(RecordViewItem*);
+
+		//! Removes and returns the item from the given row in the recordview;
+		//! otherwise returns nullptr.
+		RecordViewItem* takeItem(int row);
+
+		//! Removes the item from the view and returns true or false
+		bool takeItem(RecordViewItem*);
+
+		//! Cycles through all rows that row 'row' is the first
+		//! row in the view
+		void cycleToRow(int row);
+
+		//! Removes all available rows
+		void clear();
+
+		//! Clears all available records
+		void clearRecords();
+
+		//! Clears all available markers
+		void clearMarker();
+
+		//! Sets the height of a row in pixels
+		void setRowHeight(int height, bool allowStretch = false);
+
+		//! Returns the current row height
+		int rowHeight() const;
+
+		//! Sets the default row height
+		void setDefaultRowHeight(int height);
+
+		//! Sets the number of column to use when a new row is created
+		void setDefaultItemColumns(int numCols);
+
+		//! Sets the spacing between each row in pixels
+		void setRowSpacing(int spacing);
+
+		//! Sets the width of the label for each row
+		void setLabelWidth(int width);
+
+		//! Returns the label width
+		int labelWidth() const;
+
+		//! Sets the spacing between the label and the recordwidget
+		void setHorizontalSpacing(int);
+
+		//! Returns the horizontal spacing
+		int horizontalSpacing() const;
+
+		//! En-/Disables showing frames around the labels and the
+		//! recordwidgets
+		void setFramesEnabled(bool);
+
+		//! Sets frame margin of the labels and the recordwidgets
+		void setFrameMargin(int margin);
+
+		//! Sets the zoom factor used for zoom in/out slots
+		void setZoomFactor(float factor);
+		float zoomFactor() const;
+
+		//! Returns the current zoom spot
+		QPointF zoomSpot() const;
+
+		void setMinimumRowHeight(int);
+		void setMaximumRowHeight(int);
+		void setRelativeRowHeight(int desiredNumberOfTraces);
+
+		//! Returns the current alignment
+		Seiscomp::Core::Time alignment() const;
+
+		//! Returns the current item
+		RecordViewItem* currentItem() const;
+
+		QList<RecordViewItem*> selectedItems() const;
+		bool hasSelectedItems() const;
+
+		double timeRangeMin() const;
+		double timeRangeMax() const;
+
+		double timeScale() const;
+
+		Core::Time mapToTime(int x) const;
+
+		//! Returns all streams belonging to a station
+		QList<RecordViewItem*> stationStreams(const std::string& networkCode,
+		                                      const std::string& stationCode) const;
+
+		//! Copies the view state from another recordview
+		bool copyState(RecordView *from);
+
+		//! Moves all items to another RecordView
+		bool moveItemsTo(RecordView *to);
+
+		//! Moves selected streams to another RecordView
+		bool moveSelectionTo(RecordView *to);
+
+		//! Sets the default actions for interactive keyboard
+		//! navigation:
+		//!  - Left/Right: Moves the records left/right
+		//!  - '+'/'-': Zooms the records vertically
+		//!  - 'y'/'x': Zooms tehe records horizontally
+		//!  - 'f': Toggles filtering
+		//!  - 'r': Toggles showing filtered and raw records
+		void setDefaultActions();
+
+		//! Sets the datasource to read records from.
+		//! This method initializes the reader thread and
+		//! holds it until start() is called
+		bool setDataSource(const QString& streamURL);
+
+		//! Connects to the data source
+		virtual bool connectToDataSource();
+
+		//! Starts reading from the set data source
+		virtual bool start();
+
+		//! Stops reading from the data source
+		virtual void stop();
+
+		//! Returns the current recordstream thread
+		RecordStreamThread* recordStreamThread() const;
+
+		QWidget* infoWidget() const;
+		TimeScale* timeWidget() const;
+
+		/**
+		 * @brief Returns the time window covered by all available data
+		 * @return The data time window
+		 */
+		Core::TimeWindow coveredTimeRange() const;
+
+		Core::TimeWindow visibleTimeRange() const;
+
+
+	public slots:
+		void setRecordUpdateInterval(int ms);
+
+		//! Feeds a record into the RecordView
+		//! A new row is appended if rec's stream id
+		//! is fed for the first time
+		bool feed(const Seiscomp::Record *rec);
+		bool feed(const Seiscomp::RecordPtr rec);
+		bool feed(Seiscomp::Record *rec);
+
+		void scrollLeft();
+		void scrollLeftSlowly();
+		void scrollRight();
+		void scrollRightSlowly();
+		void scrollLineUp();
+		void scrollLineDown();
+		void scrollPageUp();
+		void scrollPageDown();
+		void scrollToTop();
+		void scrollToBottom();
+
+		void selectPreviousRow();
+		void selectNextRow();
+
+		void selectFirstRow();
+		void selectLastRow();
+
+		void enableFilter(bool);
+		void enableFilter(int, bool);
+
+		//! Whether to show the current selected recordstream or
+		//! both recordstreams
+		void showAllRecords(bool enable);
+
+		//! Whether to show record borders
+		void showRecordBorders(bool enable);
+
+		//! Whether to draw the background using alternating colors
+		//! The item background will be drawn using QPalette::Base and
+		//! QPalette::AlternateBase
+		void setAlternatingRowColors(bool enable);
+
+		//! Enables/disables the scrollbar
+		void showScrollBar(bool show);
+
+		//! Whether to automatically insert new items for new records
+		//! when using feed(...)
+		void setAutoInsertItem(bool enable);
+
+		void setAbsoluteTimeEnabled(bool enable);
+
+		void setAutoScale(bool enable);
+		void setAutoMaxScale(bool enable);
+
+		bool isFilterEnabled() const;
+
+		void setScale(double t, double a = 0.0f);
+		void setTimeRange(double t1, double t2);
+		void setSelection(double t1, double t2);
+
+		void move(double offset);
+
+		void setSelectionEnabled(bool);
+		void setSelectionMode(SelectionMode mode);
+
+		void clearSelection();
+
+		//! Sets the justification of the records regarding the
+		//! alignment time. 0 (Left) ... 1 (Right)
+		void setJustification(float);
+
+		//! Aligns the RecordView regarding the justification in
+		//! the current viewport on the set alignment time
+		void align();
+
+		void horizontalZoom(float factor);
+		void horizontalZoomIn()  { horizontalZoom( _zoomFactor); }
+		void horizontalZoomOut() { horizontalZoom(1.0f/_zoomFactor); }
+
+		void verticalZoom(float factor);
+		void verticalZoomIn()  { verticalZoom(_zoomFactor); }
+		void verticalZoomOut() { verticalZoom(1.0f/_zoomFactor); }
+
+		void zoom(float factor);
+		void zoomIn() { zoom(_zoomFactor); }
+		void zoomOut() { zoom(1.0f/_zoomFactor); }
+
+		void scaleAmplitudesUp();
+		void scaleAmplitudesDown();
+
+		void scaleVisibleAmplitudes();
+		void scaleAllRecords();
+
+		//! Sets the zoom spot. p is in global screen coordinates
+		void setZoomSpotFromGlobal(const QPoint& p);
+
+		//! Sets the relative zoom spot in logical coords
+		void setZoomSpot(const QPointF& p);
+
+		//! Sets the zoom rectangle in global coordinates.
+		void setZoomRectFromGlobal(const QRect &rect);
+
+		void setZoomRect(const QRectF &rect);
+
+		//! Sort the items by text of the label using the text in
+		//! row 'row'
+		void sortByText(int row);
+
+		//! Sort the items by text of the label using first text in
+		//! row 'row1' and then text in row 'row2'
+		void sortByText(int row1, int row2);
+
+		//! Sort the items by text of the label using first text in
+		//! row 'row1' and then text in row 'row2' and then text in row 'row3'
+		void sortByText(int row1, int row2, int row3);
+
+		//! Sort the items by text of the label using first text in
+		//! row 'row1' and then text in row 'row2' and then text in row 'row3'
+		//! and then text in row 'row4'.
+		void sortByText(int row1, int row2, int row3, int row4);
+
+		//! Sort the items by the value set in column 'column'
+		void sortByValue(int column);
+
+		//! Sort the items by the value set in column1 and then
+		//! by value in column2
+		void sortByValue(int column1, int column2);
+
+		//! Sort the items by the value set in column1 then
+		//! by value in column2 and finally by value in column3
+		void sortByValue(int column1, int column2, int column3);
+
+		//! Sort the items by the value set in column1 then
+		//! by value in column2 then by value in column3 and finally by value
+		//! in column4
+		void sortByValue(int column1, int column2, int column3, int column4);
+
+		//! Sort the items by text of a row and then by the value set in
+		//! a column
+		void sortByTextAndValue(int row, int column);
+
+		//! Sort the items by the data set with RecordViewItem::setData
+		void sortByData();
+
+		//! Finds a row by its text using regular expressions.
+		//! The first occurence according the sorting is returned.
+		//! If no item matches then -1 is returned.
+		int findByText(int row, QRegExp &regexp, int startRow = 0) const;
+
+		//! Sort the items by the time value of the markers with
+		//! text markerText
+		void sortByMarkerTime(const QString& markerText);
+
+		void setAlignment(const Seiscomp::Core::Time& time);
+
+		//! Aligns all rows on their marker with text set to
+		//! text.
+		void alignOnMarker(const QString& text);
+
+		//! Sets the cursor text for all rows
+		void setCursorText(const QString& text);
+
+		//! Selects an item
+		void setItemSelected(RecordViewItem* item, bool select);
+		void deselectAllItems();
+
+		void setCurrentItem(RecordViewItem* item);
+
+		void ensureVisible(int row);
+
+		void showSlot(int slot);
+		void showComponent(char componentCode);
+
+		//! Enables zooming by drawing a zoomrect with
+		//! the mouse
+		void setZoomEnabled(bool = true);
+
+		/**
+		 * @brief Enables rubber band selection with the mouse
+		 * @param enable Whether to enable or disable it
+		 * @param filter Which operations are enabled
+		 */
+		void setRubberBandSelectionEnabled(bool enable = true,
+		                                   SelectionOperation filter = SelectAll);
+
+		/**
+		 * @brief Restores the default selection mode (rows) and disables
+		 *        either rubberband selection or zooming.
+		 */
+		void restoreSelectionMode();
+
+		void setDefaultDisplay();
+
+		//! Sets the parameters used to filter the traces
+		void setFilter(RecordWidget::Filter *filter);
+		bool setFilterByName(const QString&);
+
+		//! Returns the set filter instance
+		RecordWidget::Filter *filter() const;
+
+		void updateRecords();
+
+		void setRecordBorderDrawMode(RecordWidget::RecordBorderDrawMode mode);
+
+
+	signals:
+		void updatedRecords();
+		void fedRecord(RecordViewItem*, const Seiscomp::Record*);
+
+		void updatedInterval(double da, double dt, double ofs);
+		void toggledFilter(bool);
+
+		void scaleChanged(double time, double amplitude);
+		void timeRangeChanged(double tmin, double tmax);
+		void selectionChanged(double smin, double smax);
+		void alignmentChanged(const Seiscomp::Core::Time&);
+
+		void amplScaleChanged(double);
+
+		//! This signal will be emitted whenever a new item
+		//! has been automatically added to the view.
+		//! Connected classes can set the columns of the item
+		//! depending on the first record used for creation
+		//! of the item.
+		void addedItem(const Seiscomp::Record*, Seiscomp::Gui::RecordViewItem*);
+
+		//! This signal is emitted whenever an item will be enabled
+		//! or disabled
+		void changedItem(RecordViewItem*, bool enabled);
+
+		//! This signal will be emitted when a time (absolut time)
+		//! has been selected inside a RecordWidget
+		void selectedTime(Seiscomp::Gui::RecordWidget*, Seiscomp::Core::Time);
+
+		void progressStarted();
+		void progressChanged(int value);
+		void progressFinished();
+
+		//! This signal will be emitted whenever the selection
+		//! changes and when in SingleSelection mode
+		void currentItemChanged(RecordViewItem* current, RecordViewItem* last);
+
+		//! This signal is emitted whenever the selection changes.
+		void selectionChanged();
+
+		void cursorTextChanged(const QString&);
+
+		//! This signal is emitted when a filter string is dropped into the
+		//! recordview and the filter has been set and enabled successfully
+		void filterChanged(const QString&);
+
+	#ifndef Q_MOC_RUN
+	// Hack to set the signal public for Qt 4 wich are protected by default.
+	public:
+	#endif
+		/**
+		 * @brief This signal is being emitted if the user selected an area
+		 *        with the rubber band selection tool.
+		 * @param rect The selected rectangle in global coordinates
+		 * @param tmin The minimum absolute time of the selected time range
+		 * @param tmax The maximum absolute time of the selected time range
+		 * @param operation The operation to apply.
+		 */
+		void selectedRubberBand(QRect rect,
+		                        QList<Seiscomp::Gui::RecordViewItem*>,
+		                        double tmin, double tmax,
+		                        Seiscomp::Gui::RecordView::SelectionOperation operation);
+
+
+	private slots:
+		void onItemClicked(RecordViewItem*, bool buttonDown = false,
+		                   Qt::KeyboardModifiers = Qt::NoModifier);
+		void selectedTime(Seiscomp::Core::Time);
+		void sliderAction(int action);
+
+
+	protected:
+		//! This method can be reimplemented in derived
+		//! classes to create a custom record widget
+		virtual RecordWidget *createRecordWidget(
+			const DataModel::WaveformStreamID &streamID
+		) const;
+
+		//! This method can be reimplemented in derived
+		//! classes to create a custom label
+		virtual RecordLabel *createLabel(RecordViewItem*) const;
+
+		bool event(QEvent* event);
+		void showEvent(QShowEvent *event);
+		void closeEvent(QCloseEvent *event);
+
+		void changeEvent(QEvent* e);
+		void resizeEvent(QResizeEvent *event);
+
+		void dragEnterEvent(QDragEnterEvent *event);
+		void dropEvent(QDropEvent *event);
+
+		void closeThread();
+
+
+	private:
+		void setupUi();
+
+		void colorItem(RecordViewItem* item, int row);
+		void colorItem(RecordViewItem*);
+		void scaleContent();
+
+		template <typename T>
+		void sortRows(std::list< std::pair<T, RecordViewItem*> >&);
+
+		void layoutRows();
+
+		void applyBufferChange();
+
+		double mapToUnit(int x) const;
+		// bool buildFilter(const QString& text, std::vector<Seiscomp::Math::Filtering::IIR::Filter<float>* >* filterList);
+
+
+	private:
+		enum Mode {
+			TIME_WINDOW,
+			RING_BUFFER
+		};
+
+		typedef QMap<DataModel::WaveformStreamID, RecordViewItem*> Items;
+		typedef QVector<RecordViewItem*> Rows;
+		typedef QSet<RecordViewItem*> SelectionList;
+
+		SelectionMode _selectionMode;
+
+		RecordStreamThread* _thread;
+		RecordViewItem* _currentItem;
+
+		TimeScale* _timeScaleWidget;
+		QScrollArea* _scrollArea;
+		QWidget* _timeScaleInfo;
+		QLayout* _timeScaleAuxLayout;
+
+		QAction* _filterAction;
+		QAction* _absTimeAction;
+
+		QTimer _recordUpdateTimer;
+
+		SelectionList _selectedItems;
+
+		Mode _mode;
+		Seiscomp::Core::Time _timeStart;
+		Seiscomp::Core::TimeSpan _timeSpan;
+
+		Items _items;
+		Rows _rows;
+		Core::Time _alignment;
+
+		QPointF _zoomSpot;
+
+		int    _rowHeight;
+		int    _minRowHeight;
+		int    _maxRowHeight;
+		int    _numberOfRows;
+		int    _defaultRowHeight;
+		float  _zoomFactor;
+
+		double _tmin, _tmax;
+		float  _amin, _amax;   // amplitude range
+
+		double _timeScale;     // pixels per second
+		double _minTimeScale;
+		double _amplScale;     // amplitude units per pixel
+
+		bool _filtering;      // the filter state
+		bool _alternatingColors;
+		bool _showAllRecords;
+		bool _showRecordBorders;
+		bool _autoInsertItems;
+		bool _autoScale;
+		bool _autoMaxScale;
+
+		bool _frames;
+		int  _frameMargin;
+		int  _horizontalSpacing;
+		int  _rowSpacing;
+
+		int  _labelWidth;
+		int  _labelColumns;
+
+		RecordWidget::RecordBorderDrawMode _recordBorderDrawMode;
+
+		RecordWidget::Filter *_filter;
+
+	friend class RecordViewItem;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/recordviewitem.h

@@ -0,0 +1,283 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_RECORDVIEWITEM_H
+#define SEISCOMP_GUI_RECORDVIEWITEM_H
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/recordsequence.h>
+#include <seiscomp/math/filter.h>
+#include <seiscomp/gui/core/recordwidget.h>
+#endif
+
+#include <QFrame>
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class RecordView;
+class RecordViewItem;
+
+
+class SC_GUI_API RecordLabel : public QWidget {
+	Q_OBJECT
+
+	public:
+		RecordLabel(QWidget *parent=0, const char *name=0);
+		~RecordLabel();
+
+	public:
+		RecordViewItem* recordViewItem() const;
+
+		void setBackgroundColor(const QColor&);
+
+		virtual void setText(const QString &str, int item=0) = 0;
+		virtual void setColor(QColor col, int item=0) = 0;
+		virtual void setFont(const QFont& f, int item=0) = 0;
+		virtual void setWidth(int width, int item=0) = 0;
+		virtual void setAlignment(Qt::Alignment al, int item=0) = 0;
+		virtual void setEditable(bool, int item=0) = 0;
+
+		virtual QString text(int item) const = 0;
+		virtual const QFont& font(int item) const = 0;
+
+		virtual void setOrientation(Qt::Orientation) = 0;
+
+		virtual int itemCount() const = 0;
+
+		void setInteractive(bool interactive);
+		bool isInteractive() const;
+
+		bool isEnabled() const { return _enabled; }
+
+	public slots:
+		void setEnabled(bool enabled);
+
+	signals:
+		//! This signal is emitted when the label has been double-clicked
+		//! and the label is not interactive
+		void doubleClicked();
+
+		//! This signal is emitted when the label has been double-clicked
+		//! and the label is interactive
+		void statusChanged(bool);
+
+		//! This signal is emitted when a text entry has been double-clicked
+		void editRequested(int item, QRect rect);
+
+	protected:
+		void mouseDoubleClickEvent(QMouseEvent *e);
+		virtual void visibilityChanged(bool) {}
+
+	private:
+		RecordViewItem* _parent;
+		bool _enabled;
+		bool _interactive;
+
+	friend class RecordViewItem;
+};
+
+
+
+class SC_GUI_API StandardRecordLabel : public RecordLabel {
+	public:
+		StandardRecordLabel(int items=3, QWidget *parent=0, const char* = 0);
+		~StandardRecordLabel();
+
+	public:
+		void setText(const QString &str, int item=0);
+		void setColor(QColor col, int item=0);
+		void setFont(const QFont& f, int item=0);
+		void setWidth(int width, int item=0);
+		void setAlignment(Qt::Alignment al, int item=0);
+		void setEditable(bool, int item=0);
+
+		QString text(int item) const;
+		const QFont& font(int item) const;
+
+		void setOrientation(Qt::Orientation o);
+
+		int itemCount() const;
+
+	protected:
+		void paintEvent(QPaintEvent *e);
+
+	protected:
+		struct Item {
+			Item() : colorSet(false) {}
+			QString text;
+			QColor color;
+			bool colorSet;
+			QFont font;
+			Qt::Alignment align;
+			bool editable;
+			int width;
+		};
+
+		bool _vertical;
+		QVector<Item> _items;
+};
+
+
+class SC_GUI_API RecordViewItem : public QWidget {
+	Q_OBJECT
+
+	private:
+		RecordViewItem(RecordView *parent=0, bool withFrame=false, int frameMargin=0,
+		               int hSpacing=0);
+		RecordViewItem(RecordView *parent, RecordWidget *widget,
+		               RecordSequence* records,
+		               bool withFrame=false, int frameMargin=0, int hSpacing=0);
+
+	public:
+		~RecordViewItem();
+
+	public:
+		RecordView* recordView() const;
+
+		bool feed(const Seiscomp::Record *rec);
+
+		void setValue(int column, double d);
+		double value(int column) const;
+
+		int columnCount() const;
+
+		//! Returns the row inside the RecordView
+		int row() const;
+
+		//! Returns the streamID used for this item
+		const DataModel::WaveformStreamID& streamID() const;
+
+		void setRecords(RecordSequence*);
+		RecordSequence* records(char componentCode = '?') const;
+		RecordSequence* filteredRecords(char componentCode = '?') const;
+
+		void setBuffer(RecordSequence*);
+
+		float timingQuality(char componentCode) const;
+
+		bool showSlot(int slot);
+		bool showRecords(char componentCode);
+		char currentComponent() const;
+
+		void setLabel(RecordLabel* label);
+		void setLabelText(const QString& text);
+
+		void setRecordWidget(RecordWidget *widget);
+
+		RecordWidget *widget() { return _widget; }
+		const RecordWidget *widget() const { return _widget; }
+
+		RecordLabel *label () { return _label;  }
+		const RecordLabel *label () const { return _label;  }
+
+		void enableFiltering(bool);
+		bool isFilteringEnabled() const;
+
+		void setBackgroundColor(const QColor&);
+		QColor backgroundColor() const;
+
+		bool isSelected() const;
+		bool isHighlighted() const;
+
+		void setData(const QVariant&);
+		const QVariant& data() const;
+
+		void setDraggingEnabled(bool);
+
+		void setRowHeight(int h);
+		void setVisible(bool visible);
+
+		void forceInvisibilty(bool force);
+		bool isInvisibilityForced() const;
+
+		int mapComponentToSlot(char) const;
+		char mapSlotToComponent(int) const;
+
+		bool insertComponent(char, int);
+
+
+	protected:
+		void mousePressEvent(QMouseEvent *event);
+		void mouseReleaseEvent(QMouseEvent *event);
+		void mouseMoveEvent(QMouseEvent *event);
+
+
+	private:
+		void setupUi(bool withFrame, int frameMargin, int hSpacing);
+		void setupConnection();
+		void setColor();
+		void clearRecords();
+
+		int createComponentToSlotMapping(char);
+
+
+	private slots:
+		void setSelected(bool);
+
+
+	private slots:
+		void setHighlight(bool);
+		void onClickedOnTime(Seiscomp::Core::Time);
+		void handleLayoutRequest();
+
+
+	signals:
+		void firstRecordAdded(const Seiscomp::Record*);
+
+		void clicked(RecordViewItem*, bool buttonDown, Qt::KeyboardModifiers);
+		void clickedOnTime(Seiscomp::Gui::RecordViewItem*, Seiscomp::Core::Time);
+		void componentChanged(RecordViewItem*, char);
+
+
+	private:
+		typedef QMap<char, int> SlotMap;
+
+		RecordView     *_parent;
+
+		SlotMap         _slotMapping;
+		RecordSequence *_seqTemplate;
+		RecordWidget   *_widget;
+		RecordLabel    *_label;
+		int             _row;
+		bool            _filtering;
+		bool            _selected;
+		bool            _highlight;
+		char            _requestedComponent;
+		char            _currentComponent;
+		QVector<double> _values;
+		QLayout        *_labelLayout;
+		QLayout        *_widgetLayout;
+		QVariant        _data;
+		QPoint          _dragStart;
+		bool            _enableDragging;
+		bool            _visible;
+		bool            _forceInvisibility;
+
+	friend class RecordView;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/core/recordwidget.h

@@ -0,0 +1,866 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_RECORDWIDGET_H
+#define SEISCOMP_GUI_RECORDWIDGET_H
+
+#include <QWidget>
+#include <QFrame>
+#include <QMouseEvent>
+#include <QPaintEvent>
+#include <QResizeEvent>
+#include <QScrollBar>
+#include <QHBoxLayout>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/record.h>
+#include <seiscomp/datamodel/waveformstreamid.h>
+#include <seiscomp/math/filter.h>
+
+#include "recordpolyline.h"
+#endif
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class RecordWidget;
+
+
+//! \brief RecordMarker - marks a certain timestamp in the record
+//! \brief sequence with a color and a type.
+//!
+//! Furthermore a marker can be moved on the stream. This class
+//! is useful to correct picks visually.
+class SC_GUI_API RecordMarker : public QObject {
+
+	Q_OBJECT
+
+	public:
+		RecordMarker(RecordWidget *parent,
+		             const Seiscomp::Core::Time& pos,
+		             Qt::Alignment = Qt::AlignVCenter);
+
+		RecordMarker(RecordWidget *parent,
+		             const Seiscomp::Core::Time& pos,
+		             const QString& text,
+		             Qt::Alignment = Qt::AlignVCenter);
+
+		RecordMarker(RecordWidget *parent,
+		             const RecordMarker&);
+
+		virtual ~RecordMarker();
+
+
+	protected:
+		void setParent(RecordWidget*);
+
+
+	public:
+		RecordWidget* parent() const;
+
+		void setColor(QColor c);
+		QColor color() const;
+
+		void setAlignment(Qt::Alignment);
+		Qt::Alignment alignment() const;
+
+		void setModifiedColor(QColor c);
+		QColor modifiedColor() const;
+
+		const Seiscomp::Core::Time& time() const;
+
+		void setCorrectedTime(const Seiscomp::Core::Time&);
+		const Seiscomp::Core::Time& correctedTime() const;
+
+		void setText(const QString&);
+		const QString& text() const;
+
+		void addAlias(const QString&);
+
+		void setDescription(const QString&);
+		const QString& description() const;
+
+		bool matches(const QString &text) const;
+
+		//! Returns the text to render
+		//! When description is empty then text is used else
+		//! the description itself is going to be rendered
+		const QString& renderText() const;
+
+		void setVisible(bool visible);
+		bool isVisible() const;
+		bool isHidden() const;
+
+		void setMovable(bool enable);
+		bool isMovable() const;
+
+		void setMoveCopy(bool enable);
+		bool isMoveCopyEnabled() const;
+
+		bool isEnabled() const;
+
+		//! Sets internal data to data. This can be used for
+		//! user data to store anything that a QVariant can store.
+		void setData(const QVariant& data);
+
+		//! Returns the user data set in setData
+		QVariant data() const;
+
+		//! Sets an id for the marker. This id is application depended
+		//! and can be chosen freely
+		void setId(int id);
+
+		//! Returns the id for the marker
+		int id() const;
+
+		bool isModified() const;
+
+		//! Sets the corrected time to the start time
+		void reset();
+
+		//! Sets the start time to the corrected time
+		void apply();
+
+		void update();
+
+		virtual RecordMarker *copy();
+
+		//! Draws the background of a marker. This method is called before
+		//! the traces are drawn.
+		virtual void drawBackground(QPainter &painter, RecordWidget *context,
+		                            int x, int y1, int y2,
+		                            QColor color, qreal lineWidth);
+
+		//! Draws the marker. This method is called after the traces are drawn.
+		virtual void draw(QPainter &painter, RecordWidget *context,
+		                  int x, int y1, int y2,
+		                  QColor color, qreal lineWidth);
+
+		virtual QString toolTip() const;
+
+
+	public slots:
+		virtual void setEnabled(bool enable);
+
+
+	private:
+		RecordWidget *_parent;
+		QColor _color;
+		QColor _modifierColor;
+		Seiscomp::Core::Time _time;
+		Seiscomp::Core::Time _correctedTime;
+		QString _text;
+		QString _description;
+		QVector<QString> _aliases;
+		bool _visible;
+		bool _moveable;
+		bool _moveCopy;
+		bool _enabled;
+		int _id;
+		Qt::Alignment _alignment;
+		QVariant _data;
+
+	friend class RecordWidget;
+};
+
+
+//!\brief RecordWidgetDecorator - decorates a RecordWidget
+//!
+//! This class can be used to draw custom decorations before
+//! and after the RecordWidget paints its data.
+class RecordWidgetDecorator : public QObject {
+	Q_OBJECT
+
+	public:
+		RecordWidgetDecorator(QObject *parent = 0);
+
+
+	public:
+		virtual void drawDecoration(QPainter *painter, RecordWidget *widget) = 0;
+};
+
+
+//!\brief RecordWidget - draws seismograms in a rectangular widget
+//!
+//! This class is only responsible for drawing, it gets records assigned as
+//! pointers and is (optional) responsible for their (de)allocation. Only filtered
+//! recordstreams are owned by the RecordWidget.
+class SC_GUI_API RecordWidget : public QWidget {
+	Q_OBJECT
+
+	public:
+		enum DrawMode {
+			Single,
+			InRows,
+			Stacked,
+			SameOffset
+		};
+
+		enum ShadowWidgetFlags {
+			Raw = 0x01,
+			Filtered = 0x02
+		};
+
+		enum AxisPosition {
+			Left,
+			Right
+		};
+
+		enum RecordBorderDrawMode {
+			TopLine,
+			BottomLine,
+			Box
+		};
+
+		typedef Math::Filtering::InPlaceFilter<double> Filter;
+
+		struct Trace {
+			Trace() = default;
+
+			double                    dyMin{0};   // Data minimum value
+			double                    dyMax{0};   // Data maximum value
+			double                    dOffset{0}; // Data offset
+			double                    absMax{0};
+			int                       pyMin{0};   //
+			int                       pyMax{0};
+			double                    fyMin{-1};
+			double                    fyMax{1};
+
+			double                    yMin{0};
+			double                    yMax{0};
+			double                    yOffset{0}; // The used offset
+
+			float                     timingQuality{-1};
+			int                       timingQualityCount{0};
+			bool                      dirty{false};
+			bool                      visible{false};
+			AbstractRecordPolylinePtr poly;
+			QString                   status;
+
+			void reset() {
+				dyMin = dyMax = dOffset  = absMax = 0;
+				fyMin = -1; fyMax = 1;
+				pyMin = pyMax = 0;
+				visible = false;
+				poly = nullptr;
+			}
+
+			bool validTrace() const {
+				return poly && !poly->isEmpty();
+			}
+		};
+
+	public:
+		RecordWidget(QWidget *parent=0);
+		RecordWidget(const DataModel::WaveformStreamID& streamID, QWidget *parent=0);
+
+		~RecordWidget();
+
+	public:
+		void enableRecordFiltering(int slot, bool enable);
+		bool isRecordFilteringEnabled(int slot);
+
+		bool isRecordVisible(int slot);
+		bool setRecordVisible(int slot, bool visible);
+
+		void setCustomBackgroundColor(QColor c);
+		void removeCustomBackgroundColor();
+
+		bool setRecords(int slot, RecordSequence*, bool owner = true);
+		bool setRecordID(int slot, const QString &id);
+		bool setRecordLabel(int slot, const QString &label);
+		bool setRecordColor(int slot, QColor c);
+		bool setRecordPen(int slot, const QPen &pen);
+		bool setRecordAntialiasing(int slot, bool antialiasing);
+		bool setRecordOptimization(int slot, bool enable);
+		bool setRecordStepFunction(int slot, bool enable);
+		bool setRecordBackgroundColor(int slot, QColor c);
+		bool removeRecordBackgroundColor(int slot);
+		bool setRecordFilter(int slot, const Filter *f);
+		bool setRecordScale(int slot, double scale);
+		bool setRecordUserData(int slot, QVariant data);
+		bool setRecordStatus(int slot, bool filtered, QString status);
+
+		RecordSequence *records() const;
+		RecordSequence *records(int slot) const;
+		RecordSequence *filteredRecords(int slot) const;
+		RecordSequence *takeRecords(int slot);
+		RecordSequence *createRecords(int slot, bool owner = true);
+		const Filter *recordFilter(int slot) const;
+
+		QString recordID(int slot) const;
+		QString recordLabel(int slot) const;
+		bool recordStepFunction(int slot) const;
+		QColor recordColor(int slot) const;
+		QPen recordPen(int slot) const;
+		const double *recordScale(int slot) const;
+
+		Trace *traceInfo(int slot, bool filtered = false);
+		const Trace *traceInfo(int slot, bool filtered = false) const;
+
+		QVariant recordUserData(int slot);
+
+		int setCurrentRecords(int slot);
+		int currentRecords() const;
+
+	public:
+		const QRect &canvasRect() const;
+
+		void setDrawMode(DrawMode mode);
+		DrawMode drawMode() const;
+
+		void setRecordBorderDrawMode(RecordBorderDrawMode mode);
+		RecordBorderDrawMode recordBorderDrawMode() const;
+
+		void setDrawOffset(bool f);
+		bool drawOffset() const { return _drawOffset; }
+
+		void setDrawSPS(bool f);
+		bool drawSPS() const { return _drawSPS; }
+
+		void setDrawRecordID(bool f);
+		bool drawRecordID() const { return _drawRecordID; }
+
+		void setRowSpacing(int);
+		int rowSpacing() const;
+
+		void setAxisSpacing(int);
+		int axisSpacing() const;
+
+		void setDrawAxis(bool f);
+		bool drawAxis() const { return _drawAxis; }
+
+		void setAxisWidth(int width);
+		int axisWidth() const;
+
+		void setAxisPosition(AxisPosition position);
+		AxisPosition axisPosition() const;
+
+		void setValuePrecision(int p);
+		int valuePrecision() const { return _valuePrecision; }
+
+		//! Sets a shadow widget that gets informed about record changes.
+		//! Available record slots are copied by reference
+		//! in that way that the listener is not the owner of the
+		//! data. Available marker are copied by value.
+		void setShadowWidget(RecordWidget *shadow,  bool copyMarker,
+		                     int flags = Raw);
+
+		//! Returns the current shadow widget
+		RecordWidget *shadowWidget() const { return _shadowWidget; }
+
+		//! Sets the source widget for all markers.
+		//! This instance does not hold any marker but displays
+		//! the source widgets markers. All marker query function
+		//! are forwarded to source.
+		void setMarkerSourceWidget(RecordWidget *source);
+
+		//! Returns the current marker source widget
+		RecordWidget *markerSourceWidget() const { return _markerSourceWidget; }
+
+		void setDecorator(RecordWidgetDecorator *decorator);
+		RecordWidgetDecorator *decorator() const { return _decorator; }
+
+		//! Returns the fetched timing quality average
+		float timingQuality(int slot) const;
+
+		double timeScale() const { return _pixelPerSecond; }
+		double amplScale() const { return _amplScale; }
+		double tmin() const { return _tmin; }
+		double tmax() const { return _tmax; }
+		double amplMin() const { return _amplitudeRange[0]; }
+		double amplMax() const { return _amplitudeRange[1]; }
+
+		double smin() const { return _smin; }
+		double smax() const { return _smax; }
+	
+		Seiscomp::Core::Time alignment() { return _alignment; }
+
+		Seiscomp::Core::Time centerTime();
+
+		//! Returns the trace plot position of the given slot
+		int streamYPos(int slot) const;
+		//! Returns the trace height of the given slot
+		int streamHeight(int slot) const;
+
+		//! Returns the amplitude range of the available data in the normalization
+		//! window
+		QPair<double,double> amplitudeDataRange(int slot) const;
+
+		//! Returns the amplitude range of the trace slot where first corresponds
+		//! to the lower pixel row and second to the upper pixel row
+		QPair<double,double> amplitudeRange(int slot) const;
+
+		void ensureVisibility(const Seiscomp::Core::Time &time, int pixelMargin);
+	
+		//! Method to inform the widget about a newly inserted
+		//! record.
+		virtual void fed(int slot, const Seiscomp::Record *rec);
+	
+		//! Causes the widget to rebuild its internal data
+		//! according its size and parameters
+		void setDirty();
+
+		//! Whether to show the current selected recordstream or
+		//! both recordstreams
+		void showAllRecords(bool enable);
+
+		//! Whether to show record borders
+		void showRecordBorders(bool enable);
+
+		//! Whether to show scaled or raw values. The default is false.
+		void showScaledValues(bool enable);
+		bool areScaledValuesShown() const { return _showScaledValues; }
+
+		//! Adds a marker to the widget. The ownership takes
+		//! the widget.
+		bool addMarker(RecordMarker*);
+
+		//! Inserts a marker at pos in the marker list
+		bool insertMarker(int pos, RecordMarker* marker);
+
+		int indexOfMarker(RecordMarker* marker) const;
+
+		//! Removes a record marker and returns the instance
+		RecordMarker *takeMarker(int pos);
+		RecordMarker *takeMarker(RecordMarker*);
+
+		//! Removes and deletes a record marker.
+		bool removeMarker(int pos);
+		bool removeMarker(RecordMarker*);
+
+		//! Returns the number of markers added to the widget.
+		int markerCount() const;
+
+		//! Returns the i-th marker.
+		RecordMarker* marker(int i) const;
+
+		//! Returns the marker with text set to txt
+		RecordMarker* marker(const QString& txt, bool movableOnly = false) const;
+
+		//! Returns the marker with text set to txt and which is enabled
+		RecordMarker* enabledMarker(const QString& txt) const;
+
+		//! Removes and deletes all marker inserted previously.
+		void clearMarker();
+
+		//! Sets the current marker
+		void setCurrentMarker(RecordMarker *);
+
+		//! Returns the currently focused marker
+		RecordMarker *currentMarker() const;
+
+		//! Returns the current marker under the mouse
+		RecordMarker *hoveredMarker() const;
+
+		//! Returns the marker under position p. If moveableOnly is set
+		//! to true, only movable markers are checked.
+		RecordMarker* markerAt(const QPoint& p, bool movableOnly = true, int maxDist = 5) const;
+		RecordMarker* markerAt(int x, int y, bool movableOnly = true, int maxDist = 5) const;
+
+		//! Returns the nearest marker left from time t
+		RecordMarker* lastMarker(const Seiscomp::Core::Time& t);
+
+		//! Returns the nearest marker right from time t
+		RecordMarker* nextMarker(const Seiscomp::Core::Time& t);
+
+		//! Returns the nearest marker at time t
+		RecordMarker* nearestMarker(const Seiscomp::Core::Time& t, int maxDist = -1);
+
+		//! Returns whether the widget has markers that are movable or not
+		bool hasMovableMarkers() const;
+
+		//! Sets the text to be displayed on the cursor
+		void setCursorText(const QString& text);
+
+		//! Returns the current cursor text
+		QString cursorText() const;
+
+		void setCursorPos(const QPoint&);
+		void setCursorPos(const Seiscomp::Core::Time&);
+		const Seiscomp::Core::Time& cursorPos() const;
+
+		const double *value(const Seiscomp::Core::Time&) const;
+
+		//! Returns the time on the left visible side of the widget
+		Seiscomp::Core::Time leftTime() const;
+		//! Returns the time on the right visible side of the widget
+		Seiscomp::Core::Time rightTime() const;
+
+		Seiscomp::Core::TimeWindow visibleTimeWindow() const;
+		Seiscomp::Core::TimeWindow selectedTimeWindow() const;
+		const Seiscomp::Core::TimeWindow & normalizationWindow() const;
+
+		bool isActive() const;
+		bool isFilteringEnabled() const;
+		bool isGlobalOffsetEnabled() const;
+
+		//! Maps a time to a position relative to the widget
+		int mapTime(const Core::Time&) const;
+
+		//! Maps a time to a position relative to the trace canvas
+		int mapCanvasTime(const Core::Time&) const;
+
+		//! Maps a widget position to a time
+		Core::Time unmapTime(int x) const;
+
+		const DataModel::WaveformStreamID& streamID() const;
+
+		void setSlotCount(int);
+		int slotCount() const;
+
+		//! Sets internal data to data. This can be used for
+		//! user data to store anything that a QVariant can store.
+		void setData(const QVariant& data);
+
+		//! Returns the user data set in setData
+		QVariant data() const;
+
+
+	public slots:
+		void setAmplAutoScaleEnabled(bool enable);
+
+		//! Sets clipping for drawmode InRows.
+		void setClippingEnabled(bool);
+		bool isClippingEnabled() const;
+
+		void enableGlobalOffset(bool enable);
+
+		void setSelected(double t1, double t2);
+		void setSelected(Seiscomp::Core::Time t1, Seiscomp::Core::Time t2);
+
+		void setScale(double, double=0);
+		void setTimeScale(double);
+
+		void setTimeRange(double, double);
+		void setAmplRange(double, double);
+		void setMinimumAmplRange(double, double);
+
+		void showTimeRange(double, double);
+
+		void translate(double);
+
+		void setEnabled(bool enabled);
+		void setAlignment(Seiscomp::Core::Time t);
+		void alignOnMarker(const QString& text);
+
+		void setAmplScale(double);
+	
+		void enableFiltering(bool enable);
+		void setGridSpacing(double, double, double);
+		void setGridVSpacing(double, double, double);
+		void setGridVRange(double, double);
+		void setGridVScale(double);
+
+		void setActive(bool);
+
+		void setAutoMaxScale(bool);
+
+		void setNormalizationWindow(const Seiscomp::Core::TimeWindow&);
+		void setOffsetWindow(const Seiscomp::Core::TimeWindow&);
+
+		//! Sets the maximum slot index for which setFilter(filter) is
+		//! applied. The semantics of 'any' is bound to value -1.
+		void setFilterSlotMax(int max);
+
+		//! Sets the record filter. The filter will be cloned and will not
+		//! be touched by the widget. The caller is responsible to destroy
+		//! the filter used as parameter.
+		void setFilter(Filter* filter);
+
+		void updateRecords();
+		void clearRecords();
+
+
+	private slots:
+		void scroll(int);
+
+
+	signals:
+		//! This signal is emitted when a time (absolut time)
+		//! has been selected inside the widget. It does not
+		//! happen when a marker has been hit.
+		void selectedTime(Seiscomp::Core::Time);
+
+		//! This signal is emitted when a time range (absolut time)
+		//! has been selected inside the widget by holding
+		//! the left mouse button.
+		void selectedTimeRange(Seiscomp::Core::Time, Seiscomp::Core::Time);
+
+		//! This signal is emitted when a time range (absolut time)
+		//! is selected while still holding the left mouse button.
+		void selectedTimeRangeChanged(Seiscomp::Core::Time, Seiscomp::Core::Time);
+
+		//! Whenever a current (active) marker has changed
+		//! this signal will be emittet.
+		void currentMarkerChanged(Seiscomp::Gui::RecordMarker*);
+
+		void cursorMoved(QPoint p);
+
+		//! Whenever the cursor changes this signal is emitted.
+		//! The first parameter is the owner of the cursor and
+		//! the second parameter is the slot where the cursor has
+		//! been moved. This usually equals the current slot but
+		//! when drawing all slots in rows then it might differ.
+		void cursorUpdated(RecordWidget*, int);
+		void mouseOver(bool);
+
+		//! This signal is emitted when the user clicks with the
+		//! middle mousebutton into the trace
+		void clickedOnTime(Seiscomp::Core::Time);
+
+		void traceUpdated(Seiscomp::Gui::RecordWidget*);
+
+		//! This signal is emitted when the layout of the widget
+		//! changes. Whenever a new slot has been added or removed
+		//! and the drawingMode is InRows then a layoutRequest is made.
+		void layoutRequest();
+
+		void axisSettingsChanged(Seiscomp::Gui::RecordWidget*);
+
+
+	protected:
+		void init();
+
+		bool event(QEvent *);
+
+		void paintEvent(QPaintEvent*);
+
+		void mousePressEvent(QMouseEvent*);
+		void mouseReleaseEvent(QMouseEvent*);
+		void mouseDoubleClickEvent(QMouseEvent*);
+		void mouseMoveEvent(QMouseEvent*);
+
+		void resizeEvent(QResizeEvent*);
+
+		void enterEvent(QEvent*);
+		void leaveEvent(QEvent*);
+
+		void enabledChange(bool) { update(); }
+
+		virtual void changedRecords(int slot, RecordSequence*);
+
+		virtual void drawActiveCursor(QPainter &painter, int x, int y);
+
+		virtual void drawCustomBackground(QPainter &painter);
+		virtual void customPaintTracesBegin(QPainter &painter);
+		virtual void customPaintTracesEnd(QPainter &painter);
+
+		virtual void createPolyline(int slot, AbstractRecordPolylinePtr &polyline,
+		                            RecordSequence const *, double pixelPerSecond,
+		                            double amplMin, double amplMax, double amplOffset,
+		                            int height, bool optimization, bool highPrecision);
+		virtual const double *value(int slot, const Seiscomp::Core::Time&) const;
+
+
+	protected:
+		struct Stream {
+			enum Index {
+				Raw = 0,
+				Filtered = 1
+			};
+
+			Stream(bool owner);
+			~Stream();
+
+			void setDirty();
+			void free();
+
+			RecordSequence *records[2];
+			Trace           traces[2];
+			bool            ownRawRecords;
+			bool            ownFilteredRecords;
+			bool            visible;
+			bool            filtering;
+
+			QString         id;
+			QPen            pen;
+			bool            antialiasing;
+			bool            stepFunction;
+			QColor          customBackgroundColor;
+			bool            hasCustomBackgroundColor;
+			bool            optimize;
+			double          scale;
+
+			// The value range axis, if enabled
+			QString         axisLabel;
+			double          axisSpacing[2];
+			bool            axisDirty;
+
+			// Internal variables to track the current trace position
+			// in widget coordinated
+			int             posY;
+			int             height;
+
+			QVariant        userData;
+
+			Filter         *filter;
+		};
+
+
+	protected:
+		Stream *getStream(int);
+		const Stream *getStream(int) const;
+
+		bool createFilter();
+		bool createFilter(int slot);
+		void filterRecords(Stream *s);
+		bool setFilteredRecords(int slot, RecordSequence* seq, bool owner);
+		Record* filteredRecord(Filter *&filter,
+		                       const Record*, const Record*,
+		                       double tolerance) const;
+
+		void prepareRecords(Stream *s);
+		void drawRecords(Stream *s, int slot);
+		void drawTrace(QPainter &painter,
+		               const Trace *trace,
+		               const RecordSequence *seq,
+		               const QPen &pen,
+		               const QPoint &paintOffset) const;
+		void drawRecordBorders(QPainter &painter, const RecordSequence *seq) const;
+		void drawMarkers(QPainter &painter, QFont &font, const QColor &fg);
+
+		void drawAxis(QPainter &painter, const QPen &p);
+
+		int canvasWidth() const;
+		int canvasHeight() const;
+
+
+	private:
+		typedef QVector<Stream*> StreamMap;
+
+		QVariant             _data;
+		DrawMode             _drawMode;
+		RecordBorderDrawMode _recordBorderDrawMode;
+		Seiscomp::Core::Time _alignment;
+		bool                 _clipRows{true};
+	
+		double               _tmin;            // time range min
+		double               _tmax;            // time range max
+		double               _smin, _smax;     // selection
+		double               _pixelPerSecond;
+		double               _amplScale;       // pixel per amplitude unit (0=normalize)
+		double               _gridHSpacing[2];
+		double               _gridHOffset;
+
+		double               _gridVRange[2];
+		double               _gridVSpacing[2];
+		double               _gridVOffset;
+		double               _gridVScale;
+
+		double               _amplitudeRange[2];
+		bool                 _useFixedAmplitudeRange{false};
+		bool                 _useMinAmplitudeRange{false};
+
+		bool                 _active{false};
+		bool                 _filtering{false};
+		bool                 _showScaledValues{false};
+
+		bool                 _drawRecords{false};
+		bool                 _drawRecordID{true};
+		bool                 _drawOffset{true};
+		bool                 _drawSPS{false};
+		bool                 _showAllRecords{false};
+		bool                 _showRecordBorders{false};
+		bool                 _autoMaxScale{false};
+		bool                 _enabled;
+		bool                 _useGlobalOffset{false};
+		bool                 _drawAxis;
+
+		int                  _tracePaintOffset;
+		int                  _axisWidth;
+		AxisPosition         _axisPosition;
+		int                  _axisSpacing;
+		int                  _rowSpacing;
+
+		StreamMap            _streams;
+		int                  _currentSlot;
+		int                  _requestedSlot;
+		int                  _maxFilterSlot;
+		int                  _currentCursorYPos;
+		int                  _valuePrecision;
+
+		QColor               _customBackgroundColor;
+		bool                 _hasCustomBackground;
+
+		Seiscomp::DataModel::WaveformStreamID _streamID;
+
+		QVector<RecordMarker*> _marker;
+		RecordMarker        *_activeMarker;
+		RecordMarker        *_hoveredMarker;
+
+		QScrollBar          *_scrollBar;
+
+		QRect                _canvasRect;
+		int                  _margins[4];
+		QString              _cursorText;
+		Seiscomp::Core::Time _cursorPos;
+		Seiscomp::Core::Time _startDragPos;
+
+		Seiscomp::Core::TimeWindow _normalizationWindow;
+		Seiscomp::Core::TimeWindow _offsetWindow;
+
+		RecordWidget        *_shadowWidget;
+		RecordWidget        *_markerSourceWidget;
+
+		RecordWidgetDecorator *_decorator;
+
+		int                  _shadowWidgetFlags;
+};
+
+
+inline const QRect &RecordWidget::canvasRect() const {
+	return _canvasRect;
+}
+
+inline int RecordWidget::rowSpacing() const {
+	return _rowSpacing;
+}
+
+inline int RecordWidget::axisSpacing() const {
+	return _axisSpacing;
+}
+
+inline int RecordWidget::axisWidth() const {
+	return _axisWidth;
+}
+
+inline RecordWidget::AxisPosition RecordWidget::axisPosition() const {
+	return _axisPosition;
+}
+
+inline int RecordWidget::canvasWidth() const {
+	return _canvasRect.width();
+}
+
+inline int RecordWidget::canvasHeight() const {
+	return _canvasRect.height();
+}
+
+
+
+}
+}
+
+
+# endif

include/seiscomp/gui/core/ruler.h

@@ -0,0 +1,209 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_RULER_H
+#define SEISCOMP_GUI_RULER_H
+
+#include <seiscomp/gui/qt.h>
+
+#include <QFrame>
+
+namespace Seiscomp {
+namespace Gui {
+
+class SC_GUI_API Ruler : public QFrame
+{
+	Q_OBJECT
+
+	public:
+		enum Position { Bottom, Top, Left, Right };
+
+		Ruler(QWidget* = 0, Qt::WindowFlags f = Qt::WindowFlags(), Position pos = Bottom);
+		~Ruler() {}
+
+		void setPosition(Position, bool allowLabelTextRotation = false);
+		void setReverseDirection(bool reverse);
+		void setRange(double, double);
+		void setLimits(double leftValue, double rightValue, double minRange, double maxRange);
+		void setScale(double);
+		bool setSelected(double, double);
+		bool setSelectionHandle(int handle, double pos);
+		bool setSelectionHandleEnabled(int handle, bool enable);
+		void setAnnot(double = -1); // -1 is "auto", 0 is none
+		void setTicks(double = -1); // -1 is "auto", 0 is none
+
+		void setSelectionHandleCount(int);
+
+		bool isSelectionEnabled() const { return _enableSelection; }
+		int selectionHandleCount() const;
+		double selectionHandlePos(int) const;
+
+		void setWheelEnabled(bool scale, bool translate);
+
+		double minimumRange() const { return _min; }
+		double maximumRange() const { return _max; }
+
+		double minimumSelection() const;
+		double maximumSelection() const;
+
+		double scale() const { return _scl; }
+		double pixelPerUnit() const { return _scl; }
+
+		double dA() const { return _drx[0]; }
+		double dT() const { return _drx[1]; }
+		double dOfs() const { return _ofs; }
+
+		virtual QSize sizeHint() const;
+
+		//! Functions for position independent drawing
+		int rulerWidth() const { return isHorizontal() ? width() : height(); }
+		int rulerHeight() const { return isHorizontal() ? height() : width(); }
+
+		bool isBottom() const { return _position == Bottom; }
+		bool isTop() const { return _position == Top; }
+		bool isLeft() const { return _position == Left; }
+		bool isRight() const { return _position == Right; }
+		bool isHorizontal() const { return isBottom() || isTop(); }
+		bool isVertical() const { return !isHorizontal(); }
+
+
+	public slots:
+		void showRange(double, double);
+		void translate(double);
+		void setAutoScaleEnabled(bool);
+		void setSelectionEnabled(bool);
+
+		void setRangeSelectionEnabled(
+		       bool enabled,
+		       bool emitRangeChangeWhileDragging = false
+		);
+
+		void changed(int pos = -1);
+
+
+	signals:
+		void scaleChanged(double);
+		void changedSelection(double, double);
+		void selectionHandleMoved(int handle, double pos, Qt::KeyboardModifiers);
+		void selectionHandleMoveFinished();
+		void changedInterval(double dA, double dT, double ofs);
+		void dragged(double diffTime);
+		void dragStarted();
+		void dragFinished();
+
+		void rangeChangeRequested(double tmin, double tmax);
+
+
+	protected:
+		void paintEvent(QPaintEvent*);
+		void mousePressEvent(QMouseEvent*);
+		void mouseReleaseEvent(QMouseEvent*);
+		void mouseMoveEvent(QMouseEvent*);
+		void wheelEvent(QWheelEvent*);
+		void resizeEvent(QResizeEvent*);
+
+		//! Should be reimplemented in derived classes to
+		//! customize the displayed string. str holds the string
+		//! used for displaying and value describes the position
+		//! on the ruler.
+		virtual bool getTickText(double pos, double lastPos,
+		                         int line, QString &str) const;
+		virtual void updateIntervals();
+
+		void enterEvent(QEvent *e);
+		void leaveEvent(QEvent *e);
+
+		void setLineCount(int lines, int spacing = 4);
+		virtual void drawSelection(QPainter &p);
+		void drawRangeSelection(QPainter &p);
+
+		//! Converts ruler position to point in widget coordinates, rx is the
+		//! position on the ruler, ry the distance from the rulers baseline
+		QPoint r2wPos(int rx, int ry) const;
+		//! Converts widget coordinates to ruler position
+		QPoint w2rPos(int x, int y) const;
+		//! Converts ruler rectangle to rectangle in widget coordinates.
+		//! rx is the position on the ruler, ry the distance from the rulers
+		//! baseline
+		QRect r2wRect(int rx, int ry, int rw, int rh) const;
+		//! Draws text at the specified ruler position (rx) with
+		//! the specified distance (ry) from the rulers baseline.
+		//! If allowRotate is set to 'true' the text is rotated
+		//! by 90 degrees if the ruler is in a vertical mode.
+		bool rulerDrawText(QPainter &p, int rx, int ry,
+		                   const QString &text, bool allowClip = false,
+		                   bool allowRotate = false) const;
+		bool rulerDrawTextAtLine(QPainter &p, int rx, int line,
+		                         const QString &text, bool allowClip = false,
+		                         bool allowRotate = false) const;
+
+		void checkLimit(double &tmin, double &tmax);
+		void changeRange(double tmin, double tmax);
+
+	protected:
+		struct Handle {
+			Handle() : enabled(true) {}
+			double pos;
+			bool   enabled;
+
+			bool operator<(const Handle &other) const {
+				return pos < other.pos;
+			}
+		};
+
+		Position _position;
+
+		double  _ofs{0};
+		double  _scl{1.0},
+		        _min{0}, _max{0},       // ruler range
+		        _da{-1},              // annotation interval
+		        _dt{-1},              // tick mark interval
+		        _limitLeft, _limitRight,
+		        _limitMinRange, _limitMaxRange;
+		int     _pos{0}, _tickLong, _tickShort, _lc, _lineSpacing;
+		QVector<Handle> _selectionHandles;
+		int     _currentSelectionHandle{-1};
+
+		double  _drx[2];   // current intervals
+
+		int     _dragMode{0};
+		double  _dragStart;
+		int     _iDragStart;
+
+		int     _rangemin{0}, _rangemax{0};
+		bool    _rangeValid;
+
+		bool    _enableSelection;
+		bool    _enableRangeSelection{false};
+		bool    _enableLabelRotation{false};
+		bool    _leftToRight{true}; // Or bottomToTop
+		bool    _emitRangeChangeWhileDragging{false};
+		bool    _hover{false};
+		bool    _wheelScale{true};
+		bool    _wheelTranslate{true};
+		bool    _autoScale{false};
+};
+
+
+} // ns Gui
+} // ns Seiscomp
+
+# endif // _RULER_H_

include/seiscomp/gui/core/scheme.h

@@ -0,0 +1,377 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_SCHEME_H
+#define SEISCOMP_GUI_SCHEME_H
+
+
+#include <QColor>
+#include <QPen>
+#include <QBrush>
+#include <QPoint>
+#include <QFont>
+#include <seiscomp/gui/qt.h>
+#include <seiscomp/gui/core/gradient.h>
+#include <seiscomp/gui/core/recordwidget.h>
+
+
+class QTabWidget;
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API Scheme {
+	public:
+		Scheme();
+
+		void applyTabPosition(QTabWidget *tab);
+
+		struct Colors {
+			Colors();
+
+			struct Splash {
+				Splash();
+				QColor version;
+				QColor message;
+			};
+
+			struct Picks {
+				Picks();
+				QColor manual;
+				QColor automatic;
+				QColor undefined;
+				QColor disabled;
+			};
+
+			struct Arrivals {
+				Arrivals();
+				QColor   manual;
+				QColor   automatic;
+				QColor   theoretical;
+				QColor   undefined;
+				QColor   disabled;
+				QPen     uncertainties;
+				QPen     defaultUncertainties;
+				Gradient residuals;
+			};
+
+			struct Magnitudes {
+				Magnitudes();
+				QColor set;
+				QColor unset;
+				QColor disabled;
+				Gradient residuals;
+			};
+
+			struct RecordStates {
+				RecordStates();
+				QColor unrequested;
+				QColor requested;
+				QColor inProgress;
+				QColor notAvailable;
+			};
+
+			struct BrushPen {
+				QPen pen;
+				QBrush brush;
+			};
+
+			struct RecordBorders {
+				RecordBorders();
+				BrushPen standard;
+				BrushPen signatureValid;
+				BrushPen signatureInvalid;
+			};
+
+			struct Records {
+				Records();
+				QColor alignment;
+				QColor background;
+				QColor alternateBackground;
+				QColor foreground;
+				QColor alternateForeground;
+				QColor spectrogram;
+				QPen offset;
+				QPen gridPen;
+				QPen subGridPen;
+				QBrush gaps;
+				QBrush overlaps;
+				RecordStates states;
+				RecordBorders borders;
+			};
+
+			struct Stations {
+				Stations();
+				QColor text;
+				QColor associated;
+				QColor selected;
+				QColor triggering;
+				QColor triggered0;
+				QColor triggered1;
+				QColor triggered2;
+				QColor disabled;
+				QColor idle;
+			};
+
+			struct QC {
+				QC();
+				QColor delay0;
+				QColor delay1;
+				QColor delay2;
+				QColor delay3;
+				QColor delay4;
+				QColor delay5;
+				QColor delay6;
+				QColor delay7;
+				QColor qcWarning;
+				QColor qcError;
+				QColor qcOk;
+				QColor qcNotSet;
+			};
+
+			struct ConfigGradient {
+				Gradient gradient;
+				bool     discrete;
+			};
+
+			struct OriginSymbol {
+				OriginSymbol();
+				bool           classic;
+				ConfigGradient depth;
+			};
+
+			struct OriginStatus {
+				OriginStatus();
+				QColor automatic;
+				QColor manual;
+			};
+
+			struct GroundMotion {
+				GroundMotion();
+				QColor gmNotSet;
+				QColor gm0;
+				QColor gm1;
+				QColor gm2;
+				QColor gm3;
+				QColor gm4;
+				QColor gm5;
+				QColor gm6;
+				QColor gm7;
+				QColor gm8;
+				QColor gm9;
+			};
+
+			struct RecordView {
+				RecordView();
+				QColor selectedTraceZoom;
+			};
+
+			struct Map {
+				Map();
+				QColor lines;
+				QColor outlines;
+				QPen   directivity;
+				QPen   grid;
+				QColor stationAnnotations;
+				QColor cityLabels;
+				QColor cityOutlines;
+				QColor cityCapital;
+				QColor cityNormal;
+
+				struct {
+					QPen   normalText;
+					QPen   normalBorder;
+					QBrush normalBackground;
+
+					QPen   highlightedText;
+					QPen   highlightedBorder;
+					QBrush highlightedBackground;
+
+					int    textSize;
+				}      annotations;
+			};
+
+			struct Legend {
+				Legend();
+				QColor background;
+				QColor border;
+				QColor text;
+				QColor headerText;
+			};
+
+			public:
+				QColor                    background;
+				Splash                    splash;
+				Records                   records;
+				Gradient                  spectrogram;
+				Picks                     picks;
+				Arrivals                  arrivals;
+				Magnitudes                magnitudes;
+				Stations                  stations;
+				QC                        qc;
+				OriginSymbol              originSymbol;
+				OriginStatus              originStatus;
+				GroundMotion              gm;
+				RecordView                recordView;
+				Map                       map;
+				Legend                    legend;
+				QMap<std::string, QColor> agencies;
+		};
+
+		struct Fonts {
+			Fonts();
+			void setBase(const QFont& f);
+
+			QFont base;
+			QFont smaller;
+			QFont normal;
+			QFont large;
+			QFont highlight;
+			QFont heading1;
+			QFont heading2;
+			QFont heading3;
+
+			QFont cityLabels;
+			QFont splashVersion;
+			QFont splashMessage;
+		};
+
+		struct Splash {
+			Splash();
+
+			struct Pos {
+				QPoint pos;
+				int    align;
+			};
+
+			Pos version;
+			Pos message;
+		};
+
+		struct Map {
+			Map();
+
+			int stationSize;
+			int originSymbolMinSize;
+			bool vectorLayerAntiAlias;
+			bool bilinearFilter;
+			bool showGrid;
+			bool showLayers;
+			bool showCities;
+			bool showLegends;
+			int cityPopulationWeight;
+			bool toBGR;
+			int polygonRoughness;
+			std::string projection;
+		};
+
+		struct Marker {
+			Marker();
+
+			int lineWidth;
+		};
+
+		struct RecordBorders {
+			RecordBorders();
+
+			Gui::RecordWidget::RecordBorderDrawMode drawMode;
+		};
+
+		struct Records {
+			Records();
+
+			int lineWidth;
+			bool antiAliasing;
+			bool optimize;
+			RecordBorders recordBorders;
+		};
+
+		struct Precision {
+			Precision();
+
+			int depth;
+			int distance;
+			int location;
+			int magnitude;
+			int originTime;
+			int pickTime;
+			int traceValues;
+			int rms;
+			int uncertainties;
+		};
+
+		struct Unit {
+			Unit();
+
+			bool distanceInKM;
+		};
+
+		struct DateTime {
+			DateTime();
+
+			bool useLocalTime;
+		};
+
+	public:
+		bool      showMenu;
+		bool      showStatusBar;
+		int       tabPosition;
+
+		Splash    splash;
+		Colors    colors;
+		Marker    marker;
+		Records   records;
+		Map       map;
+		Precision precision;
+		Unit      unit;
+		DateTime  dateTime;
+
+		Fonts     fonts;
+
+		QFont font(int relativeFontSize, bool bold = false, bool italic = false);
+
+		void fetch();
+
+};
+// <<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<
+
+
+
+
+// >>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>
+SC_GUI_API QColor blend(const QColor& c1, const QColor& c2, int percentOfC1);
+// <<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<
+
+
+
+
+// >>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>
+SC_GUI_API QColor blend(const QColor& c1, const QColor& c2);
+
+
+}
+}
+
+
+#endif
+

include/seiscomp/gui/core/spectrogramrenderer.h

@@ -0,0 +1,244 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_CORE_SPECTROGRAMRENDERER_H
+#define SEISCOMP_GUI_CORE_SPECTROGRAMRENDERER_H
+
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/recordsequence.h>
+#include <seiscomp/math/restitution/transferfunction.h>
+#include <seiscomp/io/recordfilter/spectralizer.h>
+#endif
+#include <seiscomp/gui/core/lut.h>
+
+#include <QPainter>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API SpectrogramRenderer {
+	// ----------------------------------------------------------------------
+	//  Public types
+	// ----------------------------------------------------------------------
+	public:
+		enum class NormalizationMode {
+			Fixed,
+			Frequency,
+			Time
+		};
+
+
+	// ----------------------------------------------------------------------
+	//  X'truction
+	// ----------------------------------------------------------------------
+	public:
+		//! C'tor
+		SpectrogramRenderer();
+
+
+	// ----------------------------------------------------------------------
+	//  Public Interface
+	// ----------------------------------------------------------------------
+	public:
+		//! Sets the spectrogram options and calls reset().
+		bool setOptions(const IO::Spectralizer::Options &opts);
+		const IO::Spectralizer::Options &options() const { return _options; }
+
+		//! Sets the scale of the raw stream data which is 1/gain to convert
+		//! to sensor units
+		void setScale(double scale);
+
+		//! Sets the color gradient. Key range is normalized to [0,1].
+		void setGradient(const Gradient &gradient);
+
+		//! Sets the gradient range
+		void setGradientRange(double lowerBound, double upperBound);
+
+		double gradientLowerBound() const { return _gradient.lowerBound(); }
+		double gradientUpperBound() const { return _gradient.upperBound(); }
+
+		//! Resets the spectrogram and deletes all data
+		void reset();
+
+		//! Feeds a record for processing. Records must be timely ordered
+		//! otherwise gaps are produced.
+		bool feed(const Record *rec);
+		bool feedSequence(const RecordSequence *seq);
+
+		//! Resets the view and feeds the sequence
+		void setRecords(const RecordSequence *seq);
+
+		void setAlignment(const Core::Time &align);
+		void setTimeRange(double tmin, double tmax);
+
+		//! Sets the current time window of the data
+		void setTimeWindow(const Core::TimeWindow &tw);
+
+		//! Sets the frequency range to be displayed. A value lower or equal to
+		//! zero refers to the global minimum or the global maximum
+		//! respectively.
+		void setFrequencyRange(OPT(double) fmin, OPT(double) fmax);
+
+		const OPT(double) &frequencyLowerBound() const { return _fmin; }
+		const OPT(double) &frequencyUpperBound() const { return _fmax; }
+
+		void setNormalizeAmplitudes(bool f);
+		void setNormalizationMode(NormalizationMode mode);
+		bool normalizeAmplitudes() const { return _normalizationMode != NormalizationMode::Fixed; }
+
+		void setLogScale(bool f);
+		bool logScale() const { return _logarithmic; }
+
+		void setSmoothTransform(bool);
+		bool smoothTransform() const { return _smoothTransform; }
+
+		//! Sets the transfer function for deconvolution
+		void setTransferFunction(Math::Restitution::FFT::TransferFunction *tf);
+
+		bool isDirty() const { return _dirty; }
+
+		//! Creates the spectrogram. This is usually done in render if the
+		//! spectrogram is dirty but can called from outside.
+		void renderSpectrogram();
+
+		//! Renders the spectrogram with the given painter into the given rect.
+		void render(QPainter &p, const QRect &rect, bool labelLeftAlign = true,
+		            bool renderLabels = false);
+
+		//! Renders the y axis. This call must precede a call to render otherwise
+		//! the frequency range can by out of sync.
+		void renderAxis(QPainter &p, const QRect &rect, bool leftAlign = true,
+		                int paddingOuter = 6, int paddingInner = 0,
+		                bool stretch = false);
+
+		QPair<double,double> range() const;
+
+
+	// ----------------------------------------------------------------------
+	//  Private Interface
+	// ----------------------------------------------------------------------
+	private:
+		struct SpecImage {
+			QImage         data;
+			Core::Time     startTime;
+			Core::TimeSpan dt;
+			double         minimumFrequency;
+			double         maximumFrequency;
+			int            width;
+		};
+
+		DEFINE_SMARTPOINTER(PowerSpectrum);
+		struct PowerSpectrum : public Core::BaseObject {
+			PowerSpectrum(const IO::Spectrum &spectrum, double scale)
+			: startTime(spectrum.startTime()), endTime(spectrum.endTime())
+			, dt(spectrum.dt()), frequency(spectrum.maximumFrequency()) {
+				centerTime = startTime + Core::TimeSpan(static_cast<double>(length()) * 0.5);
+				auto d = spectrum.data();
+				minimumAmplitude = maximumAmplitude = -1;
+				if ( d ) {
+					data = new DoubleArray(d->size());
+					for ( int i = 0; i < d->size(); ++i ) {
+						(*data)[i] = (*d)[i].real() * (*d)[i].real() + (*d)[i].imag() * (*d)[i].imag();
+						if ( minimumAmplitude < 0 || minimumAmplitude > (*data)[i] ) {
+							minimumAmplitude = (*data)[i];
+						}
+						if ( maximumAmplitude < (*data)[i] ) {
+							maximumAmplitude = (*data)[i];
+						}
+					}
+
+					if ( minimumAmplitude > 0 ) {
+						double norm = scale * 0.5 / frequency;
+						minimumAmplitude = log10(minimumAmplitude * norm * norm);
+						maximumAmplitude = log10(maximumAmplitude * norm * norm);
+					}
+				}
+			}
+
+			bool isValid() const { return data && data->size() > 0; }
+
+			Core::TimeSpan length() const { return endTime - startTime; }
+			const Core::Time &center() const { return centerTime; }
+
+			double minimumFrequency() const { return 0; }
+			double maximumFrequency() const { return frequency; }
+
+			Core::Time     startTime;
+			Core::Time     endTime;
+			Core::Time     centerTime;
+			Core::TimeSpan dt;
+			double         frequency;
+			DoubleArrayPtr data;
+			double         minimumAmplitude;
+			double         maximumAmplitude;
+		};
+
+		void setDirty();
+		void addSpectrum(const PowerSpectrum *);
+		void fillRow(SpecImage &img, DoubleArray *spec,
+		             int column, int offset);
+
+
+	// ----------------------------------------------------------------------
+	//  Private members
+	// ----------------------------------------------------------------------
+	private:
+		typedef QList<PowerSpectrumPtr> PowerSpectra;
+
+		typedef QList<SpecImage> SpecImageList;
+		typedef StaticColorLUT<512> Gradient512;
+		typedef Math::Restitution::FFT::TransferFunctionPtr TransferFunctionPtr;
+
+		QImage::Format            _imageFormat;
+		TransferFunctionPtr       _transferFunction;
+		Core::TimeWindow          _timeWindow;
+		Core::Time                _alignment;
+		double                    _tmin, _tmax;
+		double                    _scale;
+		OPT(double)               _fmin, _fmax;
+		double                    _ampMin, _ampMax;
+		IO::Spectralizer::Options _options;
+		IO::SpectralizerPtr       _spectralizer;
+		PowerSpectra              _spectra;
+		SpecImageList             _images;
+		Gradient512               _gradient;
+		NormalizationMode         _normalizationMode;
+		double                    _normalizationAmpRange[2];
+		bool                      _logarithmic;
+		bool                      _smoothTransform;
+		bool                      _dirty;
+		double                    _renderedFmin;
+		double                    _renderedFmax;
+};
+
+
+inline QPair<double,double> SpectrogramRenderer::range() const {
+	return QPair<double,double>(_renderedFmin, _renderedFmax);
+}
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/spectrogramwidget.h

@@ -0,0 +1,133 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_CORE_SPECTROGRAMWIDGET_H
+#define SEISCOMP_GUI_CORE_SPECTROGRAMWIDGET_H
+
+
+#include <QWidget>
+#include <seiscomp/gui/core/spectrogramrenderer.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API SpectrogramWidget : public QWidget {
+	Q_OBJECT
+
+	// ----------------------------------------------------------------------
+	//  Public types
+	// ----------------------------------------------------------------------
+	public:
+		typedef IO::Spectralizer::Options SpectrumOptions;
+
+
+	// ----------------------------------------------------------------------
+	//  X'truction
+	// ----------------------------------------------------------------------
+	public:
+		SpectrogramWidget(QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+
+	// ----------------------------------------------------------------------
+	//  Public Interface
+	// ----------------------------------------------------------------------
+	public:
+		//! Sets the spectrogram options and calls reset().
+		bool setSpectrumOptions(const SpectrumOptions &opts);
+
+		const SpectrumOptions &spectrumOptions() const;
+
+		//! Sets the scale of the raw stream data which is 1/gain
+		void setScale(double scale);
+
+		//! Sets the gradient range
+		void setGradientRange(double lowerBound, double upperBound);
+
+		double gradientLowerBound() const;
+		double gradientUpperBound() const;
+
+		//! Resets the spectrogram and deletes all data
+		void reset();
+
+		//! Feeds a record for processing. Records must be timely ordered
+		//! otherwise gaps are produced.
+		bool feed(const Record *rec);
+		bool feedSequence(const RecordSequence *seq);
+
+		//! Resets the view and feeds the sequence
+		void setRecords(const RecordSequence *seq);
+
+		void setAlignment(const Core::Time &align);
+		void setTimeRange(double tmin, double tmax);
+
+		//! Sets the current time window of the data
+		void setTimeWindow(const Core::TimeWindow &tw);
+
+		//! Sets the frequency range to be displayed. A value lower or equal to
+		//! zero refers to the global minimum or the global maximum
+		//! respectively.
+		void setFrequencyRange(OPT(double) fmin, OPT(double) fmax);
+
+		const OPT(double) &frequencyLowerBound() const;
+		const OPT(double) &frequencyUpperBound() const;
+
+		void setNormalizeAmplitudes(bool f);
+		bool normalizeAmplitudes() const;
+
+		void setLogScale(bool f);
+		bool logScale() const;
+
+		void setSmoothTransform(bool st);
+		bool smoothTransform() const;
+
+		//! Sets the transfer function for deconvolution
+		void setTransferFunction(Math::Restitution::FFT::TransferFunction *tf);
+
+
+	// ----------------------------------------------------------------------
+	//  Public slots
+	// ----------------------------------------------------------------------
+	public slots:
+		void updateSpectrogram();
+
+
+	// ----------------------------------------------------------------------
+	//  Protected Qt Interface
+	// ----------------------------------------------------------------------
+	protected:
+		void resizeEvent(QResizeEvent *);
+		void paintEvent(QPaintEvent *);
+
+
+	// ----------------------------------------------------------------------
+	//  Private members
+	// ----------------------------------------------------------------------
+	private:
+		SpectrogramRenderer _renderer;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/spectrumwidget.h

@@ -0,0 +1,142 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_CORE_SPECTRUMWIDGET_H
+#define SEISCOMP_GUI_CORE_SPECTRUMWIDGET_H
+
+
+#include <QWidget>
+#include <seiscomp/gui/plot/datay.h>
+#include <seiscomp/gui/plot/graph.h>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/math/fft.h>
+#include <seiscomp/processing/response.h>
+#endif
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API SpectrumWidget : public QWidget {
+	Q_OBJECT
+
+	// ----------------------------------------------------------------------
+	//  X'truction
+	// ----------------------------------------------------------------------
+	public:
+		SpectrumWidget(QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+
+	// ----------------------------------------------------------------------
+	//  Public interface
+	// ----------------------------------------------------------------------
+	public:
+		void setMargin(int m) { _margin = qMax(0, m); }
+
+		/**
+		 * @brief Sets the spectrum values and the Nyquist frequency as the
+		 *        frequency of the last spectrum value.
+		 * @param freqNyquist The last spectrum value is measured for that frequency
+		 * @param spec The spectrum values from 0Hz to [fNyquist]Hz
+		 */
+		void setSpectrum(double freqNyquist, const Math::ComplexArray &spec,
+		                 Processing::Response *resp = nullptr,
+		                 QString exportBasename = QString());
+
+		//! Access the x-axis
+		Axis &xAxis() { return _xAxis; }
+
+		//! Access the y-axis
+		Axis &yAxis() { return _yAxis; }
+
+
+	// ----------------------------------------------------------------------
+	//  Public slots
+	// ----------------------------------------------------------------------
+	public slots:
+		void setAmplitudeSpectrum();
+		void setPhaseSpectrum();
+		void setPowerSpectrum();
+		void setLogScaleX(bool logScale);
+		void setLogScaleY(bool logScale);
+
+		void setShowSpectrum(bool show);
+		void setShowCorrected(bool show);
+		void setShowResponse(bool show);
+
+		/**
+		 * @brief Exports all visible spectra into a simple ASCII file
+		 */
+		void exportSpectra();
+
+
+	// ----------------------------------------------------------------------
+	//  QWidget interface
+	// ----------------------------------------------------------------------
+	protected:
+		void resizeEvent(QResizeEvent *e);
+		void paintEvent(QPaintEvent *e);
+
+
+	// ----------------------------------------------------------------------
+	//  Private methods
+	// ----------------------------------------------------------------------
+	private:
+		void updateData();
+		void draw(QPainter &, const Graph *);
+		void updateRanges();
+		void updateAxisLabels();
+
+
+	// ----------------------------------------------------------------------
+	//  Private members
+	// ----------------------------------------------------------------------
+	private:
+		enum Mode {
+			Amplitude,
+			Power,
+			Phase
+		};
+
+		QString                 _exportBasename;
+		double                  _freqNyquist;
+		Math::ComplexArray      _spec;
+		Processing::ResponsePtr _resp;
+		Mode                    _mode;
+		Graph                   _graphPowerSpectrum;
+		Graph                   _graphResponseCorrectedPowerSpectrum;
+		Graph                   _graphResponsePowerSpectrum;
+		DataY                   _powerSpectrum;
+		DataY                   _responseCorrectedPowerSpectrum;
+		DataY                   _responsePowerSpectrum;
+		int                     _margin;
+		Axis                    _xAxis;
+		Axis                    _yAxis;
+		Axis                    _yAxis2;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/streamwidget.h

@@ -0,0 +1,99 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_CORE_STREAMWIDGET_H
+#define SEISCOMP_GUI_CORE_STREAMWIDGET_H
+
+#include <vector>
+#include <map>
+#include <list>
+
+#include <QWidget>
+#include <QGroupBox>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/baseobject.h>
+#include <seiscomp/core/recordsequence.h>
+#include <seiscomp/core/datetime.h>
+#include <seiscomp/core/timewindow.h>
+#include <seiscomp/gui/core/recordstreamthread.h>
+#include <seiscomp/gui/core/recordwidget.h>
+#include <seiscomp/gui/core/timescale.h>
+#include <seiscomp/gui/qt.h>
+#endif
+
+
+namespace Seiscomp { 
+namespace Gui {
+
+
+class SC_GUI_API StreamWidget : public QWidget {
+
+	Q_OBJECT
+
+
+public:
+	StreamWidget(const std::string& recordStreamURL,
+                 const std::string& waveformStreamID,
+                 const double windowLength=600,
+                 QWidget* parent=0);
+
+	~StreamWidget();
+	
+
+protected:
+	virtual void closeEvent(QCloseEvent*);
+	virtual void showEvent(QShowEvent*);
+	virtual void resizeEvent(QResizeEvent* evt);
+	
+	
+signals:
+	void StreamWidgetClosed(StreamWidget* widget);
+	
+	
+private slots:
+	void updateRecordWidget(Seiscomp::Record* record);
+	void updateRecordWidgetAlignment();
+
+	
+private:
+	void startWaveformDataAcquisition();
+	void stopWaveformDataAcquisition();
+
+	
+private:
+		
+	QTimer* _timer;
+	
+	QGroupBox*                          _groupBox;
+	std::unique_ptr<RecordStreamThread> _thread;
+	RecordWidget*                       _recordWidget;
+	RecordSequence*                     _recordSequence;
+	Core::TimeSpan                      _ringBufferSize;
+	TimeScale*                          _timeScale;
+	std::string                         _recordStreamURL;
+	std::string                         _waveformStreamID;
+};
+
+
+} // namespace Gui
+} // namespace Seiscomp
+
+#endif

include/seiscomp/gui/core/tensorrenderer.h

@@ -0,0 +1,104 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_CORE_TENSORRENDERER_H
+#define SEISCOMP_GUI_CORE_TENSORRENDERER_H
+
+
+#include <QImage>
+#include <QColor>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/math/matrix3.h>
+#include <seiscomp/math/tensor.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API TensorRenderer {
+	// ----------------------------------------------------------------------
+	// X'struction
+	// ----------------------------------------------------------------------
+	public:
+		TensorRenderer();
+
+
+	// ----------------------------------------------------------------------
+	// Public interface
+	// ----------------------------------------------------------------------
+	public:
+		void setShadingEnabled(bool);
+		bool isShadingEnabled() const { return _shading; }
+
+		void setMaterial(float ambient, float diffuse);
+
+		void setMargin(int);
+		void setProjectMargin(int);
+
+		void setBorderColor(QColor);
+		void setTColor(QColor);
+		void setPColor(QColor);
+
+		QPoint project(Math::Vector3f &v) const;
+		QPoint project(Math::Vector3d &v) const;
+		QPoint project(double azimuth, double dist = 1.0) const;
+		QPoint projectMargin(double azimuth, int margin, double dist = 1.0) const;
+
+		// Unprojects a point in screen coordinates. Returns false if the
+		// point is not on the sphere (x,y is then valid on the plane and
+		// z is undefined), true otherwise
+		bool unproject(Math::Vector3d &v, const QPointF &p) const;
+
+		void renderBorder(QImage& img);
+
+		// strike, dip and slip are expected to be in degrees
+		void render(QImage& img, double strike, double dip, double slip);
+		void render(QImage& img, const Math::Matrix3f &m);
+		void render(QImage& img, const Math::Matrix3d &m);
+		void render(QImage& img, const Math::Tensor2Sd &t, const Math::Matrix3f &m);
+		void render(QImage& img, const Math::Tensor2Sd &t);
+		void renderNP(QImage& img, double strike, double dip, double slip, QColor color);
+
+
+	private:
+		QColor _colorT;
+		QColor _colorP;
+		QColor _border;
+
+		bool   _shading;
+		QPoint _center;
+		int    _radius;
+		int    _ballRadius;
+		int    _projectRadius;
+		int    _margin;
+		int    _projectMargin;
+		float  _materialAmbient;
+		float  _materialDiffuse;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/core/timescale.h

@@ -0,0 +1,73 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_TIMESCALE_H
+#define SEISCOMP_GUI_TIMESCALE_H
+
+#include "ruler.h"
+#include <seiscomp/core/datetime.h>
+
+#define  REPAINT_WITHOUT_ERASE   FALSE
+#define  REPAINT_AFTER_ERASE     TRUE
+
+namespace Seiscomp {
+namespace Gui {
+
+class SC_GUI_API TimeScale : public Ruler {
+	Q_OBJECT
+
+	public:
+		TimeScale(QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags(), Position pos = Bottom);
+		~TimeScale(){}
+
+		void setTimeRange(double tmin, double tmax) {
+			setRange(tmin, tmax);
+		}
+
+		double tmin() const { return _min; }
+		double tmax() const { return _max; }
+
+		void setAlignment(const Core::Time& t);
+		const Core::Time &alignment() const { return _alignment; }
+
+
+	public slots:
+		void setAbsoluteTimeEnabled(bool absoluteTime, bool absoluteDate = true);
+
+	protected:
+		bool getTickText(double pos, double lastPos,
+		                 int line, QString &str) const;
+		void updateIntervals();
+
+	protected:
+		Core::Time  _alignment;
+		bool        _showAbsoluteValues;
+		bool        _showAbsoluteDate;
+		const char *_primaryTimeFormat;
+		const char *_secondaryTimeFormat;
+		const char *_relativeTimeFormat;
+};
+
+
+}
+}
+
+# endif

include/seiscomp/gui/core/ui_aboutwidget.h

@@ -0,0 +1,193 @@
+/********************************************************************************
+** Form generated from reading UI file 'aboutwidget.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_ABOUTWIDGET_H
+#define UI_ABOUTWIDGET_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTabWidget>
+#include <QtWidgets/QTextEdit>
+#include <QtWidgets/QVBoxLayout>
+#include <QtWidgets/QWidget>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_AboutWidget
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QTabWidget *tabWidget;
+    QWidget *tab;
+    QGridLayout *gridLayout;
+    QLabel *label_3;
+    QLabel *labelVersion;
+    QLabel *label_6;
+    QLabel *label_7;
+    QLabel *label;
+    QLabel *label_5;
+    QLabel *label_4;
+    QSpacerItem *spacerItem;
+    QLabel *label_2;
+    QWidget *tab_2;
+    QVBoxLayout *vboxLayout1;
+    QTextEdit *textLicense;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem1;
+    QPushButton *buttonOk;
+
+    void setupUi(QWidget *AboutWidget)
+    {
+        if (AboutWidget->objectName().isEmpty())
+            AboutWidget->setObjectName(QString::fromUtf8("AboutWidget"));
+        AboutWidget->resize(357, 292);
+        vboxLayout = new QVBoxLayout(AboutWidget);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        tabWidget = new QTabWidget(AboutWidget);
+        tabWidget->setObjectName(QString::fromUtf8("tabWidget"));
+        tab = new QWidget();
+        tab->setObjectName(QString::fromUtf8("tab"));
+        gridLayout = new QGridLayout(tab);
+#ifndef Q_OS_MAC
+        gridLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        gridLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        label_3 = new QLabel(tab);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+
+        gridLayout->addWidget(label_3, 1, 1, 1, 1);
+
+        labelVersion = new QLabel(tab);
+        labelVersion->setObjectName(QString::fromUtf8("labelVersion"));
+
+        gridLayout->addWidget(labelVersion, 0, 1, 1, 1);
+
+        label_6 = new QLabel(tab);
+        label_6->setObjectName(QString::fromUtf8("label_6"));
+
+        gridLayout->addWidget(label_6, 2, 1, 1, 1);
+
+        label_7 = new QLabel(tab);
+        label_7->setObjectName(QString::fromUtf8("label_7"));
+
+        gridLayout->addWidget(label_7, 4, 1, 1, 1);
+
+        label = new QLabel(tab);
+        label->setObjectName(QString::fromUtf8("label"));
+        QSizePolicy sizePolicy(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(label->sizePolicy().hasHeightForWidth());
+        label->setSizePolicy(sizePolicy);
+
+        gridLayout->addWidget(label, 0, 0, 1, 1);
+
+        label_5 = new QLabel(tab);
+        label_5->setObjectName(QString::fromUtf8("label_5"));
+
+        gridLayout->addWidget(label_5, 5, 1, 1, 1);
+
+        label_4 = new QLabel(tab);
+        label_4->setObjectName(QString::fromUtf8("label_4"));
+
+        gridLayout->addWidget(label_4, 5, 0, 1, 1);
+
+        spacerItem = new QSpacerItem(351, 40, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        gridLayout->addItem(spacerItem, 6, 0, 1, 2);
+
+        label_2 = new QLabel(tab);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+
+        gridLayout->addWidget(label_2, 1, 0, 1, 1);
+
+        tabWidget->addTab(tab, QString());
+        tab_2 = new QWidget();
+        tab_2->setObjectName(QString::fromUtf8("tab_2"));
+        vboxLayout1 = new QVBoxLayout(tab_2);
+#ifndef Q_OS_MAC
+        vboxLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout1->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        textLicense = new QTextEdit(tab_2);
+        textLicense->setObjectName(QString::fromUtf8("textLicense"));
+        textLicense->setReadOnly(true);
+
+        vboxLayout1->addWidget(textLicense);
+
+        tabWidget->addTab(tab_2, QString());
+
+        vboxLayout->addWidget(tabWidget);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem1 = new QSpacerItem(271, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem1);
+
+        buttonOk = new QPushButton(AboutWidget);
+        buttonOk->setObjectName(QString::fromUtf8("buttonOk"));
+
+        hboxLayout->addWidget(buttonOk);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+
+        retranslateUi(AboutWidget);
+        QObject::connect(buttonOk, SIGNAL(clicked()), AboutWidget, SLOT(close()));
+
+        QMetaObject::connectSlotsByName(AboutWidget);
+    } // setupUi
+
+    void retranslateUi(QWidget *AboutWidget)
+    {
+        AboutWidget->setWindowTitle(QCoreApplication::translate("AboutWidget", "About SeisComP::GUI", nullptr));
+        label_3->setText(QCoreApplication::translate("AboutWidget", "GFZ Potsdam", nullptr));
+        labelVersion->setText(QCoreApplication::translate("AboutWidget", "-", nullptr));
+        label_6->setText(QCoreApplication::translate("AboutWidget", "German Research Centre for Geosciences", nullptr));
+        label_7->setText(QCoreApplication::translate("AboutWidget", "gempa GmbH (http://www.gempa.de)", nullptr));
+        label->setText(QCoreApplication::translate("AboutWidget", "Version:", nullptr));
+        label_5->setText(QCoreApplication::translate("AboutWidget", "geofon_dc@gfz-potsdam.de", nullptr));
+        label_4->setText(QCoreApplication::translate("AboutWidget", "Contact:", nullptr));
+        label_2->setText(QCoreApplication::translate("AboutWidget", "Authors:", nullptr));
+        tabWidget->setTabText(tabWidget->indexOf(tab), QCoreApplication::translate("AboutWidget", "About", nullptr));
+        tabWidget->setTabText(tabWidget->indexOf(tab_2), QCoreApplication::translate("AboutWidget", "License", nullptr));
+        buttonOk->setText(QCoreApplication::translate("AboutWidget", "Ok", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class AboutWidget: public Ui_AboutWidget {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_ABOUTWIDGET_H

include/seiscomp/gui/core/ui_connectiondialog.h

@@ -0,0 +1,393 @@
+/********************************************************************************
+** Form generated from reading UI file 'connectiondialog.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_CONNECTIONDIALOG_H
+#define UI_CONNECTIONDIALOG_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QComboBox>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QGroupBox>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QLineEdit>
+#include <QtWidgets/QListWidget>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QSpinBox>
+#include <QtWidgets/QSplitter>
+#include <QtWidgets/QToolButton>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_ConnectionDialog
+{
+public:
+    QGridLayout *gridLayout;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem;
+    QPushButton *btnClose;
+    QGroupBox *groupDatabase;
+    QGridLayout *gridLayout1;
+    QHBoxLayout *hboxLayout1;
+    QPushButton *btnDbSwitchToReported;
+    QSpacerItem *spacerItem1;
+    QPushButton *btnDbConnect;
+    QComboBox *comboDbType;
+    QLineEdit *editDbConnection;
+    QLabel *labelDbType;
+    QLabel *labelDbConnection;
+    QLabel *label_7;
+    QLineEdit *labelDbReported;
+    QSplitter *splitter;
+    QGroupBox *groupMessaging;
+    QGridLayout *gridLayout2;
+    QLabel *label_4;
+    QSpinBox *timeoutSpinBox;
+    QHBoxLayout *hboxLayout2;
+    QSpacerItem *spacerItem2;
+    QPushButton *btnConnect;
+    QLineEdit *editPrimaryGroup;
+    QLabel *label_5;
+    QLabel *label_2;
+    QLineEdit *editServer;
+    QLineEdit *editUser;
+    QLabel *label;
+    QSpacerItem *verticalSpacer;
+    QLabel *label_3;
+    QHBoxLayout *horizontalLayout;
+    QLineEdit *editPeerCertificate;
+    QToolButton *btnPeerCertificateOpen;
+    QGroupBox *groupSubscriptions;
+    QVBoxLayout *vboxLayout;
+    QListWidget *listSubscriptions;
+    QHBoxLayout *hboxLayout3;
+    QPushButton *btnSelectAll;
+    QSpacerItem *spacerItem3;
+    QPushButton *btnDeselectAll;
+
+    void setupUi(QDialog *ConnectionDialog)
+    {
+        if (ConnectionDialog->objectName().isEmpty())
+            ConnectionDialog->setObjectName(QString::fromUtf8("ConnectionDialog"));
+        ConnectionDialog->resize(868, 652);
+        QSizePolicy sizePolicy(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(ConnectionDialog->sizePolicy().hasHeightForWidth());
+        ConnectionDialog->setSizePolicy(sizePolicy);
+        gridLayout = new QGridLayout(ConnectionDialog);
+        gridLayout->setSpacing(4);
+        gridLayout->setContentsMargins(4, 4, 4, 4);
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem = new QSpacerItem(261, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem);
+
+        btnClose = new QPushButton(ConnectionDialog);
+        btnClose->setObjectName(QString::fromUtf8("btnClose"));
+
+        hboxLayout->addWidget(btnClose);
+
+
+        gridLayout->addLayout(hboxLayout, 2, 0, 1, 1);
+
+        groupDatabase = new QGroupBox(ConnectionDialog);
+        groupDatabase->setObjectName(QString::fromUtf8("groupDatabase"));
+        QSizePolicy sizePolicy1(QSizePolicy::Preferred, QSizePolicy::Maximum);
+        sizePolicy1.setHorizontalStretch(0);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(groupDatabase->sizePolicy().hasHeightForWidth());
+        groupDatabase->setSizePolicy(sizePolicy1);
+        gridLayout1 = new QGridLayout(groupDatabase);
+#ifndef Q_OS_MAC
+        gridLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        gridLayout1->setContentsMargins(9, 9, 9, 9);
+#endif
+        gridLayout1->setObjectName(QString::fromUtf8("gridLayout1"));
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        btnDbSwitchToReported = new QPushButton(groupDatabase);
+        btnDbSwitchToReported->setObjectName(QString::fromUtf8("btnDbSwitchToReported"));
+        btnDbSwitchToReported->setEnabled(false);
+
+        hboxLayout1->addWidget(btnDbSwitchToReported);
+
+        spacerItem1 = new QSpacerItem(71, 27, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem1);
+
+        btnDbConnect = new QPushButton(groupDatabase);
+        btnDbConnect->setObjectName(QString::fromUtf8("btnDbConnect"));
+
+        hboxLayout1->addWidget(btnDbConnect);
+
+
+        gridLayout1->addLayout(hboxLayout1, 3, 1, 1, 1);
+
+        comboDbType = new QComboBox(groupDatabase);
+        comboDbType->setObjectName(QString::fromUtf8("comboDbType"));
+        comboDbType->setModelColumn(0);
+
+        gridLayout1->addWidget(comboDbType, 0, 1, 1, 1);
+
+        editDbConnection = new QLineEdit(groupDatabase);
+        editDbConnection->setObjectName(QString::fromUtf8("editDbConnection"));
+
+        gridLayout1->addWidget(editDbConnection, 1, 1, 1, 1);
+
+        labelDbType = new QLabel(groupDatabase);
+        labelDbType->setObjectName(QString::fromUtf8("labelDbType"));
+
+        gridLayout1->addWidget(labelDbType, 0, 0, 1, 1);
+
+        labelDbConnection = new QLabel(groupDatabase);
+        labelDbConnection->setObjectName(QString::fromUtf8("labelDbConnection"));
+
+        gridLayout1->addWidget(labelDbConnection, 1, 0, 1, 1);
+
+        label_7 = new QLabel(groupDatabase);
+        label_7->setObjectName(QString::fromUtf8("label_7"));
+
+        gridLayout1->addWidget(label_7, 2, 0, 1, 1);
+
+        labelDbReported = new QLineEdit(groupDatabase);
+        labelDbReported->setObjectName(QString::fromUtf8("labelDbReported"));
+        labelDbReported->setReadOnly(true);
+
+        gridLayout1->addWidget(labelDbReported, 2, 1, 1, 1);
+
+
+        gridLayout->addWidget(groupDatabase, 1, 0, 1, 1);
+
+        splitter = new QSplitter(ConnectionDialog);
+        splitter->setObjectName(QString::fromUtf8("splitter"));
+        splitter->setOrientation(Qt::Horizontal);
+        groupMessaging = new QGroupBox(splitter);
+        groupMessaging->setObjectName(QString::fromUtf8("groupMessaging"));
+        QSizePolicy sizePolicy2(QSizePolicy::Expanding, QSizePolicy::Minimum);
+        sizePolicy2.setHorizontalStretch(0);
+        sizePolicy2.setVerticalStretch(0);
+        sizePolicy2.setHeightForWidth(groupMessaging->sizePolicy().hasHeightForWidth());
+        groupMessaging->setSizePolicy(sizePolicy2);
+        gridLayout2 = new QGridLayout(groupMessaging);
+#ifndef Q_OS_MAC
+        gridLayout2->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        gridLayout2->setContentsMargins(9, 9, 9, 9);
+#endif
+        gridLayout2->setObjectName(QString::fromUtf8("gridLayout2"));
+        label_4 = new QLabel(groupMessaging);
+        label_4->setObjectName(QString::fromUtf8("label_4"));
+
+        gridLayout2->addWidget(label_4, 2, 0, 1, 1);
+
+        timeoutSpinBox = new QSpinBox(groupMessaging);
+        timeoutSpinBox->setObjectName(QString::fromUtf8("timeoutSpinBox"));
+
+        gridLayout2->addWidget(timeoutSpinBox, 2, 1, 1, 1);
+
+        hboxLayout2 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout2->setSpacing(6);
+#endif
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        spacerItem2 = new QSpacerItem(40, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout2->addItem(spacerItem2);
+
+        btnConnect = new QPushButton(groupMessaging);
+        btnConnect->setObjectName(QString::fromUtf8("btnConnect"));
+
+        hboxLayout2->addWidget(btnConnect);
+
+
+        gridLayout2->addLayout(hboxLayout2, 6, 0, 1, 2);
+
+        editPrimaryGroup = new QLineEdit(groupMessaging);
+        editPrimaryGroup->setObjectName(QString::fromUtf8("editPrimaryGroup"));
+
+        gridLayout2->addWidget(editPrimaryGroup, 3, 1, 1, 1);
+
+        label_5 = new QLabel(groupMessaging);
+        label_5->setObjectName(QString::fromUtf8("label_5"));
+
+        gridLayout2->addWidget(label_5, 3, 0, 1, 1);
+
+        label_2 = new QLabel(groupMessaging);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+
+        gridLayout2->addWidget(label_2, 1, 0, 1, 1);
+
+        editServer = new QLineEdit(groupMessaging);
+        editServer->setObjectName(QString::fromUtf8("editServer"));
+
+        gridLayout2->addWidget(editServer, 1, 1, 1, 1);
+
+        editUser = new QLineEdit(groupMessaging);
+        editUser->setObjectName(QString::fromUtf8("editUser"));
+
+        gridLayout2->addWidget(editUser, 0, 1, 1, 1);
+
+        label = new QLabel(groupMessaging);
+        label->setObjectName(QString::fromUtf8("label"));
+
+        gridLayout2->addWidget(label, 0, 0, 1, 1);
+
+        verticalSpacer = new QSpacerItem(20, 40, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        gridLayout2->addItem(verticalSpacer, 5, 1, 1, 1);
+
+        label_3 = new QLabel(groupMessaging);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+
+        gridLayout2->addWidget(label_3, 4, 0, 1, 1);
+
+        horizontalLayout = new QHBoxLayout();
+        horizontalLayout->setObjectName(QString::fromUtf8("horizontalLayout"));
+        editPeerCertificate = new QLineEdit(groupMessaging);
+        editPeerCertificate->setObjectName(QString::fromUtf8("editPeerCertificate"));
+        sizePolicy2.setHeightForWidth(editPeerCertificate->sizePolicy().hasHeightForWidth());
+        editPeerCertificate->setSizePolicy(sizePolicy2);
+
+        horizontalLayout->addWidget(editPeerCertificate);
+
+        btnPeerCertificateOpen = new QToolButton(groupMessaging);
+        btnPeerCertificateOpen->setObjectName(QString::fromUtf8("btnPeerCertificateOpen"));
+
+        horizontalLayout->addWidget(btnPeerCertificateOpen);
+
+
+        gridLayout2->addLayout(horizontalLayout, 4, 1, 1, 1);
+
+        splitter->addWidget(groupMessaging);
+        groupSubscriptions = new QGroupBox(splitter);
+        groupSubscriptions->setObjectName(QString::fromUtf8("groupSubscriptions"));
+        groupSubscriptions->setEnabled(false);
+        sizePolicy2.setHeightForWidth(groupSubscriptions->sizePolicy().hasHeightForWidth());
+        groupSubscriptions->setSizePolicy(sizePolicy2);
+        vboxLayout = new QVBoxLayout(groupSubscriptions);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        listSubscriptions = new QListWidget(groupSubscriptions);
+        listSubscriptions->setObjectName(QString::fromUtf8("listSubscriptions"));
+        QSizePolicy sizePolicy3(QSizePolicy::Expanding, QSizePolicy::MinimumExpanding);
+        sizePolicy3.setHorizontalStretch(0);
+        sizePolicy3.setVerticalStretch(0);
+        sizePolicy3.setHeightForWidth(listSubscriptions->sizePolicy().hasHeightForWidth());
+        listSubscriptions->setSizePolicy(sizePolicy3);
+
+        vboxLayout->addWidget(listSubscriptions);
+
+        hboxLayout3 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout3->setSpacing(6);
+#endif
+        hboxLayout3->setContentsMargins(0, 0, 0, 0);
+        hboxLayout3->setObjectName(QString::fromUtf8("hboxLayout3"));
+        btnSelectAll = new QPushButton(groupSubscriptions);
+        btnSelectAll->setObjectName(QString::fromUtf8("btnSelectAll"));
+
+        hboxLayout3->addWidget(btnSelectAll);
+
+        spacerItem3 = new QSpacerItem(70, 30, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout3->addItem(spacerItem3);
+
+        btnDeselectAll = new QPushButton(groupSubscriptions);
+        btnDeselectAll->setObjectName(QString::fromUtf8("btnDeselectAll"));
+
+        hboxLayout3->addWidget(btnDeselectAll);
+
+
+        vboxLayout->addLayout(hboxLayout3);
+
+        splitter->addWidget(groupSubscriptions);
+
+        gridLayout->addWidget(splitter, 0, 0, 1, 1);
+
+        QWidget::setTabOrder(editUser, editServer);
+        QWidget::setTabOrder(editServer, timeoutSpinBox);
+        QWidget::setTabOrder(timeoutSpinBox, editPrimaryGroup);
+        QWidget::setTabOrder(editPrimaryGroup, btnConnect);
+        QWidget::setTabOrder(btnConnect, listSubscriptions);
+        QWidget::setTabOrder(listSubscriptions, comboDbType);
+        QWidget::setTabOrder(comboDbType, editDbConnection);
+        QWidget::setTabOrder(editDbConnection, btnDbSwitchToReported);
+        QWidget::setTabOrder(btnDbSwitchToReported, btnDbConnect);
+        QWidget::setTabOrder(btnDbConnect, btnClose);
+
+        retranslateUi(ConnectionDialog);
+        QObject::connect(btnClose, SIGNAL(clicked()), ConnectionDialog, SLOT(accept()));
+
+        QMetaObject::connectSlotsByName(ConnectionDialog);
+    } // setupUi
+
+    void retranslateUi(QDialog *ConnectionDialog)
+    {
+        ConnectionDialog->setWindowTitle(QCoreApplication::translate("ConnectionDialog", "Setup connection", nullptr));
+        btnClose->setText(QCoreApplication::translate("ConnectionDialog", "Continue", nullptr));
+        groupDatabase->setTitle(QCoreApplication::translate("ConnectionDialog", "Database", nullptr));
+        btnDbSwitchToReported->setText(QCoreApplication::translate("ConnectionDialog", "Switch to reported", nullptr));
+        btnDbConnect->setText(QCoreApplication::translate("ConnectionDialog", "Connect", nullptr));
+        labelDbType->setText(QCoreApplication::translate("ConnectionDialog", "Type:", nullptr));
+        labelDbConnection->setText(QCoreApplication::translate("ConnectionDialog", "Connection:", nullptr));
+        label_7->setText(QCoreApplication::translate("ConnectionDialog", "Reported:", nullptr));
+        groupMessaging->setTitle(QCoreApplication::translate("ConnectionDialog", "Messaging", nullptr));
+        label_4->setText(QCoreApplication::translate("ConnectionDialog", "Timeout in sec.:", nullptr));
+        btnConnect->setText(QCoreApplication::translate("ConnectionDialog", "Connect", nullptr));
+        label_5->setText(QCoreApplication::translate("ConnectionDialog", "Primary group:", nullptr));
+        label_2->setText(QCoreApplication::translate("ConnectionDialog", "Server:", nullptr));
+        editServer->setText(QCoreApplication::translate("ConnectionDialog", "localhost", nullptr));
+        editUser->setText(QCoreApplication::translate("ConnectionDialog", "user", nullptr));
+        label->setText(QCoreApplication::translate("ConnectionDialog", "User:", nullptr));
+        label_3->setText(QCoreApplication::translate("ConnectionDialog", "Peer certificate:", nullptr));
+#if QT_CONFIG(tooltip)
+        btnPeerCertificateOpen->setToolTip(QCoreApplication::translate("ConnectionDialog", "Select peer certificate file", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnPeerCertificateOpen->setText(QCoreApplication::translate("ConnectionDialog", "...", nullptr));
+        groupSubscriptions->setTitle(QCoreApplication::translate("ConnectionDialog", "Subscriptions", nullptr));
+        btnSelectAll->setText(QCoreApplication::translate("ConnectionDialog", "Select All", nullptr));
+        btnDeselectAll->setText(QCoreApplication::translate("ConnectionDialog", "Deselect All", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class ConnectionDialog: public Ui_ConnectionDialog {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_CONNECTIONDIALOG_H

include/seiscomp/gui/core/ui_diagramfilter.h

@@ -0,0 +1,265 @@
+/********************************************************************************
+** Form generated from reading UI file 'diagramfilter.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_DIAGRAMFILTER_H
+#define UI_DIAGRAMFILTER_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QComboBox>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QDoubleSpinBox>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_FilterSettings
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QHBoxLayout *hboxLayout;
+    QLabel *label;
+    QComboBox *comboFilter;
+    QFrame *line;
+    QFrame *frameNoFilter;
+    QVBoxLayout *vboxLayout1;
+    QLabel *label_7;
+    QSpacerItem *spacerItem;
+    QFrame *frameAzimuthAroundEpicenter;
+    QVBoxLayout *vboxLayout2;
+    QHBoxLayout *hboxLayout1;
+    QLabel *label_2;
+    QDoubleSpinBox *spinAzimuthCenter;
+    QLabel *label_3;
+    QSpacerItem *spacerItem1;
+    QLabel *label_4;
+    QLabel *label_6;
+    QDoubleSpinBox *spinAzimuthExtent;
+    QLabel *label_5;
+    QSpacerItem *spacerItem2;
+    QHBoxLayout *hboxLayout2;
+    QSpacerItem *spacerItem3;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *FilterSettings)
+    {
+        if (FilterSettings->objectName().isEmpty())
+            FilterSettings->setObjectName(QString::fromUtf8("FilterSettings"));
+        FilterSettings->resize(317, 132);
+        vboxLayout = new QVBoxLayout(FilterSettings);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        label = new QLabel(FilterSettings);
+        label->setObjectName(QString::fromUtf8("label"));
+        QSizePolicy sizePolicy(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(label->sizePolicy().hasHeightForWidth());
+        label->setSizePolicy(sizePolicy);
+
+        hboxLayout->addWidget(label);
+
+        comboFilter = new QComboBox(FilterSettings);
+        comboFilter->addItem(QString());
+        comboFilter->addItem(QString());
+        comboFilter->setObjectName(QString::fromUtf8("comboFilter"));
+
+        hboxLayout->addWidget(comboFilter);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        line = new QFrame(FilterSettings);
+        line->setObjectName(QString::fromUtf8("line"));
+        line->setFrameShape(QFrame::HLine);
+        line->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout->addWidget(line);
+
+        frameNoFilter = new QFrame(FilterSettings);
+        frameNoFilter->setObjectName(QString::fromUtf8("frameNoFilter"));
+        frameNoFilter->setFrameShape(QFrame::NoFrame);
+        frameNoFilter->setFrameShadow(QFrame::Raised);
+        vboxLayout1 = new QVBoxLayout(frameNoFilter);
+#ifndef Q_OS_MAC
+        vboxLayout1->setSpacing(6);
+#endif
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        label_7 = new QLabel(frameNoFilter);
+        label_7->setObjectName(QString::fromUtf8("label_7"));
+
+        vboxLayout1->addWidget(label_7);
+
+        spacerItem = new QSpacerItem(20, 40, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout1->addItem(spacerItem);
+
+
+        vboxLayout->addWidget(frameNoFilter);
+
+        frameAzimuthAroundEpicenter = new QFrame(FilterSettings);
+        frameAzimuthAroundEpicenter->setObjectName(QString::fromUtf8("frameAzimuthAroundEpicenter"));
+        frameAzimuthAroundEpicenter->setFrameShape(QFrame::NoFrame);
+        frameAzimuthAroundEpicenter->setFrameShadow(QFrame::Raised);
+        vboxLayout2 = new QVBoxLayout(frameAzimuthAroundEpicenter);
+#ifndef Q_OS_MAC
+        vboxLayout2->setSpacing(6);
+#endif
+        vboxLayout2->setContentsMargins(0, 0, 0, 0);
+        vboxLayout2->setObjectName(QString::fromUtf8("vboxLayout2"));
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        label_2 = new QLabel(frameAzimuthAroundEpicenter);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+        sizePolicy.setHeightForWidth(label_2->sizePolicy().hasHeightForWidth());
+        label_2->setSizePolicy(sizePolicy);
+
+        hboxLayout1->addWidget(label_2);
+
+        spinAzimuthCenter = new QDoubleSpinBox(frameAzimuthAroundEpicenter);
+        spinAzimuthCenter->setObjectName(QString::fromUtf8("spinAzimuthCenter"));
+        spinAzimuthCenter->setDecimals(1);
+        spinAzimuthCenter->setMaximum(360.000000000000000);
+        spinAzimuthCenter->setMinimum(-360.000000000000000);
+
+        hboxLayout1->addWidget(spinAzimuthCenter);
+
+        label_3 = new QLabel(frameAzimuthAroundEpicenter);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+        sizePolicy.setHeightForWidth(label_3->sizePolicy().hasHeightForWidth());
+        label_3->setSizePolicy(sizePolicy);
+
+        hboxLayout1->addWidget(label_3);
+
+        spacerItem1 = new QSpacerItem(10, 5, QSizePolicy::Fixed, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem1);
+
+        label_4 = new QLabel(frameAzimuthAroundEpicenter);
+        label_4->setObjectName(QString::fromUtf8("label_4"));
+        sizePolicy.setHeightForWidth(label_4->sizePolicy().hasHeightForWidth());
+        label_4->setSizePolicy(sizePolicy);
+
+        hboxLayout1->addWidget(label_4);
+
+        label_6 = new QLabel(frameAzimuthAroundEpicenter);
+        label_6->setObjectName(QString::fromUtf8("label_6"));
+        sizePolicy.setHeightForWidth(label_6->sizePolicy().hasHeightForWidth());
+        label_6->setSizePolicy(sizePolicy);
+
+        hboxLayout1->addWidget(label_6);
+
+        spinAzimuthExtent = new QDoubleSpinBox(frameAzimuthAroundEpicenter);
+        spinAzimuthExtent->setObjectName(QString::fromUtf8("spinAzimuthExtent"));
+        spinAzimuthExtent->setDecimals(1);
+        spinAzimuthExtent->setMaximum(180.000000000000000);
+        spinAzimuthExtent->setMinimum(0.000000000000000);
+        spinAzimuthExtent->setValue(45.000000000000000);
+
+        hboxLayout1->addWidget(spinAzimuthExtent);
+
+        label_5 = new QLabel(frameAzimuthAroundEpicenter);
+        label_5->setObjectName(QString::fromUtf8("label_5"));
+        sizePolicy.setHeightForWidth(label_5->sizePolicy().hasHeightForWidth());
+        label_5->setSizePolicy(sizePolicy);
+
+        hboxLayout1->addWidget(label_5);
+
+
+        vboxLayout2->addLayout(hboxLayout1);
+
+        spacerItem2 = new QSpacerItem(20, 40, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout2->addItem(spacerItem2);
+
+
+        vboxLayout->addWidget(frameAzimuthAroundEpicenter);
+
+        hboxLayout2 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout2->setSpacing(6);
+#endif
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        spacerItem3 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout2->addItem(spacerItem3);
+
+        okButton = new QPushButton(FilterSettings);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout2->addWidget(okButton);
+
+        cancelButton = new QPushButton(FilterSettings);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout2->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout2);
+
+
+        retranslateUi(FilterSettings);
+        QObject::connect(okButton, SIGNAL(clicked()), FilterSettings, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), FilterSettings, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(FilterSettings);
+    } // setupUi
+
+    void retranslateUi(QDialog *FilterSettings)
+    {
+        FilterSettings->setWindowTitle(QCoreApplication::translate("FilterSettings", "Filter settings", nullptr));
+        label->setText(QCoreApplication::translate("FilterSettings", "Filter:", nullptr));
+        comboFilter->setItemText(0, QCoreApplication::translate("FilterSettings", "None", nullptr));
+        comboFilter->setItemText(1, QCoreApplication::translate("FilterSettings", "Azimuth around epicenter", nullptr));
+
+        label_7->setText(QCoreApplication::translate("FilterSettings", "No filter. Displays all values.", nullptr));
+        label_2->setText(QCoreApplication::translate("FilterSettings", "Center:", nullptr));
+        label_3->setText(QCoreApplication::translate("FilterSettings", "deg", nullptr));
+        label_4->setText(QCoreApplication::translate("FilterSettings", "Extent:", nullptr));
+        label_6->setText(QCoreApplication::translate("FilterSettings", "+/-", nullptr));
+        label_5->setText(QCoreApplication::translate("FilterSettings", "deg", nullptr));
+        okButton->setText(QCoreApplication::translate("FilterSettings", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("FilterSettings", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class FilterSettings: public Ui_FilterSettings {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_DIAGRAMFILTER_H

include/seiscomp/gui/core/ui_infotext.h

@@ -0,0 +1,86 @@
+/********************************************************************************
+** Form generated from reading UI file 'infotext.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_INFOTEXT_H
+#define UI_INFOTEXT_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTextEdit>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_InfoText
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QTextEdit *textEdit;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem;
+    QPushButton *closeButton;
+
+    void setupUi(QDialog *InfoText)
+    {
+        if (InfoText->objectName().isEmpty())
+            InfoText->setObjectName(QString::fromUtf8("InfoText"));
+        InfoText->resize(319, 336);
+        vboxLayout = new QVBoxLayout(InfoText);
+        vboxLayout->setSpacing(4);
+        vboxLayout->setContentsMargins(6, 6, 6, 6);
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        textEdit = new QTextEdit(InfoText);
+        textEdit->setObjectName(QString::fromUtf8("textEdit"));
+        textEdit->setReadOnly(true);
+
+        vboxLayout->addWidget(textEdit);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem);
+
+        closeButton = new QPushButton(InfoText);
+        closeButton->setObjectName(QString::fromUtf8("closeButton"));
+
+        hboxLayout->addWidget(closeButton);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+
+        retranslateUi(InfoText);
+        QObject::connect(closeButton, SIGNAL(clicked()), InfoText, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(InfoText);
+    } // setupUi
+
+    void retranslateUi(QDialog *InfoText)
+    {
+        InfoText->setWindowTitle(QCoreApplication::translate("InfoText", "Information", nullptr));
+        closeButton->setText(QCoreApplication::translate("InfoText", "Close", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class InfoText: public Ui_InfoText {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_INFOTEXT_H

include/seiscomp/gui/core/ui_inspector.h

@@ -0,0 +1,102 @@
+/********************************************************************************
+** Form generated from reading UI file 'inspector.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_INSPECTOR_H
+#define UI_INSPECTOR_H
+
+#include <QtCore/QVariant>
+#include <QtGui/QIcon>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QHeaderView>
+#include <QtWidgets/QLineEdit>
+#include <QtWidgets/QSplitter>
+#include <QtWidgets/QTableWidget>
+#include <QtWidgets/QToolButton>
+#include <QtWidgets/QTreeWidget>
+#include <QtWidgets/QVBoxLayout>
+#include <QtWidgets/QWidget>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_Inspector
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QToolButton *buttonBack;
+    QLineEdit *editFilter;
+    QSplitter *splitter;
+    QTreeWidget *treeWidget;
+    QTableWidget *tableWidget;
+
+    void setupUi(QWidget *Inspector)
+    {
+        if (Inspector->objectName().isEmpty())
+            Inspector->setObjectName(QString::fromUtf8("Inspector"));
+        Inspector->resize(657, 498);
+        vboxLayout = new QVBoxLayout(Inspector);
+        vboxLayout->setSpacing(4);
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        buttonBack = new QToolButton(Inspector);
+        buttonBack->setObjectName(QString::fromUtf8("buttonBack"));
+        buttonBack->setEnabled(false);
+        const QIcon icon = QIcon(QString::fromUtf8(":/icons/icons/undo.png"));
+        buttonBack->setIcon(icon);
+
+        vboxLayout->addWidget(buttonBack);
+
+        editFilter = new QLineEdit(Inspector);
+        editFilter->setObjectName(QString::fromUtf8("editFilter"));
+
+        vboxLayout->addWidget(editFilter);
+
+        splitter = new QSplitter(Inspector);
+        splitter->setObjectName(QString::fromUtf8("splitter"));
+        splitter->setOrientation(Qt::Horizontal);
+        treeWidget = new QTreeWidget(splitter);
+        treeWidget->setObjectName(QString::fromUtf8("treeWidget"));
+        splitter->addWidget(treeWidget);
+        tableWidget = new QTableWidget(splitter);
+        tableWidget->setObjectName(QString::fromUtf8("tableWidget"));
+        tableWidget->setAlternatingRowColors(true);
+        splitter->addWidget(tableWidget);
+
+        vboxLayout->addWidget(splitter);
+
+
+        retranslateUi(Inspector);
+
+        QMetaObject::connectSlotsByName(Inspector);
+    } // setupUi
+
+    void retranslateUi(QWidget *Inspector)
+    {
+        Inspector->setWindowTitle(QCoreApplication::translate("Inspector", "Inspector", nullptr));
+#if QT_CONFIG(tooltip)
+        buttonBack->setToolTip(QString());
+#endif // QT_CONFIG(tooltip)
+        buttonBack->setText(QCoreApplication::translate("Inspector", "...", nullptr));
+#if QT_CONFIG(shortcut)
+        buttonBack->setShortcut(QCoreApplication::translate("Inspector", "Backspace", nullptr));
+#endif // QT_CONFIG(shortcut)
+#if QT_CONFIG(tooltip)
+        editFilter->setToolTip(QCoreApplication::translate("Inspector", "Define an object filter, e.g. 'Network.code=GE'. Wildcards are allowed to match a value.", nullptr));
+#endif // QT_CONFIG(tooltip)
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class Inspector: public Ui_Inspector {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_INSPECTOR_H

include/seiscomp/gui/core/ui_questionbox.h

@@ -0,0 +1,194 @@
+/********************************************************************************
+** Form generated from reading UI file 'questionbox.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_QUESTIONBOX_H
+#define UI_QUESTIONBOX_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QCheckBox>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_QuestionBox
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QHBoxLayout *hboxLayout;
+    QVBoxLayout *vboxLayout1;
+    QLabel *labelIcon;
+    QSpacerItem *spacerItem;
+    QVBoxLayout *vboxLayout2;
+    QLabel *labelMessage;
+    QLabel *labelInfo;
+    QSpacerItem *spacerItem1;
+    QVBoxLayout *vboxLayout3;
+    QCheckBox *checkBox;
+    QHBoxLayout *hboxLayout1;
+    QPushButton *yesButton;
+    QSpacerItem *spacerItem2;
+    QPushButton *noButton;
+
+    void setupUi(QDialog *QuestionBox)
+    {
+        if (QuestionBox->objectName().isEmpty())
+            QuestionBox->setObjectName(QString::fromUtf8("QuestionBox"));
+        QuestionBox->resize(231, 131);
+        QSizePolicy sizePolicy(QSizePolicy::Preferred, QSizePolicy::Maximum);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(QuestionBox->sizePolicy().hasHeightForWidth());
+        QuestionBox->setSizePolicy(sizePolicy);
+        QuestionBox->setSizeGripEnabled(false);
+        QuestionBox->setModal(true);
+        vboxLayout = new QVBoxLayout(QuestionBox);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        vboxLayout1 = new QVBoxLayout();
+#ifndef Q_OS_MAC
+        vboxLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+#endif
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        labelIcon = new QLabel(QuestionBox);
+        labelIcon->setObjectName(QString::fromUtf8("labelIcon"));
+        QSizePolicy sizePolicy1(QSizePolicy::Maximum, QSizePolicy::Maximum);
+        sizePolicy1.setHorizontalStretch(0);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(labelIcon->sizePolicy().hasHeightForWidth());
+        labelIcon->setSizePolicy(sizePolicy1);
+        labelIcon->setFrameShape(QFrame::NoFrame);
+
+        vboxLayout1->addWidget(labelIcon);
+
+        spacerItem = new QSpacerItem(0, 0, QSizePolicy::Minimum, QSizePolicy::Minimum);
+
+        vboxLayout1->addItem(spacerItem);
+
+
+        hboxLayout->addLayout(vboxLayout1);
+
+        vboxLayout2 = new QVBoxLayout();
+#ifndef Q_OS_MAC
+        vboxLayout2->setSpacing(6);
+#endif
+        vboxLayout2->setContentsMargins(0, 0, 0, 0);
+        vboxLayout2->setObjectName(QString::fromUtf8("vboxLayout2"));
+        labelMessage = new QLabel(QuestionBox);
+        labelMessage->setObjectName(QString::fromUtf8("labelMessage"));
+        sizePolicy.setHeightForWidth(labelMessage->sizePolicy().hasHeightForWidth());
+        labelMessage->setSizePolicy(sizePolicy);
+        labelMessage->setFrameShape(QFrame::NoFrame);
+
+        vboxLayout2->addWidget(labelMessage);
+
+        labelInfo = new QLabel(QuestionBox);
+        labelInfo->setObjectName(QString::fromUtf8("labelInfo"));
+        sizePolicy.setHeightForWidth(labelInfo->sizePolicy().hasHeightForWidth());
+        labelInfo->setSizePolicy(sizePolicy);
+        labelInfo->setMinimumSize(QSize(0, 0));
+        labelInfo->setFrameShape(QFrame::NoFrame);
+
+        vboxLayout2->addWidget(labelInfo);
+
+
+        hboxLayout->addLayout(vboxLayout2);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        spacerItem1 = new QSpacerItem(20, 10, QSizePolicy::Minimum, QSizePolicy::Maximum);
+
+        vboxLayout->addItem(spacerItem1);
+
+        vboxLayout3 = new QVBoxLayout();
+#ifndef Q_OS_MAC
+        vboxLayout3->setSpacing(6);
+#endif
+        vboxLayout3->setContentsMargins(0, 0, 0, 0);
+        vboxLayout3->setObjectName(QString::fromUtf8("vboxLayout3"));
+        checkBox = new QCheckBox(QuestionBox);
+        checkBox->setObjectName(QString::fromUtf8("checkBox"));
+
+        vboxLayout3->addWidget(checkBox);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        yesButton = new QPushButton(QuestionBox);
+        yesButton->setObjectName(QString::fromUtf8("yesButton"));
+
+        hboxLayout1->addWidget(yesButton);
+
+        spacerItem2 = new QSpacerItem(54, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem2);
+
+        noButton = new QPushButton(QuestionBox);
+        noButton->setObjectName(QString::fromUtf8("noButton"));
+
+        hboxLayout1->addWidget(noButton);
+
+
+        vboxLayout3->addLayout(hboxLayout1);
+
+
+        vboxLayout->addLayout(vboxLayout3);
+
+
+        retranslateUi(QuestionBox);
+        QObject::connect(yesButton, SIGNAL(clicked()), QuestionBox, SLOT(accept()));
+        QObject::connect(noButton, SIGNAL(clicked()), QuestionBox, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(QuestionBox);
+    } // setupUi
+
+    void retranslateUi(QDialog *QuestionBox)
+    {
+        QuestionBox->setWindowTitle(QCoreApplication::translate("QuestionBox", "Question", nullptr));
+        labelIcon->setText(QString());
+        labelMessage->setText(QString());
+        labelInfo->setText(QString());
+        checkBox->setText(QCoreApplication::translate("QuestionBox", "Do not show this message again", nullptr));
+        yesButton->setText(QCoreApplication::translate("QuestionBox", "Yes", nullptr));
+        noButton->setText(QCoreApplication::translate("QuestionBox", "No", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class QuestionBox: public Ui_QuestionBox {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_QUESTIONBOX_H

include/seiscomp/gui/core/ui_showplugins.h

@@ -0,0 +1,99 @@
+/********************************************************************************
+** Form generated from reading UI file 'showplugins.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_SHOWPLUGINS_H
+#define UI_SHOWPLUGINS_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTextEdit>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_ShowPlugins
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QLabel *labelHeadline;
+    QTextEdit *content;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem;
+    QPushButton *closeButton;
+
+    void setupUi(QDialog *ShowPlugins)
+    {
+        if (ShowPlugins->objectName().isEmpty())
+            ShowPlugins->setObjectName(QString::fromUtf8("ShowPlugins"));
+        ShowPlugins->resize(492, 326);
+        vboxLayout = new QVBoxLayout(ShowPlugins);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        labelHeadline = new QLabel(ShowPlugins);
+        labelHeadline->setObjectName(QString::fromUtf8("labelHeadline"));
+
+        vboxLayout->addWidget(labelHeadline);
+
+        content = new QTextEdit(ShowPlugins);
+        content->setObjectName(QString::fromUtf8("content"));
+        content->setReadOnly(true);
+
+        vboxLayout->addWidget(content);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem);
+
+        closeButton = new QPushButton(ShowPlugins);
+        closeButton->setObjectName(QString::fromUtf8("closeButton"));
+
+        hboxLayout->addWidget(closeButton);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+
+        retranslateUi(ShowPlugins);
+        QObject::connect(closeButton, SIGNAL(clicked()), ShowPlugins, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(ShowPlugins);
+    } // setupUi
+
+    void retranslateUi(QDialog *ShowPlugins)
+    {
+        ShowPlugins->setWindowTitle(QCoreApplication::translate("ShowPlugins", "Loaded Plugins", nullptr));
+        labelHeadline->setText(QCoreApplication::translate("ShowPlugins", "TextLabel", nullptr));
+        content->setHtml(QCoreApplication::translate("ShowPlugins", "<html><head><meta name=\"qrichtext\" content=\"1\" /></head><body style=\" white-space: pre-wrap; font-family:DejaVu Sans; font-size:9pt; font-weight:400; font-style:normal; text-decoration:none;\"><p style=\"-qt-paragraph-type:empty; margin-top:0px; margin-bottom:0px; margin-left:0px; margin-right:0px; -qt-block-indent:0; text-indent:0px;\"></p></body></html>", nullptr));
+        closeButton->setText(QCoreApplication::translate("ShowPlugins", "Close", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class ShowPlugins: public Ui_ShowPlugins {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_SHOWPLUGINS_H

include/seiscomp/gui/core/ui_uncertainties.h

@@ -0,0 +1,157 @@
+/********************************************************************************
+** Form generated from reading UI file 'uncertainties.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_UNCERTAINTIES_H
+#define UI_UNCERTAINTIES_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QCheckBox>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QDoubleSpinBox>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_Uncertainties
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QCheckBox *cbAsymmetric;
+    QFrame *line;
+    QGridLayout *gridLayout;
+    QDoubleSpinBox *spinLowerUncertainty;
+    QLabel *labelUpperUncertainty;
+    QDoubleSpinBox *spinUpperUncertainty;
+    QLabel *labelLowerUncertainty;
+    QSpacerItem *spacerItem;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem1;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *Uncertainties)
+    {
+        if (Uncertainties->objectName().isEmpty())
+            Uncertainties->setObjectName(QString::fromUtf8("Uncertainties"));
+        Uncertainties->resize(212, 151);
+        vboxLayout = new QVBoxLayout(Uncertainties);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        cbAsymmetric = new QCheckBox(Uncertainties);
+        cbAsymmetric->setObjectName(QString::fromUtf8("cbAsymmetric"));
+
+        vboxLayout->addWidget(cbAsymmetric);
+
+        line = new QFrame(Uncertainties);
+        line->setObjectName(QString::fromUtf8("line"));
+        line->setFrameShape(QFrame::HLine);
+        line->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout->addWidget(line);
+
+        gridLayout = new QGridLayout();
+#ifndef Q_OS_MAC
+        gridLayout->setSpacing(6);
+#endif
+        gridLayout->setContentsMargins(0, 0, 0, 0);
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        spinLowerUncertainty = new QDoubleSpinBox(Uncertainties);
+        spinLowerUncertainty->setObjectName(QString::fromUtf8("spinLowerUncertainty"));
+        spinLowerUncertainty->setDecimals(4);
+        spinLowerUncertainty->setSingleStep(0.500000000000000);
+
+        gridLayout->addWidget(spinLowerUncertainty, 0, 1, 1, 1);
+
+        labelUpperUncertainty = new QLabel(Uncertainties);
+        labelUpperUncertainty->setObjectName(QString::fromUtf8("labelUpperUncertainty"));
+        labelUpperUncertainty->setEnabled(false);
+
+        gridLayout->addWidget(labelUpperUncertainty, 1, 0, 1, 1);
+
+        spinUpperUncertainty = new QDoubleSpinBox(Uncertainties);
+        spinUpperUncertainty->setObjectName(QString::fromUtf8("spinUpperUncertainty"));
+        spinUpperUncertainty->setEnabled(false);
+        spinUpperUncertainty->setDecimals(4);
+        spinUpperUncertainty->setSingleStep(0.500000000000000);
+
+        gridLayout->addWidget(spinUpperUncertainty, 1, 1, 1, 1);
+
+        labelLowerUncertainty = new QLabel(Uncertainties);
+        labelLowerUncertainty->setObjectName(QString::fromUtf8("labelLowerUncertainty"));
+
+        gridLayout->addWidget(labelLowerUncertainty, 0, 0, 1, 1);
+
+
+        vboxLayout->addLayout(gridLayout);
+
+        spacerItem = new QSpacerItem(20, 40, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout->addItem(spacerItem);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem1 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem1);
+
+        okButton = new QPushButton(Uncertainties);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout->addWidget(okButton);
+
+        cancelButton = new QPushButton(Uncertainties);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+
+        retranslateUi(Uncertainties);
+        QObject::connect(okButton, SIGNAL(clicked()), Uncertainties, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), Uncertainties, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(Uncertainties);
+    } // setupUi
+
+    void retranslateUi(QDialog *Uncertainties)
+    {
+        Uncertainties->setWindowTitle(QCoreApplication::translate("Uncertainties", "Uncertainty", nullptr));
+        cbAsymmetric->setText(QCoreApplication::translate("Uncertainties", "Asymmetric uncertainty", nullptr));
+        labelUpperUncertainty->setText(QCoreApplication::translate("Uncertainties", "Upper uncertainty:", nullptr));
+        labelLowerUncertainty->setText(QCoreApplication::translate("Uncertainties", "Lower uncertainty:", nullptr));
+        okButton->setText(QCoreApplication::translate("Uncertainties", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("Uncertainties", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class Uncertainties: public Ui_Uncertainties {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_UNCERTAINTIES_H

include/seiscomp/gui/core/ui_xmlview.h

@@ -0,0 +1,66 @@
+/********************************************************************************
+** Form generated from reading UI file 'xmlview.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_XMLVIEW_H
+#define UI_XMLVIEW_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QHeaderView>
+#include <QtWidgets/QTreeWidget>
+#include <QtWidgets/QWidget>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_XMLViewDialog
+{
+public:
+    QGridLayout *gridLayout;
+    QTreeWidget *treeWidget;
+
+    void setupUi(QWidget *XMLViewDialog)
+    {
+        if (XMLViewDialog->objectName().isEmpty())
+            XMLViewDialog->setObjectName(QString::fromUtf8("XMLViewDialog"));
+        XMLViewDialog->resize(336, 330);
+        gridLayout = new QGridLayout(XMLViewDialog);
+#ifndef Q_OS_MAC
+        gridLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        gridLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        treeWidget = new QTreeWidget(XMLViewDialog);
+        treeWidget->setObjectName(QString::fromUtf8("treeWidget"));
+        treeWidget->setAlternatingRowColors(true);
+        treeWidget->setIndentation(10);
+
+        gridLayout->addWidget(treeWidget, 0, 0, 1, 1);
+
+
+        retranslateUi(XMLViewDialog);
+
+        QMetaObject::connectSlotsByName(XMLViewDialog);
+    } // setupUi
+
+    void retranslateUi(QWidget *XMLViewDialog)
+    {
+        XMLViewDialog->setWindowTitle(QCoreApplication::translate("XMLViewDialog", "XMLView", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class XMLViewDialog: public Ui_XMLViewDialog {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_XMLVIEW_H

include/seiscomp/gui/core/uncertainties.h

@@ -0,0 +1,66 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_CORE_UNCERTAINTIES_H
+#define SEISCOMP_GUI_CORE_UNCERTAINTIES_H
+
+#include <QDialog>
+
+#include <seiscomp/gui/core/ui_uncertainties.h>
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API EditUncertainties : public QDialog {
+	Q_OBJECT
+
+	public:
+		EditUncertainties(QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~EditUncertainties();
+
+		void setUncertainties(double lower, double upper);
+
+		double lowerUncertainty() const;
+		double upperUncertainty() const;
+
+
+	signals:
+		void uncertaintiesChanged(double, double);
+
+
+	private slots:
+		void lowerChanged(double);
+		void upperChanged(double);
+
+		void symmetryChanged(bool);
+
+
+	private:
+		Ui::Uncertainties _ui;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/core/utils.h

@@ -0,0 +1,97 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_UTIL_H
+#define SEISCOMP_GUI_UTIL_H
+
+
+#include <seiscomp/gui/qt.h>
+#include <seiscomp/core/datetime.h>
+#include <seiscomp/core/defs.h>
+#include <QWidget>
+#include <vector>
+
+
+class QLabel;
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+SC_GUI_API extern QChar degrees;
+
+SC_GUI_API extern std::string colorConvertError;
+
+SC_GUI_API bool fromString(QColor &value, const std::string &str);
+SC_GUI_API QColor readColor(const std::string &query, const std::string &str,
+                            const QColor &base, bool *ok = nullptr);
+
+SC_GUI_API Qt::PenStyle stringToPenStyle(const std::string &str);
+SC_GUI_API Qt::PenStyle readPenStyle(const std::string &query, const std::string &str,
+                                     Qt::PenStyle base, bool *ok = nullptr);
+
+SC_GUI_API Qt::BrushStyle stringToBrushStyle(const std::string &str);
+SC_GUI_API Qt::BrushStyle readBrushStyle(const std::string &query, const std::string &str,
+                                         Qt::BrushStyle base, bool *ok = nullptr);
+
+SC_GUI_API QString latitudeToString(double lat, bool withValue = true, bool withUnit = true, int precision = 2);
+SC_GUI_API QString longitudeToString(double lon, bool withValue = true, bool withUnit = true, int precision = 2);
+SC_GUI_API QString depthToString(double depth, int precision = 0);
+SC_GUI_API QString timeToString(const Core::Time &t, const char *fmt, bool addTimeZone = false);
+SC_GUI_API void timeToLabel(QLabel *label, const Core::Time &t, const char *fmt, bool addTimeZone = false);
+SC_GUI_API QString elapsedTimeString(const Core::TimeSpan &dt);
+
+SC_GUI_API void setMaxWidth(QWidget *w, int numCharacters);
+SC_GUI_API void fixWidth(QWidget *w, int numCharacters);
+
+SC_GUI_API void setBold(QWidget *w, bool bold = true);
+SC_GUI_API void setItalic(QWidget *w, bool italic = true);
+
+
+class SC_GUI_API ElideFadeDrawer : public QObject {
+	public:
+		ElideFadeDrawer(QObject *parent = 0);
+
+	protected:
+		bool eventFilter(QObject *obj, QEvent *event);
+};
+
+
+class SC_GUI_API EllipsisDrawer : public QObject {
+	public:
+		EllipsisDrawer(QObject *parent = 0);
+
+	protected:
+		bool eventFilter(QObject *obj, QEvent *event);
+};
+
+
+template <typename T>
+class ObjectChangeList : public std::vector<std::pair<typename Core::SmartPointer<T>::Impl, bool> > {
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/core/xmlview.h

@@ -0,0 +1,51 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_CORE_XMLVIEW_H
+#define SEISCOMP_GUI_CORE_XMLVIEW_H
+
+#include <QtGui>
+
+#include <seiscomp/gui/core/ui_xmlview.h>
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API XMLView : public QWidget {
+	Q_OBJECT
+	public:
+		XMLView(QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags(),
+		        bool deleteOnClose = true);
+		~XMLView();
+
+		void setContent(const QString& content);
+
+	private:
+		Ui::XMLViewDialog _ui;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/datamodel/amplitudeview.h

@@ -0,0 +1,485 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_AMPLITUDEVIEW_H
+#define SEISCOMP_GUI_AMPLITUDEVIEW_H
+
+#include <seiscomp/gui/datamodel/ui_amplitudeview.h>
+#include <seiscomp/gui/core/recordview.h>
+#include <seiscomp/gui/core/connectionstatelabel.h>
+#include <seiscomp/gui/core/utils.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/seismology/ttt.h>
+#include <seiscomp/datamodel/databasequery.h>
+#include <seiscomp/datamodel/origin.h>
+#include <seiscomp/datamodel/magnitude.h>
+#include <seiscomp/datamodel/pick.h>
+#include <seiscomp/datamodel/amplitude.h>
+#include <seiscomp/processing/amplitudeprocessor.h>
+#include <seiscomp/processing/magnitudeprocessor.h>
+#include <seiscomp/math/matrix3.h>
+#endif
+
+#include <QActionGroup>
+#include <QComboBox>
+#include <QSpinBox>
+#include <QCheckBox>
+#include <QMovie>
+#include <QSet>
+#include <QLabel>
+#include <QLineEdit>
+
+
+namespace Seiscomp {
+
+namespace DataModel {
+
+class SensorLocation;
+
+}
+
+namespace Gui {
+
+class TimeScale;
+class AmplitudeView;
+
+
+namespace PrivateAmplitudeView {
+
+class AmplitudeRecordLabel;
+
+class SC_GUI_API ThreeComponentTrace : public QObject {
+	Q_OBJECT
+
+	public:
+		ThreeComponentTrace() = default;
+		~ThreeComponentTrace();
+
+	public:
+		void setTransformationEnabled(bool);
+		void showProcessedData(bool);
+		void setRecordWidget(RecordWidget *);
+		void setFilter(RecordWidget::Filter *, const std::string &filterID);
+		bool transform(int comp = -1, Record *rec = nullptr);
+
+		bool setProcessedData(int comp,
+		                      const std::string &networkCode,
+		                      const std::string &stationCode,
+		                      const std::string &locationCode,
+		                      const Core::Time &startTime,
+		                      double samplingFrequency,
+		                      DoubleArrayPtr data);
+		void removeProcessedData(int comp);
+
+	private slots:
+		void widgetDestroyed(QObject *obj);
+
+	private:
+		void transformedRecord(int comp, const Record *rec);
+
+	public:
+		// One component
+		struct Component {
+			std::string           channelCode;
+			int                   recordSlot;
+			RecordSequence       *raw{nullptr};
+			RecordSequence       *transformed{nullptr};
+			RecordSequence       *processed{nullptr};
+			RecordWidget::Filter *filter{nullptr};
+			RecordStreamThread   *thread{nullptr};
+		};
+
+		AmplitudeRecordLabel *label;
+		Math::Matrix3d        transformation;
+		Component             traces[3];
+		std::string           filterID;
+		RecordWidget         *widget{nullptr};
+		bool                  enableTransformation{false};
+		bool                  showProcessed{false};
+};
+
+
+class SC_GUI_API AmplitudeRecordLabel : public StandardRecordLabel {
+	Q_OBJECT
+
+	public:
+		AmplitudeRecordLabel(int items=3, QWidget *parent=0, const char* name = 0);
+		~AmplitudeRecordLabel();
+
+	public:
+		void setControlledItem(RecordViewItem *controlledItem);
+		RecordViewItem *controlledItem() const;
+
+		void setLinkedItem(bool sm);
+
+		void enabledExpandButton(RecordViewItem *controlledItem);
+		void disableExpandButton();
+		void unlink();
+
+		bool isLinkedItem() const;
+		bool isExpanded() const;
+
+		void setLabelColor(QColor);
+		void removeLabelColor();
+
+		void updateProcessingInfo();
+
+	protected:
+		void visibilityChanged(bool);
+		void resizeEvent(QResizeEvent *e);
+		void paintEvent(QPaintEvent *e);
+
+	public slots:
+		void extentButtonPressed();
+
+	private slots:
+		void enableExpandable(const Seiscomp::Record*);
+
+	private:
+		bool            _isLinkedItem;
+		bool            _isExpanded;
+		QPushButton    *_btnExpand;
+		RecordViewItem *_linkedItem;
+		bool            _hasLabelColor;
+		QColor          _labelColor;
+
+	public:
+		double                                  latitude;
+		double                                  longitude;
+		const DataModel::SensorLocation        *location;
+
+		Core::TimeWindow                        timeWindow;
+		ThreeComponentTrace                     data;
+
+		Math::Matrix3f                          orientationZNE;
+		Math::Matrix3f                          orientationZRT;
+
+		Processing::AmplitudeProcessorPtr       processor;
+		Processing::MagnitudeProcessorPtr       magnitudeProcessor;
+
+		Processing::AmplitudeProcessor::Config  initialAmpConfig;
+
+		double                                  initialMinSNR;
+
+		QString                                 infoText;
+		bool                                    isError;
+
+		bool                                    hasGotData;
+		bool                                    isEnabledByConfig;
+
+	friend class Gui::AmplitudeView;
+};
+
+
+}
+
+
+class AmplitudeViewPrivate;
+
+
+class SC_GUI_API AmplitudeView : public QMainWindow {
+	public:
+		struct SC_GUI_API Config {
+			typedef QPair<QString, QString> FilterEntry;
+			typedef QVector<FilterEntry> FilterList;
+			typedef QList<QString> StringList;
+
+			QString recordURL;
+			FilterList filters;
+
+			bool   showAllComponents;
+			bool   loadStrongMotionData;
+			double allComponentsMaximumStationDistance;
+			double defaultAddStationsDistance;
+
+			bool ignoreDisabledStations;
+			bool hideStationsWithoutData;
+
+			QColor timingQualityLow;
+			QColor timingQualityMedium;
+			QColor timingQualityHigh;
+
+			Core::TimeSpan preOffset;
+			Core::TimeSpan postOffset;
+
+			Config();
+
+			void addFilter(const QString &f, const QString &n) {
+				filters.push_back(QPair<QString, QString>(f, n));
+			}
+		};
+
+
+	Q_OBJECT
+
+	public:
+		//! Default c'tor
+		AmplitudeView(QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~AmplitudeView();
+
+	public:
+		bool setConfig(const Config &c, QString *error = nullptr);
+
+		void setDatabase(Seiscomp::DataModel::DatabaseQuery*);
+
+		//! Sets an origin and inserts the traces for each arrival
+		//! in the view.
+		bool setOrigin(Seiscomp::DataModel::Origin*, const std::string &magType);
+
+		bool hasModifiedAmplitudes() const;
+		void getChangedAmplitudes(ObjectChangeList<DataModel::Amplitude> &list) const;
+
+		void stop();
+
+		void selectTrace(const Seiscomp::DataModel::WaveformStreamID &wid);
+		void selectTrace(const std::string &code);
+
+		const std::string &currentMagnitudeType() const;
+
+		void setStrongMotionCodes(const std::vector<std::string> &codes);
+
+
+	public slots:
+		void setDefaultDisplay();
+		void applyAmplitudes();
+		void changeFilter(int);
+		void setArrivalState(int arrivalId, bool state);
+
+		void setStationEnabled(const std::string& networkCode,
+		                       const std::string& stationCode,
+		                       bool state);
+
+		void setCurrentStation(const std::string& networkCode,
+		                       const std::string& stationCode);
+
+
+	signals:
+		void magnitudeCreated(Seiscomp::DataModel::Magnitude*);
+		void amplitudesConfirmed(Seiscomp::DataModel::Origin*, QList<Seiscomp::DataModel::AmplitudePtr>);
+
+
+	private slots:
+		void receivedRecord(Seiscomp::Record*);
+
+		void updateTraceInfo(RecordViewItem*, const Seiscomp::Record*);
+		void onAddedItem(const Seiscomp::Record*, Seiscomp::Gui::RecordViewItem*);
+		void onSelectedTime(Seiscomp::Core::Time);
+		void onSelectedTimeRange(Seiscomp::Core::Time, Seiscomp::Core::Time);
+		void onChangingTimeRange(Seiscomp::Core::Time, Seiscomp::Core::Time);
+		void onSelectedTime(Seiscomp::Gui::RecordWidget*, Seiscomp::Core::Time);
+		void setAlignment(Seiscomp::Core::Time);
+		void acquisitionFinished();
+		void commit();
+		void itemSelected(RecordViewItem*, RecordViewItem*);
+		void updateMainCursor(RecordWidget*,int);
+		void updateSubCursor(RecordWidget*,int);
+		void updateItemLabel(RecordViewItem*, char);
+		void updateItemRecordState(const Seiscomp::Record*);
+		void updateRecordValue(Seiscomp::Core::Time);
+		void showTraceScaleToggled(bool);
+		void showTheoreticalArrivals(bool);
+		void resetScale();
+		void resetDefaultTimeWindows();
+
+		void limitFilterToZoomTrace(bool);
+
+		void toggleFilter();
+		void addNewFilter(const QString&);
+
+		void scaleVisibleAmplitudes();
+
+		void changeScale(double, double);
+		void changeTimeRange(double, double);
+
+		void sortAlphabetically();
+		void sortByDistance();
+
+		void showZComponent();
+		void showNComponent();
+		void showEComponent();
+
+		void alignOnOriginTime();
+		void alignOnPArrivals();
+
+		void pickNone(bool);
+		void pickAmplitudes(bool);
+
+		void scaleAmplUp();
+		void scaleAmplDown();
+		void scaleTimeUp();
+		void scaleTimeDown();
+
+		void scaleReset();
+
+		void scrollLeft();
+		void scrollFineLeft();
+		void scrollRight();
+		void scrollFineRight();
+
+		void createAmplitude();
+		void setAmplitude();
+		void confirmAmplitude();
+		void deleteAmplitude();
+
+		void setCurrentRowEnabled(bool);
+		void setCurrentRowDisabled(bool);
+
+		void loadNextStations();
+		void showUsedStations(bool);
+
+		void moveTraces(double offset);
+		void move(double offset);
+		void zoom(float factor);
+		void applyTimeRange(double,double);
+
+		void sortByState();
+		void alignByState();
+		void componentByState();
+		void updateLayoutFromState();
+
+		void firstConnectionEstablished();
+		void lastConnectionClosed();
+
+		void beginWaitForRecords();
+		void doWaitForRecords(int value);
+		void endWaitForRecords();
+
+		void showFullscreen(bool);
+
+		void recalculateAmplitude();
+		void recalculateAmplitudes();
+
+		void enableAutoScale();
+		void disableAutoScale();
+
+		void zoomSelectionHandleMoved(int,double,Qt::KeyboardModifiers);
+		void zoomSelectionHandleMoveFinished();
+
+		void selectionHandleMoved(int,double,Qt::KeyboardModifiers);
+		void selectionHandleMoveFinished();
+
+		void addStations();
+
+		void searchStation();
+		void search(const QString&);
+		void nextSearch();
+		void abortSearchStation();
+
+		void openConnectionInfo(const QPoint &);
+
+		void ttInterfaceChanged(QString);
+		void ttTableChanged(QString);
+
+
+	protected:
+		void showEvent(QShowEvent* event);
+
+		RecordLabel* createLabel(RecordViewItem*) const;
+
+
+	private:
+		void figureOutTravelTimeTable();
+
+		void init();
+
+		RecordViewItem* addStream(const DataModel::SensorLocation *,
+		                          const DataModel::WaveformStreamID& streamID,
+		                          const Core::Time &referenceTime,
+		                          bool showDisabled);
+
+		RecordViewItem* addRawStream(const DataModel::SensorLocation *,
+		                             const DataModel::WaveformStreamID& streamID,
+		                             const Core::Time &referenceTime);
+
+		void queueStream(const DataModel::WaveformStreamID& streamID, int component);
+
+		void setupItem(const char comps[3], RecordViewItem*);
+		bool addTheoreticalArrivals(RecordViewItem*,
+		                            const std::string& netCode,
+		                            const std::string& staCode,
+		                            const std::string& locCode);
+		bool fillTheoreticalArrivals();
+
+		void resetState();
+
+		void updateOriginInformation();
+
+		void loadNextStations(float distance);
+
+		void setCursorText(const QString&);
+		void setCursorPos(const Seiscomp::Core::Time&, bool always = false);
+		void setTimeRange(double, double);
+
+		void acquireStreams();
+
+		bool applyFilter(RecordViewItem *item = nullptr);
+
+
+		//! Makes sure that the time range [tmin, tmax] is visible.
+		//! When the interval is larger than the visible area
+		//! the time range will be left aligned.
+		void ensureVisibility(double &tmin, double &tmax);
+		void ensureVisibility(const Seiscomp::Core::Time &time, int pixelMargin);
+
+		RecordMarker *updatePhaseMarker(Seiscomp::Gui::RecordViewItem*,
+		                                const Processing::AmplitudeProcessor *proc,
+		                                const Processing::AmplitudeProcessor::Result &res);
+
+		void setPhaseMarker(Seiscomp::Gui::RecordWidget*, const Seiscomp::Core::Time&);
+
+		void updateCurrentRowState();
+		void setMarkerState(Seiscomp::Gui::RecordWidget*, bool);
+
+		bool setArrivalState(Seiscomp::Gui::RecordWidget* w, int arrivalId, bool state);
+		void resetAmplitude(RecordViewItem *item, const QString &text, bool enable);
+
+		void fetchManualAmplitudes(std::vector<RecordMarker*>* marker = nullptr) const;
+
+		void showComponent(char componentCode);
+		void fetchComponent(char componentCode);
+
+		void addAmplitude(Gui::RecordViewItem*,
+		                  DataModel::Amplitude*,
+		                  DataModel::Pick*, Core::Time reference, int id);
+
+		void addFilter(const QString& name, const QString& filter);
+
+		void changeFilter(int, bool force);
+
+		void closeThreads();
+
+		char currentComponent() const;
+
+		void searchByText(const QString &text);
+
+		void newAmplitudeAvailable(const Processing::AmplitudeProcessor*,
+		                           const Processing::AmplitudeProcessor::Result &);
+
+	private:
+		AmplitudeViewPrivate *_d_ptr;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/datamodel/calculateamplitudes.h

@@ -0,0 +1,179 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_CALCULATEAMPLITUDES_H
+#define SEISCOMP_GUI_CALCULATEAMPLITUDES_H
+
+#include <seiscomp/gui/core/recordstreamthread.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/timewindow.h>
+#include <seiscomp/datamodel/waveformstreamid.h>
+#include <seiscomp/processing/amplitudeprocessor.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+#include <QDialog>
+#include <map>
+#include <set>
+
+#include <seiscomp/gui/datamodel/ui_calculateamplitudes.h>
+
+
+namespace Seiscomp {
+
+class Record;
+
+namespace DataModel {
+
+DEFINE_SMARTPOINTER(Amplitude);
+class Pick;
+class Origin;
+class DatabaseQuery;
+
+}
+
+
+namespace Gui {
+
+
+class SC_GUI_API CalculateAmplitudes : public QDialog {
+	Q_OBJECT
+
+	public:
+		typedef std::pair<DataModel::AmplitudePtr, bool> AmplitudeEntry;
+		typedef std::multimap<std::string, AmplitudeEntry> PickAmplitudeMap;
+		typedef PickAmplitudeMap::iterator iterator;
+		typedef std::pair<iterator, iterator> iterator_range;
+		typedef std::set<std::string> TypeSet;
+
+
+	public:
+		CalculateAmplitudes(DataModel::Origin *origin,
+		                    QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~CalculateAmplitudes();
+
+		void setOrigin(DataModel::Origin *origin);
+		void setStreamURL(const std::string& streamURL);
+		void setDatabase(DataModel::DatabaseQuery *);
+
+		void setRecomputeAmplitudes(bool);
+		void setAmplitudeCache(PickAmplitudeMap *cache);
+
+		void setAmplitudeTypes(const TypeSet &types);
+
+
+	public:
+		int exec();
+		void done(int r);
+
+		bool process();
+
+		//! Iterate over the computed/fetched amplitudes.
+		iterator begin();
+		iterator end();
+
+		//! Returns the amplitudes belonging to a pick that has been
+		//! fetched or calculated
+		iterator_range pickAmplitudes(const std::string &pickID);
+
+		iterator amplitude(const std::string &amplitudeID);
+
+		bool isNewlyCreated(const iterator&) const;
+		DataModel::AmplitudePtr amplitude(const iterator&) const;
+
+		//! Sets the state of an amplitude that stand for 'newly created'
+		void setState(iterator it, bool);
+
+		void setSilentMode(bool f);
+
+
+	private slots:
+		void receivedRecord(Seiscomp::Record*);
+		void finishedAcquisition();
+		void filterStateChanged(int index);
+		void filterTypeChanged(int index);
+
+
+	private:
+		void closeAcquisition();
+
+		void addProcessor(const std::string &type,
+		                  const DataModel::Pick *pick,
+		                  const DataModel::SensorLocation *loc,
+		                  double dist);
+
+		void addProcessor(Processing::AmplitudeProcessor *,
+		                  const DataModel::Pick *pick,
+		                  int c);
+
+		void subscribeData(Processing::AmplitudeProcessor *,
+		                   const DataModel::Pick *pick,
+		                   int c);
+
+		void checkPriority(const AmplitudeEntry &newAmp);
+
+		int addProcessingRow(const std::string &streamID, const std::string &type);
+
+		void emitAmplitude(const Processing::AmplitudeProcessor *,
+		                   const Processing::AmplitudeProcessor::Result &res);
+
+		void setError(int row, QString text);
+		void setInfo(int row, QString text);
+		void setMessage(int row, QString text);
+		void setProgress(int row, int progress);
+		void setValue(int row, double value);
+
+		void filterView(int startRow = 0, int cnt = -1);
+		void updateTitle();
+
+
+	private:
+		typedef std::vector<Processing::AmplitudeProcessorPtr> ProcessorSlot;
+		typedef std::map<std::string, ProcessorSlot> ProcessorMap;
+		typedef std::multimap<Processing::AmplitudeProcessorCPtr, int> TableRowMap;
+		typedef std::map<std::string, Seiscomp::Util::KeyValuesPtr> ParameterMap;
+		typedef std::map<std::string, Seiscomp::Processing::StreamPtr> StreamMap;
+
+		::Ui::CalculateAmplitudes _ui;
+
+		ProcessorMap              _processors;
+		ParameterMap              _parameters;
+		StreamMap                 _streams;
+		TableRowMap               _rows;
+		PickAmplitudeMap          _amplitudes;
+		PickAmplitudeMap         *_externalAmplitudeCache;
+		Core::TimeWindow          _timeWindow;
+		RecordStreamThread       *_thread;
+		DataModel::DatabaseQuery *_query;
+		DataModel::Origin        *_origin;
+		TypeSet                   _amplitudeTypes;
+
+		bool                      _recomputeAmplitudes;
+		bool                      _computeSilently;
+};
+
+
+}
+
+}
+
+
+#endif

include/seiscomp/gui/datamodel/eventedit.h

@@ -0,0 +1,323 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_EVENTEDIT_H
+#define SEISCOMP_GUI_EVENTEDIT_H
+
+#include <QWidget>
+#include <string>
+#include <list>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/event.h>
+#include <seiscomp/datamodel/origin.h>
+#include <seiscomp/datamodel/magnitude.h>
+#include <seiscomp/datamodel/focalmechanism.h>
+#include <seiscomp/datamodel/momenttensor.h>
+#include <seiscomp/datamodel/journalentry.h>
+#include <seiscomp/datamodel/databasequery.h>
+#endif
+#include <seiscomp/gui/qt.h>
+#include <seiscomp/gui/datamodel/originsymbol.h>
+#include <seiscomp/gui/datamodel/tensorsymbol.h>
+#include <seiscomp/gui/map/mapwidget.h>
+
+#include <seiscomp/gui/datamodel/ui_eventedit.h>
+
+namespace Seiscomp {
+namespace Gui {
+
+// Extends tensor symbol by label and reference position
+class SC_GUI_API ExtTensorSymbol  : public TensorSymbol {
+	public:
+		ExtTensorSymbol(const Math::Tensor2Sd &t,
+		                const DataModel::FocalMechanism *fm,
+		                Map::Decorator* decorator = nullptr);
+		~ExtTensorSymbol() {};
+
+	public:
+		void setSelected(bool selected) { _selected = selected; }
+		void setDrawAgency(bool enabled) { _drawAgency = enabled; }
+		void setDrawMagnitude(bool enabled) { _drawMagnitude = enabled; }
+		void setDrawDepth(bool enabled) { _drawDepth = enabled; }
+		void setReferencePositionEnabled(bool enabled) { _refPosEnabled = enabled; }
+		void setReferencePosition(const QPointF &refPos) { _refPos = refPos; }
+
+		const QString& agencyID() const { return _agency; }
+		const Core::Time& created() const { return _created; }
+
+	protected:
+		virtual void customDraw(const Map::Canvas *canvas, QPainter &painter);
+
+	private:
+		bool            _selected;
+		bool            _refPosEnabled;
+		QPointF         _refPos;
+
+		QString         _agency;
+		QString         _magnitude;
+		QString         _depth;
+		Core::Time      _created;
+
+		bool            _drawAgency;
+		bool            _drawMagnitude;
+		bool            _drawDepth;
+};
+
+
+
+// Adds context menu entries to control drawing of focal mechanism symbols
+class SC_GUI_API FMMap : public MapWidget {
+	Q_OBJECT
+
+	public:
+		FMMap(const MapsDesc &maps, QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags())
+		 : MapWidget(maps, parent, f) { init(); }
+		FMMap(Map::ImageTree* mapTree, QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags())
+		 : MapWidget(mapTree, parent, f) { init(); }
+
+		virtual ~FMMap();
+
+		virtual void draw(QPainter&);
+
+		void addFM(const DataModel::FocalMechanism *fm);
+		void clear();
+		void setCurrentFM(const std::string &id);
+		void setEvent(const DataModel::Event *event);
+
+
+	protected:
+		void contextMenuEvent(QContextMenuEvent *e);
+
+	private:
+		void init();
+		void updateSmartLayout();
+
+	private:
+		typedef std::map<std::string, ExtTensorSymbol*> FMSymbols;
+
+		FMSymbols                   _fmSymbols;
+		OriginSymbol               *_originSymbol;
+
+		bool                        _drawAgency;
+		bool                        _drawMagnitude;
+		bool                        _drawDepth;
+		bool                        _smartLayout;
+		bool                        _groupByAgency;
+
+		bool                        _smartLayoutDirty;
+		QRectF                      _fmBoundings;
+};
+
+
+// Derived from Observer to receive local object modifications, because
+// messages sent by other controls won't be received by the client
+// application again.
+class SC_GUI_API EventEdit : public QWidget, public DataModel::Observer {
+	Q_OBJECT
+
+	public:
+		EventEdit(DataModel::DatabaseQuery* reader,
+		          Map::ImageTree *mapTreeOrigin = nullptr,
+		          QWidget *parent = 0);
+		~EventEdit();
+
+
+	public:
+		//! Sets the usage of messaging to notify about object changes.
+		//! When disabled a local EventParameters instance is searched for and
+		//! all updates and adds are applied to this instance.
+		void setMessagingEnabled(bool);
+
+
+	signals:
+		void originSelected(Seiscomp::DataModel::Origin*, Seiscomp::DataModel::Event* = nullptr);
+		void originMergeRequested(QList<Seiscomp::DataModel::Origin*>);
+		void fmSelected(Seiscomp::DataModel::FocalMechanism*, Seiscomp::DataModel::Event* = nullptr);
+
+
+	public slots:
+		void addObject(const QString& parentID, Seiscomp::DataModel::Object* obj);
+		void updateObject(const QString& parentID, Seiscomp::DataModel::Object* obj);
+		void removeObject(const QString& parentID, Seiscomp::DataModel::Object* obj);
+
+		void setEvent(Seiscomp::DataModel::Event *event, Seiscomp::DataModel::Origin *origin);
+		void updateOrigin(Seiscomp::DataModel::Origin*);
+		void updateFM(Seiscomp::DataModel::FocalMechanism*);
+
+		void showTab(int);
+
+
+	private slots:
+		void sortOriginItems(int);
+		void sortFMItems(int);
+		void originSelected(QTreeWidgetItem *item, int);
+		void fmSelected(QTreeWidgetItem *item, int);
+
+		void sortMagnitudeItems(int);
+
+		void currentTypeChanged(int);
+		void currentTypeCertaintyChanged(int);
+		void currentOriginChanged(QTreeWidgetItem*, QTreeWidgetItem*);
+		void currentFMChanged(QTreeWidgetItem*, QTreeWidgetItem*);
+		void currentMagnitudeChanged(QTreeWidgetItem*, QTreeWidgetItem*);
+
+		void originTreeCustomContextMenu(const QPoint &);
+		void originTreeHeaderCustomContextMenu(const QPoint &);
+		void fmTreeCustomContextMenu(const QPoint &);
+		void fmTreeHeaderCustomContextMenu(const QPoint &);
+		void magnitudeTreeCustomContextMenu(const QPoint &);
+
+		void fixOrigin();
+		void fixFM();
+		void releaseOrigin();
+		void releaseFM();
+
+		void fixMagnitudeType();
+		void releaseMagnitudeType();
+
+		void fixMw();
+		void fixFmMw();
+		void releaseMw();
+		void triggerMw();
+
+		void evalResultAvailable(const QString &originID,
+		                         const QString &className,
+		                         const QString &script,
+		                         const QString &result);
+
+		void evalResultError(const QString &originID,
+		                     const QString &className,
+		                     const QString &script,
+		                     int error);
+
+
+	public:
+		const DataModel::Event *currentEvent() const;
+		void handleOrigins(const QList<DataModel::Origin*> &origins);
+
+
+	private:
+		void init();
+
+		void updateContent();
+		void updateEvent();
+		void updateOrigin();
+		void updateMagnitude();
+		void updateFM();
+		void updateMT();
+		void updateJournal();
+
+		void resetContent();
+		void resetOrigin();
+		void resetMagnitude();
+		void resetFM();
+		void resetMT(bool resetCurrent = false);
+		bool sendJournal(const std::string &action,
+		                 const std::string &params);
+
+		void addMagnitude(DataModel::Magnitude *mag);
+		void addJournal(DataModel::JournalEntry *entry);
+
+		void updatePreferredOriginIndex();
+		void updatePreferredMagnitudeIndex();
+		void updatePreferredFMIndex();
+
+		void onObjectAdded(DataModel::Object* parent, DataModel::Object* newChild);
+		void onObjectRemoved(DataModel::Object* parent, DataModel::Object* oldChild);
+		void onObjectModified(DataModel::Object* object);
+
+		void insertOriginRow(DataModel::Origin *);
+		void updateOriginRow(int row, DataModel::Origin *);
+		void updateMagnitudeRow(int row, DataModel::Magnitude *);
+		void insertFMRow(DataModel::FocalMechanism *);
+		void updateFMRow(int row, DataModel::FocalMechanism *);
+
+		void storeOrigin(DataModel::Origin *);
+		void storeFM(DataModel::FocalMechanism *);
+		void storeDerivedOrigin(DataModel::Origin *);
+		void clearOrigins();
+		void clearFMs();
+
+		void mergeOrigins(const QList<DataModel::Origin*> &origins);
+
+		void setFMActivity(bool);
+
+
+	private:
+		typedef std::list<DataModel::OriginPtr> OriginList;
+		typedef std::list<DataModel::FocalMechanismPtr> FMList;
+		struct ProcessColumn {
+			int     pos;
+			QString script;
+		};
+
+		Ui::EventEdit _ui;
+
+		QList<DataModel::EventType> _eventTypesWhitelist;
+		DataModel::DatabaseQuery* _reader;
+		Map::ImageTreePtr         _mapTreeOrigin;
+		Map::ImageTreePtr         _mapTreeFM;
+		QLabel                   *_fmActivity;
+		QMovie                   *_fmActivityMovie;
+
+		DataModel::EventPtr       _currentEvent;
+		bool                      _updateLocalEPInstance;
+		bool                      _blockObserver;
+
+		// origin tab
+		OriginList                _origins;
+		MapWidget                *_originMap;
+		QRectF                    _originBoundings;
+		DataModel::OriginPtr      _currentOrigin;
+		DataModel::MagnitudePtr   _currentMagnitude;
+		int                       _fixOriginDefaultActionCount;
+		int                       _preferredOriginIdx;
+		int                       _preferredMagnitudeIdx;
+		QStringList               _originTableHeader;
+		QVector<int>              _originColumnMap;
+		int                       _customColumn;
+		QString                   _customColumnLabel;
+		std::string               _commentID;
+		QString                   _customDefaultText;
+		QMap<std::string, QColor> _customColorMap;
+		QVector<ProcessColumn>    _scriptColumns;
+		QHash<QString, int>       _scriptColumnMap;
+
+		QTreeWidget              *_originTree;
+
+		// focal mechanism tab
+		FMList                       _fms;
+		OriginList                   _derivedOrigins;
+		FMMap                       *_fmMap;
+		DataModel::FocalMechanismPtr _currentFM;
+		DataModel::MomentTensorPtr   _currentMT;
+		int                          _fixFMDefaultActionCount;
+		int                          _preferredFMIdx;
+		QStringList                  _fmTableHeader;
+		QVector<int>                 _fmColumnMap;
+		OriginSymbol                *_fmPrefOriginSymbol;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/datamodel/eventlayer.h

@@ -0,0 +1,136 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_EVENTLAYER_H
+#define SEISCOMP_GUI_EVENTLAYER_H
+
+
+#include <seiscomp/gui/map/layer.h>
+#include <seiscomp/gui/map/legend.h>
+#include <seiscomp/gui/datamodel/originsymbol.h>
+#include <QMap>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API EventLayer : public Map::Layer {
+	Q_OBJECT
+
+	// ----------------------------------------------------------------------
+	//  X'truction
+	// ----------------------------------------------------------------------
+	public:
+		//! C'tor
+		EventLayer(QObject* parent = nullptr);
+
+		//! D'tor
+		~EventLayer();
+
+
+	// ----------------------------------------------------------------------
+	//  Layer interface
+	// ----------------------------------------------------------------------
+	public:
+		virtual void draw(const Map::Canvas *, QPainter &);
+		virtual void calculateMapPosition(const Map::Canvas *canvas);
+		virtual bool isInside(const QMouseEvent *event, const QPointF &geoPos);
+
+		virtual void handleEnterEvent();
+		virtual void handleLeaveEvent();
+		virtual bool filterMouseMoveEvent(QMouseEvent *event, const QPointF &geoPos);
+		virtual bool filterMouseDoubleClickEvent(QMouseEvent *event, const QPointF &geoPos);
+
+
+	// ----------------------------------------------------------------------
+	//  Slots
+	// ----------------------------------------------------------------------
+	public slots:
+		virtual void clear();
+		virtual void addEvent(Seiscomp::DataModel::Event*,bool);
+		virtual void updateEvent(Seiscomp::DataModel::Event*);
+		virtual void removeEvent(Seiscomp::DataModel::Event*);
+
+
+	// ----------------------------------------------------------------------
+	//  Signals
+	// ----------------------------------------------------------------------
+	signals:
+		void eventHovered(const std::string &eventID);
+		void eventSelected(const std::string &eventID);
+
+
+	// ----------------------------------------------------------------------
+	//  Protected members
+	// ----------------------------------------------------------------------
+	protected:
+		typedef QMap<std::string, OriginSymbol*> SymbolMap;
+
+		SymbolMap           _eventSymbols;
+		mutable std::string _hoverId;
+		mutable bool        _hoverChanged;
+};
+
+
+class EventLegend : public Map::Legend {
+	Q_OBJECT
+
+	// ----------------------------------------------------------------------
+	//  X'truction
+	// ----------------------------------------------------------------------
+	public:
+		//! C'tor
+		EventLegend(QObject* parent = nullptr);
+
+		//! D'tor
+		~EventLegend();
+
+
+	// ----------------------------------------------------------------------
+	//  Legend interface
+	// ----------------------------------------------------------------------
+	public:
+		virtual void contextResizeEvent(const QSize &size);
+		virtual void draw(const QRect &rect, QPainter &p);
+
+
+	// ----------------------------------------------------------------------
+	//  Private members
+	// ----------------------------------------------------------------------
+	private:
+		typedef QPair<QString, int> StringWithWidth;
+		typedef QPair<QColor, StringWithWidth> DepthItem;
+		typedef QPair<int, StringWithWidth> MagItem;
+
+		QVector<DepthItem> _depthItems;
+		QVector<MagItem> _magItems;
+
+		int _depthWidth;
+		int _magWidth;
+		int _magHeight;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/datamodel/eventlistview.h

@@ -0,0 +1,404 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_ORIGINLISTVIEW_H
+#define SEISCOMP_GUI_ORIGINLISTVIEW_H
+
+#include <seiscomp/gui/core/connectiondialog.h>
+#include <seiscomp/gui/core/utils.h>
+#include <seiscomp/gui/qt.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/baseobject.h>
+#include <seiscomp/core/timewindow.h>
+#include <seiscomp/geo/boundingbox.h>
+#endif
+
+#include <QWidget>
+
+
+// Ui forward declarations
+class QTreeWidget;
+class QTreeWidgetItem;
+
+namespace Ui {
+	class EventListView;
+	class EventListViewRegionFilterDialog;
+}
+
+
+namespace Seiscomp {
+
+namespace DataModel {
+
+
+DEFINE_SMARTPOINTER(Event);
+DEFINE_SMARTPOINTER(Origin);
+DEFINE_SMARTPOINTER(FocalMechanism);
+DEFINE_SMARTPOINTER(Pick);
+DEFINE_SMARTPOINTER(Station);
+DEFINE_SMARTPOINTER(Amplitude);
+class OriginReference;
+class DatabaseQuery;
+class Notifier;
+
+}
+
+namespace Client {
+
+DEFINE_SMARTPOINTER(Connection);
+
+}
+
+namespace Geo {
+
+DEFINE_SMARTPOINTER(GeoFeature);
+
+}
+
+namespace Gui {
+
+
+namespace Private {
+
+class EventTreeItem;
+class OriginTreeItem;
+class FocalMechanismTreeItem;
+class EventFilterWidget;
+
+}
+
+
+class CommandMessage;
+
+
+class SC_GUI_API EventListView : public QWidget {
+	Q_OBJECT
+
+	// ------------------------------------------------------------------
+	//  Public types
+	// ------------------------------------------------------------------
+	public:
+		typedef QMap<QString, DataModel::StationPtr> StationMap;
+
+		struct Filter {
+			Filter(const Seiscomp::Core::TimeWindow& tw = Seiscomp::Core::TimeWindow())
+			   : startTime(tw.startTime()), endTime(tw.endTime()) {}
+			Seiscomp::Core::Time     startTime;
+			Seiscomp::Core::Time     endTime;
+			OPT(float)               minLatitude, maxLatitude;
+			OPT(float)               minLongitude, maxLongitude;
+			OPT(float)               minDepth, maxDepth;
+			OPT(float)               minMagnitude, maxMagnitude;
+			std::string              eventID;
+
+			bool isNull() const;
+		};
+
+
+	// ------------------------------------------------------------------
+	//  X'truction
+	// ------------------------------------------------------------------
+	public:
+		EventListView(Seiscomp::DataModel::DatabaseQuery* reader,
+		              bool withOrigins = true, bool withFocalMechanisms = false,
+		              QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~EventListView();
+
+
+	public:
+		void setRelativeMinimumEventTime(const Seiscomp::Core::TimeSpan&);
+		void add(Seiscomp::DataModel::Event* event,
+		         Seiscomp::DataModel::Origin* origin);
+
+		//! Sets the usage of messaging to notify about new objects or updates.
+		//! When disabled a local EventParameters instance is searched for and
+		//! all updates and adds are applied to this instance.
+		void setMessagingEnabled(bool);
+		void setEventModificationsEnabled(bool);
+		void setSortingEnabled(bool);
+		void moveSection(int, int);
+
+		void setControlsHidden(bool);
+		void setCustomControls(QWidget*) const;
+		void setFMLinkEnabled(bool);
+
+		QList<Seiscomp::DataModel::Event*> selectedEvents();
+
+		QTreeWidget *eventTree() { return _treeWidget; }
+		Seiscomp::DataModel::Event *eventFromTreeItem(QTreeWidgetItem *item) const;
+
+		int eventCount() const;
+
+		//! \since 15.0.0
+		int visibleEventCount() const;
+
+
+	signals:
+		void originAdded();
+		void focalMechanismAdded();
+
+		void originSelected(Seiscomp::DataModel::Origin*,
+		                    Seiscomp::DataModel::Event* = nullptr);
+		void originUpdated(Seiscomp::DataModel::Origin*);
+
+		void focalMechanismSelected(Seiscomp::DataModel::FocalMechanism*,
+		                            Seiscomp::DataModel::Event* = nullptr);
+		void focalMechanismUpdated(Seiscomp::DataModel::FocalMechanism*);
+
+		void eventSelected(Seiscomp::DataModel::Event*);
+		void eventFMSelected(Seiscomp::DataModel::Event*);
+		void originReferenceAdded(const std::string &, Seiscomp::DataModel::OriginReference*);
+
+		//! Emitted when the event list is cleared
+		void reset();
+		void eventAddedToList(Seiscomp::DataModel::Event*, bool fromNotification);
+		void eventUpdatedInList(Seiscomp::DataModel::Event*);
+		void eventRemovedFromList(Seiscomp::DataModel::Event*);
+
+		//! \since 15.0.0
+		void visibleEventCountChanged();
+
+		//! Emitted when a bigger update process has finished, such as show/hide
+		//! of a subset of events.
+		void eventsUpdated();
+
+
+	public slots:
+		void setAutoSelect(bool);
+		void onCommand(Seiscomp::Gui::CommandMessage* cmsg);
+		void messageAvailable(Seiscomp::Core::Message*, Seiscomp::Client::Packet*);
+		void notifierAvailable(Seiscomp::DataModel::Notifier*);
+
+		void updateOrigin(Seiscomp::DataModel::Origin* origin);
+		void insertOrigin(Seiscomp::DataModel::Origin* origin,
+		                  Seiscomp::DataModel::Event* baseEvent,
+		                  const Seiscomp::Gui::ObjectChangeList<Seiscomp::DataModel::Pick>&,
+		                  const std::vector<Seiscomp::DataModel::AmplitudePtr>&);
+
+		void updateFocalMechanism(Seiscomp::DataModel::FocalMechanism *fm);
+		void insertFocalMechanism(Seiscomp::DataModel::FocalMechanism *fm,
+		                          Seiscomp::DataModel::Event *event,
+		                          Seiscomp::DataModel::Origin *origin = 0);
+
+		void setInterval(const Seiscomp::Core::TimeWindow&);
+
+		void selectFirstEnabledEvent();
+		void selectEvent(int index);
+		void selectEventID(const std::string& publicID);
+
+		/**
+		 * @brief Activates the previous visible event.
+		 * This is similar to selecting the event before (visually below) the
+		 * current event in the list.
+		 */
+		void setPreviousEvent();
+
+		/**
+		 * @brief Activates the next visible event.
+		 * This is similar to selecting the event after (visually above) the
+		 * current event in the list.
+		 */
+		void setNextEvent();
+
+		void readFromDatabase();
+		void readFromDatabase(const Seiscomp::Gui::EventListView::Filter&);
+		void clear();
+		void clearDatabaseFilter();
+
+		void selectEventFM(const QString &);
+
+	protected slots:
+		void itemSelected(QTreeWidgetItem*,int);
+		void itemPressed(QTreeWidgetItem*,int);
+		void copyRowToClipboard();
+
+		void readLastDays();
+		void readInterval();
+
+		void onShowOtherEvents(int checked);
+		void onShowForeignEvents(int checked);
+		void onHideOutsideRegion(int checked);
+		void onFilterRegionModeChanged(int mode);
+
+		void updateAgencyState();
+
+	private slots:
+		void sortItems(int);
+		void headerContextMenuRequested(const QPoint &);
+		void waitDialogDestroyed(QObject *o);
+
+		void regionSelectionChanged(int index);
+		void changeRegion();
+
+		void itemEntered(QTreeWidgetItem *item, int);
+		void itemExpanded(QTreeWidgetItem * item);
+		void currentItemChanged(QTreeWidgetItem* current, QTreeWidgetItem* previous);
+		void indicatorResized(const QSize &size);
+
+		void evalResultAvailable(const QString &publicID,
+		                         const QString &className,
+		                         const QString &script,
+		                         const QString &result);
+
+		void evalResultError(const QString &publicID,
+		                     const QString &className,
+		                     const QString &script,
+		                     int error);
+
+
+	protected:
+		bool eventFilter(QObject *obj, QEvent *event);
+
+	private:
+		void initTree();
+
+		Private::EventTreeItem* addEvent(Seiscomp::DataModel::Event*, bool fromNotification);
+		Private::OriginTreeItem* addOrigin(Seiscomp::DataModel::Origin*, QTreeWidgetItem* parent, bool highPriority);
+		Private::FocalMechanismTreeItem* addFocalMechanism(Seiscomp::DataModel::FocalMechanism*, QTreeWidgetItem* parent);
+
+		Private::EventTreeItem* findEvent(const std::string&);
+		Private::OriginTreeItem* findOrigin(const std::string&);
+		Private::FocalMechanismTreeItem* findFocalMechanism(const std::string&);
+
+		void removeExpiredEvents();
+		void updateHideState();
+		bool updateHideState(QTreeWidgetItem *item);
+
+		void updateOriginProcessColumns(QTreeWidgetItem *item, bool highPriority);
+		void updateEventProcessColumns(QTreeWidgetItem *item, bool highPriority);
+
+		bool sendJournalAndWait(const std::string &objectID,
+		                        const std::string &action,
+		                        const std::string &params, const char *group);
+
+		void loadItem(QTreeWidgetItem*);
+
+
+	public:
+		struct ProcessColumn {
+			int     pos;
+			QString script;
+		};
+
+		struct ItemConfig {
+			ItemConfig() : createFMLink(false) {}
+
+			QColor                    disabledColor;
+
+			bool                      createFMLink;
+			QStringList               header;
+			QVector<int>              columnMap;
+			int                       customColumn;
+			std::string               originCommentID;
+			std::string               eventCommentID;
+			QString                   customDefaultText;
+			QMap<std::string, QColor> customColorMap;
+			QVector<ProcessColumn>    originScriptColumns;
+			QVector<ProcessColumn>    eventScriptColumns;
+			QSet<int>                 eventScriptPositions;
+			QHash<QString, int>       originScriptColumnMap;
+			QHash<QString, int>       eventScriptColumnMap;
+			QSet<int>                 hiddenEventTypes;
+			QSet<QString>             preferredAgencies;
+		};
+
+		struct Region {
+			QString                name;
+			Geo::GeoBoundingBox    bbox;
+			const Geo::GeoFeature *poly{nullptr};
+		};
+
+		typedef QList<Region> FilterRegions;
+
+	private:
+		::Ui::EventListView                *_ui;
+		Private::EventFilterWidget         *_filterWidget;
+		ItemConfig                          _itemConfig;
+		FilterRegions                       _filterRegions;
+		QTreeWidget                        *_treeWidget;
+		QTreeWidgetItem                    *_unassociatedEventItem;
+		QWidget                            *_commandWaitDialog;
+		QMovie                             *_busyIndicator;
+		QLabel                             *_busyIndicatorLabel;
+		//StationMap                        _associatedStations;
+		Seiscomp::DataModel::DatabaseQuery *_reader;
+		Seiscomp::Core::TimeSpan            _timeAgo;
+		Filter                              _filter;
+		bool                                _autoSelect;
+		bool                                _withOrigins;
+		bool                                _withFocalMechanisms;
+		bool                                _updateLocalEPInstance;
+		//bool                              _withComments;
+		bool                                _blockSelection;
+		bool                                _blockRemovingOfExpiredEvents;
+		bool                                _blockCountSignal;
+		bool                                _hideOtherEvents;
+		bool                                _hideForeignEvents;
+		bool                                _hideOutsideRegion;
+		bool                                _checkEventAgency;
+		bool                                _showOnlyLatestPerAgency;
+		int                                 _regionIndex;
+		mutable int                         _visibleEventCount;
+};
+
+
+class SC_GUI_API EventListViewRegionFilterDialog : public QDialog {
+	Q_OBJECT
+
+	// ------------------------------------------------------------------
+	//  X'truction
+	// ------------------------------------------------------------------
+	public:
+		EventListViewRegionFilterDialog(QWidget *parent, EventListView::Region *target,
+		                                EventListView::FilterRegions *regionList);
+		~EventListViewRegionFilterDialog();
+
+
+	// ------------------------------------------------------------------
+	//  QDialog interface
+	// ------------------------------------------------------------------
+	public:
+		virtual void accept();
+
+
+	// ------------------------------------------------------------------
+	//  Slots
+	// ------------------------------------------------------------------
+	private slots:
+		void regionSelectionChanged(const QString &);
+		void showError(const QString &);
+
+
+	// ------------------------------------------------------------------
+	//  Private members
+	// ------------------------------------------------------------------
+	private:
+		::Ui::EventListViewRegionFilterDialog *_ui;
+		EventListView::Region                 *_target;
+		EventListView::FilterRegions          *_regionList;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/datamodel/eventsummary.h

@@ -0,0 +1,204 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_EVENTSUMMARY_H
+#define SEISCOMP_GUI_EVENTSUMMARY_H
+
+#include <string>
+#include <set>
+
+#include <QWidget>
+#include <QHBoxLayout>
+#include <QLabel>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/event.h>
+#include <seiscomp/datamodel/focalmechanism.h>
+#include <seiscomp/datamodel/origin.h>
+#include <seiscomp/datamodel/magnitude.h>
+#include <seiscomp/datamodel/databasequery.h>
+#endif
+#include <seiscomp/gui/core/gradient.h>
+#include <seiscomp/gui/map/mapwidget.h>
+#include <seiscomp/gui/qt.h>
+
+
+namespace Ui {
+	class EventSummary;
+}
+
+
+namespace Seiscomp {
+namespace Gui {
+
+class OriginSymbol;
+
+class SC_GUI_API EventSummaryMagnitudeRow : public QHBoxLayout {
+	Q_OBJECT
+
+	public:
+		EventSummaryMagnitudeRow(const std::string &type,
+		                         QWidget *parent = 0);
+
+		void reset();
+		void select(bool);
+
+		void set(const std::string &id, const double *value, int stationCount);
+
+	signals:
+		void clicked(const std::string &magID);
+
+	protected:
+		bool eventFilter(QObject *obj, QEvent *event);
+
+	private:
+		void setMagnitude(const double *value, int stationCount);
+
+	public:
+		std::string magnitudeID;
+		QLabel *label;
+		QLabel *value;
+};
+
+class SC_GUI_API EventSummary : public QWidget {
+	Q_OBJECT
+
+	public:
+		EventSummary(const MapsDesc &maps,
+		             DataModel::DatabaseQuery* reader,
+		             QWidget *parent = 0);
+		EventSummary(Map::ImageTree* mapTree,
+		             DataModel::DatabaseQuery* reader,
+		             QWidget * parent = 0);
+		~EventSummary();
+
+	public:
+		DataModel::Event *currentEvent() const;
+		DataModel::Origin *currentOrigin() const;
+
+		//! Negative value switches to default behaviour
+		void setDefaultEventRadius(double radius);
+		void setSecondDisplayUpToMaxMinutes(int);
+
+		void addVisibleMagnitudeType(const std::string &mag);
+		QList<QFrame*> separators() const;
+
+	signals:
+		void selected(Seiscomp::DataModel::Origin*, Seiscomp::DataModel::Event*);
+		void magnitudeSelected(const std::string &magnitudeID);
+
+	public slots:
+		void addObject(const QString& parentID, Seiscomp::DataModel::Object* obj);
+		void updateObject(const QString& parentID, Seiscomp::DataModel::Object* obj);
+		void removeObject(const QString& parentID, Seiscomp::DataModel::Object* obj);
+
+		void updateOrigin(Seiscomp::DataModel::Origin* origin);
+
+		void setEvent(Seiscomp::DataModel::Event *event,
+		              Seiscomp::DataModel::Origin* org = nullptr,
+		              bool fixed = false);
+
+		void showOrigin(Seiscomp::DataModel::Origin*);
+
+	public:
+		QPushButton *exportButton() const;
+		MapWidget *mapWidget() const;
+
+
+	private slots:
+		void updateTimeAgo();
+		void magnitudeClicked(const std::string &magnitudeID);
+
+	private:
+		void init();
+		void setTextContrast(bool);
+
+		void mapClicked();
+
+		void setFocalMechanism(DataModel::FocalMechanism*);
+
+		void setOrigin(DataModel::Origin *origin);
+		void setOrigin(const std::string &originID);
+
+		void setMagnitude(const DataModel::Magnitude *mag);
+		void selectMagnitude(const std::string &type);
+
+		void resetContent();
+		void resetMagnitudes();
+
+		void updateContent();
+		void updateMagnitude();
+		void updateOrigin();
+		void updateAlert();
+
+	private:
+		struct AlertSettings {
+			AlertSettings() : textSize(-1) {}
+
+			bool empty() { return commentId.empty(); }
+
+			std::string                 commentId;
+			std::vector<std::string >   commentBlacklist;
+
+			int                         textSize;
+			Gui::Gradient               gradient;
+		};
+
+	private:
+		::Ui::EventSummary *_ui;
+		Map::ImageTreePtr _maptree;
+		MapWidget *_map;
+
+		QTimer _timeAgo;
+
+		DataModel::DatabaseQuery*        _reader;
+
+		DataModel::EventPtr              _currentEvent;
+		DataModel::OriginPtr             _currentOrigin;
+		DataModel::MagnitudeCPtr         _currentMag;
+		DataModel::FocalMechanismPtr     _currentFocalMechanism;
+
+		OriginSymbol *_symbol;
+
+		QBoxLayout *_magnitudeRows;
+
+		typedef std::set<std::string> MagnitudeTypes;
+		typedef std::map<std::string, EventSummaryMagnitudeRow*> MagnitudeList;
+
+		MagnitudeTypes                   _visibleMagnitudes;
+		MagnitudeList                    _magnitudes;
+		AlertSettings                    _alertSettings;
+
+		bool                             _alertActive;
+		bool                             _fixedView;
+		bool                             _showComment;
+
+		double                           _defaultEventRadius;
+		int                              _maxMinutesSecondDisplay;
+
+	friend class EventSummaryMap;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/datamodel/eventsummaryview.h

@@ -0,0 +1,334 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_EVENTSUMMARYVIEW_H
+#define SEISCOMP_GUI_EVENTSUMMARYVIEW_H
+
+
+#include <QtGui>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/event.h>
+#include <seiscomp/datamodel/origin.h>
+#include <seiscomp/datamodel/focalmechanism.h>
+#include <seiscomp/datamodel/types.h>
+
+#include <seiscomp/gui/datamodel/originlocatormap.h>
+#include <seiscomp/gui/map/mapwidget.h>
+#include <seiscomp/datamodel/databasequery.h>
+#include <seiscomp/datamodel/magnitude.h>
+#endif
+
+#include <seiscomp/gui/core/application.h>
+
+#include <QProcess>
+
+
+namespace Ui {
+	class EventSummaryView;
+	class Hypocenter;
+}
+
+
+
+namespace Seiscomp {
+
+namespace DataModel {
+DEFINE_SMARTPOINTER(Pick);
+class DatabaseReader;
+}
+
+namespace Gui {
+
+
+class MagList;
+class TensorSymbol;
+
+
+//!
+//! magnitude-type-quality display line
+//!
+class SC_GUI_API MagRow : public QWidget
+{
+	Q_OBJECT
+
+	public:
+		MagRow(DataModel::Magnitude *netMag, bool bold, QWidget *parent = 0);
+		MagRow(const std::string &type, bool bold, QWidget *parent = 0);
+		~MagRow();
+
+		void setMagnitude(DataModel::Magnitude*);
+		DataModel::Magnitude *magnitude() const { return _netMag.get(); }
+
+		void setReferenceMagnitude(DataModel::Magnitude*);
+		DataModel::Magnitude *referenceMagnitude() const { return _netMagReference.get(); }
+
+		void setReferenceMagnitudeVisible(bool);
+		void setReferenceMagnitudeColor(QColor);
+
+		void setVisible(bool);
+
+		void updateContent();
+
+	private:
+		void init();
+		void setBold(bool);
+
+	private:
+		QHBoxLayout *_rowsLayout;
+		QLabel *_type;
+		QLabel *_magnitude;
+		QLabel *_magnitudeReference;
+		QLabel *_quality;
+		QLabel *_qualityReference;
+		QLabel *_stdev;
+		QLabel *_stdevReference;
+		DataModel::MagnitudePtr _netMag;
+		DataModel::MagnitudePtr _netMagReference;
+		bool _header;
+		bool _referenceMagVisible;
+
+	friend class MagList;
+};
+
+
+//!
+//! widget for displaying the magnitude-type-quality lines
+//!
+class SC_GUI_API MagList : public QWidget
+{
+	Q_OBJECT
+	
+	public:
+		MagList(QWidget *parent = 0);
+		~MagList();
+
+		void addMag(DataModel::Magnitude* netMag, bool bold, bool visible);
+		void addMag(const std::string& type, bool bold, bool visible);
+		void updateMag(DataModel::Magnitude* netMag);
+		void updateReferenceMag(DataModel::Magnitude* netMag);
+
+		void selectMagnitude(const char *id);
+
+		void reset();
+		void clear();
+
+		void showAll();
+		void hideTypes(const std::set<std::string>&);
+
+		void setReferenceMagnitudesVisible(bool);
+		void setReferenceMagnitudesColor(QColor);
+
+		int rowCount() { return _magRows.size(); }
+		MagRow *rowAt(int i) const { return _magRows[i]; }
+		MagRow* row(const std::string& type) const;
+
+// 		QSize sizeHint() const;
+
+
+	private:
+		QWidget* _widget;
+		QGridLayout* _mainLayout;
+		QVector<MagRow*> _magRows;
+		MagRow* _header;
+		QColor _referenceColor;
+		bool _space;
+		bool _referenceMagsVisible;
+};
+
+
+class SC_GUI_API EventSummaryView : public QWidget
+{
+	Q_OBJECT
+
+	public:
+		EventSummaryView(const MapsDesc &maps,
+		                 Seiscomp::DataModel::DatabaseQuery* reader,
+		                 QWidget *parent = 0);
+		EventSummaryView(Map::ImageTree* mapTree,
+		                 Seiscomp::DataModel::DatabaseQuery* reader,
+		                 QWidget * parent = 0);
+		~EventSummaryView();
+
+		void setToolButtonText(const QString&);
+
+		void setScript0(const std::string&, bool oldStyle, bool exportMap);
+		void setScript1(const std::string&, bool oldStyle, bool exportMap);
+
+		Seiscomp::DataModel::Event* currentEvent() const;
+		Seiscomp::DataModel::Origin* currentOrigin() const;
+		Seiscomp::DataModel::Magnitude* currentMagnitude() const;
+
+		OriginLocatorMap* map() const;
+
+		bool ignoreOtherEvents() const;
+
+
+	public slots:
+		void addObject(const QString &parentID, Seiscomp::DataModel::Object *obj);
+		void updateObject(const QString &parentID, Seiscomp::DataModel::Object *obj);
+		void removeObject(const QString &parentID, Seiscomp::DataModel::Object *obj);
+		void showEvent(Seiscomp::DataModel::Event* event, Seiscomp::DataModel::Origin* org = nullptr);
+		//! Shows an origin that maybe does not belong to an event yet
+		void showOrigin(Seiscomp::DataModel::Origin* origin);
+		void updateTimeAgoLabel();
+		void updateEvent();
+		void deferredMapUpdate();
+
+		void setWaveformPropagation(bool);
+		void drawStations(bool);
+		void drawBeachballs(bool);
+		void drawFullTensor(bool);
+		void setAutoSelect(bool);
+
+		void setInteractiveEnabled(bool);
+
+	private slots:
+		void runScript0();
+		void runScript1();
+
+		void switchToAutomaticPressed();
+		void showVisibleMagnitudes(bool);
+		void setLastAutomaticOriginColor(QColor c);
+		void setLastAutomaticFMColor(QColor c);
+
+		void setLastAutomaticOriginVisible(bool);
+
+		void showOnlyMostRecentEvent(bool);
+		void ignoreOtherEvents(bool);
+
+	signals:
+		void toolButtonPressed();
+		void requestNonFakeEvent();
+		void newNofifier(Seiscomp::DataModel::Notifier *n);
+		void showInStatusbar(QString, int);
+
+	private:
+		void init();
+		void runScript(const QString&, const QString& name, bool oldStyle,
+		               bool exportMap);
+
+		void processEventMsg(DataModel::Event* event, DataModel::Origin* org = nullptr);
+
+		bool setOriginParameter(std::string OriginID);
+		void setPrefMagnitudeParameter(std::string MaginitudeID);
+		void setOrigin(DataModel::Origin* origin);
+		void setAutomaticOrigin(DataModel::Origin* origin);
+		void setAutomaticFM(DataModel::FocalMechanism* fm);
+		void setMagnitudeParameter(DataModel::Origin* origin);
+		void setAutomaticMagnitudeParameter(DataModel::Origin* origin);
+		void setFMParametersVisible(bool);
+		void updateEventComment();
+		void updateEventName();
+
+		void showFocalMechanism(DataModel::FocalMechanism *fm, int ofsX, int ofsY,
+		                        QColor borderColor);
+		void setFM(DataModel::FocalMechanism *fm);
+
+		void clearMagnitudeParameter();
+		void clearPrefMagnitudeParameter();
+		void clearOriginParameter();
+		void clearAutomaticOriginParameter();
+		void clearAutomaticFMParameter();
+		void clearMap();
+		void updateMap(bool realignView);
+		void updateMagnitude(DataModel::Magnitude *mag);
+		bool updateLastAutomaticOrigin(DataModel::Origin *origin);
+		bool updateLastAutomaticFM(DataModel::FocalMechanism *fm);
+
+		// for calculating map boundaries from max sta dist
+		DataModel::Pick* getPick(DataModel::Arrival* arrival);
+		DataModel::Station* getStation(DataModel::Pick* pick);
+		void calcMinMax(double& latMin, double& latMax, double& lonMin, double& lonMax );
+
+		std::string description(DataModel::Origin*) const;
+
+		bool checkAndDisplay(DataModel::Event *);
+		void calcOriginDistances();
+
+
+	private:
+		Ui::EventSummaryView *_ui;
+		Ui::Hypocenter       *_uiHypocenter;
+		MagList              *_magList;
+
+		Seiscomp::DataModel::EventPtr _currentEvent;
+		Seiscomp::DataModel::EventPtr _lastEvent;
+		Seiscomp::DataModel::OriginPtr _currentOrigin;
+		Seiscomp::DataModel::OriginPtr _lastAutomaticOrigin;
+		Seiscomp::DataModel::FocalMechanismPtr _currentFocalMechanism;
+		Seiscomp::DataModel::FocalMechanismPtr _lastAutomaticFocalMechanism;
+		Seiscomp::DataModel::MagnitudePtr _currentNetMag;
+
+		Seiscomp::Gui::Map::ImageTreePtr _maptree;
+		OriginLocatorMap *_map;
+
+		Seiscomp::DataModel::DatabaseQuery* _reader;
+
+		QColor _automaticOriginColor;
+		QColor _automaticFMColor;
+		QColor _automaticOriginEnabledColor;
+		QColor _automaticOriginDisabledColor;
+
+		bool _interactive;
+		bool _autoSelect;
+		bool _displayFocMechs;
+		bool _recenterMap;
+		bool _recenterMapConfig;
+		bool _ignoreOtherEvents;
+		bool _showLastAutomaticSolution;
+		bool _showOnlyMostRecentEvent;
+		bool _enableFullTensor;
+		int  _maxMinutesSecondDisplay;
+
+		QTimer* _mapTimer;
+
+		double _maxHotspotDist;
+		double _minHotspotPopulation;
+		std::string _hotSpotDescriptionPattern;
+		std::string _script0;
+		std::string _script1;
+		bool        _scriptStyle0;
+		bool        _scriptStyle1;
+		bool        _scriptExportMap0;
+		bool        _scriptExportMap1;
+
+		std::string _displayCommentID;
+		std::string _displayCommentDefault;
+		bool        _displayComment;
+
+		std::string _displayEventCommentID;
+		std::string _displayEventCommentDefault;
+		bool        _displayEventComment;
+
+		//typedef std::vector< std::pair<Seiscomp::DataModel::StationPtr, double> > StationDistances;
+		//StationDistances _originStations;
+		size_t _originStationsIndex;
+
+		std::set<std::string> _visibleMagnitudes;
+};
+
+
+}
+}
+
+
+#endif // of EVENTSUMMARYVIEW_H

include/seiscomp/gui/datamodel/importpicks.h

@@ -0,0 +1,66 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_IMPORTPICKS_H
+#define SEISCOMP_GUI_IMPORTPICKS_H
+
+#include <QtGui>
+#include <seiscomp/gui/datamodel/ui_importpicks.h>
+#include <seiscomp/gui/qt.h>
+
+namespace Seiscomp {
+
+namespace Gui {
+
+
+class SC_GUI_API ImportPicksDialog : public QDialog {
+	Q_OBJECT
+
+	public:
+		enum Selection {
+			LatestOrigin,
+			LatestAutomaticOrigin,
+			MaxPhaseOrigin,
+			AllOrigins
+		};
+
+
+	public:
+		ImportPicksDialog(QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		Selection currentSelection() const;
+		bool importAllPicks() const;
+		bool importAllPhases() const;
+		bool preferTargetPhases() const;
+
+
+	private:
+		::Ui::ImportPicks _ui;
+		static Selection _lastSelection;
+};
+
+
+
+}
+
+}
+
+#endif

include/seiscomp/gui/datamodel/inventorylistview.h

@@ -0,0 +1,126 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_INVENTORYLISTVIEW_H
+#define SEISCOMP_GUI_INVENTORYLISTVIEW_H
+
+#include <QTreeWidget>
+#include <QStack>
+#include <QMap>
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/object.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+
+namespace DataModel {
+
+class Network;
+class Station;
+class Stream;
+class Component;
+
+}
+
+
+namespace Gui {
+
+class SC_GUI_API InventoryListView : public QTreeWidget,
+                                               public DataModel::Visitor {
+	Q_OBJECT
+
+
+	public:
+		InventoryListView(QWidget *parent, Qt::WindowFlags f = Qt::WindowFlags());
+
+		bool selectStream(const QString& streamID, bool);
+		void selectStreams(const QString&, bool);
+
+		QStringList selectedStreams() const;
+		void expandNetworks();
+
+	protected:
+		bool visit(DataModel::PublicObject*);
+		void visit(DataModel::Object*);
+		void finished();
+
+
+	signals:
+		void streamChanged(QString, bool);
+	
+	public slots:
+		void clearSelection();
+		void setNonSelectedHidden(bool);
+
+	private slots:
+		void onItemChanged(QTreeWidgetItem *item, int column);
+		void onItemPressed(QTreeWidgetItem *item, int column);
+
+
+	private:
+		void updateChildSelection(QTreeWidgetItem *item);
+		void updateParentSelection(QTreeWidgetItem *item);
+
+		void setNonSelectedHidden(QTreeWidgetItem*, bool);
+
+		template <typename T>
+		QTreeWidgetItem* add(T*);
+
+		template <typename T>
+		QTreeWidgetItem* add(QTreeWidgetItem* parent, T*);
+
+		template <typename T>
+		QTreeWidgetItem* create(T* object);
+
+		QTreeWidgetItem* createDefaultItem();
+		QTreeWidgetItem* insert(DataModel::Object*);
+
+		void setRow(QTreeWidgetItem*,
+		            const QString& first,
+		            const QString& second = "",
+		            const QString& third = "");
+
+		void notifyAboutStateChange(const QString& streamID, bool state, bool hightPriority = false);
+
+	private:
+		QStack<QTreeWidgetItem*> _itemStack;
+
+		typedef QMap<QChar, QTreeWidgetItem*> ComponentMap;
+		typedef QMap<QString, ComponentMap> StreamMap;
+		typedef QMap<QString, StreamMap> StationMap;
+		typedef QMap<QString, StationMap> NetworkMap;
+		typedef QMap<QString, QTreeWidgetItem*> StreamItems;
+
+		StreamItems _streamItems;
+
+		QTreeWidgetItem* _highestChangedItem;
+};
+
+
+}
+}
+
+
+#endif
+
+

include/seiscomp/gui/datamodel/locatorsettings.h

@@ -0,0 +1,60 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_LOCATORSETTINGS_H
+#define SEISCOMP_GUI_LOCATORSETTINGS_H
+
+#include <QtGui>
+#include <seiscomp/gui/datamodel/ui_locatorsettings.h>
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API LocatorSettings : public QDialog {
+	Q_OBJECT
+
+	public:
+		typedef QList< QPair<QString,QString> > ContentList;
+
+	public:
+		LocatorSettings(QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+	public:
+		void addRow(const QString &name, const QString &value);
+		void lastRowAdded();
+
+		ContentList content() const;
+
+
+	private:
+		::Ui::LocatorSettings _ui;
+};
+
+
+
+}
+
+}
+
+#endif

include/seiscomp/gui/datamodel/maglistview.h

@@ -0,0 +1,137 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_MAGLISTVIEW_H
+#define SEISCOMP_GUI_MAGLISTVIEW_H
+
+#include <QtGui>
+#include <seiscomp/gui/core/connectiondialog.h>
+#include <seiscomp/gui/datamodel/ui_maglistview.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/baseobject.h>
+#include <seiscomp/datamodel/magnitude.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+namespace Seiscomp {
+
+namespace DataModel {
+
+DEFINE_SMARTPOINTER(Event);
+DEFINE_SMARTPOINTER(Origin);
+DEFINE_SMARTPOINTER(Pick);
+DEFINE_SMARTPOINTER(Station);
+class DatabaseQuery;
+class Notifier;
+
+}
+
+namespace Client {
+
+DEFINE_SMARTPOINTER(Connection);
+
+}
+
+namespace Gui {
+
+
+class SC_GUI_API MagListView : public QWidget {
+	Q_OBJECT
+
+	// ------------------------------------------------------------------
+	//  Public types
+	// ------------------------------------------------------------------
+	public:
+		typedef QMap<QString, DataModel::StationPtr> StationMap;
+
+
+	// ------------------------------------------------------------------
+	//  X'truction
+	// ------------------------------------------------------------------
+	public:
+		MagListView(Seiscomp::DataModel::DatabaseQuery* reader,
+		              bool withOrigins = true,
+		              QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~MagListView();
+
+
+	signals:
+		void originAdded();
+		void netMagAdded();
+
+		void netMagSelected(Seiscomp::DataModel::Magnitude*,
+		                    Seiscomp::DataModel::Origin* = nullptr,
+                            Seiscomp::DataModel::Event* = nullptr);
+		void originSelected(Seiscomp::DataModel::Origin*,
+		                    Seiscomp::DataModel::Event* = nullptr);
+		void eventSelected(Seiscomp::DataModel::Event*);
+
+		void originUpdated(Seiscomp::DataModel::Origin*);
+
+
+	public slots:
+		void setAutoSelect(bool);
+		void messageAvailable(Seiscomp::Core::Message*);
+		void notifierAvailable(Seiscomp::DataModel::Notifier*);
+		void expandEventItem(QTreeWidgetItem* eventItem, int col);
+		void expandOriginItem(QTreeWidgetItem* originItem, int col);
+
+	protected slots:
+		void itemSelected(QTreeWidgetItem*,int);
+
+		void readFromDatabase();
+		void clear();
+		//! HACK
+		void onShowAll();
+
+
+	private:
+		void initTree();
+
+		QTreeWidgetItem* addEvent(Seiscomp::DataModel::Event*);
+		QTreeWidgetItem* addOrigin(Seiscomp::DataModel::Origin*, bool bold, QTreeWidgetItem* parent = nullptr);
+		QTreeWidgetItem* addNetMag(Seiscomp::DataModel::Magnitude*, bool bold, QTreeWidgetItem* parent = nullptr);
+
+		QTreeWidgetItem* findEvent(const std::string&);
+		QTreeWidgetItem* findOrigin(const std::string&);
+		QTreeWidgetItem* findNetMag(const std::string&);
+
+		void readPicks(Seiscomp::DataModel::Origin*);
+
+
+	private:
+		::Ui::OriginListView _ui;
+		QTreeWidgetItem* _unassociatedEventItem;
+		QVector<DataModel::PickPtr> _associatedPicks;
+		//StationMap _associatedStations;
+		Seiscomp::DataModel::DatabaseQuery* _reader;
+		bool _autoSelect;
+		bool _withOrigins;
+		bool _blockSelection;
+		bool _readLock;
+
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/datamodel/magnitudemap.h

@@ -0,0 +1,121 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MAGNITUDEMAP_H
+#define SEISCOMP_GUI_MAGNITUDEMAP_H
+
+
+#include <QtGui>
+#include <seiscomp/gui/map/mapwidget.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/baseobject.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+
+namespace DataModel {
+DEFINE_SMARTPOINTER(Origin);
+DEFINE_SMARTPOINTER(Magnitude);
+class StationMagnitude;
+DEFINE_SMARTPOINTER(Station);
+}
+
+namespace Gui {
+
+namespace Map {
+
+class AnnotationLayer;
+
+}
+
+class SC_GUI_API MagnitudeMap : public MapWidget {
+	Q_OBJECT
+
+	public:
+		MagnitudeMap(const MapsDesc &maps,
+		             QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		MagnitudeMap(Map::ImageTree* mapTree,
+		             QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		~MagnitudeMap();
+
+		//! Sets the maximum distance for stations to be displayed
+		//! if they are not part of the origin
+		void setStationsMaxDist(double);
+
+		//! Make the station state changeable interactively
+		//! The default is TRUE
+		void setStationsInteractive(bool);
+		void setOrigin(DataModel::Origin* o);
+		void setMagnitude(DataModel::Magnitude* nm);
+
+		void setMagnitudeState(int id, bool state);
+		void setStationState(const std::string& code, bool state);
+
+		void addStationMagnitude(DataModel::StationMagnitude* staMag, int index);
+
+
+	public slots:
+		void setDrawStations(bool);
+		void setDrawStationAnnotations(bool);
+
+
+	signals:
+		void clickedMagnitude(int id);
+		void clickedStation(const std::string &net, const std::string &code);
+		void magnitudeChanged(int id, bool state);
+		void stationChanged(const std::string &code, bool state);
+
+
+	protected:
+		void mousePressEvent(QMouseEvent*);
+		void mouseDoubleClickEvent(QMouseEvent*);
+
+
+	private:
+		void addMagnitude(int stationId, int magId);
+		void setStationState(int i, bool state);
+		void setStationResidual(int i, double residual);
+		void setMagnitudeResidual(int id, double residual);
+		int findStation(const std::string& stationCode) const;
+		int addStation(const std::string &net, const std::string &sta);
+		void sortSymbols();
+
+
+	private:
+		DataModel::OriginPtr       _origin;
+		Map::Layer                *_symbolLayer;
+		Map::AnnotationLayer      *_annotationLayer;
+		DataModel::MagnitudePtr    _magnitude;
+		QVector<int>               _magnitudes;
+		std::map<std::string, int> _stationCodes;
+		int                        _hoverId{-1};
+		double                     _stationsMaxDist{-1};
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/datamodel/magnitudeview.h

@@ -0,0 +1,353 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MAGNITUDEVIEW_H
+#define SEISCOMP_GUI_MAGNITUDEVIEW_H
+
+
+#include <QtGui>
+#include <seiscomp/gui/datamodel/ui_magnitudeview.h>
+#include <seiscomp/gui/datamodel/ui_magnitudeview_filter.h>
+#include <seiscomp/gui/datamodel/magnitudemap.h>
+#include <seiscomp/gui/map/mapwidget.h>
+#include <seiscomp/gui/core/diagramwidget.h>
+#include <seiscomp/gui/datamodel/amplitudeview.h>
+#include <seiscomp/gui/datamodel/calculateamplitudes.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/baseobject.h>
+#include <seiscomp/datamodel/databasequery.h>
+#include <seiscomp/datamodel/publicobjectcache.h>
+#include <seiscomp/datamodel/event.h>
+#include <seiscomp/datamodel/origin.h>
+#include <seiscomp/datamodel/arrival.h>
+#include <seiscomp/datamodel/pick.h>
+#include <seiscomp/datamodel/station.h>
+#include <seiscomp/datamodel/magnitude.h>
+#include <seiscomp/datamodel/stationmagnitude.h>
+#include <seiscomp/datamodel/amplitude.h>
+#endif
+
+#include <set>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API StationMagnitudeModel : public QAbstractTableModel {
+	Q_OBJECT
+
+	public:
+		StationMagnitudeModel(DataModel::Origin *origin = nullptr,
+		                      DataModel::Magnitude *netMag = nullptr,
+		                      DataModel::PublicObjectCache *cache = nullptr,
+		                      QObject *parent = 0);
+
+		void setOrigin(DataModel::Origin *origin,
+		               DataModel::Magnitude *netMag);
+
+		int rowCount(const QModelIndex &parent = QModelIndex()) const;
+		int columnCount(const QModelIndex &parent = QModelIndex()) const;
+
+		QVariant data(const QModelIndex &index, int role) const;
+		QVariant headerData(int section, Qt::Orientation orientation,
+		                    int role = Qt::DisplayRole) const;
+
+		Qt::ItemFlags flags(const QModelIndex &index) const;
+		bool setData(const QModelIndex &index, const QVariant &value,
+		             int role = Qt::EditRole);
+
+		bool insertRow(int row, const QModelIndex & parent = QModelIndex());
+
+		bool useMagnitude(int row) const;
+
+
+	private:
+		DataModel::PublicObjectCache *_cache;
+		DataModel::Origin            *_origin;
+		DataModel::Magnitude         *_magnitude;
+		QVector<Qt::CheckState>       _used;
+		QVector<double>               _distance;
+		QStringList                   _header;
+		int                           _rowCount;
+};
+
+
+class ModelAbstractRowFilter {
+	public:
+		MAKEENUM(
+			CompareOperation,
+			EVALUES(
+				Undefined,
+				Less,
+				LessEqual,
+				Equal,
+				NotEqual,
+				Greater,
+				GreaterEqual,
+				Like
+			),
+			ENAMES(
+				"None",
+				"Less",
+				"Less or equal",
+				"Equal",
+				"Not equal",
+				"Greater",
+				"Greater or equal",
+				"Like"
+			)
+		);
+
+	public:
+		virtual ~ModelAbstractRowFilter() {}
+
+		virtual int column() const = 0;
+		virtual CompareOperation operation() const = 0;
+		virtual QString value() const = 0;
+
+		virtual QString toString() = 0;
+		virtual bool fromString(const QString &) = 0;
+
+		virtual bool passes(QAbstractItemModel *model, int row) = 0;
+};
+
+
+class SC_GUI_API MagnitudeRowFilter : public QDialog {
+	Q_OBJECT
+
+	public:
+		MagnitudeRowFilter(ModelAbstractRowFilter **filter, QWidget * parent = 0,
+		                   Qt::WindowFlags f = Qt::WindowFlags());
+
+		virtual void accept();
+
+	private slots:
+		void addFilter();
+		void removeFilter();
+
+	private:
+		struct Row {
+			QLayout   *layout;
+			QComboBox *column;
+			QComboBox *operation;
+			QLineEdit *value;
+		};
+
+		Row &addRow();
+		void popRow();
+
+		::Ui::MagnitudeRowFilter   _ui;
+		QVector<Row>               _rows;
+		ModelAbstractRowFilter   **_filter;
+};
+
+
+class SC_GUI_API MagnitudeView : public QWidget {
+	Q_OBJECT
+
+	public:
+		typedef std::set<std::pair<DataModel::AmplitudePtr, bool> > AmplitudeSet;
+		typedef std::set<std::string> StringSet;
+
+
+	public:
+		MagnitudeView(const MapsDesc &maps,
+		              Seiscomp::DataModel::DatabaseQuery* reader,
+		              QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		MagnitudeView(Map::ImageTree* mapTree,
+		              Seiscomp::DataModel::DatabaseQuery* reader,
+		              QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		~MagnitudeView();
+
+		void setDrawGridLines(bool);
+		void setComputeMagnitudesSilently(bool);
+		void setMagnitudeTypeSelectionEnabled(bool);
+
+		void setAmplitudeConfig(const AmplitudeView::Config &config);
+		const AmplitudeView::Config &amplitudeConfig() const;
+
+		MapWidget* map() const;
+
+		void setPreferredMagnitudeID(const std::string &);
+
+		bool setDefaultAggregationType(const std::string &);
+
+
+	signals:
+		void localAmplitudesAvailable(Seiscomp::DataModel::Origin*, AmplitudeSet*, StringSet*);
+		void magnitudeUpdated(const QString &, Seiscomp::DataModel::Object*);
+		void magnitudeRemoved(const QString &, Seiscomp::DataModel::Object*);
+		void magnitudeSelected(const QString &, Seiscomp::DataModel::Magnitude*);
+		void requestClose();
+
+
+	public slots:
+		void drawStations(bool);
+		void drawStationAnnotations(bool);
+
+		void setOrigin(Seiscomp::DataModel::Origin *, Seiscomp::DataModel::Event *);
+
+		bool showMagnitude(const std::string &);
+
+		void addObject(const QString& parentID, Seiscomp::DataModel::Object*);
+		void removeObject(const QString& parentID, Seiscomp::DataModel::Object*);
+		void updateObject(const QString& parentID, Seiscomp::DataModel::Object*);
+
+		//! Enables/disabled the rework of magnitudes, default is true
+		void setReadOnly(bool);
+		void disableRework();
+
+		void computeMagnitudes();
+
+		void reload();
+
+
+	private slots:
+		void objectDestroyed(QObject*);
+		void magnitudeCreated(Seiscomp::DataModel::Magnitude*);
+		void amplitudesConfirmed(Seiscomp::DataModel::Origin*, QList<Seiscomp::DataModel::AmplitudePtr>);
+		void recalculateMagnitude();
+		void selectChannels();
+		void selectChannelsWithEdit();
+		void activateChannels();
+		void deactivateChannels();
+		void openWaveforms();
+
+		void magnitudesSelected();
+		void hoverMagnitude(int id);
+		void selectMagnitude(int id);
+		void selectStation(const std::string &net, const std::string &code);
+		void adjustMagnitudeRect(QRectF&);
+		void tableStationMagnitudesContextMenuRequested(const QPoint &pos);
+		void tableStationMagnitudesHeaderContextMenuRequested(const QPoint &pos);
+		void changeMagnitudeState(int id, bool state);
+		void changeStationState(int id, bool state);
+		void dataChanged(const QModelIndex&, const QModelIndex&);
+		void selectPreferredMagnitude(int idx);
+		void tabStateChanged(int state);
+		void updateContent();
+
+		void closeTab(int idx);
+
+		void debugCreateMagRef();
+		void evaluationStatusChanged(int index);
+
+		void magnitudeCommentChanged(QString);
+
+
+	protected:
+		void closeEvent(QCloseEvent *e);
+
+
+	private:
+		void init(Seiscomp::DataModel::DatabaseQuery* reader);
+
+		void setContent();
+		void resetContent();
+
+		int  addMagnitude(Seiscomp::DataModel::Magnitude*);
+		void addStationMagnitude(Seiscomp::DataModel::StationMagnitude*, int);
+		void updateMagnitudeLabels();
+		void updateMinMaxMagnitude();
+
+		// for calculating map boundaries from max sta dist
+		DataModel::Station* getStation(DataModel::Pick* p);
+		DataModel::Pick* getPick(DataModel::Arrival* a);
+		void calcMinMax(Seiscomp::DataModel::Origin*, double& latMin, double& latMax, double& lonMin, double& lonMax );
+
+		//! returns distance to origin
+		double addStationMagnitude(DataModel::Magnitude* magnitude,
+		                           DataModel::StationMagnitude* stationMagnitude,
+		                           double weight);
+
+		struct MagnitudeStatus {
+			MagnitudeStatus(const  std::string &t,
+			                const DataModel::Amplitude *a,
+			                Processing::MagnitudeProcessor::Status s,
+			                bool isWarning = false)
+			: type(t), amplitude(a), status(s), warning(isWarning) {}
+
+			std::string                             type;
+			const DataModel::Amplitude             *amplitude;
+			Processing::MagnitudeProcessor::Status  status;
+			bool                                    warning;
+		};
+
+		typedef QList<MagnitudeStatus> MagnitudeStats;
+
+		DataModel::Magnitude *
+		computeStationMagnitudes(const std::string &magType,
+		                         QList<DataModel::AmplitudePtr> *amps,
+		                         MagnitudeStats *errors = nullptr);
+
+		void computeMagnitude(DataModel::Magnitude *magnitude, const std::string &aggType);
+		bool editSelectionFilter();
+		void resetPreferredMagnitudeSelection();
+
+
+	private:
+		typedef CalculateAmplitudes::AmplitudeEntry AmplitudeEntry;
+		typedef CalculateAmplitudes::PickAmplitudeMap PickAmplitudeMap;
+		typedef Processing::MagnitudeProcessorFactory::ServiceNames AvailableTypes;
+
+		Seiscomp::DataModel::DatabaseQuery *_reader;
+
+		::Ui::MagnitudeView                *_ui;
+
+		Map::ImageTreePtr                   _maptree;
+		MagnitudeMap                       *_map;
+
+		DiagramWidget                      *_stamagnitudes;
+		StationMagnitudeModel               _modelStationMagnitudes;
+		QSortFilterProxyModel              *_modelStationMagnitudesProxy;
+
+		AmplitudeView::Config               _amplitudeConfig;
+		AmplitudeView                      *_amplitudeView;
+
+		QTabBar                            *_tabMagnitudes;
+
+		DataModel::OriginPtr                _origin;
+		DataModel::EventPtr                 _event;
+		DataModel::MagnitudePtr             _netMag;
+
+		double                              _minStationMagnitude;
+		double                              _maxStationMagnitude;
+
+		DataModel::PublicObjectRingBuffer   _objCache;
+
+		bool                                _computeMagnitudesSilently;
+		bool                                _enableMagnitudeTypeSelection;
+		OPT(std::string)                    _defaultMagnitudeAggregation;
+
+		PickAmplitudeMap                    _amplitudes;
+		std::string                         _preferredMagnitudeID;
+		std::vector<std::string>            _magnitudeTypes;
+		std::vector<std::string>            _currentMagnitudeTypes;
+		AvailableTypes                     *_availableMagTypes;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/datamodel/origindialog.h

@@ -0,0 +1,107 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_ORIGINDIALOG_H
+#define SEISCOMP_GUI_ORIGINDIALOG_H
+
+
+#include <ctime>
+
+#include <QDialog>
+#include <QDateTime>
+#include <QString>
+
+#include <seiscomp/gui/datamodel/ui_origindialog.h>
+#include <seiscomp/core/datetime.h>
+#include <seiscomp/gui/qt.h>
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API OriginDialog : public QDialog
+{
+
+	Q_OBJECT
+
+public:
+	static void SetDefaultDepth(double depth);
+	static double DefaultDepth();
+
+	OriginDialog(QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+	OriginDialog(double lon, double lat,
+	             QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+	OriginDialog(double lon, double lat, double dep,
+	             QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+	~OriginDialog() override;
+
+	time_t getTime_t() const;
+	void setTime(Core::Time t);
+
+	double longitude() const;
+	void setLongitude(double lon);
+
+	double latitude() const;
+	void setLatitude(double lat);
+
+	double depth() const;
+	void setDepth(double dep);
+
+	// enable advanced group box
+	void enableAdvancedOptions(bool enable = true, bool checkable = true);
+
+	bool advanced() const;
+	void setAdvanced(bool checked);
+
+	int phaseCount() const;
+	void setPhaseCount(int count);
+
+	double magValue() const;
+	void setMagValue(double mag);
+
+	QString magType() const;
+	void setMagType(const QString &type);
+	void setMagTypes(const QStringList &types);
+
+	void setSendButtonText(const QString &text);
+
+	void loadSettings(const QString &groupName = "OriginDialog");
+	void saveSettings(const QString &groupName = "OriginDialog");
+
+protected slots:
+	void onTextEdited(const QString &text);
+
+private:
+	void init(double lon, double lat, double dep);
+
+private:
+	static double _defaultDepth;
+
+	Ui::OriginDialog _ui;
+	QStringList      _magTypes;
+};
+
+
+} // namespace Gui
+} // namespace Seiscomp
+
+#endif

include/seiscomp/gui/datamodel/originlocatormap.h

@@ -0,0 +1,132 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_ORIGINLOCATORMAP_H
+#define SEISCOMP_GUI_ORIGINLOCATORMAP_H
+
+
+#include <QtGui>
+#include <seiscomp/gui/map/mapwidget.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/origin.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+
+namespace DataModel {
+
+DEFINE_SMARTPOINTER(Station);
+
+}
+
+namespace Gui {
+
+namespace Map {
+
+class AnnotationLayer;
+
+}
+
+class OriginSymbol;
+
+class SC_GUI_API OriginLocatorMap : public MapWidget {
+	Q_OBJECT
+
+	public:
+		OriginLocatorMap(const MapsDesc &maps,
+		                 QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		OriginLocatorMap(Map::ImageTree* mapTree,
+		                 QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		//! Sets the maximum distance for stations to be displayed
+		//! if they are not part of the origin
+		void setStationsMaxDist(double);
+
+		//! Make the station state changeable interactively
+		//! The default is TRUE
+		void setStationsInteractive(bool);
+		void setOrigin(DataModel::Origin* o);
+
+		bool waveformPropagation() const;
+		bool drawStations() const;
+
+		void setArrivalState(int id, bool state);
+		void setStationState(const std::string& code, bool state);
+
+		void setOriginCreationEnabled(bool enable);
+
+		void addLayer(Map::Layer *layer);
+
+
+	public slots:
+		void setDrawStations(bool);
+		void setDrawStationLines(bool);
+		void setDrawStationAnnotations(bool);
+		void setWaveformPropagation(bool);
+
+
+	signals:
+#ifndef Q_MOC_RUN
+	// This is in particular for Qt 4 where signals are protected by default.
+	public:
+#endif
+		void hoverArrival(int id);
+
+	signals:
+		void clickedArrival(int id);
+		void arrivalChanged(int id, bool state);
+		void clickedStation(const std::string &net, const std::string &code);
+		void stationChanged(const std::string &stationCode, bool state);
+		void artificialOriginRequested(const QPointF &epicenter,
+		                               const QPoint &dialogPos);
+
+
+	protected:
+		void mousePressEvent(QMouseEvent*);
+		void mouseDoubleClickEvent(QMouseEvent*);
+		void contextMenuEvent(QContextMenuEvent*);
+
+
+	private:
+		void addArrival();
+		void setStationState(int i, bool state);
+
+
+	private:
+		DataModel::OriginPtr       _origin;
+		OriginSymbol              *_originSymbol;
+		Map::Layer                *_symbolLayer;
+		Map::AnnotationLayer      *_annotationLayer;
+		bool                       _waveformPropagation{false};
+		bool                       _enabledCreateOrigin{false};
+		QVector<int>               _arrivals;
+		std::map<std::string, int> _stationCodes;
+		double                     _stationsMaxDist{-1};
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/datamodel/originlocatorview.h

@@ -0,0 +1,488 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_ORIGINLOCATORVIEW_H
+#define SEISCOMP_GUI_ORIGINLOCATORVIEW_H
+
+
+#include <seiscomp/gui/core/diagramwidget.h>
+#include <seiscomp/gui/datamodel/originlocatormap.h>
+#include <seiscomp/gui/datamodel/pickerview.h>
+#include <seiscomp/gui/map/mapwidget.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/databasequery.h>
+#include <seiscomp/datamodel/pick.h>
+#include <seiscomp/datamodel/amplitude.h>
+#include <seiscomp/datamodel/origin.h>
+#include <seiscomp/seismology/locatorinterface.h>
+#include <seiscomp/core/baseobject.h>
+#endif
+
+#include <QAbstractItemModel>
+#include <QStyledItemDelegate>
+
+#include <set>
+
+
+// Ui forward declarations
+class QTreeWidgetItem;
+
+namespace Ui {
+	class OriginLocatorView;
+	class FilterSettings;
+}
+
+
+
+namespace Seiscomp {
+
+namespace DataModel {
+
+DEFINE_SMARTPOINTER(Event);
+DEFINE_SMARTPOINTER(Arrival);
+DEFINE_SMARTPOINTER(Station);
+
+}
+
+namespace Gui {
+
+
+class PickerView;
+class RecordStreamThread;
+
+
+class SC_GUI_API ArrivalModel : public QAbstractTableModel {
+	Q_OBJECT
+
+	public:
+		struct Filter {
+			virtual ~Filter() {}
+			virtual bool accepts(int row, int idx, DataModel::Arrival *) const = 0;
+		};
+
+	public:
+		ArrivalModel(DataModel::Origin* origin = nullptr, QObject *parent = 0);
+
+	public:
+		void setDisabledForeground(QColor c) { _disabledForeground = c; }
+
+		void setOrigin(DataModel::Origin* origin);
+		DataModel::Origin *origin() const;
+
+		void setRowColor(int row, const QColor&);
+
+		int rowCount(const QModelIndex &parent = QModelIndex()) const;
+		int columnCount(const QModelIndex &parent = QModelIndex()) const;
+
+		QVariant data(const QModelIndex &index, int role) const;
+		QVariant headerData(int section, Qt::Orientation orientation,
+		                    int role = Qt::DisplayRole) const;
+
+		Qt::ItemFlags flags(const QModelIndex &index) const;
+		bool setData(const QModelIndex &index, const QVariant &value,
+		             int role = Qt::EditRole);
+
+		void setRowEnabled(int row, bool enabled);
+		bool isRowEnabled(int row) const;
+
+		void setTakeOffAngle(int row, const QVariant &val);
+
+		bool useNoArrivals() const;
+		bool useArrival(int row) const;
+		void setUseArrival(int row, DataModel::Arrival *arrival);
+
+		bool backazimuthUsed(int row) const;
+		void setBackazimuthUsed(int row, bool enabled);
+
+		bool horizontalSlownessUsed(int row) const;
+		void setHorizontalSlownessUsed(int row, bool enabled);
+
+		bool timeUsed(int row) const;
+		void setTimeUsed(int row, bool enabled);
+
+		int  usedFlags(int row) const;
+
+	private:
+		static const int F_DISABLED = 1 << 31;
+
+		DataModel::Origin *_origin;
+		QVector<int>       _used;
+		QVector<int>       _hoverState;
+		QVector<QVariant>  _takeOffs;
+		QVector<bool>      _enableState;
+		QVector<QVariant>  _backgroundColors;
+		QColor             _disabledForeground;
+		QStringList        _header;
+		std::string        _pickTimeFormat;
+};
+
+
+class SC_GUI_API ArrivalDelegate : public QStyledItemDelegate {
+	Q_OBJECT
+
+	public:
+		ArrivalDelegate(QWidget *parent = 0);
+
+	public:
+		void paint(QPainter * painter, const QStyleOptionViewItem & option,
+		           const QModelIndex & index) const;
+
+		bool editorEvent(QEvent *event, QAbstractItemModel *model,
+		                 const QStyleOptionViewItem &option,
+		                 const QModelIndex &index);
+
+		QSize sizeHint(const QStyleOptionViewItem &option,
+		               const QModelIndex &index) const;
+
+	public slots:
+		bool helpEvent(QHelpEvent *event, QAbstractItemView *view,
+		               const QStyleOptionViewItem &option,
+		               const QModelIndex &index);
+
+	private:
+		int         _flags[3];
+		QString     _labels[3];
+		int         _margin;
+		int         _spacing;
+		int         _statusRectWidth;
+		mutable int _labelWidth;
+};
+
+
+class SC_GUI_API DiagramFilterSettingsDialog : public QDialog {
+	Q_OBJECT
+
+	public:
+		struct Filter {
+			virtual ~Filter() {};
+			virtual bool accepts(DiagramWidget *w, int id) = 0;
+		};
+
+
+	public:
+		DiagramFilterSettingsDialog(QWidget *parent = 0);
+		~DiagramFilterSettingsDialog();
+
+		Filter *createFilter() const;
+
+
+	private slots:
+		void filterChanged(int);
+
+	private:
+		::Ui::FilterSettings *_ui;
+};
+
+
+class SC_GUI_API OriginLocatorPlot : public DiagramWidget {
+	Q_OBJECT
+
+	public:
+		OriginLocatorPlot(QWidget *parent = 0);
+
+
+	signals:
+		void focalMechanismCommitted(bool withMT = false,
+		                             QPoint pos = QPoint(0, 0));
+
+
+	protected slots:
+		virtual void linkClicked();
+		virtual void commitButtonClicked(bool);
+		virtual void commitWithMTTriggered(bool);
+};
+
+
+class OriginLocatorViewPrivate;
+
+
+class SC_GUI_API OriginLocatorView : public QWidget {
+	Q_OBJECT
+
+	public:
+		struct SC_GUI_API Config {
+			double reductionVelocityP;
+			bool   drawMapLines;
+			bool   drawGridLines;
+			bool   computeMissingTakeOffAngles;
+			double defaultEventRadius;
+
+			Config();
+		};
+
+		typedef std::vector<DataModel::PickPtr> PickList;
+		typedef std::set<std::pair<DataModel::PickPtr, bool> > PickSet;
+		typedef std::set<std::pair<DataModel::AmplitudePtr, bool> > AmplitudeSet;
+		typedef std::set<std::string> StringSet;
+		typedef std::map<std::string, DataModel::PickPtr> PickMap;
+
+
+	public:
+		OriginLocatorView(const MapsDesc &maps,
+		                  const PickerView::Config &pickerConfig,
+		                  QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		OriginLocatorView(Map::ImageTree* mapTree,
+		                  const PickerView::Config &pickerConfig,
+		                  QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~OriginLocatorView();
+
+	signals:
+		void waveformsRequested();
+		void eventListRequested();
+		void locatorRequested();
+		void computeMagnitudesRequested();
+
+		void baseEventSet();
+		void baseEventRejected();
+
+		//! When a new origin has been set inside the view this signal
+		//! is emitted. The bool flag signal whether a new origin has been
+		//! created or not
+		void newOriginSet(Seiscomp::DataModel::Origin *newOrigin,
+		                  Seiscomp::DataModel::Event *event, bool localOrigin,
+		                  bool relocated);
+		void updatedOrigin(Seiscomp::DataModel::Origin* origin);
+		void committedOrigin(Seiscomp::DataModel::Origin* origin,
+		                     Seiscomp::DataModel::Event* baseEvent,
+		                     const Seiscomp::Gui::ObjectChangeList<Seiscomp::DataModel::Pick>& changedPicks,
+		                     const std::vector<Seiscomp::DataModel::AmplitudePtr>& newAmplitudes);
+		void committedFocalMechanism(Seiscomp::DataModel::FocalMechanism *fm,
+		                             Seiscomp::DataModel::Event *event,
+		                             Seiscomp::DataModel::Origin *origin);
+
+		void artificalOriginCreated(Seiscomp::DataModel::Origin*);
+
+		void magnitudesAdded(Seiscomp::DataModel::Origin*, Seiscomp::DataModel::Event*);
+
+		void undoStateChanged(bool undoState);
+		void redoStateChanged(bool undoState);
+
+		void requestRaise();
+
+	public slots:
+		void clear();
+
+		void addObject(const QString& parentID, Seiscomp::DataModel::Object*);
+		void updateObject(const QString& parentID, Seiscomp::DataModel::Object*);
+
+		bool setOrigin(Seiscomp::DataModel::Origin*, Seiscomp::DataModel::Event*, bool = false);
+		void addPick(Seiscomp::DataModel::Pick*);
+
+		void setStationEnabled(const std::string& networkCode,
+		                       const std::string& stationCode,
+		                       bool state);
+
+		void setMagnitudeCalculationEnabled(bool);
+		void computeMagnitudes();
+		void magnitudeRemoved(const QString &, Seiscomp::DataModel::Object*);
+		void magnitudeSelected(const QString &, Seiscomp::DataModel::Magnitude*);
+
+		void mergeOrigins(QList<Seiscomp::DataModel::Origin*>);
+		void setLocalAmplitudes(Seiscomp::DataModel::Origin*, AmplitudeSet*, StringSet*);
+
+		void drawStations(bool);
+		void drawStationAnnotations(bool);
+
+		bool undo();
+		bool redo();
+
+		void createArtificialOrigin();
+		void createArtificialOrigin(const QPointF &epicenter,
+		                            const QPoint &dialogPos);
+
+	// ----------------------------------------------------------------------
+	//  Public interface
+	// ----------------------------------------------------------------------
+	public:
+		// Scripts
+		void setScript0(const std::string&);
+		void setScript1(const std::string&);
+
+		// Configuration
+		void setConfig(const Config&);
+		const Config &config() const;
+
+		/**
+		 * @brief Adds a pick to the internal pick list which will be
+		 *        sent along with the origin at commit.
+		 * @param pick The pick to be managed with a smart pointer.
+		 */
+		void addLocalPick(Seiscomp::DataModel::Pick *pick);
+
+		// Manual picker configuration
+		void setPickerConfig(const PickerView::Config&);
+		const PickerView::Config& pickerConfig() const;
+
+		// Misc
+		void setDatabase(Seiscomp::DataModel::DatabaseQuery*);
+		void setPickerView(PickerView*);
+
+		OriginLocatorMap* map() const;
+
+
+	protected:
+		void closeEvent(QCloseEvent *e);
+
+
+	private slots:
+		void editComment();
+		void setOrigin(Seiscomp::DataModel::Origin*);
+		void setCreatedOrigin(Seiscomp::DataModel::Origin*);
+
+		void hoverArrival(int);
+		void selectArrival(int);
+		void selectStation(const std::string &, const std::string &);
+		void residualsSelected();
+		void adjustResidualsRect(QRectF&);
+
+		void selectRow(const QModelIndex&, const QModelIndex&);
+
+		void plotTabChanged(int);
+
+		void zoomMap();
+
+		void mapKeyPressed(QKeyEvent*);
+		void objectDestroyed(QObject*);
+
+		void importArrivals();
+		void showWaveforms();
+		void relocate();
+		void commit(bool associate = true, bool ignoreDefaultEventType = false);
+		void customCommit();
+		void commitFocalMechanism(bool withMT = false, QPoint pos = QPoint(0, 0));
+		void commitWithOptions();
+
+		void tableArrivalsContextMenuRequested(const QPoint &pos);
+		void tableArrivalsHeaderContextMenuRequested(const QPoint &pos);
+		void dataChanged(const QModelIndex& topLeft, const QModelIndex& bottomRight);
+		void changeArrival(int,bool);
+		void changeArrivalEnableState(int,bool);
+		void artificialOriginRequested(double lat, double lon, double depth, Seiscomp::Core::Time time);
+
+		void updateBlinkState();
+
+		void locatorProfileChanged(const QString &text);
+		void locatorChanged(const QString &text);
+		void configureLocator();
+
+		void changePlotFilter();
+
+		void runScript0();
+		void runScript1();
+
+		void evalResultAvailable(const QString &originID,
+		                         const QString &className,
+		                         const QString &script,
+		                         const QString &result);
+
+		void evalResultError(const QString &originID,
+		                     const QString &className,
+		                     const QString &script,
+		                     int error);
+
+		void evaluateOrigin(Seiscomp::DataModel::Origin *org,
+		                    Seiscomp::DataModel::Event *event,
+		                    bool localOrigin, bool relocated);
+
+	private:
+		struct PhasePickWithFlags {
+			DataModel::PickPtr pick;
+			std::string        phase;
+			int                flags;
+		};
+
+		void init();
+
+		void createArtificialOrigin(const QPointF &epicenter,
+		                            double depth,
+		                            Seiscomp::Core::Time time,
+		                            const QPoint &dialogPos);
+
+		void updateOrigin(Seiscomp::DataModel::Origin*);
+		void updateContent();
+		void addArrival(int idx, DataModel::Arrival* arrival, const Core::Time &, const QColor&);
+
+		void readPicks(Seiscomp::DataModel::Origin*);
+
+		bool merge(void *sourcePhases, void *targetPhases, bool checkDuplicates,
+		           bool associateOnly, bool failOnNoNewPhases);
+
+		void relocate(std::vector<PhasePickWithFlags>* additionalPicks,
+		              bool associateOnly = false,
+		              bool replaceExistingPhases = false);
+
+		void relocate(DataModel::Origin *org,
+		              std::vector<PhasePickWithFlags>* additionalPicks,
+		              bool associateOnly = false,
+		              bool replaceExistingPhases = false,
+		              bool useArrivalTable = true);
+
+		void applyNewOrigin(DataModel::Origin *org, bool relocated);
+
+		void pushUndo();
+
+		void startBlinking(QColor, QWidget *);
+		void stopBlinking();
+
+		void runScript(const QString &script, const QString &name);
+
+		void selectArrivals(const ArrivalModel::Filter *f);
+		void selectArrivals(const ArrivalModel::Filter &f);
+
+		void setPlotFilter(DiagramFilterSettingsDialog::Filter *f);
+		void applyPlotFilter();
+
+		bool sendJournal(const std::string &objectID,
+		                 const std::string &action,
+		                 const std::string &params);
+
+		DataModel::Notifier *
+		createJournal(const std::string &objectID, const std::string &action,
+		              const std::string &params);
+
+		void setBaseEvent(DataModel::Event *e);
+		void resetCustomLabels();
+
+		void deleteSelectedArrivals();
+		void activateSelectedArrivals(Seiscomp::Seismology::LocatorInterface::Flags flags,
+		                              bool activate);
+		void renameArrivals();
+
+		void commitWithOptions(const void *options);
+
+
+	private:
+		OriginLocatorViewPrivate *_d_ptr;
+};
+
+
+inline DataModel::Origin *ArrivalModel::origin() const {
+	return _origin;
+}
+
+inline int ArrivalModel::usedFlags(int row) const {
+	return _used[row];
+}
+
+
+}
+}
+
+#endif

include/seiscomp/gui/datamodel/originsymbol.h

@@ -0,0 +1,141 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_ORIGIN_H
+#define SEISCOMP_GUI_ORIGIN_H
+
+
+#include <vector>
+#include <string>
+
+#include <QPolygon>
+#include <QColor>
+#include <QPoint>
+#include <QPainter>
+
+#include <seiscomp/gui/qt.h>
+#include <seiscomp/gui/map/mapsymbol.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/origin.h>
+#endif
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class Canvas;
+
+
+class SC_GUI_API OriginSymbol : public Map::Symbol {
+	public:
+		OriginSymbol(Map::Decorator* decorator = nullptr);
+		OriginSymbol(double latitude,
+		             double longitude,
+		             double depth = 0,
+		             Map::Decorator* decorator = nullptr);
+
+	public:
+		void setPreferredMagnitudeValue(double magnitudeValue);
+		double preferredMagnitudeValue() const;
+
+		/**
+		 * @brief Sets the symbol depth and updates the color according
+		 *        to scheme.colors.originSymbol.depth.gradient.
+		 * @param depth The depth in km
+		 */
+		void setDepth(double depth);
+		double depth() const;
+
+		/**
+		 * @brief Sets the symbol color and therefore overrides what
+		 *        a prior call to setDepth has been set. This method was
+		 *        added with API version 11.
+		 * @param c The desired color
+		 */
+		void setColor(const QColor &c);
+
+		/**
+		 * @brief Returns the current color. This method was added with API
+		 *        version 11.
+		 * @return The current symbol color.
+		 */
+		const QColor &color() const;
+
+		/**
+		 * @brief Sets the symbols fill color if filling is enabled. This
+		 *        overrides the default fill color set with setDepth.
+		 *        This method was added with API version 11.
+		 * @param c The fill color
+		 */
+		void setFillColor(const QColor &c);
+
+		/**
+		 * @brief Returns the current fill color.
+		 *        This method was added with API version 11.
+		 * @return The fill color
+		 */
+		const QColor &fillColor() const;
+
+		void setFilled(bool val);
+		bool isFilled() const;
+
+		bool isInside(int x, int y) const override;
+
+		/**
+		 * @brief Returns the size of an origin symbol in pixel depending on
+		 *        the magnitude.
+		 * @param mag The input magnitude
+		 * @return The size in pixels
+		 */
+		static int getSize(double mag);
+
+
+	protected:
+		void customDraw(const Map::Canvas *canvas, QPainter &painter) override;
+
+		void init();
+		void updateSize();
+		void depthColorCoding();
+
+
+	protected:
+		QColor _color;
+		QColor _fillColor;
+		bool   _filled{false};
+		double _magnitude{0};
+		double _depth{0};
+};
+
+
+inline const QColor &OriginSymbol::color() const {
+	return _color;
+}
+
+inline const QColor &OriginSymbol::fillColor() const {
+	return _fillColor;
+}
+
+
+} // namespace Gui
+} // namespace Seiscomp
+
+
+#endif

include/seiscomp/gui/datamodel/origintime.h

@@ -0,0 +1,52 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_ORIGINTIME_H
+#define SEISCOMP_GUI_ORIGINTIME_H
+
+
+#include <QtGui>
+#include <seiscomp/gui/datamodel/ui_origintime.h>
+#include <seiscomp/core/datetime.h>
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API OriginTimeDialog : public QDialog {
+	public:
+		OriginTimeDialog(double lon, double lat,
+		                 Seiscomp::Core::Time time,
+		                 QWidget * parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		Seiscomp::Core::Time time() const;
+
+	private:
+		Ui::OriginTimeDialog _ui;
+};
+
+
+}
+}
+
+#endif

include/seiscomp/gui/datamodel/pickersettings.h

@@ -0,0 +1,109 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+
+#ifndef SEISCOMP_GUI_WAVEFORMSETTINGS_H
+#define SEISCOMP_GUI_WAVEFORMSETTINGS_H
+
+#include <seiscomp/gui/datamodel/ui_pickersettings.h>
+#include <seiscomp/gui/datamodel/pickerview.h>
+#include <seiscomp/gui/datamodel/amplitudeview.h>
+#include <seiscomp/gui/datamodel/originlocatorview.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API PickerSettings : public QDialog {
+	Q_OBJECT
+
+	public:
+		PickerSettings(const OriginLocatorView::Config &c1,
+		               const PickerView::Config &c2,
+		               const AmplitudeView::Config &c3,
+		               QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~PickerSettings();
+
+
+	public:
+		const Ui::PickerSettings &ui() const { return _ui; }
+
+		OriginLocatorView::Config locatorConfig() const;
+		PickerView::Config pickerConfig() const;
+		AmplitudeView::Config amplitudeConfig() const;
+
+		void setSaveEnabled(bool);
+
+		bool saveSettings() const;
+
+		int exec();
+
+
+	signals:
+		void saveRequested();
+
+
+	private slots:
+		void save();
+
+		void adjustPreTime(int);
+		void adjustPostTime(int);
+		void adjustLength(int);
+
+		void adjustPreSlider(const QTime&);
+		void adjustPostSlider(const QTime&);
+		void adjustLengthSlider(const QTime&);
+
+		void adjustAmplitudePreTime(int);
+		void adjustAmplitudePostTime(int);
+
+		void adjustAmplitudePreSlider(const QTime&);
+		void adjustAmplitudePostSlider(const QTime&);
+
+		void addPickFilter();
+		void removePickFilter();
+
+		void movePickFilterUp();
+		void movePickFilterDown();
+
+		void addAmplitudeFilter();
+		void removeAmplitudeFilter();
+
+		void moveAmplitudeFilterUp();
+		void moveAmplitudeFilterDown();
+
+
+	private:
+		Ui::PickerSettings                _ui;
+		bool                              _saveSettings;
+		QAbstractListModel               *_pickerFilterModel;
+		QAbstractListModel               *_amplitudeFilterModel;
+		mutable OriginLocatorView::Config _locatorConfig;
+		mutable PickerView::Config        _pickerConfig;
+		mutable AmplitudeView::Config     _amplitudeConfig;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/datamodel/pickerview.h

@@ -0,0 +1,633 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_PICKERVIEW_H
+#define SEISCOMP_GUI_PICKERVIEW_H
+
+
+#include <seiscomp/gui/core/recordview.h>
+#include <seiscomp/gui/core/connectionstatelabel.h>
+#include <seiscomp/gui/core/utils.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/io/recordfilter/iirfilter.h>
+#include <seiscomp/datamodel/databasequery.h>
+#include <seiscomp/datamodel/origin.h>
+#include <seiscomp/datamodel/pick.h>
+#include <seiscomp/seismology/ttt.h>
+#include <seiscomp/math/matrix3.h>
+#include <seiscomp/processing/picker.h>
+#endif
+#include <QActionGroup>
+#include <QComboBox>
+#include <QPushButton>
+#include <QSpinBox>
+#include <QMovie>
+#include <QSet>
+#include <QLabel>
+#include <QLineEdit>
+#include <QMainWindow>
+
+
+namespace Seiscomp {
+
+namespace DataModel {
+
+class SensorLocation;
+
+}
+
+namespace Processing {
+
+DEFINE_SMARTPOINTER(AmplitudeProcessor);
+
+}
+
+namespace Gui {
+
+class TimeScale;
+class PickerView;
+class SpectrumWidget;
+
+
+namespace PrivatePickerView {
+
+
+class SC_GUI_API ThreeComponentTrace : public QObject {
+	Q_OBJECT
+
+	public:
+		ThreeComponentTrace() = default;
+		~ThreeComponentTrace();
+
+	public:
+		void setTransformationEnabled(bool enable);
+		void setL2Horizontals(bool);
+		void setPassThrough(int component, bool enable);
+		void setRecordWidget(RecordWidget *);
+		void reset();
+		void setFilter(RecordWidget::Filter *);
+		bool transform(int comp = -1, Seiscomp::Record *rec = nullptr);
+
+	private slots:
+		void widgetDestroyed(QObject *obj);
+
+	public:
+		typedef IO::RecordIIRFilter<double> Filter;
+
+		// One component
+		struct Component {
+			std::string         channelCode;
+			RecordSequence     *raw{nullptr};
+			RecordSequence     *transformed{nullptr};
+			Filter              filter{nullptr};
+			RecordStreamThread *thread{nullptr};
+			bool                passthrough{false};
+		};
+
+		Math::Matrix3d  transformation;
+		Component       traces[3];
+		RecordWidget   *widget{nullptr};
+		bool            enableTransformation{false};
+		bool            enableL2Horizontals{false};
+};
+
+
+class SC_GUI_API PickerRecordLabel : public StandardRecordLabel {
+	Q_OBJECT
+
+	public:
+		PickerRecordLabel(int items=3, QWidget *parent=0, const char* name = 0);
+		~PickerRecordLabel();
+
+
+	public:
+		void setConfigState(bool);
+
+		void setControlledItem(RecordViewItem *controlledItem);
+		RecordViewItem *controlledItem() const;
+
+		void setLinkedItem(bool sm);
+
+		void enabledExpandButton(RecordViewItem *controlledItem);
+		void disableExpandButton();
+		void unlink();
+
+		bool isLinkedItem() const;
+		bool isExpanded() const;
+
+		void setLabelColor(QColor);
+		void removeLabelColor();
+
+
+	protected:
+		void visibilityChanged(bool);
+		void resizeEvent(QResizeEvent *e);
+		void paintEvent(QPaintEvent *e);
+
+
+	public slots:
+		void extentButtonPressed();
+
+	private slots:
+		void enableExpandable(const Seiscomp::Record*);
+
+
+	private:
+		bool            _isLinkedItem;
+		bool            _isExpanded;
+		QPushButton    *_btnExpand;
+		RecordViewItem *_linkedItem;
+		bool            _hasLabelColor;
+		QColor          _labelColor;
+
+	private:
+		double               latitude;
+		double               longitude;
+		int                  unit;
+		QString              gainUnit[3];
+		ThreeComponentTrace  data;
+		Math::Matrix3d       orientationZNE;
+		Math::Matrix3d       orientationZRT;
+
+		bool                 hasGotData;
+		bool                 isEnabledByConfig;
+
+	friend class Gui::PickerView;
+};
+
+
+}
+
+
+class SC_GUI_API PickerMarkerActionPlugin : public QObject {
+	public:
+		virtual ~PickerMarkerActionPlugin() {}
+
+	public:
+		//! Returns the action title as added to the context menu
+		virtual QString title() const = 0;
+
+		virtual bool init(const DataModel::WaveformStreamID &wid,
+		                  const Core::Time &time) = 0;
+
+		//! Feed a record of the current stream (including all available
+		//! components)
+		virtual void setRecords(RecordSequence *seqZ, RecordSequence *seq1, RecordSequence *seq2) = 0;
+
+		//! Finalize the action, no more data will be fed a this point
+		virtual void finalize() = 0;
+};
+
+
+DEFINE_INTERFACE_FACTORY(PickerMarkerActionPlugin);
+
+
+class SpectrumViewBase : public QWidget {
+	Q_OBJECT
+
+	public:
+		SpectrumViewBase(QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags())
+		: QWidget(parent, f) {}
+
+	protected slots:
+		virtual void modeChanged(int) = 0;
+		virtual void windowFuncChanged(int) = 0;
+		virtual void windowWidthChanged(double) = 0;
+};
+
+
+class PickerViewPrivate;
+
+
+class SC_GUI_API PickerView : public QMainWindow {
+	public:
+		struct SC_GUI_API Config {
+			typedef QPair<QString, QString> FilterEntry;
+			typedef QVector<FilterEntry> FilterList;
+			typedef QList<QString> StringList;
+			typedef StringList PhaseList;
+
+			struct PhaseGroup {
+				QString name;
+				QList<PhaseGroup> childs;
+			};
+
+			typedef QList<PhaseGroup> GroupList;
+			typedef QPair<float, float> Uncertainty;
+			typedef QVector<Uncertainty> UncertaintyList;
+			typedef QMap<QString, UncertaintyList> UncertaintyProfiles;
+			typedef QPair<QString, QString> ChannelMapItem;
+			typedef QMultiMap<QString, ChannelMapItem> ChannelMap;
+
+			QString recordURL;
+			ChannelMap channelMap;
+
+			FilterList filters;
+
+			QString integrationFilter;
+			bool onlyApplyIntegrationFilterOnce;
+
+			GroupList phaseGroups;
+			PhaseList favouritePhases;
+
+			PhaseList showPhases;
+
+			UncertaintyProfiles uncertaintyProfiles;
+			QString uncertaintyProfile;
+
+			bool showCrossHair;
+
+			bool ignoreUnconfiguredStations;
+			bool ignoreDisabledStations;
+			bool loadAllComponents;
+			bool loadAllPicks;
+			bool loadStrongMotionData;
+			bool usePerStreamTimeWindows;
+			bool limitStations;
+			bool showAllComponents;
+			bool hideStationsWithoutData;
+			bool hideDisabledStations;
+
+			int    limitStationCount;
+			double allComponentsMaximumStationDistance;
+			double defaultAddStationsDistance;
+
+			double defaultDepth;
+
+			bool removeAutomaticStationPicks;
+			bool removeAutomaticPicks;
+
+			Core::TimeSpan preOffset;
+			Core::TimeSpan postOffset;
+			Core::TimeSpan minimumTimeWindow;
+
+			double alignmentPosition;
+			double offsetWindowStart;
+			double offsetWindowEnd;
+
+			QColor timingQualityLow;
+			QColor timingQualityMedium;
+			QColor timingQualityHigh;
+
+			OPT(double) repickerSignalStart;
+			OPT(double) repickerSignalEnd;
+
+			Config();
+
+			void addFilter(const QString &f, const QString &n) {
+				filters.push_back(QPair<QString, QString>(f, n));
+			}
+
+			void addShowPhase(const QString &ph) {
+				showPhases.push_back(ph);
+			}
+
+			void getPickPhases(StringList &phases) const;
+			void getPickPhases(StringList &phases, const QList<PhaseGroup> &groups) const;
+		};
+
+
+	Q_OBJECT
+
+	public:
+		//! Default c'tor
+		//! The mode defaults to ringbuffer with a buffer
+		//! size of 30 minutes
+		PickerView(QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		//! Creates a RecordView using a time window
+		PickerView(const Seiscomp::Core::TimeWindow&,
+		           QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		//! Creates a RecordView using a timespan and
+		//! a ringbuffer
+		PickerView(const Seiscomp::Core::TimeSpan&,
+		           QWidget *parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+		~PickerView();
+
+	public:
+		bool setConfig(const Config &c, QString *error = nullptr);
+
+		void setDatabase(Seiscomp::DataModel::DatabaseQuery*);
+		void activateFilter(int index);
+
+		void setBroadBandCodes(const std::vector<std::string> &codes);
+		void setStrongMotionCodes(const std::vector<std::string> &codes);
+
+		void setAuxiliaryChannels(const std::vector<std::string> &patterns,
+		                          double minimumDistance, double maximumDistance);
+
+		//! Sets an origin an inserts the traces for each arrival
+		//! in the view.
+		bool setOrigin(Seiscomp::DataModel::Origin*,
+		               double relTimeWindowStart,
+		               double relTimeWindowEnd);
+
+		//! Sets an origin and keeps all available traces
+		bool setOrigin(Seiscomp::DataModel::Origin*);
+
+		bool hasModifiedPicks() const;
+		void getChangedPicks(ObjectChangeList<DataModel::Pick> &list) const;
+
+		void stop();
+
+		void selectTrace(const std::string &, const std::string &);
+		void selectTrace(const Seiscomp::DataModel::WaveformStreamID &wid);
+
+
+	signals:
+		void requestArtificialOrigin(double lat, double lon, double depth, Seiscomp::Core::Time time);
+		void originCreated(Seiscomp::DataModel::Origin*);
+		void arrivalChanged(int id, bool state);
+		void arrivalEnableStateChanged(int id, bool state);
+
+
+	public slots:
+		void setDefaultDisplay();
+		void applyPicks();
+		void changeFilter(int);
+		void changeRotation(int);
+		void changeUnit(int);
+		void setArrivalState(int arrivalId, bool state);
+		void addPick(Seiscomp::DataModel::Pick* pick);
+
+		void setStationEnabled(const std::string& networkCode,
+		                       const std::string& stationCode,
+		                       bool state);
+
+
+	private slots:
+		void receivedRecord(Seiscomp::Record*);
+
+		void updateTraceInfo(RecordViewItem*, const Seiscomp::Record*);
+		void currentMarkerChanged(Seiscomp::Gui::RecordMarker*);
+		void apply(QAction*);
+		void setPickPhase(QAction*);
+		void alignOnPhase(QAction*);
+		void onAddedItem(const Seiscomp::Record*, Seiscomp::Gui::RecordViewItem*);
+		void onSelectedTime(Seiscomp::Core::Time);
+		void onSelectedTime(Seiscomp::Gui::RecordWidget*, Seiscomp::Core::Time);
+		void setAlignment(Seiscomp::Core::Time);
+		void acquisitionFinished();
+		void handleAcquisitionError(const QString &msg);
+		void relocate();
+		void modifyOrigin();
+		void updateTheoreticalArrivals();
+		void itemSelected(RecordViewItem*, RecordViewItem*);
+		void updateMainCursor(RecordWidget*,int);
+		void updateSubCursor(RecordWidget*,int);
+		void updateItemLabel(RecordViewItem*, char);
+		void updateItemRecordState(const Seiscomp::Record*);
+		void updateRecordValue(Seiscomp::Core::Time);
+		void showTraceScaleToggled(bool);
+
+		void specLogToggled(bool);
+		void specSmoothToggled(bool);
+		void specMinValue(double);
+		void specMaxValue(double);
+		void specTimeWindow(double);
+		void specApply();
+
+		void limitFilterToZoomTrace(bool);
+
+		void showTheoreticalArrivals(bool);
+		void showUnassociatedPicks(bool);
+		void showSpectrogram(bool);
+		void showSpectrum();
+
+		void toggleFilter();
+		void nextFilter();
+		void previousFilter();
+		void addNewFilter(const QString&);
+
+		void scaleVisibleAmplitudes();
+
+		void zoomSelectionHandleMoved(int, double, Qt::KeyboardModifiers);
+		void zoomSelectionHandleMoveFinished();
+
+		void changeScale(double, double);
+		void changeTimeRange(double, double);
+
+		void sortAlphabetically();
+		void sortByDistance();
+		void sortByAzimuth();
+		void sortByResidual();
+		void sortByPhase(const QString&);
+
+		void showAllComponents(bool);
+		void showZComponent();
+		void showNComponent();
+		void showEComponent();
+
+		void alignOnOriginTime();
+		void alignOnPArrivals();
+		void alignOnSArrivals();
+
+		void pickNone(bool);
+		void pickP(bool);
+		void pickS(bool);
+
+		void scaleAmplUp();
+		void scaleAmplDown();
+		void scaleTimeUp();
+		void scaleTimeDown();
+
+		void scaleReset();
+
+		void scrollLeft();
+		void scrollFineLeft();
+		void scrollRight();
+		void scrollFineRight();
+
+		void automaticRepick();
+		void gotoNextMarker();
+		void gotoPreviousMarker();
+
+		void createPick();
+		void setPick();
+		void confirmPick();
+		void resetPick();
+		void deletePick();
+
+		void setCurrentRowEnabled(bool);
+		void setCurrentRowDisabled(bool);
+
+		void loadNextStations();
+		void showUsedStations(bool);
+
+		void moveTraces(double offset);
+		void move(double offset);
+		void zoom(float factor);
+		void applyTimeRange(double,double);
+
+		void sortByState();
+		void alignByState();
+		void componentByState();
+		void updateLayoutFromState();
+
+		void firstConnectionEstablished();
+		void lastConnectionClosed();
+
+		void beginWaitForRecords();
+		void doWaitForRecords(int value);
+		void endWaitForRecords();
+
+		void showFullscreen(bool);
+
+		void enableAutoScale();
+		void disableAutoScale();
+
+		void addStations();
+
+		void searchStation();
+		void search(const QString&);
+		void nextSearch();
+		void abortSearchStation();
+
+		void setPickPolarity();
+		void setPickOnset();
+		void setPickUncertainty();
+
+		void openContextMenu(const QPoint &p);
+		void openRecordContextMenu(const QPoint &p);
+
+		void previewUncertainty(QAction *);
+		void previewUncertainty(double lower, double upper);
+
+		void openConnectionInfo(const QPoint &);
+		void destroyedSpectrumWidget(QObject *);
+
+		void ttInterfaceChanged(QString);
+		void ttTableChanged(QString);
+
+
+	protected:
+		void showEvent(QShowEvent* event);
+
+		RecordLabel* createLabel(RecordViewItem*) const;
+
+
+	private:
+		void figureOutTravelTimeTable();
+
+		void init();
+		void initPhases();
+		bool fillTheoreticalArrivals();
+		bool fillRawPicks();
+
+		int loadPicks();
+
+		const TravelTime* findPhase(const TravelTimeList &list, const QString &phase, double delta);
+
+		RecordViewItem* addStream(const DataModel::SensorLocation *,
+		                          const DataModel::WaveformStreamID& streamID,
+		                          double distance,
+		                          const std::string& text,
+		                          bool showDisabled,
+		                          bool addTheoreticalArrivals,
+		                          const DataModel::Stream *base = nullptr);
+
+		RecordViewItem* addRawStream(const DataModel::SensorLocation *,
+		                             const DataModel::WaveformStreamID& streamID,
+		                             double distance,
+		                             const std::string& text,
+		                             bool addTheoreticalArrivals,
+		                             const DataModel::Stream *base = nullptr);
+
+		void queueStream(double dist, const DataModel::WaveformStreamID& streamID, char component);
+
+		void setupItem(const char comps[3], RecordViewItem*);
+		bool addTheoreticalArrivals(RecordViewItem*,
+		                            const std::string& netCode,
+		                            const std::string& staCode,
+		                            const std::string& locCode);
+
+		bool addRawPick(Seiscomp::DataModel::Pick*);
+
+		void resetState();
+		void alignOnPhase(const QString&, bool theoretical);
+
+		void diffStreamState(Seiscomp::DataModel::Origin* oldOrigin,
+		                     Seiscomp::DataModel::Origin* newOrigin);
+
+		void updateOriginInformation();
+
+		void loadNextStations(float distance);
+
+		void setCursorText(const QString&);
+		void setCursorPos(const Seiscomp::Core::Time&, bool always = false);
+		void setTimeRange(double, double);
+
+		void acquireStreams();
+
+		bool applyFilter(RecordViewItem *item = nullptr);
+		bool applyRotation(RecordViewItem *item, int type);
+		void updateRecordAxisLabel(RecordViewItem *item);
+
+
+		//! Makes sure that the time range [tmin, tmax] is visible.
+		//! When the interval is larger than the visible area
+		//! the time range will be left aligned.
+		void ensureVisibility(double &tmin, double &tmax);
+		void ensureVisibility(const Seiscomp::Core::Time &time, int pixelMargin);
+
+		void updatePhaseMarker(Seiscomp::Gui::RecordWidget*, const Seiscomp::Core::Time&);
+		void declareArrival(Seiscomp::Gui::RecordMarker *m, const QString &phase, bool);
+		void updateUncertaintyHandles(RecordMarker *marker);
+
+		void updateCurrentRowState();
+		void setMarkerState(Seiscomp::Gui::RecordWidget*, bool);
+
+		bool setArrivalState(Seiscomp::Gui::RecordWidget* w, int arrivalId, bool state);
+
+		void fetchManualPicks(std::vector<RecordMarker*>* marker = nullptr) const;
+
+		void showComponent(char componentCode);
+		void fetchComponent(char componentCode);
+
+		void addArrival(Seiscomp::Gui::RecordWidget*, Seiscomp::DataModel::Arrival*, int id);
+		void addFilter(const QString& name, const QString& filter);
+
+		void changeFilter(int, bool force);
+
+		void closeThreads();
+
+		char currentComponent() const;
+
+		void searchByText(const QString &text);
+
+		void emitPick(const Processing::Picker *, const Processing::Picker::Result &res);
+
+
+	private:
+		PickerViewPrivate *_d_ptr;
+};
+
+
+}
+}
+
+
+#define REGISTER_PICKER_MARKER_ACTION(Class, Service) \
+Seiscomp::Core::Generic::InterfaceFactory<Seiscomp::Gui::PickerMarkerActionPlugin, Class> __##Class##InterfaceFactory__(Service)
+
+
+#endif

include/seiscomp/gui/datamodel/pickerzoomframe.h

@@ -0,0 +1,59 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_PICKERZOOMFRAME_H
+#define SEISCOMP_GUI_PICKERZOOMFRAME_H
+
+
+#include <QFrame>
+#include <seiscomp/gui/qt.h>
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API ZoomRecordFrame : public QFrame {
+	Q_OBJECT
+
+	public:
+		ZoomRecordFrame(QWidget* parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+
+	protected:
+		void wheelEvent(QWheelEvent* e);
+
+	signals:
+		void lineDown();
+		void lineUp();
+
+		void verticalZoomIn();
+		void verticalZoomOut();
+
+		void horizontalZoomIn();
+		void horizontalZoomOut();
+};
+
+
+}
+}
+
+
+#endif
+
+

include/seiscomp/gui/datamodel/publicobjectevaluator.h

@@ -0,0 +1,139 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_DATAMODEL_ORIGINEVALUATOR_H
+#define SEISCOMP_GUI_DATAMODEL_ORIGINEVALUATOR_H
+
+#include <list>
+
+#include <QThread>
+#include <QMutex>
+#include <QHash>
+#include <QSet>
+#include <QProcess>
+#include <QStringList>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/databasereader.h>
+#endif
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class PublicObjectEvaluator : public QThread {
+	Q_OBJECT
+
+	private:
+		PublicObjectEvaluator();
+
+
+	public:
+		static PublicObjectEvaluator &Instance();
+
+		bool setDatabaseURI(const char *uri);
+
+		//! Adds a job for an publicID of a specific PublicObject type and a
+		//! script to be called.
+		//! Multiple calls will increase the reference count of
+		//! script while removeJob will decrease it. A reference
+		//! count of 0 removes this script from the job list.
+		bool append(void *owner, const QString &publicID,
+		            const Core::RTTI& classType, const QString &script);
+		bool append(void *owner, const QString &publicID,
+		            const Core::RTTI& classType, const QStringList &scripts);
+
+		bool prepend(void *owner, const QString &publicID,
+		             const Core::RTTI& classType, const QString &script);
+		bool prepend(void *owner, const QString &publicID,
+		             const Core::RTTI& classType, const QStringList &scripts);
+
+		bool moveToFront(const QString &publicID);
+
+		//! Remove a job for an publicID and a script. This decreases
+		//! the reference count of script if it exists already and removes
+		//! it when the reference count drops to 0.
+		bool erase(void *owner, const QString &publicID, const QString &script);
+
+		//! Removes all scripts for an publicID and does not check for
+		//! reference counts.
+		bool erase(void *owner, const QString &publicID);
+
+		int pendingJobs() const;
+
+		//! Removes all pending jobs of owner. If owner is set to nullptr
+		//! all jobs are removed
+		void clear(void *owner);
+
+		//! Does an evaluation. The evaluation is not queued but executed
+		//! in place,
+		bool eval(DataModel::PublicObject *po, const QStringList &scripts);
+
+		QString errorMsg(int errorCode) const;
+
+
+	protected:
+		void run();
+
+
+	private:
+		bool connect();
+
+
+	signals:
+		void resultAvailable(const QString &publicID, const QString &className,
+		                     const QString &script, const QString &result);
+
+		void resultError(const QString &publicID, const QString &className,
+		                 const QString &script, int errorCode);
+
+
+	private:
+		// A script which is an owner. If two or more objects
+		// added the same script then owner is set to nullptr.
+		typedef QHash<QString,void*> Scripts;
+		struct Job {
+			Job(const QString &id, const Core::RTTI &ct)
+			 : publicID(id), classType(ct) {}
+
+			QString     publicID;
+			Core::RTTI  classType;
+			Scripts     scripts;
+		};
+
+		typedef std::list<Job> JobList;
+		typedef QHash<QString, JobList::iterator> JobIDMap;
+
+		static PublicObjectEvaluator    *_instance;
+		mutable QMutex                   _mutexJobList;
+		std::string                      _databaseURI;
+		DataModel::DatabaseReader        _reader;
+
+		JobIDMap                         _jobIDLookup;
+		JobList                          _jobs;
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/datamodel/selectstation.h

@@ -0,0 +1,82 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_SELECTSTATION_H
+#define SEISCOMP_SELECTSTATION_H
+
+
+#include <QDialog>
+#include <QAbstractTableModel>
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/datetime.h>
+#include <seiscomp/datamodel/station.h>
+#endif
+#include <seiscomp/gui/qt.h>
+
+#include <seiscomp/gui/datamodel/ui_selectstation.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API SelectStation : public QDialog {
+	Q_OBJECT
+
+	// ------------------------------------------------------------------
+	// X'struction
+	// ------------------------------------------------------------------
+	public:
+		explicit SelectStation(Core::Time time, bool ignoreDisabledStations,
+		                       QWidget* parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		explicit SelectStation(Core::Time time, bool ignoreDisabledStations,
+		                       const QSet<QString> &blackList,
+		                       QWidget* parent = 0, Qt::WindowFlags f = Qt::WindowFlags());
+		~SelectStation();
+
+		QList<DataModel::Station*> selectedStations() const;
+
+		void setReferenceLocation(double lat, double lon);
+
+
+	// ------------------------------------------------------------------
+	// Private Interface
+	// ------------------------------------------------------------------
+	private slots:
+		void listMatchingStations(const QString& substr);
+
+
+	private:
+		void init(Core::Time, bool ignoreDisabledStations,
+		          const QSet<QString> *blackList);
+
+
+	// ------------------------------------------------------------------
+	// Private data members
+	// ------------------------------------------------------------------
+	private:
+		Ui::SelectStation _ui;
+};
+
+} // namespace Gui
+} // namespace Seiscomp
+
+#endif

include/seiscomp/gui/datamodel/stationsymbol.h

@@ -0,0 +1,112 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_STATIONSYMBOL_H
+#define SEISCOMP_GUI_STATIONSYMBOL_H
+
+
+#include <iostream>
+#include <string>
+#include <vector>
+
+#include <QColor>
+
+#include <seiscomp/datamodel/station.h>
+#include <seiscomp/gui/map/mapsymbol.h>
+#include <seiscomp/gui/qt.h>
+#include <seiscomp/math/coord.h>
+
+
+// Forward declaration
+class QPainter;
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API StationSymbol : public Map::Symbol {
+	public:
+		StationSymbol(Map::Decorator *decorator = nullptr);
+		StationSymbol(double latitude,
+		              double longitude,
+		              Map::Decorator *decorator = nullptr);
+
+		void setColor(const QColor &color);
+		const QColor &color() const;
+
+		/**
+		 * @brief Sets the color of the outline. The default is black.
+		 * @since 15
+		 * @param color The outline color
+		 */
+		void setOutlineColor(const QColor &color);
+
+		/**
+		 * @brief Returns the current outline color.
+		 * @since 15
+		 * @return The outline color.
+		 */
+		const QColor &outlineColor() const;
+
+		void setRadius(int radius);
+		int radius() const;
+
+		void setFrameColor(const QColor &color);
+		const QColor &frameColor() const;
+
+		void setFrameSize(int);
+		int frameSize() const;
+
+		bool isInside(int x, int y) const override;
+
+		/**
+		 * @brief Draws the station symbol
+		 * @param canvas The canvas is not being used and can be nullptr
+		 * @param painter The painter to draw with
+		 */
+		void customDraw(const Map::Canvas *canvas, QPainter &painter) override;
+
+	protected:
+		QPolygon generateShape(int posX, int posY, int radius);
+
+		const QPolygon &stationPolygon() const;
+
+
+	private:
+		void init();
+
+
+	private:
+		int       _radius;
+		int       _frameSize;
+		QPolygon  _stationPolygon;
+
+		QColor    _frameColor;
+		QColor    _outlineColor;
+		QColor    _color;
+};
+
+
+} // namespace Gui
+} // namespace Seiscomp
+
+
+#endif

include/seiscomp/gui/datamodel/tensorsymbol.h

@@ -0,0 +1,79 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_FMSYMBOL_H
+#define SEISCOMP_GUI_FMSYMBOL_H
+
+
+#include <seiscomp/gui/core/tensorrenderer.h>
+#include <seiscomp/gui/map/mapsymbol.h>
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API TensorSymbol : public Map::Symbol
+{
+
+	public:
+		TensorSymbol(const Math::Tensor2Sd &t,
+		             Map::Decorator* decorator = nullptr);
+		~TensorSymbol();
+
+		void setShadingEnabled(bool);
+		void setDrawConnectorEnabled(bool);
+		void setBorderColor(QColor);
+		void setTColor(QColor);
+		void setPColor(QColor);
+
+		void setPosition(QPointF geoPosition);
+		void setOffset(QPoint offset);
+
+
+	public:
+		virtual bool isInside(int x, int y) const;
+
+
+	protected:
+		virtual void customDraw(const Map::Canvas *canvas, QPainter& painter);
+		void resize(int w, int h);
+
+
+	protected:
+		TensorRenderer     _renderer;
+		QImage             _buffer;
+		Math::Tensor2Sd    _tensor;
+		Math::Matrix3f     _rotation;
+
+		QSize              _lastSize;
+		QPoint             _offset;
+
+		bool               _drawLocationConnector;
+
+};
+
+
+
+}
+}
+
+#endif

include/seiscomp/gui/datamodel/ttdecorator.h

@@ -0,0 +1,117 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_TTDECORATOR_H
+#define SEISCOMP_GUI_TTDECORATOR_H
+
+
+#include <list>
+
+#include <seiscomp/math/geo.h>
+#include <seiscomp/seismology/ttt.h>
+#include <seiscomp/datamodel/timequantity.h>
+#include <seiscomp/gui/map/mapwidget.h>
+#include <seiscomp/gui/qt.h>
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class SC_GUI_API TTDecorator : public Map::Decorator {
+	// ------------------------------------------------------------------
+	// Nested Types
+	// ------------------------------------------------------------------
+	private:
+		typedef std::vector<double> TravelTimes;
+		enum Direction { NORTH_SOUTH, EAST_WEST };
+
+
+	// ------------------------------------------------------------------
+	// X'struction
+	// ------------------------------------------------------------------
+	public:
+		TTDecorator(Map::Decorator *decorator = nullptr);
+
+		void setPreferredMagnitudeValue(double val);
+
+		double longitude() const;
+		void setLongitude(double longitude);
+
+		double latitude() const;
+		void setLatitude(double latitude);
+
+		double depth() const;
+		void setDepth(double depth);
+
+		const DataModel::TimeQuantity& originTime() const;
+		void setOriginTime(const DataModel::TimeQuantity& time);
+
+
+	// ------------------------------------------------------------------
+	// Protected Interface
+	// ------------------------------------------------------------------
+	protected:
+		virtual void customDraw(const Map::Canvas *canvas, QPainter& painter);
+
+
+	// ------------------------------------------------------------------
+	// Private Interface
+	// ------------------------------------------------------------------
+	private:
+		void computeTTT(TravelTimes& travelTimes, const std::string& phase,
+		                double phaseDistance);
+
+		double computeTTTPolygon(const std::vector<double>& travelTimes,
+		                         std::vector<QPointF>& polygon);
+
+		void drawPolygon(const Map::Canvas *canvas, QPainter& painter,
+		                 const std::vector<QPointF>& polygon);
+
+		void annotatePropagation(const Map::Canvas *canvas, QPainter& painter,
+		                         double distance, Direction direction);
+
+	// ----------------------------------------------------------------------
+	// Private data members
+	// ----------------------------------------------------------------------
+	private:
+		std::vector<QPointF> _polygonP;
+		std::vector<QPointF> _polygonS;
+		TravelTimeTable      _ttTable;
+		TravelTimes          _travelTimesP;
+		TravelTimes          _travelTimesS;
+		int                  _deltaDepth;
+		double               _maxPDistance;
+		double               _maxSDistance;
+		double               _pDistance;
+		int                  _deltaDist;
+		int                  _rotDelta;
+		double               _preferredMagnitudeVal;
+		double               _longitude;
+		double               _latitude;
+		double               _depth;
+		DataModel::TimeQuantity _originTime;
+
+};
+
+
+} // namespace Gui
+} // namespace Seiscomp
+
+#endif

include/seiscomp/gui/datamodel/ui_calculateamplitudes.h

@@ -0,0 +1,218 @@
+/********************************************************************************
+** Form generated from reading UI file 'calculateamplitudes.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_CALCULATEAMPLITUDES_H
+#define UI_CALCULATEAMPLITUDES_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QComboBox>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QHeaderView>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTableWidget>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_CalculateAmplitudes
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QHBoxLayout *hboxLayout;
+    QLabel *label;
+    QLabel *source;
+    QFrame *frame;
+    QHBoxLayout *hboxLayout1;
+    QLabel *label_2;
+    QComboBox *comboFilterState;
+    QSpacerItem *spacerItem;
+    QLabel *label_3;
+    QComboBox *comboFilterType;
+    QTableWidget *table;
+    QHBoxLayout *hboxLayout2;
+    QSpacerItem *spacerItem1;
+    QPushButton *btnOK;
+    QPushButton *btnCancel;
+
+    void setupUi(QDialog *CalculateAmplitudes)
+    {
+        if (CalculateAmplitudes->objectName().isEmpty())
+            CalculateAmplitudes->setObjectName(QString::fromUtf8("CalculateAmplitudes"));
+        CalculateAmplitudes->resize(645, 624);
+        vboxLayout = new QVBoxLayout(CalculateAmplitudes);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        label = new QLabel(CalculateAmplitudes);
+        label->setObjectName(QString::fromUtf8("label"));
+        QSizePolicy sizePolicy(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(label->sizePolicy().hasHeightForWidth());
+        label->setSizePolicy(sizePolicy);
+
+        hboxLayout->addWidget(label);
+
+        source = new QLabel(CalculateAmplitudes);
+        source->setObjectName(QString::fromUtf8("source"));
+        QSizePolicy sizePolicy1(QSizePolicy::Ignored, QSizePolicy::Preferred);
+        sizePolicy1.setHorizontalStretch(0);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(source->sizePolicy().hasHeightForWidth());
+        source->setSizePolicy(sizePolicy1);
+
+        hboxLayout->addWidget(source);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        frame = new QFrame(CalculateAmplitudes);
+        frame->setObjectName(QString::fromUtf8("frame"));
+        frame->setFrameShape(QFrame::HLine);
+        frame->setFrameShadow(QFrame::Plain);
+
+        vboxLayout->addWidget(frame);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        label_2 = new QLabel(CalculateAmplitudes);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+
+        hboxLayout1->addWidget(label_2);
+
+        comboFilterState = new QComboBox(CalculateAmplitudes);
+        comboFilterState->addItem(QString());
+        comboFilterState->addItem(QString());
+        comboFilterState->addItem(QString());
+        comboFilterState->addItem(QString());
+        comboFilterState->setObjectName(QString::fromUtf8("comboFilterState"));
+
+        hboxLayout1->addWidget(comboFilterState);
+
+        spacerItem = new QSpacerItem(40, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem);
+
+        label_3 = new QLabel(CalculateAmplitudes);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+
+        hboxLayout1->addWidget(label_3);
+
+        comboFilterType = new QComboBox(CalculateAmplitudes);
+        comboFilterType->setObjectName(QString::fromUtf8("comboFilterType"));
+        QSizePolicy sizePolicy2(QSizePolicy::Maximum, QSizePolicy::Fixed);
+        sizePolicy2.setHorizontalStretch(0);
+        sizePolicy2.setVerticalStretch(0);
+        sizePolicy2.setHeightForWidth(comboFilterType->sizePolicy().hasHeightForWidth());
+        comboFilterType->setSizePolicy(sizePolicy2);
+
+        hboxLayout1->addWidget(comboFilterType);
+
+
+        vboxLayout->addLayout(hboxLayout1);
+
+        table = new QTableWidget(CalculateAmplitudes);
+        if (table->columnCount() < 4)
+            table->setColumnCount(4);
+        QTableWidgetItem *__qtablewidgetitem = new QTableWidgetItem();
+        table->setHorizontalHeaderItem(0, __qtablewidgetitem);
+        QTableWidgetItem *__qtablewidgetitem1 = new QTableWidgetItem();
+        table->setHorizontalHeaderItem(1, __qtablewidgetitem1);
+        QTableWidgetItem *__qtablewidgetitem2 = new QTableWidgetItem();
+        table->setHorizontalHeaderItem(2, __qtablewidgetitem2);
+        QTableWidgetItem *__qtablewidgetitem3 = new QTableWidgetItem();
+        table->setHorizontalHeaderItem(3, __qtablewidgetitem3);
+        table->setObjectName(QString::fromUtf8("table"));
+
+        vboxLayout->addWidget(table);
+
+        hboxLayout2 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout2->setSpacing(6);
+#endif
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        spacerItem1 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout2->addItem(spacerItem1);
+
+        btnOK = new QPushButton(CalculateAmplitudes);
+        btnOK->setObjectName(QString::fromUtf8("btnOK"));
+
+        hboxLayout2->addWidget(btnOK);
+
+        btnCancel = new QPushButton(CalculateAmplitudes);
+        btnCancel->setObjectName(QString::fromUtf8("btnCancel"));
+
+        hboxLayout2->addWidget(btnCancel);
+
+
+        vboxLayout->addLayout(hboxLayout2);
+
+
+        retranslateUi(CalculateAmplitudes);
+        QObject::connect(btnCancel, SIGNAL(clicked()), CalculateAmplitudes, SLOT(reject()));
+        QObject::connect(btnOK, SIGNAL(clicked()), CalculateAmplitudes, SLOT(accept()));
+
+        QMetaObject::connectSlotsByName(CalculateAmplitudes);
+    } // setupUi
+
+    void retranslateUi(QDialog *CalculateAmplitudes)
+    {
+        CalculateAmplitudes->setWindowTitle(QCoreApplication::translate("CalculateAmplitudes", "Measure amplitudes", nullptr));
+        label->setText(QCoreApplication::translate("CalculateAmplitudes", "Source:", nullptr));
+        source->setText(QCoreApplication::translate("CalculateAmplitudes", "TextLabel", nullptr));
+        label_2->setText(QCoreApplication::translate("CalculateAmplitudes", "State:", nullptr));
+        comboFilterState->setItemText(0, QCoreApplication::translate("CalculateAmplitudes", "- Any -", nullptr));
+        comboFilterState->setItemText(1, QCoreApplication::translate("CalculateAmplitudes", "Success", nullptr));
+        comboFilterState->setItemText(2, QCoreApplication::translate("CalculateAmplitudes", "Error", nullptr));
+        comboFilterState->setItemText(3, QCoreApplication::translate("CalculateAmplitudes", "Progress", nullptr));
+
+        label_3->setText(QCoreApplication::translate("CalculateAmplitudes", "Type:", nullptr));
+        QTableWidgetItem *___qtablewidgetitem = table->horizontalHeaderItem(0);
+        ___qtablewidgetitem->setText(QCoreApplication::translate("CalculateAmplitudes", "Stream", nullptr));
+        QTableWidgetItem *___qtablewidgetitem1 = table->horizontalHeaderItem(1);
+        ___qtablewidgetitem1->setText(QCoreApplication::translate("CalculateAmplitudes", "Type", nullptr));
+        QTableWidgetItem *___qtablewidgetitem2 = table->horizontalHeaderItem(2);
+        ___qtablewidgetitem2->setText(QCoreApplication::translate("CalculateAmplitudes", "Value", nullptr));
+        QTableWidgetItem *___qtablewidgetitem3 = table->horizontalHeaderItem(3);
+        ___qtablewidgetitem3->setText(QCoreApplication::translate("CalculateAmplitudes", "Progress", nullptr));
+        btnOK->setText(QCoreApplication::translate("CalculateAmplitudes", "OK", nullptr));
+        btnCancel->setText(QCoreApplication::translate("CalculateAmplitudes", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class CalculateAmplitudes: public Ui_CalculateAmplitudes {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_CALCULATEAMPLITUDES_H

include/seiscomp/gui/datamodel/ui_eventfilterwidget.h

@@ -0,0 +1,338 @@
+/********************************************************************************
+** Form generated from reading UI file 'eventfilterwidget.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_EVENTFILTERWIDGET_H
+#define UI_EVENTFILTERWIDGET_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QLineEdit>
+#include <QtWidgets/QToolButton>
+#include <QtWidgets/QVBoxLayout>
+#include <QtWidgets/QWidget>
+#include "seiscomp/gui/core/optionaldoublespinbox.h"
+
+QT_BEGIN_NAMESPACE
+
+class Ui_EventFilter
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QGridLayout *gridLayout;
+    Seiscomp::Gui::OptionalDoubleSpinBox *toLatitude;
+    QFrame *frame;
+    Seiscomp::Gui::OptionalDoubleSpinBox *fromMagnitude;
+    QLabel *label_4;
+    QLabel *label_15;
+    Seiscomp::Gui::OptionalDoubleSpinBox *toLongitude;
+    Seiscomp::Gui::OptionalDoubleSpinBox *fromDepth;
+    QFrame *frame_2;
+    QLabel *label;
+    Seiscomp::Gui::OptionalDoubleSpinBox *toDepth;
+    QLabel *label_5;
+    QFrame *frame_3;
+    QLabel *label_14;
+    QLabel *label_11;
+    QLabel *label_8;
+    QLabel *label_10;
+    QLabel *label_12;
+    QLabel *label_9;
+    Seiscomp::Gui::OptionalDoubleSpinBox *fromLatitude;
+    QLabel *label_6;
+    QLabel *label_7;
+    Seiscomp::Gui::OptionalDoubleSpinBox *toMagnitude;
+    Seiscomp::Gui::OptionalDoubleSpinBox *fromLongitude;
+    QLabel *label_13;
+    QFrame *frame_4;
+    QLineEdit *editEventID;
+    QFrame *frame_5;
+    QToolButton *btnReset;
+
+    void setupUi(QWidget *EventFilter)
+    {
+        if (EventFilter->objectName().isEmpty())
+            EventFilter->setObjectName(QString::fromUtf8("EventFilter"));
+        EventFilter->resize(407, 419);
+        vboxLayout = new QVBoxLayout(EventFilter);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        gridLayout = new QGridLayout();
+#ifndef Q_OS_MAC
+        gridLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        gridLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        toLatitude = new Seiscomp::Gui::OptionalDoubleSpinBox(EventFilter);
+        toLatitude->setObjectName(QString::fromUtf8("toLatitude"));
+        toLatitude->setDecimals(4);
+        toLatitude->setMaximum(90.000000000000000);
+        toLatitude->setMinimum(-90.000000000000000);
+        toLatitude->setValue(-90.000000000000000);
+
+        gridLayout->addWidget(toLatitude, 3, 3, 1, 1);
+
+        frame = new QFrame(EventFilter);
+        frame->setObjectName(QString::fromUtf8("frame"));
+        frame->setFrameShape(QFrame::HLine);
+        frame->setFrameShadow(QFrame::Sunken);
+
+        gridLayout->addWidget(frame, 4, 0, 1, 4);
+
+        fromMagnitude = new Seiscomp::Gui::OptionalDoubleSpinBox(EventFilter);
+        fromMagnitude->setObjectName(QString::fromUtf8("fromMagnitude"));
+        fromMagnitude->setDecimals(1);
+        fromMagnitude->setMaximum(20.000000000000000);
+        fromMagnitude->setMinimum(-10.000000000000000);
+        fromMagnitude->setSingleStep(0.500000000000000);
+        fromMagnitude->setValue(-10.000000000000000);
+
+        gridLayout->addWidget(fromMagnitude, 12, 1, 1, 1);
+
+        label_4 = new QLabel(EventFilter);
+        label_4->setObjectName(QString::fromUtf8("label_4"));
+        QSizePolicy sizePolicy(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(label_4->sizePolicy().hasHeightForWidth());
+        label_4->setSizePolicy(sizePolicy);
+
+        gridLayout->addWidget(label_4, 0, 0, 1, 1);
+
+        label_15 = new QLabel(EventFilter);
+        label_15->setObjectName(QString::fromUtf8("label_15"));
+
+        gridLayout->addWidget(label_15, 12, 2, 1, 1);
+
+        toLongitude = new Seiscomp::Gui::OptionalDoubleSpinBox(EventFilter);
+        toLongitude->setObjectName(QString::fromUtf8("toLongitude"));
+        toLongitude->setDecimals(4);
+        toLongitude->setMaximum(180.000000000000000);
+        toLongitude->setMinimum(-180.000000000000000);
+        toLongitude->setValue(-180.000000000000000);
+
+        gridLayout->addWidget(toLongitude, 6, 3, 1, 1);
+
+        fromDepth = new Seiscomp::Gui::OptionalDoubleSpinBox(EventFilter);
+        fromDepth->setObjectName(QString::fromUtf8("fromDepth"));
+        fromDepth->setMaximum(999.000000000000000);
+        fromDepth->setMinimum(-999.000000000000000);
+        fromDepth->setValue(-999.000000000000000);
+
+        gridLayout->addWidget(fromDepth, 9, 1, 1, 1);
+
+        frame_2 = new QFrame(EventFilter);
+        frame_2->setObjectName(QString::fromUtf8("frame_2"));
+        frame_2->setFrameShape(QFrame::HLine);
+        frame_2->setFrameShadow(QFrame::Sunken);
+
+        gridLayout->addWidget(frame_2, 7, 0, 1, 4);
+
+        label = new QLabel(EventFilter);
+        label->setObjectName(QString::fromUtf8("label"));
+
+        gridLayout->addWidget(label, 2, 0, 1, 4);
+
+        toDepth = new Seiscomp::Gui::OptionalDoubleSpinBox(EventFilter);
+        toDepth->setObjectName(QString::fromUtf8("toDepth"));
+        toDepth->setMaximum(999.000000000000000);
+        toDepth->setMinimum(-999.000000000000000);
+        toDepth->setValue(-999.000000000000000);
+
+        gridLayout->addWidget(toDepth, 9, 3, 1, 1);
+
+        label_5 = new QLabel(EventFilter);
+        label_5->setObjectName(QString::fromUtf8("label_5"));
+        QSizePolicy sizePolicy1(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy1.setHorizontalStretch(0);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(label_5->sizePolicy().hasHeightForWidth());
+        label_5->setSizePolicy(sizePolicy1);
+        label_5->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_5, 3, 0, 1, 1);
+
+        frame_3 = new QFrame(EventFilter);
+        frame_3->setObjectName(QString::fromUtf8("frame_3"));
+        frame_3->setFrameShape(QFrame::HLine);
+        frame_3->setFrameShadow(QFrame::Sunken);
+
+        gridLayout->addWidget(frame_3, 10, 0, 1, 4);
+
+        label_14 = new QLabel(EventFilter);
+        label_14->setObjectName(QString::fromUtf8("label_14"));
+        label_14->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_14, 12, 0, 1, 1);
+
+        label_11 = new QLabel(EventFilter);
+        label_11->setObjectName(QString::fromUtf8("label_11"));
+        label_11->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_11, 9, 0, 1, 1);
+
+        label_8 = new QLabel(EventFilter);
+        label_8->setObjectName(QString::fromUtf8("label_8"));
+        label_8->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_8, 6, 0, 1, 1);
+
+        label_10 = new QLabel(EventFilter);
+        label_10->setObjectName(QString::fromUtf8("label_10"));
+
+        gridLayout->addWidget(label_10, 8, 0, 1, 4);
+
+        label_12 = new QLabel(EventFilter);
+        label_12->setObjectName(QString::fromUtf8("label_12"));
+
+        gridLayout->addWidget(label_12, 9, 2, 1, 1);
+
+        label_9 = new QLabel(EventFilter);
+        label_9->setObjectName(QString::fromUtf8("label_9"));
+
+        gridLayout->addWidget(label_9, 6, 2, 1, 1);
+
+        fromLatitude = new Seiscomp::Gui::OptionalDoubleSpinBox(EventFilter);
+        fromLatitude->setObjectName(QString::fromUtf8("fromLatitude"));
+        fromLatitude->setDecimals(4);
+        fromLatitude->setMaximum(90.000000000000000);
+        fromLatitude->setMinimum(-90.000000000000000);
+        fromLatitude->setValue(-90.000000000000000);
+
+        gridLayout->addWidget(fromLatitude, 3, 1, 1, 1);
+
+        label_6 = new QLabel(EventFilter);
+        label_6->setObjectName(QString::fromUtf8("label_6"));
+        sizePolicy.setHeightForWidth(label_6->sizePolicy().hasHeightForWidth());
+        label_6->setSizePolicy(sizePolicy);
+
+        gridLayout->addWidget(label_6, 3, 2, 1, 1);
+
+        label_7 = new QLabel(EventFilter);
+        label_7->setObjectName(QString::fromUtf8("label_7"));
+
+        gridLayout->addWidget(label_7, 5, 0, 1, 4);
+
+        toMagnitude = new Seiscomp::Gui::OptionalDoubleSpinBox(EventFilter);
+        toMagnitude->setObjectName(QString::fromUtf8("toMagnitude"));
+        toMagnitude->setDecimals(1);
+        toMagnitude->setMaximum(20.000000000000000);
+        toMagnitude->setMinimum(-10.000000000000000);
+        toMagnitude->setSingleStep(0.500000000000000);
+        toMagnitude->setValue(-10.000000000000000);
+
+        gridLayout->addWidget(toMagnitude, 12, 3, 1, 1);
+
+        fromLongitude = new Seiscomp::Gui::OptionalDoubleSpinBox(EventFilter);
+        fromLongitude->setObjectName(QString::fromUtf8("fromLongitude"));
+        fromLongitude->setDecimals(4);
+        fromLongitude->setMaximum(180.000000000000000);
+        fromLongitude->setMinimum(-180.000000000000000);
+        fromLongitude->setValue(-180.000000000000000);
+
+        gridLayout->addWidget(fromLongitude, 6, 1, 1, 1);
+
+        label_13 = new QLabel(EventFilter);
+        label_13->setObjectName(QString::fromUtf8("label_13"));
+
+        gridLayout->addWidget(label_13, 11, 0, 1, 4);
+
+        frame_4 = new QFrame(EventFilter);
+        frame_4->setObjectName(QString::fromUtf8("frame_4"));
+        frame_4->setFrameShape(QFrame::HLine);
+        frame_4->setFrameShadow(QFrame::Sunken);
+
+        gridLayout->addWidget(frame_4, 1, 0, 1, 4);
+
+        editEventID = new QLineEdit(EventFilter);
+        editEventID->setObjectName(QString::fromUtf8("editEventID"));
+
+        gridLayout->addWidget(editEventID, 0, 1, 1, 3);
+
+
+        vboxLayout->addLayout(gridLayout);
+
+        frame_5 = new QFrame(EventFilter);
+        frame_5->setObjectName(QString::fromUtf8("frame_5"));
+        frame_5->setFrameShape(QFrame::HLine);
+        frame_5->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout->addWidget(frame_5);
+
+        btnReset = new QToolButton(EventFilter);
+        btnReset->setObjectName(QString::fromUtf8("btnReset"));
+
+        vboxLayout->addWidget(btnReset);
+
+        QWidget::setTabOrder(fromLatitude, toLatitude);
+        QWidget::setTabOrder(toLatitude, fromLongitude);
+        QWidget::setTabOrder(fromLongitude, toLongitude);
+        QWidget::setTabOrder(toLongitude, fromDepth);
+        QWidget::setTabOrder(fromDepth, toDepth);
+        QWidget::setTabOrder(toDepth, fromMagnitude);
+        QWidget::setTabOrder(fromMagnitude, toMagnitude);
+
+        retranslateUi(EventFilter);
+
+        QMetaObject::connectSlotsByName(EventFilter);
+    } // setupUi
+
+    void retranslateUi(QWidget *EventFilter)
+    {
+        EventFilter->setWindowTitle(QCoreApplication::translate("EventFilter", "Filter Settings", nullptr));
+        toLatitude->setSpecialValueText(QCoreApplication::translate("EventFilter", "Unset", nullptr));
+        toLatitude->setSuffix(QCoreApplication::translate("EventFilter", "\302\260", nullptr));
+        fromMagnitude->setSpecialValueText(QCoreApplication::translate("EventFilter", "Unset", nullptr));
+        label_4->setText(QCoreApplication::translate("EventFilter", "Event ID", nullptr));
+        label_15->setText(QCoreApplication::translate("EventFilter", "to", nullptr));
+        toLongitude->setSpecialValueText(QCoreApplication::translate("EventFilter", "Unset", nullptr));
+        toLongitude->setSuffix(QCoreApplication::translate("EventFilter", "\302\260", nullptr));
+        fromDepth->setSpecialValueText(QCoreApplication::translate("EventFilter", "Unset", nullptr));
+        fromDepth->setSuffix(QCoreApplication::translate("EventFilter", "km", nullptr));
+        label->setText(QCoreApplication::translate("EventFilter", "Latitude range", nullptr));
+        toDepth->setSpecialValueText(QCoreApplication::translate("EventFilter", "Unset", nullptr));
+        toDepth->setSuffix(QCoreApplication::translate("EventFilter", "km", nullptr));
+        label_5->setText(QCoreApplication::translate("EventFilter", "from", nullptr));
+        label_14->setText(QCoreApplication::translate("EventFilter", "from", nullptr));
+        label_11->setText(QCoreApplication::translate("EventFilter", "from", nullptr));
+        label_8->setText(QCoreApplication::translate("EventFilter", "from", nullptr));
+        label_10->setText(QCoreApplication::translate("EventFilter", "Depth range", nullptr));
+        label_12->setText(QCoreApplication::translate("EventFilter", "to", nullptr));
+        label_9->setText(QCoreApplication::translate("EventFilter", "to", nullptr));
+        fromLatitude->setSpecialValueText(QCoreApplication::translate("EventFilter", "Unset", nullptr));
+        fromLatitude->setSuffix(QCoreApplication::translate("EventFilter", "\302\260", nullptr));
+        label_6->setText(QCoreApplication::translate("EventFilter", "to", nullptr));
+        label_7->setText(QCoreApplication::translate("EventFilter", "Longitude range", nullptr));
+        toMagnitude->setSpecialValueText(QCoreApplication::translate("EventFilter", "Unset", nullptr));
+        fromLongitude->setSpecialValueText(QCoreApplication::translate("EventFilter", "Unset", nullptr));
+        fromLongitude->setSuffix(QCoreApplication::translate("EventFilter", "\302\260", nullptr));
+        label_13->setText(QCoreApplication::translate("EventFilter", "Magnitude range", nullptr));
+#if QT_CONFIG(tooltip)
+        editEventID->setToolTip(QCoreApplication::translate("EventFilter", "EventID filter which allows wildcards (* and ?)", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnReset->setText(QCoreApplication::translate("EventFilter", "Reset all", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class EventFilter: public Ui_EventFilter {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_EVENTFILTERWIDGET_H

include/seiscomp/gui/datamodel/ui_eventlistview.h

@@ -0,0 +1,379 @@
+/********************************************************************************
+** Form generated from reading UI file 'eventlistview.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_EVENTLISTVIEW_H
+#define UI_EVENTLISTVIEW_H
+
+#include <QtCore/QVariant>
+#include <QtGui/QIcon>
+#include <QtWidgets/QAction>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QCheckBox>
+#include <QtWidgets/QComboBox>
+#include <QtWidgets/QDateTimeEdit>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QSpinBox>
+#include <QtWidgets/QToolButton>
+#include <QtWidgets/QVBoxLayout>
+#include <QtWidgets/QWidget>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_EventListView
+{
+public:
+    QAction *actionCopyRowToClipboard;
+    QVBoxLayout *vboxLayout;
+    QFrame *frameList;
+    QFrame *frameControls;
+    QVBoxLayout *vboxLayout1;
+    QHBoxLayout *hboxLayout;
+    QToolButton *btnClear;
+    QToolButton *btnFilter;
+    QSpacerItem *spacerItem;
+    QLabel *label_3;
+    QSpinBox *spinBox;
+    QToolButton *btnReadDays;
+    QSpacerItem *spacerItem1;
+    QLabel *label;
+    QDateTimeEdit *dateTimeEditStart;
+    QLabel *label_2;
+    QDateTimeEdit *dateTimeEditEnd;
+    QToolButton *btnReadInterval;
+    QFrame *frameCustomControls;
+    QFrame *frame;
+    QHBoxLayout *hboxLayout1;
+    QCheckBox *cbHideOther;
+    QSpacerItem *spacerItem2;
+    QCheckBox *cbHideForeign;
+    QSpacerItem *spacerItem3;
+    QCheckBox *cbShowLatestOnly;
+    QSpacerItem *spacerItem4;
+    QHBoxLayout *hboxLayout2;
+    QFrame *frameRegionFilter;
+    QHBoxLayout *hboxLayout3;
+    QCheckBox *cbFilterRegions;
+    QComboBox *cbFilterRegionMode;
+    QComboBox *lstFilterRegions;
+    QToolButton *btnChangeRegion;
+    QLabel *lbFilterRegions;
+    QSpacerItem *spacerItem5;
+
+    void setupUi(QWidget *EventListView)
+    {
+        if (EventListView->objectName().isEmpty())
+            EventListView->setObjectName(QString::fromUtf8("EventListView"));
+        EventListView->resize(802, 710);
+        actionCopyRowToClipboard = new QAction(EventListView);
+        actionCopyRowToClipboard->setObjectName(QString::fromUtf8("actionCopyRowToClipboard"));
+        vboxLayout = new QVBoxLayout(EventListView);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+        vboxLayout->setContentsMargins(0, 0, 0, 0);
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        frameList = new QFrame(EventListView);
+        frameList->setObjectName(QString::fromUtf8("frameList"));
+        QSizePolicy sizePolicy(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(2);
+        sizePolicy.setHeightForWidth(frameList->sizePolicy().hasHeightForWidth());
+        frameList->setSizePolicy(sizePolicy);
+        frameList->setFrameShape(QFrame::NoFrame);
+        frameList->setFrameShadow(QFrame::Plain);
+
+        vboxLayout->addWidget(frameList);
+
+        frameControls = new QFrame(EventListView);
+        frameControls->setObjectName(QString::fromUtf8("frameControls"));
+        frameControls->setFrameShadow(QFrame::Plain);
+        vboxLayout1 = new QVBoxLayout(frameControls);
+#ifndef Q_OS_MAC
+        vboxLayout1->setSpacing(6);
+#endif
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        btnClear = new QToolButton(frameControls);
+        btnClear->setObjectName(QString::fromUtf8("btnClear"));
+        btnClear->setEnabled(false);
+        QSizePolicy sizePolicy1(QSizePolicy::Minimum, QSizePolicy::Fixed);
+        sizePolicy1.setHorizontalStretch(0);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(btnClear->sizePolicy().hasHeightForWidth());
+        btnClear->setSizePolicy(sizePolicy1);
+
+        hboxLayout->addWidget(btnClear);
+
+        btnFilter = new QToolButton(frameControls);
+        btnFilter->setObjectName(QString::fromUtf8("btnFilter"));
+        sizePolicy1.setHeightForWidth(btnFilter->sizePolicy().hasHeightForWidth());
+        btnFilter->setSizePolicy(sizePolicy1);
+        const QIcon icon = QIcon(QString::fromUtf8(":/icons/icons/filter2.png"));
+        btnFilter->setIcon(icon);
+
+        hboxLayout->addWidget(btnFilter);
+
+        spacerItem = new QSpacerItem(16, 29, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem);
+
+        label_3 = new QLabel(frameControls);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+        QSizePolicy sizePolicy2(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy2.setHorizontalStretch(0);
+        sizePolicy2.setVerticalStretch(0);
+        sizePolicy2.setHeightForWidth(label_3->sizePolicy().hasHeightForWidth());
+        label_3->setSizePolicy(sizePolicy2);
+
+        hboxLayout->addWidget(label_3);
+
+        spinBox = new QSpinBox(frameControls);
+        spinBox->setObjectName(QString::fromUtf8("spinBox"));
+        QSizePolicy sizePolicy3(QSizePolicy::Preferred, QSizePolicy::Fixed);
+        sizePolicy3.setHorizontalStretch(0);
+        sizePolicy3.setVerticalStretch(0);
+        sizePolicy3.setHeightForWidth(spinBox->sizePolicy().hasHeightForWidth());
+        spinBox->setSizePolicy(sizePolicy3);
+        spinBox->setMinimum(1);
+
+        hboxLayout->addWidget(spinBox);
+
+        btnReadDays = new QToolButton(frameControls);
+        btnReadDays->setObjectName(QString::fromUtf8("btnReadDays"));
+        QSizePolicy sizePolicy4(QSizePolicy::Maximum, QSizePolicy::Fixed);
+        sizePolicy4.setHorizontalStretch(0);
+        sizePolicy4.setVerticalStretch(0);
+        sizePolicy4.setHeightForWidth(btnReadDays->sizePolicy().hasHeightForWidth());
+        btnReadDays->setSizePolicy(sizePolicy4);
+        btnReadDays->setMinimumSize(QSize(50, 0));
+
+        hboxLayout->addWidget(btnReadDays);
+
+        spacerItem1 = new QSpacerItem(16, 29, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem1);
+
+        label = new QLabel(frameControls);
+        label->setObjectName(QString::fromUtf8("label"));
+        sizePolicy2.setHeightForWidth(label->sizePolicy().hasHeightForWidth());
+        label->setSizePolicy(sizePolicy2);
+
+        hboxLayout->addWidget(label);
+
+        dateTimeEditStart = new QDateTimeEdit(frameControls);
+        dateTimeEditStart->setObjectName(QString::fromUtf8("dateTimeEditStart"));
+        dateTimeEditStart->setCurrentSection(QDateTimeEdit::YearSection);
+
+        hboxLayout->addWidget(dateTimeEditStart);
+
+        label_2 = new QLabel(frameControls);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+        sizePolicy2.setHeightForWidth(label_2->sizePolicy().hasHeightForWidth());
+        label_2->setSizePolicy(sizePolicy2);
+
+        hboxLayout->addWidget(label_2);
+
+        dateTimeEditEnd = new QDateTimeEdit(frameControls);
+        dateTimeEditEnd->setObjectName(QString::fromUtf8("dateTimeEditEnd"));
+        dateTimeEditEnd->setCurrentSection(QDateTimeEdit::YearSection);
+
+        hboxLayout->addWidget(dateTimeEditEnd);
+
+        btnReadInterval = new QToolButton(frameControls);
+        btnReadInterval->setObjectName(QString::fromUtf8("btnReadInterval"));
+        sizePolicy4.setHeightForWidth(btnReadInterval->sizePolicy().hasHeightForWidth());
+        btnReadInterval->setSizePolicy(sizePolicy4);
+        btnReadInterval->setMinimumSize(QSize(50, 0));
+
+        hboxLayout->addWidget(btnReadInterval);
+
+
+        vboxLayout1->addLayout(hboxLayout);
+
+
+        vboxLayout->addWidget(frameControls);
+
+        frameCustomControls = new QFrame(EventListView);
+        frameCustomControls->setObjectName(QString::fromUtf8("frameCustomControls"));
+        frameCustomControls->setFrameShape(QFrame::NoFrame);
+        frameCustomControls->setFrameShadow(QFrame::Plain);
+
+        vboxLayout->addWidget(frameCustomControls);
+
+        frame = new QFrame(EventListView);
+        frame->setObjectName(QString::fromUtf8("frame"));
+        frame->setFrameShape(QFrame::HLine);
+        frame->setFrameShadow(QFrame::Raised);
+
+        vboxLayout->addWidget(frame);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        cbHideOther = new QCheckBox(EventListView);
+        cbHideOther->setObjectName(QString::fromUtf8("cbHideOther"));
+        cbHideOther->setChecked(true);
+
+        hboxLayout1->addWidget(cbHideOther);
+
+        spacerItem2 = new QSpacerItem(16, 23, QSizePolicy::Minimum, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem2);
+
+        cbHideForeign = new QCheckBox(EventListView);
+        cbHideForeign->setObjectName(QString::fromUtf8("cbHideForeign"));
+        cbHideForeign->setChecked(false);
+
+        hboxLayout1->addWidget(cbHideForeign);
+
+        spacerItem3 = new QSpacerItem(16, 23, QSizePolicy::Minimum, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem3);
+
+        cbShowLatestOnly = new QCheckBox(EventListView);
+        cbShowLatestOnly->setObjectName(QString::fromUtf8("cbShowLatestOnly"));
+
+        hboxLayout1->addWidget(cbShowLatestOnly);
+
+        spacerItem4 = new QSpacerItem(144, 23, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem4);
+
+
+        vboxLayout->addLayout(hboxLayout1);
+
+        hboxLayout2 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout2->setSpacing(6);
+#endif
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        frameRegionFilter = new QFrame(EventListView);
+        frameRegionFilter->setObjectName(QString::fromUtf8("frameRegionFilter"));
+        frameRegionFilter->setFrameShape(QFrame::NoFrame);
+        frameRegionFilter->setFrameShadow(QFrame::Raised);
+        hboxLayout3 = new QHBoxLayout(frameRegionFilter);
+#ifndef Q_OS_MAC
+        hboxLayout3->setSpacing(6);
+#endif
+        hboxLayout3->setContentsMargins(0, 0, 0, 0);
+        hboxLayout3->setObjectName(QString::fromUtf8("hboxLayout3"));
+        cbFilterRegions = new QCheckBox(frameRegionFilter);
+        cbFilterRegions->setObjectName(QString::fromUtf8("cbFilterRegions"));
+
+        hboxLayout3->addWidget(cbFilterRegions);
+
+        cbFilterRegionMode = new QComboBox(frameRegionFilter);
+        cbFilterRegionMode->addItem(QString());
+        cbFilterRegionMode->addItem(QString());
+        cbFilterRegionMode->setObjectName(QString::fromUtf8("cbFilterRegionMode"));
+
+        hboxLayout3->addWidget(cbFilterRegionMode);
+
+        lstFilterRegions = new QComboBox(frameRegionFilter);
+        lstFilterRegions->setObjectName(QString::fromUtf8("lstFilterRegions"));
+
+        hboxLayout3->addWidget(lstFilterRegions);
+
+        btnChangeRegion = new QToolButton(frameRegionFilter);
+        btnChangeRegion->setObjectName(QString::fromUtf8("btnChangeRegion"));
+
+        hboxLayout3->addWidget(btnChangeRegion);
+
+        lbFilterRegions = new QLabel(frameRegionFilter);
+        lbFilterRegions->setObjectName(QString::fromUtf8("lbFilterRegions"));
+
+        hboxLayout3->addWidget(lbFilterRegions);
+
+
+        hboxLayout2->addWidget(frameRegionFilter);
+
+        spacerItem5 = new QSpacerItem(351, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout2->addItem(spacerItem5);
+
+
+        vboxLayout->addLayout(hboxLayout2);
+
+
+        retranslateUi(EventListView);
+
+        QMetaObject::connectSlotsByName(EventListView);
+    } // setupUi
+
+    void retranslateUi(QWidget *EventListView)
+    {
+        EventListView->setWindowTitle(QCoreApplication::translate("EventListView", "Event List", nullptr));
+        actionCopyRowToClipboard->setText(QCoreApplication::translate("EventListView", "copyRowToClipboard", nullptr));
+#if QT_CONFIG(shortcut)
+        actionCopyRowToClipboard->setShortcut(QCoreApplication::translate("EventListView", "Ctrl+C", nullptr));
+#endif // QT_CONFIG(shortcut)
+#if QT_CONFIG(tooltip)
+        btnClear->setToolTip(QCoreApplication::translate("EventListView", "Removes all events from the list", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnClear->setText(QCoreApplication::translate("EventListView", "Clear list", nullptr));
+#if QT_CONFIG(tooltip)
+        btnFilter->setToolTip(QCoreApplication::translate("EventListView", "Configures the server-side event filter", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnFilter->setText(QCoreApplication::translate("EventListView", "Filter", nullptr));
+        label_3->setText(QCoreApplication::translate("EventListView", "Last days:", nullptr));
+#if QT_CONFIG(tooltip)
+        btnReadDays->setToolTip(QCoreApplication::translate("EventListView", "Reads the events of the last n days using the \"Last days:\" value", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnReadDays->setText(QCoreApplication::translate("EventListView", "Read", nullptr));
+        label->setText(QCoreApplication::translate("EventListView", "From:", nullptr));
+        dateTimeEditStart->setDisplayFormat(QCoreApplication::translate("EventListView", "yyyy/MM/dd HH:mm:ss", nullptr));
+        label_2->setText(QCoreApplication::translate("EventListView", "To:", nullptr));
+        dateTimeEditEnd->setDisplayFormat(QCoreApplication::translate("EventListView", "yyyy/MM/dd HH:mm:ss", nullptr));
+#if QT_CONFIG(tooltip)
+        btnReadInterval->setToolTip(QCoreApplication::translate("EventListView", "Reads the events of the given timespan using the \"From:\" and \"To:\" dates", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnReadInterval->setText(QCoreApplication::translate("EventListView", "Read", nullptr));
+#if QT_CONFIG(tooltip)
+        cbHideOther->setToolTip(QCoreApplication::translate("EventListView", "Hides/shows events with EventType set to OTHER/NOT_EXISTING", nullptr));
+#endif // QT_CONFIG(tooltip)
+        cbHideOther->setText(QCoreApplication::translate("EventListView", "Hide other/fake events", nullptr));
+#if QT_CONFIG(tooltip)
+        cbHideForeign->setToolTip(QCoreApplication::translate("EventListView", "Hides/shows events from non preferred agencies", nullptr));
+#endif // QT_CONFIG(tooltip)
+        cbHideForeign->setText(QCoreApplication::translate("EventListView", "Show only own events", nullptr));
+#if QT_CONFIG(tooltip)
+        cbShowLatestOnly->setToolTip(QCoreApplication::translate("EventListView", "Enables/disables the display of only one origin per agency (the latest one) or all origins", nullptr));
+#endif // QT_CONFIG(tooltip)
+        cbShowLatestOnly->setText(QCoreApplication::translate("EventListView", "Show only latest/preferred origin per agency", nullptr));
+        cbFilterRegions->setText(QCoreApplication::translate("EventListView", "Hide events", nullptr));
+        cbFilterRegionMode->setItemText(0, QCoreApplication::translate("EventListView", "outside", nullptr));
+        cbFilterRegionMode->setItemText(1, QCoreApplication::translate("EventListView", "inside", nullptr));
+
+        btnChangeRegion->setText(QCoreApplication::translate("EventListView", "...", nullptr));
+        lbFilterRegions->setText(QCoreApplication::translate("EventListView", "region", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class EventListView: public Ui_EventListView {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_EVENTLISTVIEW_H

include/seiscomp/gui/datamodel/ui_eventlistviewregionfilterdialog.h

@@ -0,0 +1,306 @@
+/********************************************************************************
+** Form generated from reading UI file 'eventlistviewregionfilterdialog.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_EVENTLISTVIEWREGIONFILTERDIALOG_H
+#define UI_EVENTLISTVIEWREGIONFILTERDIALOG_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QComboBox>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QGroupBox>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QLineEdit>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_EventListViewRegionFilterDialog
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QGroupBox *groupBox;
+    QGridLayout *gridLayout;
+    QLabel *label_2;
+    QLabel *label_6;
+    QComboBox *cbRegions;
+    QLabel *label_8;
+    QLabel *label;
+    QHBoxLayout *hboxLayout;
+    QLineEdit *edMaxLon;
+    QLabel *label_11;
+    QLabel *label_7;
+    QHBoxLayout *hboxLayout1;
+    QLineEdit *edMinLon;
+    QLabel *label_9;
+    QHBoxLayout *hboxLayout2;
+    QLineEdit *edMaxLat;
+    QLabel *label_10;
+    QLabel *label_5;
+    QHBoxLayout *hboxLayout3;
+    QLineEdit *edMinLat;
+    QLabel *label_3;
+    QLabel *label_4;
+    QLabel *labelPolys;
+    QComboBox *cbPolys;
+    QSpacerItem *spacerItem;
+    QHBoxLayout *hboxLayout4;
+    QSpacerItem *spacerItem1;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *EventListViewRegionFilterDialog)
+    {
+        if (EventListViewRegionFilterDialog->objectName().isEmpty())
+            EventListViewRegionFilterDialog->setObjectName(QString::fromUtf8("EventListViewRegionFilterDialog"));
+        EventListViewRegionFilterDialog->resize(676, 642);
+        vboxLayout = new QVBoxLayout(EventListViewRegionFilterDialog);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        groupBox = new QGroupBox(EventListViewRegionFilterDialog);
+        groupBox->setObjectName(QString::fromUtf8("groupBox"));
+        gridLayout = new QGridLayout(groupBox);
+#ifndef Q_OS_MAC
+        gridLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        gridLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        label_2 = new QLabel(groupBox);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+
+        gridLayout->addWidget(label_2, 1, 1, 1, 1);
+
+        label_6 = new QLabel(groupBox);
+        label_6->setObjectName(QString::fromUtf8("label_6"));
+        QSizePolicy sizePolicy(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(label_6->sizePolicy().hasHeightForWidth());
+        label_6->setSizePolicy(sizePolicy);
+
+        gridLayout->addWidget(label_6, 1, 0, 1, 1);
+
+        cbRegions = new QComboBox(groupBox);
+        cbRegions->setObjectName(QString::fromUtf8("cbRegions"));
+
+        gridLayout->addWidget(cbRegions, 0, 1, 1, 4);
+
+        label_8 = new QLabel(groupBox);
+        label_8->setObjectName(QString::fromUtf8("label_8"));
+
+        gridLayout->addWidget(label_8, 1, 3, 1, 1);
+
+        label = new QLabel(groupBox);
+        label->setObjectName(QString::fromUtf8("label"));
+        sizePolicy.setHeightForWidth(label->sizePolicy().hasHeightForWidth());
+        label->setSizePolicy(sizePolicy);
+
+        gridLayout->addWidget(label, 0, 0, 1, 1);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        edMaxLon = new QLineEdit(groupBox);
+        edMaxLon->setObjectName(QString::fromUtf8("edMaxLon"));
+        edMaxLon->setMaxLength(11);
+        edMaxLon->setAlignment(Qt::AlignRight);
+
+        hboxLayout->addWidget(edMaxLon);
+
+        label_11 = new QLabel(groupBox);
+        label_11->setObjectName(QString::fromUtf8("label_11"));
+
+        hboxLayout->addWidget(label_11);
+
+
+        gridLayout->addLayout(hboxLayout, 2, 4, 1, 1);
+
+        label_7 = new QLabel(groupBox);
+        label_7->setObjectName(QString::fromUtf8("label_7"));
+        sizePolicy.setHeightForWidth(label_7->sizePolicy().hasHeightForWidth());
+        label_7->setSizePolicy(sizePolicy);
+
+        gridLayout->addWidget(label_7, 2, 0, 1, 1);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        edMinLon = new QLineEdit(groupBox);
+        edMinLon->setObjectName(QString::fromUtf8("edMinLon"));
+        edMinLon->setMaxLength(11);
+        edMinLon->setAlignment(Qt::AlignRight);
+
+        hboxLayout1->addWidget(edMinLon);
+
+        label_9 = new QLabel(groupBox);
+        label_9->setObjectName(QString::fromUtf8("label_9"));
+
+        hboxLayout1->addWidget(label_9);
+
+
+        gridLayout->addLayout(hboxLayout1, 2, 2, 1, 1);
+
+        hboxLayout2 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout2->setSpacing(6);
+#endif
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        edMaxLat = new QLineEdit(groupBox);
+        edMaxLat->setObjectName(QString::fromUtf8("edMaxLat"));
+        edMaxLat->setMaxLength(10);
+        edMaxLat->setAlignment(Qt::AlignRight);
+
+        hboxLayout2->addWidget(edMaxLat);
+
+        label_10 = new QLabel(groupBox);
+        label_10->setObjectName(QString::fromUtf8("label_10"));
+
+        hboxLayout2->addWidget(label_10);
+
+
+        gridLayout->addLayout(hboxLayout2, 1, 4, 1, 1);
+
+        label_5 = new QLabel(groupBox);
+        label_5->setObjectName(QString::fromUtf8("label_5"));
+
+        gridLayout->addWidget(label_5, 2, 3, 1, 1);
+
+        hboxLayout3 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout3->setSpacing(6);
+#endif
+        hboxLayout3->setContentsMargins(0, 0, 0, 0);
+        hboxLayout3->setObjectName(QString::fromUtf8("hboxLayout3"));
+        edMinLat = new QLineEdit(groupBox);
+        edMinLat->setObjectName(QString::fromUtf8("edMinLat"));
+        edMinLat->setMaxLength(10);
+        edMinLat->setAlignment(Qt::AlignRight);
+
+        hboxLayout3->addWidget(edMinLat);
+
+        label_3 = new QLabel(groupBox);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+
+        hboxLayout3->addWidget(label_3);
+
+
+        gridLayout->addLayout(hboxLayout3, 1, 2, 1, 1);
+
+        label_4 = new QLabel(groupBox);
+        label_4->setObjectName(QString::fromUtf8("label_4"));
+
+        gridLayout->addWidget(label_4, 2, 1, 1, 1);
+
+        labelPolys = new QLabel(groupBox);
+        labelPolys->setObjectName(QString::fromUtf8("labelPolys"));
+        labelPolys->setEnabled(false);
+
+        gridLayout->addWidget(labelPolys, 3, 0, 1, 1);
+
+        cbPolys = new QComboBox(groupBox);
+        cbPolys->setObjectName(QString::fromUtf8("cbPolys"));
+        cbPolys->setEnabled(false);
+
+        gridLayout->addWidget(cbPolys, 3, 1, 1, 4);
+
+
+        vboxLayout->addWidget(groupBox);
+
+        spacerItem = new QSpacerItem(20, 0, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout->addItem(spacerItem);
+
+        hboxLayout4 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout4->setSpacing(6);
+#endif
+        hboxLayout4->setContentsMargins(0, 0, 0, 0);
+        hboxLayout4->setObjectName(QString::fromUtf8("hboxLayout4"));
+        spacerItem1 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout4->addItem(spacerItem1);
+
+        okButton = new QPushButton(EventListViewRegionFilterDialog);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout4->addWidget(okButton);
+
+        cancelButton = new QPushButton(EventListViewRegionFilterDialog);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout4->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout4);
+
+        QWidget::setTabOrder(cbRegions, edMinLat);
+        QWidget::setTabOrder(edMinLat, edMaxLat);
+        QWidget::setTabOrder(edMaxLat, edMinLon);
+        QWidget::setTabOrder(edMinLon, edMaxLon);
+        QWidget::setTabOrder(edMaxLon, okButton);
+        QWidget::setTabOrder(okButton, cancelButton);
+
+        retranslateUi(EventListViewRegionFilterDialog);
+
+        QMetaObject::connectSlotsByName(EventListViewRegionFilterDialog);
+    } // setupUi
+
+    void retranslateUi(QDialog *EventListViewRegionFilterDialog)
+    {
+        EventListViewRegionFilterDialog->setWindowTitle(QCoreApplication::translate("EventListViewRegionFilterDialog", "Edit region", nullptr));
+        groupBox->setTitle(QCoreApplication::translate("EventListViewRegionFilterDialog", "Region", nullptr));
+        label_2->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "from", nullptr));
+        label_6->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "Latitude range", nullptr));
+        label_8->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "to", nullptr));
+        label->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "Template", nullptr));
+        edMaxLon->setText(QString());
+        label_11->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "\302\260 ", nullptr));
+        label_7->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "Longitude range", nullptr));
+        edMinLon->setText(QString());
+        label_9->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "\302\260 ", nullptr));
+        edMaxLat->setText(QString());
+        label_10->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "\302\260 ", nullptr));
+        label_5->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "to", nullptr));
+        edMinLat->setText(QString());
+        label_3->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "\302\260 ", nullptr));
+        label_4->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "from", nullptr));
+#if QT_CONFIG(tooltip)
+        labelPolys->setToolTip(QCoreApplication::translate("EventListViewRegionFilterDialog", "If a polygon is selected then it will override the latitude/longitude rect.", nullptr));
+#endif // QT_CONFIG(tooltip)
+        labelPolys->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "Polygon", nullptr));
+        okButton->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("EventListViewRegionFilterDialog", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class EventListViewRegionFilterDialog: public Ui_EventListViewRegionFilterDialog {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_EVENTLISTVIEWREGIONFILTERDIALOG_H

include/seiscomp/gui/datamodel/ui_eventsummary.h

@@ -0,0 +1,668 @@
+/********************************************************************************
+** Form generated from reading UI file 'eventsummary.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_EVENTSUMMARY_H
+#define UI_EVENTSUMMARY_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+#include <QtWidgets/QWidget>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_EventSummary
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QLabel *originTime;
+    QLabel *timeAgo;
+    QHBoxLayout *hboxLayout;
+    QLabel *magnitudeText;
+    QLabel *magnitude;
+    QLabel *region;
+    QLabel *nearestCity;
+    QHBoxLayout *hboxLayout1;
+    QLabel *depthText;
+    QLabel *depth;
+    QHBoxLayout *hboxLayout2;
+    QLabel *latitude;
+    QSpacerItem *spacerItem;
+    QLabel *longitude;
+    QSpacerItem *spacerItem1;
+    QLabel *type;
+    QFrame *map;
+    QLabel *labelOpComment;
+    QFrame *labelOpCommentSeparator;
+    QFrame *magnitudes;
+    QFrame *separator1;
+    QLabel *thisLocationText;
+    QHBoxLayout *hboxLayout3;
+    QLabel *phaseCountText;
+    QLabel *phaseCount;
+    QHBoxLayout *hboxLayout4;
+    QLabel *azimuthalGapText;
+    QLabel *azimuthalGap;
+    QHBoxLayout *hboxLayout5;
+    QLabel *rmsText;
+    QLabel *rms;
+    QHBoxLayout *hboxLayout6;
+    QLabel *minimumDistanceText;
+    QLabel *minimumDistance;
+    QHBoxLayout *hboxLayout7;
+    QLabel *maximumDistanceText;
+    QLabel *maximumDistance;
+    QFrame *separator2;
+    QHBoxLayout *hboxLayout8;
+    QLabel *firstLocationText;
+    QLabel *firstLocation;
+    QHBoxLayout *hboxLayout9;
+    QLabel *eventIDText;
+    QLabel *eventID;
+    QHBoxLayout *hboxLayout10;
+    QLabel *originIDText;
+    QLabel *originID;
+    QHBoxLayout *hboxLayout11;
+    QLabel *originIDText_2;
+    QLabel *agencyID;
+    QHBoxLayout *hboxLayout12;
+    QLabel *state;
+    QLabel *mode;
+    QFrame *focalMechanism;
+    QVBoxLayout *vboxLayout1;
+    QFrame *separator3;
+    QHBoxLayout *hboxLayout13;
+    QVBoxLayout *vboxLayout2;
+    QFrame *frame;
+    QHBoxLayout *hboxLayout14;
+    QLabel *momentTensor;
+    QLabel *label;
+    QSpacerItem *spacerItem2;
+    QVBoxLayout *vboxLayout3;
+    QVBoxLayout *vboxLayout4;
+    QLabel *mw;
+    QLabel *fmDepth;
+    QSpacerItem *spacerItem3;
+    QSpacerItem *spacerItem4;
+    QHBoxLayout *hboxLayout15;
+    QSpacerItem *spacerItem5;
+    QPushButton *exportButton;
+
+    void setupUi(QWidget *EventSummary)
+    {
+        if (EventSummary->objectName().isEmpty())
+            EventSummary->setObjectName(QString::fromUtf8("EventSummary"));
+        EventSummary->resize(412, 762);
+        vboxLayout = new QVBoxLayout(EventSummary);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+        vboxLayout->setContentsMargins(0, 0, 0, 0);
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        originTime = new QLabel(EventSummary);
+        originTime->setObjectName(QString::fromUtf8("originTime"));
+
+        vboxLayout->addWidget(originTime);
+
+        timeAgo = new QLabel(EventSummary);
+        timeAgo->setObjectName(QString::fromUtf8("timeAgo"));
+
+        vboxLayout->addWidget(timeAgo);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        magnitudeText = new QLabel(EventSummary);
+        magnitudeText->setObjectName(QString::fromUtf8("magnitudeText"));
+        QSizePolicy sizePolicy(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(magnitudeText->sizePolicy().hasHeightForWidth());
+        magnitudeText->setSizePolicy(sizePolicy);
+
+        hboxLayout->addWidget(magnitudeText);
+
+        magnitude = new QLabel(EventSummary);
+        magnitude->setObjectName(QString::fromUtf8("magnitude"));
+
+        hboxLayout->addWidget(magnitude);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        region = new QLabel(EventSummary);
+        region->setObjectName(QString::fromUtf8("region"));
+        QSizePolicy sizePolicy1(QSizePolicy::Ignored, QSizePolicy::Preferred);
+        sizePolicy1.setHorizontalStretch(0);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(region->sizePolicy().hasHeightForWidth());
+        region->setSizePolicy(sizePolicy1);
+
+        vboxLayout->addWidget(region);
+
+        nearestCity = new QLabel(EventSummary);
+        nearestCity->setObjectName(QString::fromUtf8("nearestCity"));
+
+        vboxLayout->addWidget(nearestCity);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        depthText = new QLabel(EventSummary);
+        depthText->setObjectName(QString::fromUtf8("depthText"));
+        sizePolicy.setHeightForWidth(depthText->sizePolicy().hasHeightForWidth());
+        depthText->setSizePolicy(sizePolicy);
+
+        hboxLayout1->addWidget(depthText);
+
+        depth = new QLabel(EventSummary);
+        depth->setObjectName(QString::fromUtf8("depth"));
+
+        hboxLayout1->addWidget(depth);
+
+
+        vboxLayout->addLayout(hboxLayout1);
+
+        hboxLayout2 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout2->setSpacing(6);
+#endif
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        latitude = new QLabel(EventSummary);
+        latitude->setObjectName(QString::fromUtf8("latitude"));
+
+        hboxLayout2->addWidget(latitude);
+
+        spacerItem = new QSpacerItem(2, 5, QSizePolicy::Maximum, QSizePolicy::Minimum);
+
+        hboxLayout2->addItem(spacerItem);
+
+        longitude = new QLabel(EventSummary);
+        longitude->setObjectName(QString::fromUtf8("longitude"));
+
+        hboxLayout2->addWidget(longitude);
+
+        spacerItem1 = new QSpacerItem(2, 5, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout2->addItem(spacerItem1);
+
+
+        vboxLayout->addLayout(hboxLayout2);
+
+        type = new QLabel(EventSummary);
+        type->setObjectName(QString::fromUtf8("type"));
+        sizePolicy1.setHeightForWidth(type->sizePolicy().hasHeightForWidth());
+        type->setSizePolicy(sizePolicy1);
+
+        vboxLayout->addWidget(type);
+
+        map = new QFrame(EventSummary);
+        map->setObjectName(QString::fromUtf8("map"));
+        QSizePolicy sizePolicy2(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy2.setHorizontalStretch(0);
+        sizePolicy2.setVerticalStretch(0);
+        sizePolicy2.setHeightForWidth(map->sizePolicy().hasHeightForWidth());
+        map->setSizePolicy(sizePolicy2);
+        map->setFrameShape(QFrame::NoFrame);
+        map->setFrameShadow(QFrame::Plain);
+
+        vboxLayout->addWidget(map);
+
+        labelOpComment = new QLabel(EventSummary);
+        labelOpComment->setObjectName(QString::fromUtf8("labelOpComment"));
+        sizePolicy1.setHeightForWidth(labelOpComment->sizePolicy().hasHeightForWidth());
+        labelOpComment->setSizePolicy(sizePolicy1);
+        labelOpComment->setWordWrap(true);
+
+        vboxLayout->addWidget(labelOpComment);
+
+        labelOpCommentSeparator = new QFrame(EventSummary);
+        labelOpCommentSeparator->setObjectName(QString::fromUtf8("labelOpCommentSeparator"));
+        labelOpCommentSeparator->setFrameShape(QFrame::HLine);
+        labelOpCommentSeparator->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout->addWidget(labelOpCommentSeparator);
+
+        magnitudes = new QFrame(EventSummary);
+        magnitudes->setObjectName(QString::fromUtf8("magnitudes"));
+        magnitudes->setFrameShape(QFrame::NoFrame);
+        magnitudes->setFrameShadow(QFrame::Plain);
+
+        vboxLayout->addWidget(magnitudes);
+
+        separator1 = new QFrame(EventSummary);
+        separator1->setObjectName(QString::fromUtf8("separator1"));
+        separator1->setFrameShape(QFrame::HLine);
+        separator1->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout->addWidget(separator1);
+
+        thisLocationText = new QLabel(EventSummary);
+        thisLocationText->setObjectName(QString::fromUtf8("thisLocationText"));
+
+        vboxLayout->addWidget(thisLocationText);
+
+        hboxLayout3 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout3->setSpacing(6);
+#endif
+        hboxLayout3->setContentsMargins(0, 0, 0, 0);
+        hboxLayout3->setObjectName(QString::fromUtf8("hboxLayout3"));
+        phaseCountText = new QLabel(EventSummary);
+        phaseCountText->setObjectName(QString::fromUtf8("phaseCountText"));
+
+        hboxLayout3->addWidget(phaseCountText);
+
+        phaseCount = new QLabel(EventSummary);
+        phaseCount->setObjectName(QString::fromUtf8("phaseCount"));
+
+        hboxLayout3->addWidget(phaseCount);
+
+
+        vboxLayout->addLayout(hboxLayout3);
+
+        hboxLayout4 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout4->setSpacing(6);
+#endif
+        hboxLayout4->setContentsMargins(0, 0, 0, 0);
+        hboxLayout4->setObjectName(QString::fromUtf8("hboxLayout4"));
+        azimuthalGapText = new QLabel(EventSummary);
+        azimuthalGapText->setObjectName(QString::fromUtf8("azimuthalGapText"));
+
+        hboxLayout4->addWidget(azimuthalGapText);
+
+        azimuthalGap = new QLabel(EventSummary);
+        azimuthalGap->setObjectName(QString::fromUtf8("azimuthalGap"));
+
+        hboxLayout4->addWidget(azimuthalGap);
+
+
+        vboxLayout->addLayout(hboxLayout4);
+
+        hboxLayout5 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout5->setSpacing(6);
+#endif
+        hboxLayout5->setContentsMargins(0, 0, 0, 0);
+        hboxLayout5->setObjectName(QString::fromUtf8("hboxLayout5"));
+        rmsText = new QLabel(EventSummary);
+        rmsText->setObjectName(QString::fromUtf8("rmsText"));
+
+        hboxLayout5->addWidget(rmsText);
+
+        rms = new QLabel(EventSummary);
+        rms->setObjectName(QString::fromUtf8("rms"));
+
+        hboxLayout5->addWidget(rms);
+
+
+        vboxLayout->addLayout(hboxLayout5);
+
+        hboxLayout6 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout6->setSpacing(6);
+#endif
+        hboxLayout6->setContentsMargins(0, 0, 0, 0);
+        hboxLayout6->setObjectName(QString::fromUtf8("hboxLayout6"));
+        minimumDistanceText = new QLabel(EventSummary);
+        minimumDistanceText->setObjectName(QString::fromUtf8("minimumDistanceText"));
+
+        hboxLayout6->addWidget(minimumDistanceText);
+
+        minimumDistance = new QLabel(EventSummary);
+        minimumDistance->setObjectName(QString::fromUtf8("minimumDistance"));
+
+        hboxLayout6->addWidget(minimumDistance);
+
+
+        vboxLayout->addLayout(hboxLayout6);
+
+        hboxLayout7 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout7->setSpacing(6);
+#endif
+        hboxLayout7->setContentsMargins(0, 0, 0, 0);
+        hboxLayout7->setObjectName(QString::fromUtf8("hboxLayout7"));
+        maximumDistanceText = new QLabel(EventSummary);
+        maximumDistanceText->setObjectName(QString::fromUtf8("maximumDistanceText"));
+
+        hboxLayout7->addWidget(maximumDistanceText);
+
+        maximumDistance = new QLabel(EventSummary);
+        maximumDistance->setObjectName(QString::fromUtf8("maximumDistance"));
+
+        hboxLayout7->addWidget(maximumDistance);
+
+
+        vboxLayout->addLayout(hboxLayout7);
+
+        separator2 = new QFrame(EventSummary);
+        separator2->setObjectName(QString::fromUtf8("separator2"));
+        separator2->setFrameShape(QFrame::HLine);
+        separator2->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout->addWidget(separator2);
+
+        hboxLayout8 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout8->setSpacing(6);
+#endif
+        hboxLayout8->setContentsMargins(0, 0, 0, 0);
+        hboxLayout8->setObjectName(QString::fromUtf8("hboxLayout8"));
+        firstLocationText = new QLabel(EventSummary);
+        firstLocationText->setObjectName(QString::fromUtf8("firstLocationText"));
+
+        hboxLayout8->addWidget(firstLocationText);
+
+        firstLocation = new QLabel(EventSummary);
+        firstLocation->setObjectName(QString::fromUtf8("firstLocation"));
+
+        hboxLayout8->addWidget(firstLocation);
+
+
+        vboxLayout->addLayout(hboxLayout8);
+
+        hboxLayout9 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout9->setSpacing(6);
+#endif
+        hboxLayout9->setContentsMargins(0, 0, 0, 0);
+        hboxLayout9->setObjectName(QString::fromUtf8("hboxLayout9"));
+        eventIDText = new QLabel(EventSummary);
+        eventIDText->setObjectName(QString::fromUtf8("eventIDText"));
+
+        hboxLayout9->addWidget(eventIDText);
+
+        eventID = new QLabel(EventSummary);
+        eventID->setObjectName(QString::fromUtf8("eventID"));
+        sizePolicy1.setHeightForWidth(eventID->sizePolicy().hasHeightForWidth());
+        eventID->setSizePolicy(sizePolicy1);
+
+        hboxLayout9->addWidget(eventID);
+
+
+        vboxLayout->addLayout(hboxLayout9);
+
+        hboxLayout10 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout10->setSpacing(6);
+#endif
+        hboxLayout10->setContentsMargins(0, 0, 0, 0);
+        hboxLayout10->setObjectName(QString::fromUtf8("hboxLayout10"));
+        originIDText = new QLabel(EventSummary);
+        originIDText->setObjectName(QString::fromUtf8("originIDText"));
+
+        hboxLayout10->addWidget(originIDText);
+
+        originID = new QLabel(EventSummary);
+        originID->setObjectName(QString::fromUtf8("originID"));
+        sizePolicy1.setHeightForWidth(originID->sizePolicy().hasHeightForWidth());
+        originID->setSizePolicy(sizePolicy1);
+
+        hboxLayout10->addWidget(originID);
+
+
+        vboxLayout->addLayout(hboxLayout10);
+
+        hboxLayout11 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout11->setSpacing(6);
+#endif
+        hboxLayout11->setContentsMargins(0, 0, 0, 0);
+        hboxLayout11->setObjectName(QString::fromUtf8("hboxLayout11"));
+        originIDText_2 = new QLabel(EventSummary);
+        originIDText_2->setObjectName(QString::fromUtf8("originIDText_2"));
+
+        hboxLayout11->addWidget(originIDText_2);
+
+        agencyID = new QLabel(EventSummary);
+        agencyID->setObjectName(QString::fromUtf8("agencyID"));
+        sizePolicy1.setHeightForWidth(agencyID->sizePolicy().hasHeightForWidth());
+        agencyID->setSizePolicy(sizePolicy1);
+
+        hboxLayout11->addWidget(agencyID);
+
+
+        vboxLayout->addLayout(hboxLayout11);
+
+        hboxLayout12 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout12->setSpacing(6);
+#endif
+        hboxLayout12->setContentsMargins(0, 0, 0, 0);
+        hboxLayout12->setObjectName(QString::fromUtf8("hboxLayout12"));
+        state = new QLabel(EventSummary);
+        state->setObjectName(QString::fromUtf8("state"));
+
+        hboxLayout12->addWidget(state);
+
+        mode = new QLabel(EventSummary);
+        mode->setObjectName(QString::fromUtf8("mode"));
+        sizePolicy1.setHeightForWidth(mode->sizePolicy().hasHeightForWidth());
+        mode->setSizePolicy(sizePolicy1);
+
+        hboxLayout12->addWidget(mode);
+
+
+        vboxLayout->addLayout(hboxLayout12);
+
+        focalMechanism = new QFrame(EventSummary);
+        focalMechanism->setObjectName(QString::fromUtf8("focalMechanism"));
+        QSizePolicy sizePolicy3(QSizePolicy::Preferred, QSizePolicy::Minimum);
+        sizePolicy3.setHorizontalStretch(0);
+        sizePolicy3.setVerticalStretch(0);
+        sizePolicy3.setHeightForWidth(focalMechanism->sizePolicy().hasHeightForWidth());
+        focalMechanism->setSizePolicy(sizePolicy3);
+        focalMechanism->setMinimumSize(QSize(16, 60));
+        focalMechanism->setFrameShape(QFrame::NoFrame);
+        focalMechanism->setFrameShadow(QFrame::Raised);
+        vboxLayout1 = new QVBoxLayout(focalMechanism);
+#ifndef Q_OS_MAC
+        vboxLayout1->setSpacing(6);
+#endif
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        separator3 = new QFrame(focalMechanism);
+        separator3->setObjectName(QString::fromUtf8("separator3"));
+        separator3->setFrameShape(QFrame::HLine);
+        separator3->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout1->addWidget(separator3);
+
+        hboxLayout13 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout13->setSpacing(6);
+#endif
+        hboxLayout13->setContentsMargins(0, 0, 0, 0);
+        hboxLayout13->setObjectName(QString::fromUtf8("hboxLayout13"));
+        vboxLayout2 = new QVBoxLayout();
+        vboxLayout2->setSpacing(0);
+#ifndef Q_OS_MAC
+        vboxLayout2->setContentsMargins(0, 0, 0, 0);
+#endif
+        vboxLayout2->setObjectName(QString::fromUtf8("vboxLayout2"));
+        frame = new QFrame(focalMechanism);
+        frame->setObjectName(QString::fromUtf8("frame"));
+        frame->setFrameShape(QFrame::NoFrame);
+        frame->setFrameShadow(QFrame::Raised);
+        hboxLayout14 = new QHBoxLayout(frame);
+        hboxLayout14->setSpacing(0);
+        hboxLayout14->setContentsMargins(0, 0, 0, 0);
+        hboxLayout14->setObjectName(QString::fromUtf8("hboxLayout14"));
+        momentTensor = new QLabel(frame);
+        momentTensor->setObjectName(QString::fromUtf8("momentTensor"));
+        momentTensor->setEnabled(true);
+        QSizePolicy sizePolicy4(QSizePolicy::Fixed, QSizePolicy::Fixed);
+        sizePolicy4.setHorizontalStretch(0);
+        sizePolicy4.setVerticalStretch(0);
+        sizePolicy4.setHeightForWidth(momentTensor->sizePolicy().hasHeightForWidth());
+        momentTensor->setSizePolicy(sizePolicy4);
+        momentTensor->setMinimumSize(QSize(42, 42));
+        momentTensor->setMaximumSize(QSize(42, 42));
+        momentTensor->setFrameShape(QFrame::NoFrame);
+        momentTensor->setFrameShadow(QFrame::Sunken);
+
+        hboxLayout14->addWidget(momentTensor);
+
+        label = new QLabel(frame);
+        label->setObjectName(QString::fromUtf8("label"));
+
+        hboxLayout14->addWidget(label);
+
+
+        vboxLayout2->addWidget(frame);
+
+        spacerItem2 = new QSpacerItem(20, 20, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout2->addItem(spacerItem2);
+
+
+        hboxLayout13->addLayout(vboxLayout2);
+
+        vboxLayout3 = new QVBoxLayout();
+        vboxLayout3->setSpacing(0);
+        vboxLayout3->setContentsMargins(0, 0, 0, 0);
+        vboxLayout3->setObjectName(QString::fromUtf8("vboxLayout3"));
+        vboxLayout4 = new QVBoxLayout();
+#ifndef Q_OS_MAC
+        vboxLayout4->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout4->setContentsMargins(0, 0, 0, 0);
+#endif
+        vboxLayout4->setObjectName(QString::fromUtf8("vboxLayout4"));
+        mw = new QLabel(focalMechanism);
+        mw->setObjectName(QString::fromUtf8("mw"));
+        QSizePolicy sizePolicy5(QSizePolicy::Preferred, QSizePolicy::Fixed);
+        sizePolicy5.setHorizontalStretch(0);
+        sizePolicy5.setVerticalStretch(0);
+        sizePolicy5.setHeightForWidth(mw->sizePolicy().hasHeightForWidth());
+        mw->setSizePolicy(sizePolicy5);
+
+        vboxLayout4->addWidget(mw);
+
+        fmDepth = new QLabel(focalMechanism);
+        fmDepth->setObjectName(QString::fromUtf8("fmDepth"));
+        sizePolicy5.setHeightForWidth(fmDepth->sizePolicy().hasHeightForWidth());
+        fmDepth->setSizePolicy(sizePolicy5);
+
+        vboxLayout4->addWidget(fmDepth);
+
+
+        vboxLayout3->addLayout(vboxLayout4);
+
+        spacerItem3 = new QSpacerItem(20, 0, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout3->addItem(spacerItem3);
+
+
+        hboxLayout13->addLayout(vboxLayout3);
+
+
+        vboxLayout1->addLayout(hboxLayout13);
+
+
+        vboxLayout->addWidget(focalMechanism);
+
+        spacerItem4 = new QSpacerItem(20, 51, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout->addItem(spacerItem4);
+
+        hboxLayout15 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout15->setSpacing(6);
+#endif
+        hboxLayout15->setContentsMargins(0, 0, 0, 0);
+        hboxLayout15->setObjectName(QString::fromUtf8("hboxLayout15"));
+        spacerItem5 = new QSpacerItem(10, 1, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout15->addItem(spacerItem5);
+
+        exportButton = new QPushButton(EventSummary);
+        exportButton->setObjectName(QString::fromUtf8("exportButton"));
+        exportButton->setIconSize(QSize(46, 32));
+
+        hboxLayout15->addWidget(exportButton);
+
+
+        vboxLayout->addLayout(hboxLayout15);
+
+
+        retranslateUi(EventSummary);
+
+        QMetaObject::connectSlotsByName(EventSummary);
+    } // setupUi
+
+    void retranslateUi(QWidget *EventSummary)
+    {
+        EventSummary->setWindowTitle(QCoreApplication::translate("EventSummary", "Form", nullptr));
+        originTime->setText(QCoreApplication::translate("EventSummary", "1970/01/01 - 00:00:00", nullptr));
+        timeAgo->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        magnitudeText->setText(QCoreApplication::translate("EventSummary", "M", nullptr));
+        magnitude->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        region->setText(QCoreApplication::translate("EventSummary", "...", nullptr));
+        nearestCity->setText(QCoreApplication::translate("EventSummary", "200 km SW of City XYZ", nullptr));
+        depthText->setText(QCoreApplication::translate("EventSummary", "Depth", nullptr));
+        depth->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        latitude->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        longitude->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        type->setText(QString());
+        labelOpComment->setText(QString());
+        thisLocationText->setText(QCoreApplication::translate("EventSummary", "Location:", nullptr));
+        phaseCountText->setText(QCoreApplication::translate("EventSummary", "Phases:", nullptr));
+        phaseCount->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        azimuthalGapText->setText(QCoreApplication::translate("EventSummary", "Az. Gap:", nullptr));
+        azimuthalGap->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        rmsText->setText(QCoreApplication::translate("EventSummary", "RMS Res.:", nullptr));
+        rms->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        minimumDistanceText->setText(QCoreApplication::translate("EventSummary", "Min. Dist.:", nullptr));
+        minimumDistance->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        maximumDistanceText->setText(QCoreApplication::translate("EventSummary", "Max. Dist.:", nullptr));
+        maximumDistance->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        firstLocationText->setText(QCoreApplication::translate("EventSummary", "First Location:", nullptr));
+        firstLocation->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        eventIDText->setText(QCoreApplication::translate("EventSummary", "Event ID:", nullptr));
+        eventID->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        originIDText->setText(QCoreApplication::translate("EventSummary", "Origin ID:", nullptr));
+        originID->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        originIDText_2->setText(QCoreApplication::translate("EventSummary", "Agency ID:", nullptr));
+        agencyID->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        state->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        mode->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        momentTensor->setText(QString());
+        label->setText(QString());
+        mw->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+        fmDepth->setText(QCoreApplication::translate("EventSummary", "-", nullptr));
+#if QT_CONFIG(tooltip)
+        exportButton->setToolTip(QCoreApplication::translate("EventSummary", "Run configured script with current event", nullptr));
+#endif // QT_CONFIG(tooltip)
+        exportButton->setText(QString());
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class EventSummary: public Ui_EventSummary {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_EVENTSUMMARY_H

include/seiscomp/gui/datamodel/ui_eventsummaryview.h

@@ -0,0 +1,375 @@
+/********************************************************************************
+** Form generated from reading UI file 'eventsummaryview.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_EVENTSUMMARYVIEW_H
+#define UI_EVENTSUMMARYVIEW_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QAction>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+#include <QtWidgets/QWidget>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_EventSummaryView
+{
+public:
+    QAction *actionShowInvisibleMagnitudes;
+    QHBoxLayout *hboxLayout;
+    QFrame *frameRegion;
+    QVBoxLayout *vboxLayout;
+    QLabel *_lbOriginTime;
+    QLabel *_lbOriginTimeAutomatic;
+    QLabel *_lbTimeAgo;
+    QLabel *_lbRegion;
+    QLabel *_lbRegionExtra;
+    QFrame *frameMap;
+    QFrame *frameHDistance;
+    QVBoxLayout *vboxLayout1;
+    QFrame *frameMagnitudes;
+    QVBoxLayout *vboxLayout2;
+    QHBoxLayout *hboxLayout1;
+    QLabel *_lbPreMagType;
+    QLabel *_lbPreMagVal;
+    QSpacerItem *spacerItem;
+    QLabel *labelDepth;
+    QHBoxLayout *hboxLayout2;
+    QLabel *labelCustomName;
+    QLabel *labelCustomValue;
+    QFrame *frameMagnitudeDistance;
+    QFrame *frameVDistance;
+    QFrame *frameEpicenterInformation;
+    QFrame *frameProcessing;
+    QHBoxLayout *hboxLayout3;
+    QPushButton *btnSwitchToAutomatic;
+    QSpacerItem *spacerItem1;
+    QPushButton *btnShowDetails;
+    QFrame *framePlugable;
+    QHBoxLayout *hboxLayout4;
+    QPushButton *btnPlugable0;
+    QSpacerItem *spacerItem2;
+    QPushButton *btnPlugable1;
+
+    void setupUi(QWidget *EventSummaryView)
+    {
+        if (EventSummaryView->objectName().isEmpty())
+            EventSummaryView->setObjectName(QString::fromUtf8("EventSummaryView"));
+        EventSummaryView->resize(941, 678);
+        actionShowInvisibleMagnitudes = new QAction(EventSummaryView);
+        actionShowInvisibleMagnitudes->setObjectName(QString::fromUtf8("actionShowInvisibleMagnitudes"));
+        actionShowInvisibleMagnitudes->setCheckable(true);
+        actionShowInvisibleMagnitudes->setChecked(false);
+        hboxLayout = new QHBoxLayout(EventSummaryView);
+        hboxLayout->setSpacing(6);
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        frameRegion = new QFrame(EventSummaryView);
+        frameRegion->setObjectName(QString::fromUtf8("frameRegion"));
+        QSizePolicy sizePolicy(QSizePolicy::Expanding, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(5);
+        sizePolicy.setVerticalStretch(5);
+        sizePolicy.setHeightForWidth(frameRegion->sizePolicy().hasHeightForWidth());
+        frameRegion->setSizePolicy(sizePolicy);
+        frameRegion->setMaximumSize(QSize(16777215, 16777215));
+        frameRegion->setBaseSize(QSize(0, 0));
+        frameRegion->setFrameShape(QFrame::NoFrame);
+        frameRegion->setFrameShadow(QFrame::Raised);
+        vboxLayout = new QVBoxLayout(frameRegion);
+        vboxLayout->setSpacing(6);
+        vboxLayout->setContentsMargins(0, 0, 0, 0);
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        _lbOriginTime = new QLabel(frameRegion);
+        _lbOriginTime->setObjectName(QString::fromUtf8("_lbOriginTime"));
+        QSizePolicy sizePolicy1(QSizePolicy::MinimumExpanding, QSizePolicy::Maximum);
+        sizePolicy1.setHorizontalStretch(0);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(_lbOriginTime->sizePolicy().hasHeightForWidth());
+        _lbOriginTime->setSizePolicy(sizePolicy1);
+
+        vboxLayout->addWidget(_lbOriginTime);
+
+        _lbOriginTimeAutomatic = new QLabel(frameRegion);
+        _lbOriginTimeAutomatic->setObjectName(QString::fromUtf8("_lbOriginTimeAutomatic"));
+
+        vboxLayout->addWidget(_lbOriginTimeAutomatic);
+
+        _lbTimeAgo = new QLabel(frameRegion);
+        _lbTimeAgo->setObjectName(QString::fromUtf8("_lbTimeAgo"));
+        QSizePolicy sizePolicy2(QSizePolicy::Preferred, QSizePolicy::Maximum);
+        sizePolicy2.setHorizontalStretch(0);
+        sizePolicy2.setVerticalStretch(0);
+        sizePolicy2.setHeightForWidth(_lbTimeAgo->sizePolicy().hasHeightForWidth());
+        _lbTimeAgo->setSizePolicy(sizePolicy2);
+
+        vboxLayout->addWidget(_lbTimeAgo);
+
+        _lbRegion = new QLabel(frameRegion);
+        _lbRegion->setObjectName(QString::fromUtf8("_lbRegion"));
+        QSizePolicy sizePolicy3(QSizePolicy::Ignored, QSizePolicy::Maximum);
+        sizePolicy3.setHorizontalStretch(0);
+        sizePolicy3.setVerticalStretch(0);
+        sizePolicy3.setHeightForWidth(_lbRegion->sizePolicy().hasHeightForWidth());
+        _lbRegion->setSizePolicy(sizePolicy3);
+        _lbRegion->setScaledContents(false);
+
+        vboxLayout->addWidget(_lbRegion);
+
+        _lbRegionExtra = new QLabel(frameRegion);
+        _lbRegionExtra->setObjectName(QString::fromUtf8("_lbRegionExtra"));
+
+        vboxLayout->addWidget(_lbRegionExtra);
+
+        frameMap = new QFrame(frameRegion);
+        frameMap->setObjectName(QString::fromUtf8("frameMap"));
+        QSizePolicy sizePolicy4(QSizePolicy::Preferred, QSizePolicy::MinimumExpanding);
+        sizePolicy4.setHorizontalStretch(1);
+        sizePolicy4.setVerticalStretch(1);
+        sizePolicy4.setHeightForWidth(frameMap->sizePolicy().hasHeightForWidth());
+        frameMap->setSizePolicy(sizePolicy4);
+        frameMap->setFrameShape(QFrame::StyledPanel);
+        frameMap->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout->addWidget(frameMap);
+
+
+        hboxLayout->addWidget(frameRegion);
+
+        frameHDistance = new QFrame(EventSummaryView);
+        frameHDistance->setObjectName(QString::fromUtf8("frameHDistance"));
+        QSizePolicy sizePolicy5(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy5.setHorizontalStretch(0);
+        sizePolicy5.setVerticalStretch(0);
+        sizePolicy5.setHeightForWidth(frameHDistance->sizePolicy().hasHeightForWidth());
+        frameHDistance->setSizePolicy(sizePolicy5);
+        frameHDistance->setMinimumSize(QSize(8, 16));
+        frameHDistance->setFrameShape(QFrame::NoFrame);
+        frameHDistance->setFrameShadow(QFrame::Plain);
+
+        hboxLayout->addWidget(frameHDistance);
+
+        vboxLayout1 = new QVBoxLayout();
+        vboxLayout1->setSpacing(6);
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        frameMagnitudes = new QFrame(EventSummaryView);
+        frameMagnitudes->setObjectName(QString::fromUtf8("frameMagnitudes"));
+        sizePolicy2.setHeightForWidth(frameMagnitudes->sizePolicy().hasHeightForWidth());
+        frameMagnitudes->setSizePolicy(sizePolicy2);
+        frameMagnitudes->setMaximumSize(QSize(16777215, 400));
+        frameMagnitudes->setBaseSize(QSize(0, 0));
+        frameMagnitudes->setFrameShape(QFrame::StyledPanel);
+        frameMagnitudes->setFrameShadow(QFrame::Raised);
+        vboxLayout2 = new QVBoxLayout(frameMagnitudes);
+        vboxLayout2->setSpacing(4);
+        vboxLayout2->setContentsMargins(4, 4, 4, 4);
+        vboxLayout2->setObjectName(QString::fromUtf8("vboxLayout2"));
+        hboxLayout1 = new QHBoxLayout();
+        hboxLayout1->setSpacing(10);
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        _lbPreMagType = new QLabel(frameMagnitudes);
+        _lbPreMagType->setObjectName(QString::fromUtf8("_lbPreMagType"));
+        QSizePolicy sizePolicy6(QSizePolicy::Maximum, QSizePolicy::Maximum);
+        sizePolicy6.setHorizontalStretch(0);
+        sizePolicy6.setVerticalStretch(0);
+        sizePolicy6.setHeightForWidth(_lbPreMagType->sizePolicy().hasHeightForWidth());
+        _lbPreMagType->setSizePolicy(sizePolicy6);
+
+        hboxLayout1->addWidget(_lbPreMagType);
+
+        _lbPreMagVal = new QLabel(frameMagnitudes);
+        _lbPreMagVal->setObjectName(QString::fromUtf8("_lbPreMagVal"));
+        QSizePolicy sizePolicy7(QSizePolicy::Minimum, QSizePolicy::Maximum);
+        sizePolicy7.setHorizontalStretch(0);
+        sizePolicy7.setVerticalStretch(0);
+        sizePolicy7.setHeightForWidth(_lbPreMagVal->sizePolicy().hasHeightForWidth());
+        _lbPreMagVal->setSizePolicy(sizePolicy7);
+
+        hboxLayout1->addWidget(_lbPreMagVal);
+
+        spacerItem = new QSpacerItem(20, 5, QSizePolicy::Minimum, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem);
+
+        labelDepth = new QLabel(frameMagnitudes);
+        labelDepth->setObjectName(QString::fromUtf8("labelDepth"));
+        labelDepth->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        hboxLayout1->addWidget(labelDepth);
+
+
+        vboxLayout2->addLayout(hboxLayout1);
+
+        hboxLayout2 = new QHBoxLayout();
+        hboxLayout2->setSpacing(10);
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        labelCustomName = new QLabel(frameMagnitudes);
+        labelCustomName->setObjectName(QString::fromUtf8("labelCustomName"));
+        sizePolicy5.setHeightForWidth(labelCustomName->sizePolicy().hasHeightForWidth());
+        labelCustomName->setSizePolicy(sizePolicy5);
+
+        hboxLayout2->addWidget(labelCustomName);
+
+        labelCustomValue = new QLabel(frameMagnitudes);
+        labelCustomValue->setObjectName(QString::fromUtf8("labelCustomValue"));
+        QSizePolicy sizePolicy8(QSizePolicy::Ignored, QSizePolicy::Preferred);
+        sizePolicy8.setHorizontalStretch(0);
+        sizePolicy8.setVerticalStretch(0);
+        sizePolicy8.setHeightForWidth(labelCustomValue->sizePolicy().hasHeightForWidth());
+        labelCustomValue->setSizePolicy(sizePolicy8);
+
+        hboxLayout2->addWidget(labelCustomValue);
+
+
+        vboxLayout2->addLayout(hboxLayout2);
+
+        frameMagnitudeDistance = new QFrame(frameMagnitudes);
+        frameMagnitudeDistance->setObjectName(QString::fromUtf8("frameMagnitudeDistance"));
+        frameMagnitudeDistance->setFrameShape(QFrame::NoFrame);
+        frameMagnitudeDistance->setFrameShadow(QFrame::Raised);
+
+        vboxLayout2->addWidget(frameMagnitudeDistance);
+
+
+        vboxLayout1->addWidget(frameMagnitudes);
+
+        frameVDistance = new QFrame(EventSummaryView);
+        frameVDistance->setObjectName(QString::fromUtf8("frameVDistance"));
+        frameVDistance->setMinimumSize(QSize(8, 8));
+        frameVDistance->setFrameShape(QFrame::NoFrame);
+        frameVDistance->setFrameShadow(QFrame::Plain);
+
+        vboxLayout1->addWidget(frameVDistance);
+
+        frameEpicenterInformation = new QFrame(EventSummaryView);
+        frameEpicenterInformation->setObjectName(QString::fromUtf8("frameEpicenterInformation"));
+        QSizePolicy sizePolicy9(QSizePolicy::Preferred, QSizePolicy::MinimumExpanding);
+        sizePolicy9.setHorizontalStretch(0);
+        sizePolicy9.setVerticalStretch(0);
+        sizePolicy9.setHeightForWidth(frameEpicenterInformation->sizePolicy().hasHeightForWidth());
+        frameEpicenterInformation->setSizePolicy(sizePolicy9);
+        frameEpicenterInformation->setFrameShape(QFrame::NoFrame);
+
+        vboxLayout1->addWidget(frameEpicenterInformation);
+
+        frameProcessing = new QFrame(EventSummaryView);
+        frameProcessing->setObjectName(QString::fromUtf8("frameProcessing"));
+        frameProcessing->setEnabled(true);
+        sizePolicy2.setHeightForWidth(frameProcessing->sizePolicy().hasHeightForWidth());
+        frameProcessing->setSizePolicy(sizePolicy2);
+        frameProcessing->setFrameShape(QFrame::StyledPanel);
+        frameProcessing->setFrameShadow(QFrame::Raised);
+        hboxLayout3 = new QHBoxLayout(frameProcessing);
+        hboxLayout3->setSpacing(6);
+        hboxLayout3->setContentsMargins(0, 0, 0, 0);
+        hboxLayout3->setObjectName(QString::fromUtf8("hboxLayout3"));
+        btnSwitchToAutomatic = new QPushButton(frameProcessing);
+        btnSwitchToAutomatic->setObjectName(QString::fromUtf8("btnSwitchToAutomatic"));
+        btnSwitchToAutomatic->setEnabled(false);
+
+        hboxLayout3->addWidget(btnSwitchToAutomatic);
+
+        spacerItem1 = new QSpacerItem(0, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout3->addItem(spacerItem1);
+
+        btnShowDetails = new QPushButton(frameProcessing);
+        btnShowDetails->setObjectName(QString::fromUtf8("btnShowDetails"));
+        btnShowDetails->setEnabled(false);
+        QSizePolicy sizePolicy10(QSizePolicy::Maximum, QSizePolicy::Fixed);
+        sizePolicy10.setHorizontalStretch(0);
+        sizePolicy10.setVerticalStretch(0);
+        sizePolicy10.setHeightForWidth(btnShowDetails->sizePolicy().hasHeightForWidth());
+        btnShowDetails->setSizePolicy(sizePolicy10);
+
+        hboxLayout3->addWidget(btnShowDetails);
+
+
+        vboxLayout1->addWidget(frameProcessing);
+
+        framePlugable = new QFrame(EventSummaryView);
+        framePlugable->setObjectName(QString::fromUtf8("framePlugable"));
+        framePlugable->setFrameShape(QFrame::StyledPanel);
+        framePlugable->setFrameShadow(QFrame::Raised);
+        hboxLayout4 = new QHBoxLayout(framePlugable);
+        hboxLayout4->setSpacing(6);
+        hboxLayout4->setContentsMargins(0, 0, 0, 0);
+        hboxLayout4->setObjectName(QString::fromUtf8("hboxLayout4"));
+        btnPlugable0 = new QPushButton(framePlugable);
+        btnPlugable0->setObjectName(QString::fromUtf8("btnPlugable0"));
+        btnPlugable0->setEnabled(false);
+        sizePolicy10.setHeightForWidth(btnPlugable0->sizePolicy().hasHeightForWidth());
+        btnPlugable0->setSizePolicy(sizePolicy10);
+        btnPlugable0->setMinimumSize(QSize(0, 0));
+
+        hboxLayout4->addWidget(btnPlugable0);
+
+        spacerItem2 = new QSpacerItem(40, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout4->addItem(spacerItem2);
+
+        btnPlugable1 = new QPushButton(framePlugable);
+        btnPlugable1->setObjectName(QString::fromUtf8("btnPlugable1"));
+        btnPlugable1->setEnabled(false);
+        sizePolicy10.setHeightForWidth(btnPlugable1->sizePolicy().hasHeightForWidth());
+        btnPlugable1->setSizePolicy(sizePolicy10);
+        btnPlugable1->setMinimumSize(QSize(0, 0));
+
+        hboxLayout4->addWidget(btnPlugable1);
+
+
+        vboxLayout1->addWidget(framePlugable);
+
+
+        hboxLayout->addLayout(vboxLayout1);
+
+
+        retranslateUi(EventSummaryView);
+
+        QMetaObject::connectSlotsByName(EventSummaryView);
+    } // setupUi
+
+    void retranslateUi(QWidget *EventSummaryView)
+    {
+        EventSummaryView->setWindowTitle(QCoreApplication::translate("EventSummaryView", "EventSummaryView", nullptr));
+        actionShowInvisibleMagnitudes->setText(QCoreApplication::translate("EventSummaryView", "Show invisible magnitudes", nullptr));
+#if QT_CONFIG(shortcut)
+        actionShowInvisibleMagnitudes->setShortcut(QCoreApplication::translate("EventSummaryView", "Ctrl+Alt+Shift+I", nullptr));
+#endif // QT_CONFIG(shortcut)
+        _lbOriginTime->setText(QCoreApplication::translate("EventSummaryView", "0000/00/00 - 00.00.00.000 UTC", nullptr));
+        _lbOriginTimeAutomatic->setText(QCoreApplication::translate("EventSummaryView", "0000/00/00 - 00.00.00.000 UTC", nullptr));
+        _lbTimeAgo->setText(QCoreApplication::translate("EventSummaryView", "00 Min. 00 Sec. ago", nullptr));
+        _lbRegion->setText(QCoreApplication::translate("EventSummaryView", "region", nullptr));
+        _lbRegionExtra->setText(QCoreApplication::translate("EventSummaryView", "regionInformation", nullptr));
+        _lbPreMagType->setText(QCoreApplication::translate("EventSummaryView", "mb", nullptr));
+        _lbPreMagVal->setText(QCoreApplication::translate("EventSummaryView", "---", nullptr));
+        labelDepth->setText(QCoreApplication::translate("EventSummaryView", "0 km", nullptr));
+        labelCustomName->setText(QCoreApplication::translate("EventSummaryView", "...", nullptr));
+        labelCustomValue->setText(QCoreApplication::translate("EventSummaryView", "-", nullptr));
+        btnSwitchToAutomatic->setText(QCoreApplication::translate("EventSummaryView", "Fix automatic solutions", nullptr));
+        btnShowDetails->setText(QCoreApplication::translate("EventSummaryView", "Show Details", nullptr));
+        btnPlugable0->setText(QCoreApplication::translate("EventSummaryView", "Button0", nullptr));
+        btnPlugable1->setText(QCoreApplication::translate("EventSummaryView", "Button1", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class EventSummaryView: public Ui_EventSummaryView {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_EVENTSUMMARYVIEW_H

include/seiscomp/gui/datamodel/ui_importpicks.h

@@ -0,0 +1,255 @@
+/********************************************************************************
+** Form generated from reading UI file 'importpicks.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_IMPORTPICKS_H
+#define UI_IMPORTPICKS_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QCheckBox>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QRadioButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_ImportPicks
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QLabel *label;
+    QRadioButton *radioLatestOrigin;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem;
+    QLabel *label_2;
+    QRadioButton *radioLatestAutomaticOrigin;
+    QHBoxLayout *hboxLayout1;
+    QSpacerItem *spacerItem1;
+    QLabel *label_5;
+    QRadioButton *radioMaxPhaseOrigin;
+    QHBoxLayout *hboxLayout2;
+    QSpacerItem *spacerItem2;
+    QLabel *label_3;
+    QRadioButton *radioAllOrigins;
+    QHBoxLayout *hboxLayout3;
+    QSpacerItem *spacerItem3;
+    QLabel *label_4;
+    QSpacerItem *spacerItem4;
+    QCheckBox *checkAllAgencies;
+    QCheckBox *checkAllPhases;
+    QCheckBox *checkPreferTargetPhases;
+    QHBoxLayout *hboxLayout4;
+    QSpacerItem *spacerItem5;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *ImportPicks)
+    {
+        if (ImportPicks->objectName().isEmpty())
+            ImportPicks->setObjectName(QString::fromUtf8("ImportPicks"));
+        ImportPicks->resize(415, 499);
+        QSizePolicy sizePolicy(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(ImportPicks->sizePolicy().hasHeightForWidth());
+        ImportPicks->setSizePolicy(sizePolicy);
+        vboxLayout = new QVBoxLayout(ImportPicks);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        label = new QLabel(ImportPicks);
+        label->setObjectName(QString::fromUtf8("label"));
+        label->setWordWrap(true);
+
+        vboxLayout->addWidget(label);
+
+        radioLatestOrigin = new QRadioButton(ImportPicks);
+        radioLatestOrigin->setObjectName(QString::fromUtf8("radioLatestOrigin"));
+        radioLatestOrigin->setChecked(true);
+
+        vboxLayout->addWidget(radioLatestOrigin);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem = new QSpacerItem(20, 20, QSizePolicy::Fixed, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem);
+
+        label_2 = new QLabel(ImportPicks);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+        label_2->setWordWrap(true);
+
+        hboxLayout->addWidget(label_2);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        radioLatestAutomaticOrigin = new QRadioButton(ImportPicks);
+        radioLatestAutomaticOrigin->setObjectName(QString::fromUtf8("radioLatestAutomaticOrigin"));
+
+        vboxLayout->addWidget(radioLatestAutomaticOrigin);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        spacerItem1 = new QSpacerItem(20, 20, QSizePolicy::Fixed, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem1);
+
+        label_5 = new QLabel(ImportPicks);
+        label_5->setObjectName(QString::fromUtf8("label_5"));
+        label_5->setWordWrap(true);
+
+        hboxLayout1->addWidget(label_5);
+
+
+        vboxLayout->addLayout(hboxLayout1);
+
+        radioMaxPhaseOrigin = new QRadioButton(ImportPicks);
+        radioMaxPhaseOrigin->setObjectName(QString::fromUtf8("radioMaxPhaseOrigin"));
+
+        vboxLayout->addWidget(radioMaxPhaseOrigin);
+
+        hboxLayout2 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout2->setSpacing(6);
+#endif
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        spacerItem2 = new QSpacerItem(20, 20, QSizePolicy::Fixed, QSizePolicy::Minimum);
+
+        hboxLayout2->addItem(spacerItem2);
+
+        label_3 = new QLabel(ImportPicks);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+        label_3->setWordWrap(true);
+
+        hboxLayout2->addWidget(label_3);
+
+
+        vboxLayout->addLayout(hboxLayout2);
+
+        radioAllOrigins = new QRadioButton(ImportPicks);
+        radioAllOrigins->setObjectName(QString::fromUtf8("radioAllOrigins"));
+
+        vboxLayout->addWidget(radioAllOrigins);
+
+        hboxLayout3 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout3->setSpacing(6);
+#endif
+        hboxLayout3->setContentsMargins(0, 0, 0, 0);
+        hboxLayout3->setObjectName(QString::fromUtf8("hboxLayout3"));
+        spacerItem3 = new QSpacerItem(20, 20, QSizePolicy::Fixed, QSizePolicy::Minimum);
+
+        hboxLayout3->addItem(spacerItem3);
+
+        label_4 = new QLabel(ImportPicks);
+        label_4->setObjectName(QString::fromUtf8("label_4"));
+        label_4->setWordWrap(true);
+
+        hboxLayout3->addWidget(label_4);
+
+
+        vboxLayout->addLayout(hboxLayout3);
+
+        spacerItem4 = new QSpacerItem(397, 21, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout->addItem(spacerItem4);
+
+        checkAllAgencies = new QCheckBox(ImportPicks);
+        checkAllAgencies->setObjectName(QString::fromUtf8("checkAllAgencies"));
+
+        vboxLayout->addWidget(checkAllAgencies);
+
+        checkAllPhases = new QCheckBox(ImportPicks);
+        checkAllPhases->setObjectName(QString::fromUtf8("checkAllPhases"));
+        checkAllPhases->setChecked(true);
+
+        vboxLayout->addWidget(checkAllPhases);
+
+        checkPreferTargetPhases = new QCheckBox(ImportPicks);
+        checkPreferTargetPhases->setObjectName(QString::fromUtf8("checkPreferTargetPhases"));
+        checkPreferTargetPhases->setChecked(true);
+
+        vboxLayout->addWidget(checkPreferTargetPhases);
+
+        hboxLayout4 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout4->setSpacing(6);
+#endif
+        hboxLayout4->setContentsMargins(0, 0, 0, 0);
+        hboxLayout4->setObjectName(QString::fromUtf8("hboxLayout4"));
+        spacerItem5 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout4->addItem(spacerItem5);
+
+        okButton = new QPushButton(ImportPicks);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout4->addWidget(okButton);
+
+        cancelButton = new QPushButton(ImportPicks);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout4->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout4);
+
+
+        retranslateUi(ImportPicks);
+        QObject::connect(okButton, SIGNAL(clicked()), ImportPicks, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), ImportPicks, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(ImportPicks);
+    } // setupUi
+
+    void retranslateUi(QDialog *ImportPicks)
+    {
+        ImportPicks->setWindowTitle(QCoreApplication::translate("ImportPicks", "Import picks", nullptr));
+        label->setText(QCoreApplication::translate("ImportPicks", "Please select the picks of the origin(s) you want to import. Streams that are picked already are going to be ignored.", nullptr));
+        radioLatestOrigin->setText(QCoreApplication::translate("ImportPicks", "Latest origin", nullptr));
+        label_2->setText(QCoreApplication::translate("ImportPicks", "Imports the picks and corresponding weights of the latest origin belonging to the event including manual solutions (e.g. created by another operator).", nullptr));
+        radioLatestAutomaticOrigin->setText(QCoreApplication::translate("ImportPicks", "Latest automatic origin", nullptr));
+        label_5->setText(QCoreApplication::translate("ImportPicks", "Imports the picks and corresponding weights of the latest automatic origin belonging to the event. Manual solutions are going to be ignored.", nullptr));
+        radioMaxPhaseOrigin->setText(QCoreApplication::translate("ImportPicks", "Origin with maximum phase count", nullptr));
+        label_3->setText(QCoreApplication::translate("ImportPicks", "Imports the picks and corresponding weights of the latest origin with the most phases belonging to the event.", nullptr));
+        radioAllOrigins->setText(QCoreApplication::translate("ImportPicks", "All origins referenced by this event", nullptr));
+        label_4->setText(QCoreApplication::translate("ImportPicks", "Imports the picks of all origins of the event. Duplicates are going to be removed. All picks are associated to the origin with a weight of 0!", nullptr));
+        checkAllAgencies->setText(QCoreApplication::translate("ImportPicks", "Import picks from all agencies instead of using only own picks.", nullptr));
+        checkAllPhases->setText(QCoreApplication::translate("ImportPicks", "Import all phases and do not map only to P and S.", nullptr));
+        checkPreferTargetPhases->setText(QCoreApplication::translate("ImportPicks", "Prefer phases of target in case of duplicates.", nullptr));
+        okButton->setText(QCoreApplication::translate("ImportPicks", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("ImportPicks", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class ImportPicks: public Ui_ImportPicks {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_IMPORTPICKS_H

include/seiscomp/gui/datamodel/ui_locatorsettings.h

@@ -0,0 +1,98 @@
+/********************************************************************************
+** Form generated from reading UI file 'locatorsettings.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_LOCATORSETTINGS_H
+#define UI_LOCATORSETTINGS_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QHeaderView>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTableWidget>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_LocatorSettings
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QTableWidget *tableParameters;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *LocatorSettings)
+    {
+        if (LocatorSettings->objectName().isEmpty())
+            LocatorSettings->setObjectName(QString::fromUtf8("LocatorSettings"));
+        LocatorSettings->resize(453, 455);
+        vboxLayout = new QVBoxLayout(LocatorSettings);
+        vboxLayout->setSpacing(4);
+        vboxLayout->setContentsMargins(6, 6, 6, 6);
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        tableParameters = new QTableWidget(LocatorSettings);
+        tableParameters->setObjectName(QString::fromUtf8("tableParameters"));
+        tableParameters->setAlternatingRowColors(true);
+        tableParameters->setSelectionMode(QAbstractItemView::SingleSelection);
+        tableParameters->setSelectionBehavior(QAbstractItemView::SelectRows);
+        tableParameters->setSortingEnabled(true);
+
+        vboxLayout->addWidget(tableParameters);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem);
+
+        okButton = new QPushButton(LocatorSettings);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout->addWidget(okButton);
+
+        cancelButton = new QPushButton(LocatorSettings);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+
+        retranslateUi(LocatorSettings);
+        QObject::connect(okButton, SIGNAL(clicked()), LocatorSettings, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), LocatorSettings, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(LocatorSettings);
+    } // setupUi
+
+    void retranslateUi(QDialog *LocatorSettings)
+    {
+        LocatorSettings->setWindowTitle(QCoreApplication::translate("LocatorSettings", "Dialog", nullptr));
+        okButton->setText(QCoreApplication::translate("LocatorSettings", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("LocatorSettings", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class LocatorSettings: public Ui_LocatorSettings {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_LOCATORSETTINGS_H

include/seiscomp/gui/datamodel/ui_maglistview.h

@@ -0,0 +1,98 @@
+/********************************************************************************
+** Form generated from reading UI file 'maglistview.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_MAGLISTVIEW_H
+#define UI_MAGLISTVIEW_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QHeaderView>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTreeWidget>
+#include <QtWidgets/QVBoxLayout>
+#include <QtWidgets/QWidget>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_OriginListView
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QTreeWidget *treeWidget;
+    QHBoxLayout *hboxLayout;
+    QPushButton *btnClear;
+    QSpacerItem *spacerItem;
+    QPushButton *btnDbRead;
+
+    void setupUi(QWidget *OriginListView)
+    {
+        if (OriginListView->objectName().isEmpty())
+            OriginListView->setObjectName(QString::fromUtf8("OriginListView"));
+        OriginListView->resize(448, 649);
+        vboxLayout = new QVBoxLayout(OriginListView);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        treeWidget = new QTreeWidget(OriginListView);
+        treeWidget->setObjectName(QString::fromUtf8("treeWidget"));
+
+        vboxLayout->addWidget(treeWidget);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        btnClear = new QPushButton(OriginListView);
+        btnClear->setObjectName(QString::fromUtf8("btnClear"));
+        btnClear->setEnabled(false);
+
+        hboxLayout->addWidget(btnClear);
+
+        spacerItem = new QSpacerItem(201, 27, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem);
+
+        btnDbRead = new QPushButton(OriginListView);
+        btnDbRead->setObjectName(QString::fromUtf8("btnDbRead"));
+        btnDbRead->setEnabled(false);
+
+        hboxLayout->addWidget(btnDbRead);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+
+        retranslateUi(OriginListView);
+
+        QMetaObject::connectSlotsByName(OriginListView);
+    } // setupUi
+
+    void retranslateUi(QWidget *OriginListView)
+    {
+        OriginListView->setWindowTitle(QCoreApplication::translate("OriginListView", "OriginList", nullptr));
+        btnClear->setText(QCoreApplication::translate("OriginListView", "Clear", nullptr));
+        btnDbRead->setText(QCoreApplication::translate("OriginListView", "Read from DB", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class OriginListView: public Ui_OriginListView {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_MAGLISTVIEW_H

include/seiscomp/gui/datamodel/ui_magnitudeview.h

@@ -0,0 +1,575 @@
+/********************************************************************************
+** Form generated from reading UI file 'magnitudeview.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_MAGNITUDEVIEW_H
+#define UI_MAGNITUDEVIEW_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QComboBox>
+#include <QtWidgets/QDoubleSpinBox>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QHeaderView>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QRadioButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QSpinBox>
+#include <QtWidgets/QTableView>
+#include <QtWidgets/QToolButton>
+#include <QtWidgets/QVBoxLayout>
+#include <QtWidgets/QWidget>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_MagnitudeView
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QFrame *frameMagnitudeTypes;
+    QHBoxLayout *hboxLayout;
+    QFrame *groupSummary;
+    QVBoxLayout *vboxLayout1;
+    QLabel *labelRegion;
+    QFrame *frameMap;
+    QVBoxLayout *vboxLayout2;
+    QFrame *groupMagnitude;
+    QGridLayout *gridLayout;
+    QLabel *label_3;
+    QLabel *lbAgencyID;
+    QLabel *labelAuthor;
+    QLabel *lbAuthor;
+    QSpacerItem *spacerItem;
+    QLabel *label_8;
+    QLabel *label;
+    QLabel *labelAgencyID;
+    QLabel *label_2;
+    QLabel *labelMagnitude;
+    QLabel *labelRMS;
+    QLabel *labelMinMag;
+    QLabel *labelMaxMag;
+    QLabel *labelNumStaMags;
+    QLabel *label_7;
+    QLabel *lbMethod;
+    QLabel *labelMethod;
+    QFrame *frame;
+    QLabel *lbEvaluation;
+    QLabel *labelEvaluation;
+    QFrame *groupMagnitudes;
+    QVBoxLayout *vboxLayout3;
+    QTableView *tableStationMagnitudes;
+    QFrame *groupReview;
+    QVBoxLayout *vboxLayout4;
+    QHBoxLayout *hboxLayout1;
+    QFrame *groupSettings;
+    QHBoxLayout *hboxLayout2;
+    QRadioButton *btnDefault;
+    QRadioButton *btnMean;
+    QRadioButton *btnMedian;
+    QRadioButton *btnTrimmedMean;
+    QSpinBox *spinTrimmedMeanValue;
+    QRadioButton *btnTrimmedMedian;
+    QDoubleSpinBox *spinTrimmedMedianValue;
+    QSpacerItem *spacerItem1;
+    QHBoxLayout *layoutActions;
+    QToolButton *btnRecalculate;
+    QToolButton *btnSelect;
+    QToolButton *btnActivate;
+    QToolButton *btnDeactivate;
+    QLabel *label_4;
+    QComboBox *cbEvalStatus;
+    QSpacerItem *spacerItem2;
+    QToolButton *btnWaveforms;
+    QToolButton *btnCommit;
+
+    void setupUi(QWidget *MagnitudeView)
+    {
+        if (MagnitudeView->objectName().isEmpty())
+            MagnitudeView->setObjectName(QString::fromUtf8("MagnitudeView"));
+        MagnitudeView->resize(894, 864);
+        QSizePolicy sizePolicy(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(MagnitudeView->sizePolicy().hasHeightForWidth());
+        MagnitudeView->setSizePolicy(sizePolicy);
+        vboxLayout = new QVBoxLayout(MagnitudeView);
+        vboxLayout->setSpacing(6);
+        vboxLayout->setContentsMargins(0, 0, 0, 0);
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        frameMagnitudeTypes = new QFrame(MagnitudeView);
+        frameMagnitudeTypes->setObjectName(QString::fromUtf8("frameMagnitudeTypes"));
+        frameMagnitudeTypes->setFrameShape(QFrame::NoFrame);
+
+        vboxLayout->addWidget(frameMagnitudeTypes);
+
+        hboxLayout = new QHBoxLayout();
+        hboxLayout->setSpacing(4);
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        groupSummary = new QFrame(MagnitudeView);
+        groupSummary->setObjectName(QString::fromUtf8("groupSummary"));
+        QSizePolicy sizePolicy1(QSizePolicy::Expanding, QSizePolicy::Preferred);
+        sizePolicy1.setHorizontalStretch(2);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(groupSummary->sizePolicy().hasHeightForWidth());
+        groupSummary->setSizePolicy(sizePolicy1);
+        vboxLayout1 = new QVBoxLayout(groupSummary);
+        vboxLayout1->setSpacing(4);
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        labelRegion = new QLabel(groupSummary);
+        labelRegion->setObjectName(QString::fromUtf8("labelRegion"));
+        QSizePolicy sizePolicy2(QSizePolicy::Ignored, QSizePolicy::Maximum);
+        sizePolicy2.setHorizontalStretch(0);
+        sizePolicy2.setVerticalStretch(0);
+        sizePolicy2.setHeightForWidth(labelRegion->sizePolicy().hasHeightForWidth());
+        labelRegion->setSizePolicy(sizePolicy2);
+        labelRegion->setMinimumSize(QSize(100, 0));
+        labelRegion->setFrameShape(QFrame::NoFrame);
+
+        vboxLayout1->addWidget(labelRegion);
+
+        frameMap = new QFrame(groupSummary);
+        frameMap->setObjectName(QString::fromUtf8("frameMap"));
+        QSizePolicy sizePolicy3(QSizePolicy::Preferred, QSizePolicy::Expanding);
+        sizePolicy3.setHorizontalStretch(1);
+        sizePolicy3.setVerticalStretch(0);
+        sizePolicy3.setHeightForWidth(frameMap->sizePolicy().hasHeightForWidth());
+        frameMap->setSizePolicy(sizePolicy3);
+        frameMap->setMinimumSize(QSize(120, 200));
+        frameMap->setFrameShape(QFrame::NoFrame);
+        frameMap->setFrameShadow(QFrame::Plain);
+
+        vboxLayout1->addWidget(frameMap);
+
+
+        hboxLayout->addWidget(groupSummary);
+
+        vboxLayout2 = new QVBoxLayout();
+        vboxLayout2->setSpacing(4);
+        vboxLayout2->setContentsMargins(0, 0, 0, 0);
+        vboxLayout2->setObjectName(QString::fromUtf8("vboxLayout2"));
+        groupMagnitude = new QFrame(MagnitudeView);
+        groupMagnitude->setObjectName(QString::fromUtf8("groupMagnitude"));
+        QSizePolicy sizePolicy4(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy4.setHorizontalStretch(0);
+        sizePolicy4.setVerticalStretch(1);
+        sizePolicy4.setHeightForWidth(groupMagnitude->sizePolicy().hasHeightForWidth());
+        groupMagnitude->setSizePolicy(sizePolicy4);
+        gridLayout = new QGridLayout(groupMagnitude);
+        gridLayout->setSpacing(6);
+        gridLayout->setContentsMargins(9, 9, 9, 9);
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        label_3 = new QLabel(groupMagnitude);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+        sizePolicy.setHeightForWidth(label_3->sizePolicy().hasHeightForWidth());
+        label_3->setSizePolicy(sizePolicy);
+        label_3->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_3, 3, 0, 1, 1);
+
+        lbAgencyID = new QLabel(groupMagnitude);
+        lbAgencyID->setObjectName(QString::fromUtf8("lbAgencyID"));
+        sizePolicy.setHeightForWidth(lbAgencyID->sizePolicy().hasHeightForWidth());
+        lbAgencyID->setSizePolicy(sizePolicy);
+        lbAgencyID->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbAgencyID, 7, 0, 1, 1);
+
+        labelAuthor = new QLabel(groupMagnitude);
+        labelAuthor->setObjectName(QString::fromUtf8("labelAuthor"));
+        QSizePolicy sizePolicy5(QSizePolicy::Ignored, QSizePolicy::Preferred);
+        sizePolicy5.setHorizontalStretch(0);
+        sizePolicy5.setVerticalStretch(0);
+        sizePolicy5.setHeightForWidth(labelAuthor->sizePolicy().hasHeightForWidth());
+        labelAuthor->setSizePolicy(sizePolicy5);
+
+        gridLayout->addWidget(labelAuthor, 8, 1, 1, 1);
+
+        lbAuthor = new QLabel(groupMagnitude);
+        lbAuthor->setObjectName(QString::fromUtf8("lbAuthor"));
+        lbAuthor->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbAuthor, 8, 0, 1, 1);
+
+        spacerItem = new QSpacerItem(20, 87, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        gridLayout->addItem(spacerItem, 5, 0, 1, 2);
+
+        label_8 = new QLabel(groupMagnitude);
+        label_8->setObjectName(QString::fromUtf8("label_8"));
+        sizePolicy.setHeightForWidth(label_8->sizePolicy().hasHeightForWidth());
+        label_8->setSizePolicy(sizePolicy);
+        label_8->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_8, 2, 0, 1, 1);
+
+        label = new QLabel(groupMagnitude);
+        label->setObjectName(QString::fromUtf8("label"));
+        label->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label, 1, 0, 1, 1);
+
+        labelAgencyID = new QLabel(groupMagnitude);
+        labelAgencyID->setObjectName(QString::fromUtf8("labelAgencyID"));
+        sizePolicy5.setHeightForWidth(labelAgencyID->sizePolicy().hasHeightForWidth());
+        labelAgencyID->setSizePolicy(sizePolicy5);
+
+        gridLayout->addWidget(labelAgencyID, 7, 1, 1, 1);
+
+        label_2 = new QLabel(groupMagnitude);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+        sizePolicy.setHeightForWidth(label_2->sizePolicy().hasHeightForWidth());
+        label_2->setSizePolicy(sizePolicy);
+        label_2->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_2, 4, 0, 1, 1);
+
+        labelMagnitude = new QLabel(groupMagnitude);
+        labelMagnitude->setObjectName(QString::fromUtf8("labelMagnitude"));
+        QSizePolicy sizePolicy6(QSizePolicy::MinimumExpanding, QSizePolicy::Preferred);
+        sizePolicy6.setHorizontalStretch(0);
+        sizePolicy6.setVerticalStretch(0);
+        sizePolicy6.setHeightForWidth(labelMagnitude->sizePolicy().hasHeightForWidth());
+        labelMagnitude->setSizePolicy(sizePolicy6);
+
+        gridLayout->addWidget(labelMagnitude, 0, 1, 1, 1);
+
+        labelRMS = new QLabel(groupMagnitude);
+        labelRMS->setObjectName(QString::fromUtf8("labelRMS"));
+        sizePolicy6.setHeightForWidth(labelRMS->sizePolicy().hasHeightForWidth());
+        labelRMS->setSizePolicy(sizePolicy6);
+
+        gridLayout->addWidget(labelRMS, 1, 1, 1, 1);
+
+        labelMinMag = new QLabel(groupMagnitude);
+        labelMinMag->setObjectName(QString::fromUtf8("labelMinMag"));
+        sizePolicy6.setHeightForWidth(labelMinMag->sizePolicy().hasHeightForWidth());
+        labelMinMag->setSizePolicy(sizePolicy6);
+
+        gridLayout->addWidget(labelMinMag, 3, 1, 1, 1);
+
+        labelMaxMag = new QLabel(groupMagnitude);
+        labelMaxMag->setObjectName(QString::fromUtf8("labelMaxMag"));
+        sizePolicy6.setHeightForWidth(labelMaxMag->sizePolicy().hasHeightForWidth());
+        labelMaxMag->setSizePolicy(sizePolicy6);
+
+        gridLayout->addWidget(labelMaxMag, 4, 1, 1, 1);
+
+        labelNumStaMags = new QLabel(groupMagnitude);
+        labelNumStaMags->setObjectName(QString::fromUtf8("labelNumStaMags"));
+        sizePolicy6.setHeightForWidth(labelNumStaMags->sizePolicy().hasHeightForWidth());
+        labelNumStaMags->setSizePolicy(sizePolicy6);
+        labelNumStaMags->setLayoutDirection(Qt::LeftToRight);
+        labelNumStaMags->setAlignment(Qt::AlignLeading|Qt::AlignLeft|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelNumStaMags, 2, 1, 1, 1);
+
+        label_7 = new QLabel(groupMagnitude);
+        label_7->setObjectName(QString::fromUtf8("label_7"));
+        sizePolicy.setHeightForWidth(label_7->sizePolicy().hasHeightForWidth());
+        label_7->setSizePolicy(sizePolicy);
+        label_7->setMinimumSize(QSize(0, 0));
+        label_7->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_7, 0, 0, 1, 1);
+
+        lbMethod = new QLabel(groupMagnitude);
+        lbMethod->setObjectName(QString::fromUtf8("lbMethod"));
+        sizePolicy.setHeightForWidth(lbMethod->sizePolicy().hasHeightForWidth());
+        lbMethod->setSizePolicy(sizePolicy);
+        lbMethod->setLayoutDirection(Qt::LeftToRight);
+        lbMethod->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbMethod, 10, 0, 1, 1);
+
+        labelMethod = new QLabel(groupMagnitude);
+        labelMethod->setObjectName(QString::fromUtf8("labelMethod"));
+        sizePolicy.setHeightForWidth(labelMethod->sizePolicy().hasHeightForWidth());
+        labelMethod->setSizePolicy(sizePolicy);
+        labelMethod->setScaledContents(false);
+
+        gridLayout->addWidget(labelMethod, 10, 1, 1, 1);
+
+        frame = new QFrame(groupMagnitude);
+        frame->setObjectName(QString::fromUtf8("frame"));
+        QSizePolicy sizePolicy7(QSizePolicy::Preferred, QSizePolicy::Fixed);
+        sizePolicy7.setHorizontalStretch(0);
+        sizePolicy7.setVerticalStretch(0);
+        sizePolicy7.setHeightForWidth(frame->sizePolicy().hasHeightForWidth());
+        frame->setSizePolicy(sizePolicy7);
+        frame->setFrameShape(QFrame::HLine);
+        frame->setFrameShadow(QFrame::Plain);
+
+        gridLayout->addWidget(frame, 6, 0, 1, 2);
+
+        lbEvaluation = new QLabel(groupMagnitude);
+        lbEvaluation->setObjectName(QString::fromUtf8("lbEvaluation"));
+        lbEvaluation->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbEvaluation, 9, 0, 1, 1);
+
+        labelEvaluation = new QLabel(groupMagnitude);
+        labelEvaluation->setObjectName(QString::fromUtf8("labelEvaluation"));
+
+        gridLayout->addWidget(labelEvaluation, 9, 1, 1, 1);
+
+
+        vboxLayout2->addWidget(groupMagnitude);
+
+
+        hboxLayout->addLayout(vboxLayout2);
+
+        groupMagnitudes = new QFrame(MagnitudeView);
+        groupMagnitudes->setObjectName(QString::fromUtf8("groupMagnitudes"));
+        sizePolicy1.setHeightForWidth(groupMagnitudes->sizePolicy().hasHeightForWidth());
+        groupMagnitudes->setSizePolicy(sizePolicy1);
+        vboxLayout3 = new QVBoxLayout(groupMagnitudes);
+        vboxLayout3->setSpacing(4);
+        vboxLayout3->setContentsMargins(0, 0, 0, 0);
+        vboxLayout3->setObjectName(QString::fromUtf8("vboxLayout3"));
+
+        hboxLayout->addWidget(groupMagnitudes);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        tableStationMagnitudes = new QTableView(MagnitudeView);
+        tableStationMagnitudes->setObjectName(QString::fromUtf8("tableStationMagnitudes"));
+        tableStationMagnitudes->setFrameShape(QFrame::NoFrame);
+        tableStationMagnitudes->setFrameShadow(QFrame::Plain);
+        tableStationMagnitudes->setVerticalScrollBarPolicy(Qt::ScrollBarAlwaysOn);
+        tableStationMagnitudes->setAlternatingRowColors(true);
+        tableStationMagnitudes->setSelectionMode(QAbstractItemView::SingleSelection);
+        tableStationMagnitudes->setSelectionBehavior(QAbstractItemView::SelectRows);
+
+        vboxLayout->addWidget(tableStationMagnitudes);
+
+        groupReview = new QFrame(MagnitudeView);
+        groupReview->setObjectName(QString::fromUtf8("groupReview"));
+        groupReview->setFrameShape(QFrame::NoFrame);
+        groupReview->setFrameShadow(QFrame::Raised);
+        vboxLayout4 = new QVBoxLayout(groupReview);
+        vboxLayout4->setSpacing(6);
+        vboxLayout4->setContentsMargins(0, 0, 0, 0);
+        vboxLayout4->setObjectName(QString::fromUtf8("vboxLayout4"));
+        hboxLayout1 = new QHBoxLayout();
+        hboxLayout1->setSpacing(6);
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        groupSettings = new QFrame(groupReview);
+        groupSettings->setObjectName(QString::fromUtf8("groupSettings"));
+        QSizePolicy sizePolicy8(QSizePolicy::Maximum, QSizePolicy::Maximum);
+        sizePolicy8.setHorizontalStretch(1);
+        sizePolicy8.setVerticalStretch(0);
+        sizePolicy8.setHeightForWidth(groupSettings->sizePolicy().hasHeightForWidth());
+        groupSettings->setSizePolicy(sizePolicy8);
+        hboxLayout2 = new QHBoxLayout(groupSettings);
+        hboxLayout2->setSpacing(6);
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        btnDefault = new QRadioButton(groupSettings);
+        btnDefault->setObjectName(QString::fromUtf8("btnDefault"));
+        QSizePolicy sizePolicy9(QSizePolicy::Maximum, QSizePolicy::Fixed);
+        sizePolicy9.setHorizontalStretch(0);
+        sizePolicy9.setVerticalStretch(0);
+        sizePolicy9.setHeightForWidth(btnDefault->sizePolicy().hasHeightForWidth());
+        btnDefault->setSizePolicy(sizePolicy9);
+        btnDefault->setChecked(true);
+
+        hboxLayout2->addWidget(btnDefault);
+
+        btnMean = new QRadioButton(groupSettings);
+        btnMean->setObjectName(QString::fromUtf8("btnMean"));
+        sizePolicy9.setHeightForWidth(btnMean->sizePolicy().hasHeightForWidth());
+        btnMean->setSizePolicy(sizePolicy9);
+
+        hboxLayout2->addWidget(btnMean);
+
+        btnMedian = new QRadioButton(groupSettings);
+        btnMedian->setObjectName(QString::fromUtf8("btnMedian"));
+
+        hboxLayout2->addWidget(btnMedian);
+
+        btnTrimmedMean = new QRadioButton(groupSettings);
+        btnTrimmedMean->setObjectName(QString::fromUtf8("btnTrimmedMean"));
+        sizePolicy9.setHeightForWidth(btnTrimmedMean->sizePolicy().hasHeightForWidth());
+        btnTrimmedMean->setSizePolicy(sizePolicy9);
+
+        hboxLayout2->addWidget(btnTrimmedMean);
+
+        spinTrimmedMeanValue = new QSpinBox(groupSettings);
+        spinTrimmedMeanValue->setObjectName(QString::fromUtf8("spinTrimmedMeanValue"));
+        sizePolicy9.setHeightForWidth(spinTrimmedMeanValue->sizePolicy().hasHeightForWidth());
+        spinTrimmedMeanValue->setSizePolicy(sizePolicy9);
+        spinTrimmedMeanValue->setMaximum(100);
+        spinTrimmedMeanValue->setValue(25);
+
+        hboxLayout2->addWidget(spinTrimmedMeanValue);
+
+        btnTrimmedMedian = new QRadioButton(groupSettings);
+        btnTrimmedMedian->setObjectName(QString::fromUtf8("btnTrimmedMedian"));
+        sizePolicy9.setHeightForWidth(btnTrimmedMedian->sizePolicy().hasHeightForWidth());
+        btnTrimmedMedian->setSizePolicy(sizePolicy9);
+
+        hboxLayout2->addWidget(btnTrimmedMedian);
+
+        spinTrimmedMedianValue = new QDoubleSpinBox(groupSettings);
+        spinTrimmedMedianValue->setObjectName(QString::fromUtf8("spinTrimmedMedianValue"));
+        sizePolicy9.setHeightForWidth(spinTrimmedMedianValue->sizePolicy().hasHeightForWidth());
+        spinTrimmedMedianValue->setSizePolicy(sizePolicy9);
+        spinTrimmedMedianValue->setMaximum(100.000000000000000);
+        spinTrimmedMedianValue->setSingleStep(0.100000000000000);
+        spinTrimmedMedianValue->setValue(0.500000000000000);
+
+        hboxLayout2->addWidget(spinTrimmedMedianValue);
+
+
+        hboxLayout1->addWidget(groupSettings);
+
+        spacerItem1 = new QSpacerItem(40, 20, QSizePolicy::MinimumExpanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem1);
+
+
+        vboxLayout4->addLayout(hboxLayout1);
+
+        layoutActions = new QHBoxLayout();
+        layoutActions->setSpacing(6);
+        layoutActions->setContentsMargins(0, 0, 0, 0);
+        layoutActions->setObjectName(QString::fromUtf8("layoutActions"));
+        btnRecalculate = new QToolButton(groupReview);
+        btnRecalculate->setObjectName(QString::fromUtf8("btnRecalculate"));
+
+        layoutActions->addWidget(btnRecalculate);
+
+        btnSelect = new QToolButton(groupReview);
+        btnSelect->setObjectName(QString::fromUtf8("btnSelect"));
+
+        layoutActions->addWidget(btnSelect);
+
+        btnActivate = new QToolButton(groupReview);
+        btnActivate->setObjectName(QString::fromUtf8("btnActivate"));
+
+        layoutActions->addWidget(btnActivate);
+
+        btnDeactivate = new QToolButton(groupReview);
+        btnDeactivate->setObjectName(QString::fromUtf8("btnDeactivate"));
+
+        layoutActions->addWidget(btnDeactivate);
+
+        label_4 = new QLabel(groupReview);
+        label_4->setObjectName(QString::fromUtf8("label_4"));
+
+        layoutActions->addWidget(label_4);
+
+        cbEvalStatus = new QComboBox(groupReview);
+        cbEvalStatus->setObjectName(QString::fromUtf8("cbEvalStatus"));
+
+        layoutActions->addWidget(cbEvalStatus);
+
+        spacerItem2 = new QSpacerItem(474, 29, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        layoutActions->addItem(spacerItem2);
+
+        btnWaveforms = new QToolButton(groupReview);
+        btnWaveforms->setObjectName(QString::fromUtf8("btnWaveforms"));
+
+        layoutActions->addWidget(btnWaveforms);
+
+        btnCommit = new QToolButton(groupReview);
+        btnCommit->setObjectName(QString::fromUtf8("btnCommit"));
+        btnCommit->setEnabled(false);
+
+        layoutActions->addWidget(btnCommit);
+
+
+        vboxLayout4->addLayout(layoutActions);
+
+
+        vboxLayout->addWidget(groupReview);
+
+
+        retranslateUi(MagnitudeView);
+        QObject::connect(btnTrimmedMean, SIGNAL(toggled(bool)), spinTrimmedMeanValue, SLOT(setEnabled(bool)));
+        QObject::connect(btnTrimmedMedian, SIGNAL(toggled(bool)), spinTrimmedMedianValue, SLOT(setEnabled(bool)));
+
+        QMetaObject::connectSlotsByName(MagnitudeView);
+    } // setupUi
+
+    void retranslateUi(QWidget *MagnitudeView)
+    {
+        MagnitudeView->setWindowTitle(QCoreApplication::translate("MagnitudeView", "MagnitudeView", nullptr));
+        labelRegion->setText(QCoreApplication::translate("MagnitudeView", "Region", nullptr));
+        label_3->setText(QCoreApplication::translate("MagnitudeView", "Min: ", nullptr));
+        lbAgencyID->setText(QCoreApplication::translate("MagnitudeView", "Agency: ", nullptr));
+        labelAuthor->setText(QCoreApplication::translate("MagnitudeView", "-", nullptr));
+        lbAuthor->setText(QCoreApplication::translate("MagnitudeView", "Author: ", nullptr));
+#if QT_CONFIG(tooltip)
+        label_8->setToolTip(QCoreApplication::translate("MagnitudeView", "Station Magnitude Count", nullptr));
+#endif // QT_CONFIG(tooltip)
+        label_8->setText(QCoreApplication::translate("MagnitudeView", "Count: ", nullptr));
+        label->setText(QCoreApplication::translate("MagnitudeView", "+/-: ", nullptr));
+        labelAgencyID->setText(QCoreApplication::translate("MagnitudeView", "MagTool@GFZ", nullptr));
+        label_2->setText(QCoreApplication::translate("MagnitudeView", "Max: ", nullptr));
+        labelMagnitude->setText(QCoreApplication::translate("MagnitudeView", "-.-", nullptr));
+        labelRMS->setText(QCoreApplication::translate("MagnitudeView", "-.-", nullptr));
+        labelMinMag->setText(QCoreApplication::translate("MagnitudeView", "-.-", nullptr));
+        labelMaxMag->setText(QCoreApplication::translate("MagnitudeView", "-.-", nullptr));
+        labelNumStaMags->setText(QCoreApplication::translate("MagnitudeView", "0", nullptr));
+        label_7->setText(QCoreApplication::translate("MagnitudeView", "Value: ", nullptr));
+        lbMethod->setText(QCoreApplication::translate("MagnitudeView", "Method: ", nullptr));
+        labelMethod->setText(QCoreApplication::translate("MagnitudeView", "average", nullptr));
+        lbEvaluation->setText(QCoreApplication::translate("MagnitudeView", "Evaluation:", nullptr));
+        labelEvaluation->setText(QCoreApplication::translate("MagnitudeView", "-", nullptr));
+        btnDefault->setText(QCoreApplication::translate("MagnitudeView", "Default", nullptr));
+        btnMean->setText(QCoreApplication::translate("MagnitudeView", "Mean", nullptr));
+        btnMedian->setText(QCoreApplication::translate("MagnitudeView", "Median", nullptr));
+        btnTrimmedMean->setText(QCoreApplication::translate("MagnitudeView", "Trimmed mean", nullptr));
+        spinTrimmedMeanValue->setSuffix(QCoreApplication::translate("MagnitudeView", "%", nullptr));
+        btnTrimmedMedian->setText(QCoreApplication::translate("MagnitudeView", "Median trimmed mean", nullptr));
+#if QT_CONFIG(tooltip)
+        btnRecalculate->setToolTip(QCoreApplication::translate("MagnitudeView", "Recalculate the network magnitude", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnRecalculate->setText(QCoreApplication::translate("MagnitudeView", "Recalculate", nullptr));
+#if QT_CONFIG(tooltip)
+        btnSelect->setToolTip(QCoreApplication::translate("MagnitudeView", "Selects channels passing the current filter", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnSelect->setText(QCoreApplication::translate("MagnitudeView", "Select", nullptr));
+#if QT_CONFIG(shortcut)
+        btnSelect->setShortcut(QCoreApplication::translate("MagnitudeView", "S", nullptr));
+#endif // QT_CONFIG(shortcut)
+#if QT_CONFIG(tooltip)
+        btnActivate->setToolTip(QCoreApplication::translate("MagnitudeView", "Activate selected channels", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnActivate->setText(QCoreApplication::translate("MagnitudeView", "+", nullptr));
+#if QT_CONFIG(shortcut)
+        btnActivate->setShortcut(QCoreApplication::translate("MagnitudeView", "+", nullptr));
+#endif // QT_CONFIG(shortcut)
+#if QT_CONFIG(tooltip)
+        btnDeactivate->setToolTip(QCoreApplication::translate("MagnitudeView", "Deactivate selected channels", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnDeactivate->setText(QCoreApplication::translate("MagnitudeView", "-", nullptr));
+#if QT_CONFIG(shortcut)
+        btnDeactivate->setShortcut(QCoreApplication::translate("MagnitudeView", "-", nullptr));
+#endif // QT_CONFIG(shortcut)
+        label_4->setText(QCoreApplication::translate("MagnitudeView", "Evaluation:", nullptr));
+        btnWaveforms->setText(QCoreApplication::translate("MagnitudeView", "Waveforms", nullptr));
+        btnCommit->setText(QCoreApplication::translate("MagnitudeView", "Commit", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class MagnitudeView: public Ui_MagnitudeView {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_MAGNITUDEVIEW_H

include/seiscomp/gui/datamodel/ui_magnitudeview_filter.h

@@ -0,0 +1,145 @@
+/********************************************************************************
+** Form generated from reading UI file 'magnitudeview_filter.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_MAGNITUDEVIEW_FILTER_H
+#define UI_MAGNITUDEVIEW_FILTER_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QToolButton>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_MagnitudeRowFilter
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QHBoxLayout *hboxLayout;
+    QLabel *labelInfo;
+    QToolButton *btnRemove;
+    QToolButton *btnAdd;
+    QFrame *frameFilters;
+    QSpacerItem *spacerItem;
+    QHBoxLayout *hboxLayout1;
+    QSpacerItem *spacerItem1;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *MagnitudeRowFilter)
+    {
+        if (MagnitudeRowFilter->objectName().isEmpty())
+            MagnitudeRowFilter->setObjectName(QString::fromUtf8("MagnitudeRowFilter"));
+        MagnitudeRowFilter->resize(405, 209);
+        vboxLayout = new QVBoxLayout(MagnitudeRowFilter);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        labelInfo = new QLabel(MagnitudeRowFilter);
+        labelInfo->setObjectName(QString::fromUtf8("labelInfo"));
+
+        hboxLayout->addWidget(labelInfo);
+
+        btnRemove = new QToolButton(MagnitudeRowFilter);
+        btnRemove->setObjectName(QString::fromUtf8("btnRemove"));
+
+        hboxLayout->addWidget(btnRemove);
+
+        btnAdd = new QToolButton(MagnitudeRowFilter);
+        btnAdd->setObjectName(QString::fromUtf8("btnAdd"));
+
+        hboxLayout->addWidget(btnAdd);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        frameFilters = new QFrame(MagnitudeRowFilter);
+        frameFilters->setObjectName(QString::fromUtf8("frameFilters"));
+        frameFilters->setFrameShape(QFrame::NoFrame);
+        frameFilters->setFrameShadow(QFrame::Raised);
+
+        vboxLayout->addWidget(frameFilters);
+
+        spacerItem = new QSpacerItem(20, 40, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout->addItem(spacerItem);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        spacerItem1 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem1);
+
+        okButton = new QPushButton(MagnitudeRowFilter);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout1->addWidget(okButton);
+
+        cancelButton = new QPushButton(MagnitudeRowFilter);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout1->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout1);
+
+
+        retranslateUi(MagnitudeRowFilter);
+        QObject::connect(okButton, SIGNAL(clicked()), MagnitudeRowFilter, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), MagnitudeRowFilter, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(MagnitudeRowFilter);
+    } // setupUi
+
+    void retranslateUi(QDialog *MagnitudeRowFilter)
+    {
+        MagnitudeRowFilter->setWindowTitle(QCoreApplication::translate("MagnitudeRowFilter", "Selection filter", nullptr));
+        labelInfo->setText(QString());
+#if QT_CONFIG(tooltip)
+        btnRemove->setToolTip(QCoreApplication::translate("MagnitudeRowFilter", "Remove last filter", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnRemove->setText(QCoreApplication::translate("MagnitudeRowFilter", "-", nullptr));
+#if QT_CONFIG(tooltip)
+        btnAdd->setToolTip(QCoreApplication::translate("MagnitudeRowFilter", "Add another filter that is OR'ed with the others", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnAdd->setText(QCoreApplication::translate("MagnitudeRowFilter", "+", nullptr));
+        okButton->setText(QCoreApplication::translate("MagnitudeRowFilter", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("MagnitudeRowFilter", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class MagnitudeRowFilter: public Ui_MagnitudeRowFilter {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_MAGNITUDEVIEW_FILTER_H

include/seiscomp/gui/datamodel/ui_mergeorigins.h

@@ -0,0 +1,113 @@
+/********************************************************************************
+** Form generated from reading UI file 'mergeorigins.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_MERGEORIGINS_H
+#define UI_MERGEORIGINS_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QCheckBox>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_MergeOrigins
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QLabel *labelInfo;
+    QCheckBox *checkAllAgencies;
+    QSpacerItem *spacerItem;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem1;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *MergeOrigins)
+    {
+        if (MergeOrigins->objectName().isEmpty())
+            MergeOrigins->setObjectName(QString::fromUtf8("MergeOrigins"));
+        MergeOrigins->resize(411, 182);
+        vboxLayout = new QVBoxLayout(MergeOrigins);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        labelInfo = new QLabel(MergeOrigins);
+        labelInfo->setObjectName(QString::fromUtf8("labelInfo"));
+        labelInfo->setAlignment(Qt::AlignLeading|Qt::AlignLeft|Qt::AlignTop);
+        labelInfo->setWordWrap(true);
+
+        vboxLayout->addWidget(labelInfo);
+
+        checkAllAgencies = new QCheckBox(MergeOrigins);
+        checkAllAgencies->setObjectName(QString::fromUtf8("checkAllAgencies"));
+
+        vboxLayout->addWidget(checkAllAgencies);
+
+        spacerItem = new QSpacerItem(20, 20, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout->addItem(spacerItem);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem1 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem1);
+
+        okButton = new QPushButton(MergeOrigins);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout->addWidget(okButton);
+
+        cancelButton = new QPushButton(MergeOrigins);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+
+        retranslateUi(MergeOrigins);
+        QObject::connect(okButton, SIGNAL(clicked()), MergeOrigins, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), MergeOrigins, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(MergeOrigins);
+    } // setupUi
+
+    void retranslateUi(QDialog *MergeOrigins)
+    {
+        MergeOrigins->setWindowTitle(QCoreApplication::translate("MergeOrigins", "Merge origins", nullptr));
+        labelInfo->setText(QCoreApplication::translate("MergeOrigins", "%1 origins are selected to be merged. Picks are not associated with the result more than once. The first associated pick and its defined phase is taken. If the same pick is associated with a successive origin in the merge list it is ignored. In a drag and drop operation the drop target is always the first element in the merge list. ", nullptr));
+        checkAllAgencies->setText(QCoreApplication::translate("MergeOrigins", "Merge picks from all agencies instead of using only own picks.", nullptr));
+        okButton->setText(QCoreApplication::translate("MergeOrigins", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("MergeOrigins", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class MergeOrigins: public Ui_MergeOrigins {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_MERGEORIGINS_H

include/seiscomp/gui/datamodel/ui_origindialog.h

@@ -0,0 +1,364 @@
+/********************************************************************************
+** Form generated from reading UI file 'origindialog.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_ORIGINDIALOG_H
+#define UI_ORIGINDIALOG_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QComboBox>
+#include <QtWidgets/QDateTimeEdit>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QGroupBox>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QLineEdit>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_OriginDialog
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QGroupBox *groupBox;
+    QGridLayout *gridLayout;
+    QLabel *depthLabel;
+    QLabel *lonLabel;
+    QLabel *latLabel;
+    QLabel *timeLabel;
+    QDateTimeEdit *dateTimeEdit;
+    QLineEdit *latLineEdit;
+    QLabel *latUnitLabel;
+    QLabel *lonUnitLabel;
+    QLabel *depthUnitLabel;
+    QLineEdit *lonLineEdit;
+    QLineEdit *depthLineEdit;
+    QGroupBox *advancedGroupBox;
+    QGridLayout *gridLayout1;
+    QLabel *magTypeLabel;
+    QLabel *magLabel;
+    QLabel *phaseCountLabel;
+    QLineEdit *phaseCountLineEdit;
+    QLineEdit *magLineEdit;
+    QComboBox *magTypeComboBox;
+    QSpacerItem *spacerItem;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem1;
+    QPushButton *sendButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *OriginDialog)
+    {
+        if (OriginDialog->objectName().isEmpty())
+            OriginDialog->setObjectName(QString::fromUtf8("OriginDialog"));
+        OriginDialog->resize(284, 346);
+        QSizePolicy sizePolicy(QSizePolicy::Preferred, QSizePolicy::Minimum);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(OriginDialog->sizePolicy().hasHeightForWidth());
+        OriginDialog->setSizePolicy(sizePolicy);
+        vboxLayout = new QVBoxLayout(OriginDialog);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        groupBox = new QGroupBox(OriginDialog);
+        groupBox->setObjectName(QString::fromUtf8("groupBox"));
+        gridLayout = new QGridLayout(groupBox);
+#ifndef Q_OS_MAC
+        gridLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        gridLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        depthLabel = new QLabel(groupBox);
+        depthLabel->setObjectName(QString::fromUtf8("depthLabel"));
+
+        gridLayout->addWidget(depthLabel, 3, 0, 1, 1);
+
+        lonLabel = new QLabel(groupBox);
+        lonLabel->setObjectName(QString::fromUtf8("lonLabel"));
+
+        gridLayout->addWidget(lonLabel, 2, 0, 1, 1);
+
+        latLabel = new QLabel(groupBox);
+        latLabel->setObjectName(QString::fromUtf8("latLabel"));
+
+        gridLayout->addWidget(latLabel, 1, 0, 1, 1);
+
+        timeLabel = new QLabel(groupBox);
+        timeLabel->setObjectName(QString::fromUtf8("timeLabel"));
+        QSizePolicy sizePolicy1(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy1.setHorizontalStretch(0);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(timeLabel->sizePolicy().hasHeightForWidth());
+        timeLabel->setSizePolicy(sizePolicy1);
+
+        gridLayout->addWidget(timeLabel, 0, 0, 1, 1);
+
+        dateTimeEdit = new QDateTimeEdit(groupBox);
+        dateTimeEdit->setObjectName(QString::fromUtf8("dateTimeEdit"));
+        dateTimeEdit->setAlignment(Qt::AlignRight);
+        dateTimeEdit->setCurrentSection(QDateTimeEdit::YearSection);
+
+        gridLayout->addWidget(dateTimeEdit, 0, 1, 1, 1);
+
+        latLineEdit = new QLineEdit(groupBox);
+        latLineEdit->setObjectName(QString::fromUtf8("latLineEdit"));
+
+        gridLayout->addWidget(latLineEdit, 1, 1, 1, 1);
+
+        latUnitLabel = new QLabel(groupBox);
+        latUnitLabel->setObjectName(QString::fromUtf8("latUnitLabel"));
+
+        gridLayout->addWidget(latUnitLabel, 1, 2, 1, 1);
+
+        lonUnitLabel = new QLabel(groupBox);
+        lonUnitLabel->setObjectName(QString::fromUtf8("lonUnitLabel"));
+
+        gridLayout->addWidget(lonUnitLabel, 2, 2, 1, 1);
+
+        depthUnitLabel = new QLabel(groupBox);
+        depthUnitLabel->setObjectName(QString::fromUtf8("depthUnitLabel"));
+
+        gridLayout->addWidget(depthUnitLabel, 3, 2, 1, 1);
+
+        lonLineEdit = new QLineEdit(groupBox);
+        lonLineEdit->setObjectName(QString::fromUtf8("lonLineEdit"));
+
+        gridLayout->addWidget(lonLineEdit, 2, 1, 1, 1);
+
+        depthLineEdit = new QLineEdit(groupBox);
+        depthLineEdit->setObjectName(QString::fromUtf8("depthLineEdit"));
+
+        gridLayout->addWidget(depthLineEdit, 3, 1, 1, 1);
+
+
+        vboxLayout->addWidget(groupBox);
+
+        advancedGroupBox = new QGroupBox(OriginDialog);
+        advancedGroupBox->setObjectName(QString::fromUtf8("advancedGroupBox"));
+        advancedGroupBox->setEnabled(true);
+        advancedGroupBox->setCheckable(true);
+        advancedGroupBox->setChecked(false);
+        gridLayout1 = new QGridLayout(advancedGroupBox);
+#ifndef Q_OS_MAC
+        gridLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        gridLayout1->setContentsMargins(9, 9, 9, 9);
+#endif
+        gridLayout1->setObjectName(QString::fromUtf8("gridLayout1"));
+        magTypeLabel = new QLabel(advancedGroupBox);
+        magTypeLabel->setObjectName(QString::fromUtf8("magTypeLabel"));
+        sizePolicy1.setHeightForWidth(magTypeLabel->sizePolicy().hasHeightForWidth());
+        magTypeLabel->setSizePolicy(sizePolicy1);
+
+        gridLayout1->addWidget(magTypeLabel, 2, 0, 1, 1);
+
+        magLabel = new QLabel(advancedGroupBox);
+        magLabel->setObjectName(QString::fromUtf8("magLabel"));
+        sizePolicy1.setHeightForWidth(magLabel->sizePolicy().hasHeightForWidth());
+        magLabel->setSizePolicy(sizePolicy1);
+
+        gridLayout1->addWidget(magLabel, 1, 0, 1, 1);
+
+        phaseCountLabel = new QLabel(advancedGroupBox);
+        phaseCountLabel->setObjectName(QString::fromUtf8("phaseCountLabel"));
+        sizePolicy1.setHeightForWidth(phaseCountLabel->sizePolicy().hasHeightForWidth());
+        phaseCountLabel->setSizePolicy(sizePolicy1);
+
+        gridLayout1->addWidget(phaseCountLabel, 0, 0, 1, 1);
+
+        phaseCountLineEdit = new QLineEdit(advancedGroupBox);
+        phaseCountLineEdit->setObjectName(QString::fromUtf8("phaseCountLineEdit"));
+
+        gridLayout1->addWidget(phaseCountLineEdit, 0, 1, 1, 1);
+
+        magLineEdit = new QLineEdit(advancedGroupBox);
+        magLineEdit->setObjectName(QString::fromUtf8("magLineEdit"));
+
+        gridLayout1->addWidget(magLineEdit, 1, 1, 1, 1);
+
+        magTypeComboBox = new QComboBox(advancedGroupBox);
+        magTypeComboBox->setObjectName(QString::fromUtf8("magTypeComboBox"));
+        magTypeComboBox->setEditable(true);
+        magTypeComboBox->setMaxVisibleItems(30);
+
+        gridLayout1->addWidget(magTypeComboBox, 2, 1, 1, 1);
+
+
+        vboxLayout->addWidget(advancedGroupBox);
+
+        spacerItem = new QSpacerItem(20, 40, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout->addItem(spacerItem);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem1 = new QSpacerItem(40, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem1);
+
+        sendButton = new QPushButton(OriginDialog);
+        sendButton->setObjectName(QString::fromUtf8("sendButton"));
+        QPalette palette;
+        QBrush brush(QColor(0, 0, 0, 255));
+        brush.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::WindowText, brush);
+        QBrush brush1(QColor(221, 223, 228, 255));
+        brush1.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::Button, brush1);
+        QBrush brush2(QColor(255, 255, 255, 255));
+        brush2.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::Light, brush2);
+        palette.setBrush(QPalette::Active, QPalette::Midlight, brush2);
+        QBrush brush3(QColor(85, 85, 85, 255));
+        brush3.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::Dark, brush3);
+        QBrush brush4(QColor(199, 199, 199, 255));
+        brush4.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::Mid, brush4);
+        palette.setBrush(QPalette::Active, QPalette::Text, brush);
+        palette.setBrush(QPalette::Active, QPalette::BrightText, brush2);
+        palette.setBrush(QPalette::Active, QPalette::ButtonText, brush);
+        palette.setBrush(QPalette::Active, QPalette::Base, brush2);
+        QBrush brush5(QColor(239, 239, 239, 255));
+        brush5.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::Window, brush5);
+        palette.setBrush(QPalette::Active, QPalette::Shadow, brush);
+        QBrush brush6(QColor(103, 141, 178, 255));
+        brush6.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::Highlight, brush6);
+        palette.setBrush(QPalette::Active, QPalette::HighlightedText, brush2);
+        QBrush brush7(QColor(0, 0, 238, 255));
+        brush7.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::Link, brush7);
+        QBrush brush8(QColor(82, 24, 139, 255));
+        brush8.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::LinkVisited, brush8);
+        QBrush brush9(QColor(232, 232, 232, 255));
+        brush9.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Active, QPalette::AlternateBase, brush9);
+        palette.setBrush(QPalette::Inactive, QPalette::WindowText, brush);
+        palette.setBrush(QPalette::Inactive, QPalette::Button, brush1);
+        palette.setBrush(QPalette::Inactive, QPalette::Light, brush2);
+        palette.setBrush(QPalette::Inactive, QPalette::Midlight, brush2);
+        palette.setBrush(QPalette::Inactive, QPalette::Dark, brush3);
+        palette.setBrush(QPalette::Inactive, QPalette::Mid, brush4);
+        palette.setBrush(QPalette::Inactive, QPalette::Text, brush);
+        palette.setBrush(QPalette::Inactive, QPalette::BrightText, brush2);
+        palette.setBrush(QPalette::Inactive, QPalette::ButtonText, brush);
+        palette.setBrush(QPalette::Inactive, QPalette::Base, brush2);
+        palette.setBrush(QPalette::Inactive, QPalette::Window, brush5);
+        palette.setBrush(QPalette::Inactive, QPalette::Shadow, brush);
+        palette.setBrush(QPalette::Inactive, QPalette::Highlight, brush6);
+        palette.setBrush(QPalette::Inactive, QPalette::HighlightedText, brush2);
+        palette.setBrush(QPalette::Inactive, QPalette::Link, brush7);
+        palette.setBrush(QPalette::Inactive, QPalette::LinkVisited, brush8);
+        palette.setBrush(QPalette::Inactive, QPalette::AlternateBase, brush9);
+        QBrush brush10(QColor(128, 128, 128, 255));
+        brush10.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Disabled, QPalette::WindowText, brush10);
+        palette.setBrush(QPalette::Disabled, QPalette::Button, brush1);
+        palette.setBrush(QPalette::Disabled, QPalette::Light, brush2);
+        palette.setBrush(QPalette::Disabled, QPalette::Midlight, brush2);
+        palette.setBrush(QPalette::Disabled, QPalette::Dark, brush3);
+        palette.setBrush(QPalette::Disabled, QPalette::Mid, brush4);
+        palette.setBrush(QPalette::Disabled, QPalette::Text, brush4);
+        palette.setBrush(QPalette::Disabled, QPalette::BrightText, brush2);
+        palette.setBrush(QPalette::Disabled, QPalette::ButtonText, brush10);
+        palette.setBrush(QPalette::Disabled, QPalette::Base, brush5);
+        palette.setBrush(QPalette::Disabled, QPalette::Window, brush5);
+        palette.setBrush(QPalette::Disabled, QPalette::Shadow, brush);
+        QBrush brush11(QColor(86, 117, 148, 255));
+        brush11.setStyle(Qt::SolidPattern);
+        palette.setBrush(QPalette::Disabled, QPalette::Highlight, brush11);
+        palette.setBrush(QPalette::Disabled, QPalette::HighlightedText, brush2);
+        palette.setBrush(QPalette::Disabled, QPalette::Link, brush7);
+        palette.setBrush(QPalette::Disabled, QPalette::LinkVisited, brush8);
+        palette.setBrush(QPalette::Disabled, QPalette::AlternateBase, brush9);
+        sendButton->setPalette(palette);
+
+        hboxLayout->addWidget(sendButton);
+
+        cancelButton = new QPushButton(OriginDialog);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        QWidget::setTabOrder(dateTimeEdit, latLineEdit);
+        QWidget::setTabOrder(latLineEdit, lonLineEdit);
+        QWidget::setTabOrder(lonLineEdit, depthLineEdit);
+        QWidget::setTabOrder(depthLineEdit, advancedGroupBox);
+        QWidget::setTabOrder(advancedGroupBox, phaseCountLineEdit);
+        QWidget::setTabOrder(phaseCountLineEdit, magLineEdit);
+        QWidget::setTabOrder(magLineEdit, magTypeComboBox);
+        QWidget::setTabOrder(magTypeComboBox, sendButton);
+        QWidget::setTabOrder(sendButton, cancelButton);
+
+        retranslateUi(OriginDialog);
+        QObject::connect(sendButton, SIGNAL(clicked()), OriginDialog, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), OriginDialog, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(OriginDialog);
+    } // setupUi
+
+    void retranslateUi(QDialog *OriginDialog)
+    {
+        OriginDialog->setWindowTitle(QCoreApplication::translate("OriginDialog", "Artificial Origin", nullptr));
+        groupBox->setTitle(QCoreApplication::translate("OriginDialog", "Origin", nullptr));
+        depthLabel->setText(QCoreApplication::translate("OriginDialog", "Depth:", nullptr));
+#if QT_CONFIG(tooltip)
+        lonLabel->setToolTip(QCoreApplication::translate("OriginDialog", "Longitude", nullptr));
+#endif // QT_CONFIG(tooltip)
+        lonLabel->setText(QCoreApplication::translate("OriginDialog", "Lon:", nullptr));
+#if QT_CONFIG(tooltip)
+        latLabel->setToolTip(QCoreApplication::translate("OriginDialog", "Latitude", nullptr));
+#endif // QT_CONFIG(tooltip)
+        latLabel->setText(QCoreApplication::translate("OriginDialog", "Lat:", nullptr));
+        timeLabel->setText(QCoreApplication::translate("OriginDialog", "Time:", nullptr));
+        dateTimeEdit->setDisplayFormat(QCoreApplication::translate("OriginDialog", "yyyy-MM-dd hh:mm:ss", nullptr));
+        latUnitLabel->setText(QCoreApplication::translate("OriginDialog", "deg", nullptr));
+        lonUnitLabel->setText(QCoreApplication::translate("OriginDialog", "deg", nullptr));
+        depthUnitLabel->setText(QCoreApplication::translate("OriginDialog", "km", nullptr));
+        advancedGroupBox->setTitle(QCoreApplication::translate("OriginDialog", "Advanced", nullptr));
+        magTypeLabel->setText(QCoreApplication::translate("OriginDialog", "Magnitude Type", nullptr));
+        magLabel->setText(QCoreApplication::translate("OriginDialog", "Magnitude", nullptr));
+#if QT_CONFIG(tooltip)
+        phaseCountLabel->setToolTip(QString());
+#endif // QT_CONFIG(tooltip)
+        phaseCountLabel->setText(QCoreApplication::translate("OriginDialog", "PhaseCount", nullptr));
+        sendButton->setText(QCoreApplication::translate("OriginDialog", "Create", nullptr));
+        cancelButton->setText(QCoreApplication::translate("OriginDialog", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class OriginDialog: public Ui_OriginDialog {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_ORIGINDIALOG_H

include/seiscomp/gui/datamodel/ui_originlocatorview.h

@@ -0,0 +1,977 @@
+/********************************************************************************
+** Form generated from reading UI file 'originlocatorview.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_ORIGINLOCATORVIEW_H
+#define UI_ORIGINLOCATORVIEW_H
+
+#include <QtCore/QVariant>
+#include <QtGui/QIcon>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QCheckBox>
+#include <QtWidgets/QComboBox>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QHeaderView>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QLineEdit>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTableView>
+#include <QtWidgets/QToolButton>
+#include <QtWidgets/QVBoxLayout>
+#include <QtWidgets/QWidget>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_OriginLocatorView
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QHBoxLayout *hboxLayout;
+    QFrame *groupSummary;
+    QVBoxLayout *vboxLayout1;
+    QLabel *labelRegion;
+    QFrame *frameMap;
+    QFrame *groupBox;
+    QGridLayout *gridLayout;
+    QLabel *labelNumPhases;
+    QLabel *labelAgency;
+    QLabel *labelMinDistUnit;
+    QLabel *labelDepth;
+    QLabel *labelStdErrorUnit;
+    QLabel *lbEventID;
+    QLabel *labelLatitudeErrorUnit;
+    QLabel *labelLatitudeError;
+    QLabel *label_13;
+    QLabel *labelLongitude;
+    QLabel *labelCreated;
+    QLabel *label_11;
+    QLabel *labelLongitudeErrorUnit;
+    QLabel *labelUser;
+    QLabel *labelEarthModel;
+    QFrame *frameInfoSeparator;
+    QLabel *labelNumPhasesError;
+    QLabel *labelLatitudeUnit;
+    QLabel *labelStdError;
+    QLabel *labelLatitude;
+    QLabel *label_7;
+    QLabel *labelEventID;
+    QLabel *labelDepthErrorUnit;
+    QLabel *labelTime;
+    QLabel *label_12;
+    QLabel *lbEarthModel;
+    QLabel *lbMethod;
+    QLabel *labelMinDist;
+    QLabel *lbAgencyID;
+    QLabel *label_8;
+    QLabel *labelMethod;
+    QLabel *label_10;
+    QSpacerItem *spacerItem;
+    QLabel *label_16;
+    QLabel *labelNumPhasesUnit;
+    QLabel *lbUser;
+    QLabel *label_9;
+    QLabel *labelLongitudeError;
+    QLabel *labelDepthError;
+    QLabel *labelEvaluation;
+    QLabel *labelLongitudeUnit;
+    QLabel *label_15;
+    QLabel *labelAzimuthGap;
+    QLabel *labelDepthUnit;
+    QLabel *labelAzimuthGapUnit;
+    QLabel *lbEvaluation;
+    QLabel *lbComment;
+    QLabel *labelComment;
+    QFrame *groupResiduals;
+    QVBoxLayout *vboxLayout2;
+    QHBoxLayout *hboxLayout1;
+    QSpacerItem *spacerItem1;
+    QLabel *label_5;
+    QLabel *labelPlotFilter;
+    QTableView *tableArrivals;
+    QFrame *toolButtonGroupBox;
+    QGridLayout *gridLayout1;
+    QFrame *frameDepthType;
+    QHBoxLayout *hboxLayout2;
+    QComboBox *cbDepthType;
+    QFrame *frameActionsLeft;
+    QHBoxLayout *hboxLayout3;
+    QToolButton *btnRelocate;
+    QToolButton *btnCustom0;
+    QToolButton *btnCustom1;
+    QSpacerItem *spacerItem2;
+    QFrame *frameLocator;
+    QHBoxLayout *hboxLayout4;
+    QComboBox *cbLocator;
+    QToolButton *btnLocatorSettings;
+    QSpacerItem *spacerItem3;
+    QLabel *label_2;
+    QComboBox *cbLocatorProfile;
+    QSpacerItem *spacerItem4;
+    QFrame *frameFixDepth;
+    QHBoxLayout *hboxLayout5;
+    QCheckBox *cbFixedDepth;
+    QLineEdit *editFixedDepth;
+    QLabel *label_3;
+    QSpacerItem *spacerItem5;
+    QFrame *frame;
+    QHBoxLayout *hboxLayout6;
+    QCheckBox *cbDistanceCutOff;
+    QLineEdit *editDistanceCutOff;
+    QLabel *label;
+    QSpacerItem *spacerItem6;
+    QCheckBox *cbIgnoreInitialLocation;
+    QSpacerItem *spacerItem7;
+    QToolButton *buttonEditComment;
+    QFrame *frameActionsRight;
+    QHBoxLayout *hboxLayout7;
+    QSpacerItem *spacerItem8;
+    QToolButton *btnShowWaveforms;
+    QToolButton *btnImportAllArrivals;
+    QToolButton *btnMagnitudes;
+    QToolButton *btnCommit;
+
+    void setupUi(QWidget *OriginLocatorView)
+    {
+        if (OriginLocatorView->objectName().isEmpty())
+            OriginLocatorView->setObjectName(QString::fromUtf8("OriginLocatorView"));
+        OriginLocatorView->resize(1734, 1127);
+        QSizePolicy sizePolicy(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(OriginLocatorView->sizePolicy().hasHeightForWidth());
+        OriginLocatorView->setSizePolicy(sizePolicy);
+        vboxLayout = new QVBoxLayout(OriginLocatorView);
+        vboxLayout->setSpacing(6);
+        vboxLayout->setContentsMargins(0, 0, 0, 0);
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        hboxLayout = new QHBoxLayout();
+        hboxLayout->setSpacing(6);
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        groupSummary = new QFrame(OriginLocatorView);
+        groupSummary->setObjectName(QString::fromUtf8("groupSummary"));
+        QSizePolicy sizePolicy1(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy1.setHorizontalStretch(2);
+        sizePolicy1.setVerticalStretch(0);
+        sizePolicy1.setHeightForWidth(groupSummary->sizePolicy().hasHeightForWidth());
+        groupSummary->setSizePolicy(sizePolicy1);
+        groupSummary->setFrameShape(QFrame::NoFrame);
+        groupSummary->setFrameShadow(QFrame::Plain);
+        vboxLayout1 = new QVBoxLayout(groupSummary);
+        vboxLayout1->setSpacing(4);
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        labelRegion = new QLabel(groupSummary);
+        labelRegion->setObjectName(QString::fromUtf8("labelRegion"));
+        QSizePolicy sizePolicy2(QSizePolicy::Ignored, QSizePolicy::Maximum);
+        sizePolicy2.setHorizontalStretch(0);
+        sizePolicy2.setVerticalStretch(0);
+        sizePolicy2.setHeightForWidth(labelRegion->sizePolicy().hasHeightForWidth());
+        labelRegion->setSizePolicy(sizePolicy2);
+        QFont font;
+        font.setFamily(QString::fromUtf8("Sans Serif"));
+        font.setPointSize(14);
+        font.setBold(true);
+        font.setItalic(false);
+        font.setUnderline(false);
+        font.setWeight(75);
+        font.setStrikeOut(false);
+        labelRegion->setFont(font);
+        labelRegion->setFrameShape(QFrame::NoFrame);
+
+        vboxLayout1->addWidget(labelRegion);
+
+        frameMap = new QFrame(groupSummary);
+        frameMap->setObjectName(QString::fromUtf8("frameMap"));
+        QSizePolicy sizePolicy3(QSizePolicy::Minimum, QSizePolicy::Expanding);
+        sizePolicy3.setHorizontalStretch(1);
+        sizePolicy3.setVerticalStretch(0);
+        sizePolicy3.setHeightForWidth(frameMap->sizePolicy().hasHeightForWidth());
+        frameMap->setSizePolicy(sizePolicy3);
+        frameMap->setMinimumSize(QSize(120, 200));
+        frameMap->setMaximumSize(QSize(2000, 2000));
+        QPalette palette;
+        palette.setColor(QPalette::Active, QPalette::WindowText, QColor(0, 0, 0));
+        palette.setColor(QPalette::Active, QPalette::Button, QColor(221, 223, 228));
+        palette.setColor(QPalette::Active, QPalette::Light, QColor(255, 255, 255));
+        palette.setColor(QPalette::Active, QPalette::Midlight, QColor(255, 255, 255));
+        palette.setColor(QPalette::Active, QPalette::Dark, QColor(85, 85, 85));
+        palette.setColor(QPalette::Active, QPalette::Mid, QColor(199, 199, 199));
+        palette.setColor(QPalette::Active, QPalette::Text, QColor(0, 0, 0));
+        palette.setColor(QPalette::Active, QPalette::BrightText, QColor(255, 255, 255));
+        palette.setColor(QPalette::Active, QPalette::ButtonText, QColor(0, 0, 0));
+        palette.setColor(QPalette::Active, QPalette::Base, QColor(255, 255, 255));
+        palette.setColor(QPalette::Active, QPalette::Window, QColor(239, 239, 239));
+        palette.setColor(QPalette::Active, QPalette::Shadow, QColor(0, 0, 0));
+        palette.setColor(QPalette::Active, QPalette::Highlight, QColor(103, 141, 178));
+        palette.setColor(QPalette::Active, QPalette::HighlightedText, QColor(255, 255, 255));
+        palette.setColor(QPalette::Active, QPalette::Link, QColor(0, 0, 238));
+        palette.setColor(QPalette::Active, QPalette::LinkVisited, QColor(82, 24, 139));
+        palette.setColor(QPalette::Active, QPalette::AlternateBase, QColor(232, 232, 232));
+        palette.setColor(QPalette::Inactive, QPalette::WindowText, QColor(0, 0, 0));
+        palette.setColor(QPalette::Inactive, QPalette::Button, QColor(221, 223, 228));
+        palette.setColor(QPalette::Inactive, QPalette::Light, QColor(255, 255, 255));
+        palette.setColor(QPalette::Inactive, QPalette::Midlight, QColor(255, 255, 255));
+        palette.setColor(QPalette::Inactive, QPalette::Dark, QColor(85, 85, 85));
+        palette.setColor(QPalette::Inactive, QPalette::Mid, QColor(199, 199, 199));
+        palette.setColor(QPalette::Inactive, QPalette::Text, QColor(0, 0, 0));
+        palette.setColor(QPalette::Inactive, QPalette::BrightText, QColor(255, 255, 255));
+        palette.setColor(QPalette::Inactive, QPalette::ButtonText, QColor(0, 0, 0));
+        palette.setColor(QPalette::Inactive, QPalette::Base, QColor(255, 255, 255));
+        palette.setColor(QPalette::Inactive, QPalette::Window, QColor(239, 239, 239));
+        palette.setColor(QPalette::Inactive, QPalette::Shadow, QColor(0, 0, 0));
+        palette.setColor(QPalette::Inactive, QPalette::Highlight, QColor(103, 141, 178));
+        palette.setColor(QPalette::Inactive, QPalette::HighlightedText, QColor(255, 255, 255));
+        palette.setColor(QPalette::Inactive, QPalette::Link, QColor(0, 0, 238));
+        palette.setColor(QPalette::Inactive, QPalette::LinkVisited, QColor(82, 24, 139));
+        palette.setColor(QPalette::Inactive, QPalette::AlternateBase, QColor(232, 232, 232));
+        palette.setColor(QPalette::Disabled, QPalette::WindowText, QColor(128, 128, 128));
+        palette.setColor(QPalette::Disabled, QPalette::Button, QColor(221, 223, 228));
+        palette.setColor(QPalette::Disabled, QPalette::Light, QColor(255, 255, 255));
+        palette.setColor(QPalette::Disabled, QPalette::Midlight, QColor(255, 255, 255));
+        palette.setColor(QPalette::Disabled, QPalette::Dark, QColor(85, 85, 85));
+        palette.setColor(QPalette::Disabled, QPalette::Mid, QColor(199, 199, 199));
+        palette.setColor(QPalette::Disabled, QPalette::Text, QColor(199, 199, 199));
+        palette.setColor(QPalette::Disabled, QPalette::BrightText, QColor(255, 255, 255));
+        palette.setColor(QPalette::Disabled, QPalette::ButtonText, QColor(128, 128, 128));
+        palette.setColor(QPalette::Disabled, QPalette::Base, QColor(239, 239, 239));
+        palette.setColor(QPalette::Disabled, QPalette::Window, QColor(239, 239, 239));
+        palette.setColor(QPalette::Disabled, QPalette::Shadow, QColor(0, 0, 0));
+        palette.setColor(QPalette::Disabled, QPalette::Highlight, QColor(86, 117, 148));
+        palette.setColor(QPalette::Disabled, QPalette::HighlightedText, QColor(255, 255, 255));
+        palette.setColor(QPalette::Disabled, QPalette::Link, QColor(0, 0, 238));
+        palette.setColor(QPalette::Disabled, QPalette::LinkVisited, QColor(82, 24, 139));
+        palette.setColor(QPalette::Disabled, QPalette::AlternateBase, QColor(232, 232, 232));
+        frameMap->setPalette(palette);
+        frameMap->setFrameShape(QFrame::NoFrame);
+        frameMap->setFrameShadow(QFrame::Plain);
+
+        vboxLayout1->addWidget(frameMap);
+
+
+        hboxLayout->addWidget(groupSummary);
+
+        groupBox = new QFrame(OriginLocatorView);
+        groupBox->setObjectName(QString::fromUtf8("groupBox"));
+        QSizePolicy sizePolicy4(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy4.setHorizontalStretch(1);
+        sizePolicy4.setVerticalStretch(0);
+        sizePolicy4.setHeightForWidth(groupBox->sizePolicy().hasHeightForWidth());
+        groupBox->setSizePolicy(sizePolicy4);
+        gridLayout = new QGridLayout(groupBox);
+        gridLayout->setSpacing(6);
+        gridLayout->setContentsMargins(9, 9, 9, 9);
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        labelNumPhases = new QLabel(groupBox);
+        labelNumPhases->setObjectName(QString::fromUtf8("labelNumPhases"));
+        labelNumPhases->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelNumPhases, 4, 1, 1, 1);
+
+        labelAgency = new QLabel(groupBox);
+        labelAgency->setObjectName(QString::fromUtf8("labelAgency"));
+        QSizePolicy sizePolicy5(QSizePolicy::Ignored, QSizePolicy::Preferred);
+        sizePolicy5.setHorizontalStretch(0);
+        sizePolicy5.setVerticalStretch(0);
+        sizePolicy5.setHeightForWidth(labelAgency->sizePolicy().hasHeightForWidth());
+        labelAgency->setSizePolicy(sizePolicy5);
+
+        gridLayout->addWidget(labelAgency, 12, 1, 1, 4);
+
+        labelMinDistUnit = new QLabel(groupBox);
+        labelMinDistUnit->setObjectName(QString::fromUtf8("labelMinDistUnit"));
+
+        gridLayout->addWidget(labelMinDistUnit, 8, 2, 1, 1);
+
+        labelDepth = new QLabel(groupBox);
+        labelDepth->setObjectName(QString::fromUtf8("labelDepth"));
+        labelDepth->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelDepth, 1, 1, 1, 1);
+
+        labelStdErrorUnit = new QLabel(groupBox);
+        labelStdErrorUnit->setObjectName(QString::fromUtf8("labelStdErrorUnit"));
+
+        gridLayout->addWidget(labelStdErrorUnit, 5, 2, 1, 1);
+
+        lbEventID = new QLabel(groupBox);
+        lbEventID->setObjectName(QString::fromUtf8("lbEventID"));
+        lbEventID->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbEventID, 11, 0, 1, 1);
+
+        labelLatitudeErrorUnit = new QLabel(groupBox);
+        labelLatitudeErrorUnit->setObjectName(QString::fromUtf8("labelLatitudeErrorUnit"));
+
+        gridLayout->addWidget(labelLatitudeErrorUnit, 2, 4, 1, 1);
+
+        labelLatitudeError = new QLabel(groupBox);
+        labelLatitudeError->setObjectName(QString::fromUtf8("labelLatitudeError"));
+        labelLatitudeError->setAlignment(Qt::AlignLeading|Qt::AlignLeft|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelLatitudeError, 2, 3, 1, 1);
+
+        label_13 = new QLabel(groupBox);
+        label_13->setObjectName(QString::fromUtf8("label_13"));
+        label_13->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_13, 5, 0, 1, 1);
+
+        labelLongitude = new QLabel(groupBox);
+        labelLongitude->setObjectName(QString::fromUtf8("labelLongitude"));
+        labelLongitude->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelLongitude, 3, 1, 1, 1);
+
+        labelCreated = new QLabel(groupBox);
+        labelCreated->setObjectName(QString::fromUtf8("labelCreated"));
+
+        gridLayout->addWidget(labelCreated, 17, 1, 1, 4);
+
+        label_11 = new QLabel(groupBox);
+        label_11->setObjectName(QString::fromUtf8("label_11"));
+        label_11->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_11, 3, 0, 1, 1);
+
+        labelLongitudeErrorUnit = new QLabel(groupBox);
+        labelLongitudeErrorUnit->setObjectName(QString::fromUtf8("labelLongitudeErrorUnit"));
+
+        gridLayout->addWidget(labelLongitudeErrorUnit, 3, 4, 1, 1);
+
+        labelUser = new QLabel(groupBox);
+        labelUser->setObjectName(QString::fromUtf8("labelUser"));
+        sizePolicy5.setHeightForWidth(labelUser->sizePolicy().hasHeightForWidth());
+        labelUser->setSizePolicy(sizePolicy5);
+
+        gridLayout->addWidget(labelUser, 13, 1, 1, 4);
+
+        labelEarthModel = new QLabel(groupBox);
+        labelEarthModel->setObjectName(QString::fromUtf8("labelEarthModel"));
+        sizePolicy5.setHeightForWidth(labelEarthModel->sizePolicy().hasHeightForWidth());
+        labelEarthModel->setSizePolicy(sizePolicy5);
+
+        gridLayout->addWidget(labelEarthModel, 16, 1, 1, 4);
+
+        frameInfoSeparator = new QFrame(groupBox);
+        frameInfoSeparator->setObjectName(QString::fromUtf8("frameInfoSeparator"));
+        frameInfoSeparator->setFrameShape(QFrame::HLine);
+        frameInfoSeparator->setFrameShadow(QFrame::Sunken);
+
+        gridLayout->addWidget(frameInfoSeparator, 10, 0, 1, 5);
+
+        labelNumPhasesError = new QLabel(groupBox);
+        labelNumPhasesError->setObjectName(QString::fromUtf8("labelNumPhasesError"));
+        labelNumPhasesError->setAlignment(Qt::AlignLeading|Qt::AlignLeft|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelNumPhasesError, 4, 3, 1, 1);
+
+        labelLatitudeUnit = new QLabel(groupBox);
+        labelLatitudeUnit->setObjectName(QString::fromUtf8("labelLatitudeUnit"));
+
+        gridLayout->addWidget(labelLatitudeUnit, 2, 2, 1, 1);
+
+        labelStdError = new QLabel(groupBox);
+        labelStdError->setObjectName(QString::fromUtf8("labelStdError"));
+        labelStdError->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelStdError, 5, 1, 1, 1);
+
+        labelLatitude = new QLabel(groupBox);
+        labelLatitude->setObjectName(QString::fromUtf8("labelLatitude"));
+        labelLatitude->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelLatitude, 2, 1, 1, 1);
+
+        label_7 = new QLabel(groupBox);
+        label_7->setObjectName(QString::fromUtf8("label_7"));
+        label_7->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_7, 7, 0, 1, 1);
+
+        labelEventID = new QLabel(groupBox);
+        labelEventID->setObjectName(QString::fromUtf8("labelEventID"));
+        sizePolicy5.setHeightForWidth(labelEventID->sizePolicy().hasHeightForWidth());
+        labelEventID->setSizePolicy(sizePolicy5);
+
+        gridLayout->addWidget(labelEventID, 11, 1, 1, 4);
+
+        labelDepthErrorUnit = new QLabel(groupBox);
+        labelDepthErrorUnit->setObjectName(QString::fromUtf8("labelDepthErrorUnit"));
+
+        gridLayout->addWidget(labelDepthErrorUnit, 1, 4, 1, 1);
+
+        labelTime = new QLabel(groupBox);
+        labelTime->setObjectName(QString::fromUtf8("labelTime"));
+        labelTime->setAlignment(Qt::AlignLeading|Qt::AlignLeft|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelTime, 0, 1, 1, 4);
+
+        label_12 = new QLabel(groupBox);
+        label_12->setObjectName(QString::fromUtf8("label_12"));
+        label_12->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_12, 1, 0, 1, 1);
+
+        lbEarthModel = new QLabel(groupBox);
+        lbEarthModel->setObjectName(QString::fromUtf8("lbEarthModel"));
+        lbEarthModel->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbEarthModel, 16, 0, 1, 1);
+
+        lbMethod = new QLabel(groupBox);
+        lbMethod->setObjectName(QString::fromUtf8("lbMethod"));
+        lbMethod->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbMethod, 15, 0, 1, 1);
+
+        labelMinDist = new QLabel(groupBox);
+        labelMinDist->setObjectName(QString::fromUtf8("labelMinDist"));
+        labelMinDist->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelMinDist, 8, 1, 1, 1);
+
+        lbAgencyID = new QLabel(groupBox);
+        lbAgencyID->setObjectName(QString::fromUtf8("lbAgencyID"));
+        lbAgencyID->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbAgencyID, 12, 0, 1, 1);
+
+        label_8 = new QLabel(groupBox);
+        label_8->setObjectName(QString::fromUtf8("label_8"));
+        label_8->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_8, 4, 0, 1, 1);
+
+        labelMethod = new QLabel(groupBox);
+        labelMethod->setObjectName(QString::fromUtf8("labelMethod"));
+        sizePolicy5.setHeightForWidth(labelMethod->sizePolicy().hasHeightForWidth());
+        labelMethod->setSizePolicy(sizePolicy5);
+
+        gridLayout->addWidget(labelMethod, 15, 1, 1, 4);
+
+        label_10 = new QLabel(groupBox);
+        label_10->setObjectName(QString::fromUtf8("label_10"));
+        label_10->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_10, 2, 0, 1, 1);
+
+        spacerItem = new QSpacerItem(201, 0, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        gridLayout->addItem(spacerItem, 9, 0, 1, 5);
+
+        label_16 = new QLabel(groupBox);
+        label_16->setObjectName(QString::fromUtf8("label_16"));
+        label_16->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_16, 17, 0, 1, 1);
+
+        labelNumPhasesUnit = new QLabel(groupBox);
+        labelNumPhasesUnit->setObjectName(QString::fromUtf8("labelNumPhasesUnit"));
+        labelNumPhasesUnit->setAlignment(Qt::AlignCenter);
+
+        gridLayout->addWidget(labelNumPhasesUnit, 4, 2, 1, 1);
+
+        lbUser = new QLabel(groupBox);
+        lbUser->setObjectName(QString::fromUtf8("lbUser"));
+        lbUser->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbUser, 13, 0, 1, 1);
+
+        label_9 = new QLabel(groupBox);
+        label_9->setObjectName(QString::fromUtf8("label_9"));
+        label_9->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_9, 8, 0, 1, 1);
+
+        labelLongitudeError = new QLabel(groupBox);
+        labelLongitudeError->setObjectName(QString::fromUtf8("labelLongitudeError"));
+        labelLongitudeError->setAlignment(Qt::AlignLeading|Qt::AlignLeft|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelLongitudeError, 3, 3, 1, 1);
+
+        labelDepthError = new QLabel(groupBox);
+        labelDepthError->setObjectName(QString::fromUtf8("labelDepthError"));
+        labelDepthError->setAlignment(Qt::AlignLeading|Qt::AlignLeft|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelDepthError, 1, 3, 1, 1);
+
+        labelEvaluation = new QLabel(groupBox);
+        labelEvaluation->setObjectName(QString::fromUtf8("labelEvaluation"));
+
+        gridLayout->addWidget(labelEvaluation, 14, 1, 1, 4);
+
+        labelLongitudeUnit = new QLabel(groupBox);
+        labelLongitudeUnit->setObjectName(QString::fromUtf8("labelLongitudeUnit"));
+
+        gridLayout->addWidget(labelLongitudeUnit, 3, 2, 1, 1);
+
+        label_15 = new QLabel(groupBox);
+        label_15->setObjectName(QString::fromUtf8("label_15"));
+        label_15->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(label_15, 0, 0, 1, 1);
+
+        labelAzimuthGap = new QLabel(groupBox);
+        labelAzimuthGap->setObjectName(QString::fromUtf8("labelAzimuthGap"));
+        labelAzimuthGap->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelAzimuthGap, 7, 1, 1, 1);
+
+        labelDepthUnit = new QLabel(groupBox);
+        labelDepthUnit->setObjectName(QString::fromUtf8("labelDepthUnit"));
+
+        gridLayout->addWidget(labelDepthUnit, 1, 2, 1, 1);
+
+        labelAzimuthGapUnit = new QLabel(groupBox);
+        labelAzimuthGapUnit->setObjectName(QString::fromUtf8("labelAzimuthGapUnit"));
+
+        gridLayout->addWidget(labelAzimuthGapUnit, 7, 2, 1, 1);
+
+        lbEvaluation = new QLabel(groupBox);
+        lbEvaluation->setObjectName(QString::fromUtf8("lbEvaluation"));
+        lbEvaluation->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbEvaluation, 14, 0, 1, 1);
+
+        lbComment = new QLabel(groupBox);
+        lbComment->setObjectName(QString::fromUtf8("lbComment"));
+        lbComment->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(lbComment, 6, 0, 1, 1);
+
+        labelComment = new QLabel(groupBox);
+        labelComment->setObjectName(QString::fromUtf8("labelComment"));
+        labelComment->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        gridLayout->addWidget(labelComment, 6, 1, 1, 1);
+
+
+        hboxLayout->addWidget(groupBox);
+
+        groupResiduals = new QFrame(OriginLocatorView);
+        groupResiduals->setObjectName(QString::fromUtf8("groupResiduals"));
+        sizePolicy1.setHeightForWidth(groupResiduals->sizePolicy().hasHeightForWidth());
+        groupResiduals->setSizePolicy(sizePolicy1);
+        groupResiduals->setFrameShape(QFrame::NoFrame);
+        vboxLayout2 = new QVBoxLayout(groupResiduals);
+        vboxLayout2->setSpacing(4);
+        vboxLayout2->setContentsMargins(0, 0, 0, 0);
+        vboxLayout2->setObjectName(QString::fromUtf8("vboxLayout2"));
+        hboxLayout1 = new QHBoxLayout();
+        hboxLayout1->setSpacing(6);
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        spacerItem1 = new QSpacerItem(40, 4, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem1);
+
+        label_5 = new QLabel(groupResiduals);
+        label_5->setObjectName(QString::fromUtf8("label_5"));
+        QSizePolicy sizePolicy6(QSizePolicy::Preferred, QSizePolicy::Maximum);
+        sizePolicy6.setHorizontalStretch(0);
+        sizePolicy6.setVerticalStretch(0);
+        sizePolicy6.setHeightForWidth(label_5->sizePolicy().hasHeightForWidth());
+        label_5->setSizePolicy(sizePolicy6);
+
+        hboxLayout1->addWidget(label_5);
+
+        labelPlotFilter = new QLabel(groupResiduals);
+        labelPlotFilter->setObjectName(QString::fromUtf8("labelPlotFilter"));
+        sizePolicy6.setHeightForWidth(labelPlotFilter->sizePolicy().hasHeightForWidth());
+        labelPlotFilter->setSizePolicy(sizePolicy6);
+
+        hboxLayout1->addWidget(labelPlotFilter);
+
+
+        vboxLayout2->addLayout(hboxLayout1);
+
+
+        hboxLayout->addWidget(groupResiduals);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        tableArrivals = new QTableView(OriginLocatorView);
+        tableArrivals->setObjectName(QString::fromUtf8("tableArrivals"));
+        tableArrivals->setFrameShape(QFrame::NoFrame);
+        tableArrivals->setFrameShadow(QFrame::Plain);
+        tableArrivals->setVerticalScrollBarPolicy(Qt::ScrollBarAlwaysOn);
+        tableArrivals->setAlternatingRowColors(true);
+        tableArrivals->setSelectionMode(QAbstractItemView::SingleSelection);
+        tableArrivals->setSelectionBehavior(QAbstractItemView::SelectRows);
+
+        vboxLayout->addWidget(tableArrivals);
+
+        toolButtonGroupBox = new QFrame(OriginLocatorView);
+        toolButtonGroupBox->setObjectName(QString::fromUtf8("toolButtonGroupBox"));
+        sizePolicy6.setHeightForWidth(toolButtonGroupBox->sizePolicy().hasHeightForWidth());
+        toolButtonGroupBox->setSizePolicy(sizePolicy6);
+        toolButtonGroupBox->setFrameShape(QFrame::NoFrame);
+        gridLayout1 = new QGridLayout(toolButtonGroupBox);
+        gridLayout1->setSpacing(6);
+        gridLayout1->setContentsMargins(0, 0, 0, 0);
+        gridLayout1->setObjectName(QString::fromUtf8("gridLayout1"));
+        frameDepthType = new QFrame(toolButtonGroupBox);
+        frameDepthType->setObjectName(QString::fromUtf8("frameDepthType"));
+        frameDepthType->setFrameShape(QFrame::NoFrame);
+        frameDepthType->setFrameShadow(QFrame::Raised);
+        hboxLayout2 = new QHBoxLayout(frameDepthType);
+        hboxLayout2->setSpacing(6);
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        cbDepthType = new QComboBox(frameDepthType);
+        cbDepthType->setObjectName(QString::fromUtf8("cbDepthType"));
+        cbDepthType->setEnabled(false);
+
+        hboxLayout2->addWidget(cbDepthType);
+
+
+        gridLayout1->addWidget(frameDepthType, 1, 1, 1, 1);
+
+        frameActionsLeft = new QFrame(toolButtonGroupBox);
+        frameActionsLeft->setObjectName(QString::fromUtf8("frameActionsLeft"));
+        sizePolicy.setHeightForWidth(frameActionsLeft->sizePolicy().hasHeightForWidth());
+        frameActionsLeft->setSizePolicy(sizePolicy);
+        frameActionsLeft->setFrameShape(QFrame::NoFrame);
+        frameActionsLeft->setFrameShadow(QFrame::Raised);
+        hboxLayout3 = new QHBoxLayout(frameActionsLeft);
+        hboxLayout3->setSpacing(6);
+        hboxLayout3->setContentsMargins(0, 0, 0, 0);
+        hboxLayout3->setObjectName(QString::fromUtf8("hboxLayout3"));
+        btnRelocate = new QToolButton(frameActionsLeft);
+        btnRelocate->setObjectName(QString::fromUtf8("btnRelocate"));
+        btnRelocate->setEnabled(false);
+
+        hboxLayout3->addWidget(btnRelocate);
+
+        btnCustom0 = new QToolButton(frameActionsLeft);
+        btnCustom0->setObjectName(QString::fromUtf8("btnCustom0"));
+        btnCustom0->setEnabled(false);
+
+        hboxLayout3->addWidget(btnCustom0);
+
+        btnCustom1 = new QToolButton(frameActionsLeft);
+        btnCustom1->setObjectName(QString::fromUtf8("btnCustom1"));
+        btnCustom1->setEnabled(false);
+
+        hboxLayout3->addWidget(btnCustom1);
+
+        spacerItem2 = new QSpacerItem(31, 24, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout3->addItem(spacerItem2);
+
+
+        gridLayout1->addWidget(frameActionsLeft, 1, 0, 1, 1);
+
+        frameLocator = new QFrame(toolButtonGroupBox);
+        frameLocator->setObjectName(QString::fromUtf8("frameLocator"));
+        sizePolicy.setHeightForWidth(frameLocator->sizePolicy().hasHeightForWidth());
+        frameLocator->setSizePolicy(sizePolicy);
+        frameLocator->setFrameShape(QFrame::NoFrame);
+        frameLocator->setFrameShadow(QFrame::Raised);
+        hboxLayout4 = new QHBoxLayout(frameLocator);
+        hboxLayout4->setSpacing(6);
+        hboxLayout4->setContentsMargins(0, 0, 0, 0);
+        hboxLayout4->setObjectName(QString::fromUtf8("hboxLayout4"));
+        cbLocator = new QComboBox(frameLocator);
+        cbLocator->setObjectName(QString::fromUtf8("cbLocator"));
+        cbLocator->setEnabled(false);
+
+        hboxLayout4->addWidget(cbLocator);
+
+        btnLocatorSettings = new QToolButton(frameLocator);
+        btnLocatorSettings->setObjectName(QString::fromUtf8("btnLocatorSettings"));
+        btnLocatorSettings->setEnabled(false);
+        const QIcon icon = QIcon(QString::fromUtf8(":/icons/icons/configure.png"));
+        btnLocatorSettings->setIcon(icon);
+        btnLocatorSettings->setAutoRaise(true);
+
+        hboxLayout4->addWidget(btnLocatorSettings);
+
+        spacerItem3 = new QSpacerItem(20, 27, QSizePolicy::Fixed, QSizePolicy::Minimum);
+
+        hboxLayout4->addItem(spacerItem3);
+
+        label_2 = new QLabel(frameLocator);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+
+        hboxLayout4->addWidget(label_2);
+
+        cbLocatorProfile = new QComboBox(frameLocator);
+        cbLocatorProfile->setObjectName(QString::fromUtf8("cbLocatorProfile"));
+        cbLocatorProfile->setEnabled(false);
+        cbLocatorProfile->setSizeAdjustPolicy(QComboBox::AdjustToContents);
+
+        hboxLayout4->addWidget(cbLocatorProfile);
+
+        spacerItem4 = new QSpacerItem(20, 27, QSizePolicy::Fixed, QSizePolicy::Minimum);
+
+        hboxLayout4->addItem(spacerItem4);
+
+
+        gridLayout1->addWidget(frameLocator, 0, 0, 1, 1);
+
+        frameFixDepth = new QFrame(toolButtonGroupBox);
+        frameFixDepth->setObjectName(QString::fromUtf8("frameFixDepth"));
+        frameFixDepth->setFrameShape(QFrame::NoFrame);
+        frameFixDepth->setFrameShadow(QFrame::Raised);
+        hboxLayout5 = new QHBoxLayout(frameFixDepth);
+        hboxLayout5->setSpacing(6);
+        hboxLayout5->setContentsMargins(0, 0, 0, 0);
+        hboxLayout5->setObjectName(QString::fromUtf8("hboxLayout5"));
+        cbFixedDepth = new QCheckBox(frameFixDepth);
+        cbFixedDepth->setObjectName(QString::fromUtf8("cbFixedDepth"));
+        QSizePolicy sizePolicy7(QSizePolicy::Maximum, QSizePolicy::Fixed);
+        sizePolicy7.setHorizontalStretch(0);
+        sizePolicy7.setVerticalStretch(0);
+        sizePolicy7.setHeightForWidth(cbFixedDepth->sizePolicy().hasHeightForWidth());
+        cbFixedDepth->setSizePolicy(sizePolicy7);
+
+        hboxLayout5->addWidget(cbFixedDepth);
+
+        editFixedDepth = new QLineEdit(frameFixDepth);
+        editFixedDepth->setObjectName(QString::fromUtf8("editFixedDepth"));
+        editFixedDepth->setEnabled(false);
+        QSizePolicy sizePolicy8(QSizePolicy::MinimumExpanding, QSizePolicy::Fixed);
+        sizePolicy8.setHorizontalStretch(0);
+        sizePolicy8.setVerticalStretch(0);
+        sizePolicy8.setHeightForWidth(editFixedDepth->sizePolicy().hasHeightForWidth());
+        editFixedDepth->setSizePolicy(sizePolicy8);
+        editFixedDepth->setMinimumSize(QSize(60, 0));
+        editFixedDepth->setAlignment(Qt::AlignRight);
+
+        hboxLayout5->addWidget(editFixedDepth);
+
+        label_3 = new QLabel(frameFixDepth);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+        QSizePolicy sizePolicy9(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy9.setHorizontalStretch(0);
+        sizePolicy9.setVerticalStretch(0);
+        sizePolicy9.setHeightForWidth(label_3->sizePolicy().hasHeightForWidth());
+        label_3->setSizePolicy(sizePolicy9);
+
+        hboxLayout5->addWidget(label_3);
+
+        spacerItem5 = new QSpacerItem(20, 20, QSizePolicy::Maximum, QSizePolicy::Minimum);
+
+        hboxLayout5->addItem(spacerItem5);
+
+
+        gridLayout1->addWidget(frameFixDepth, 0, 1, 1, 1);
+
+        frame = new QFrame(toolButtonGroupBox);
+        frame->setObjectName(QString::fromUtf8("frame"));
+        QSizePolicy sizePolicy10(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy10.setHorizontalStretch(1);
+        sizePolicy10.setVerticalStretch(0);
+        sizePolicy10.setHeightForWidth(frame->sizePolicy().hasHeightForWidth());
+        frame->setSizePolicy(sizePolicy10);
+        frame->setFrameShape(QFrame::NoFrame);
+        frame->setFrameShadow(QFrame::Raised);
+        hboxLayout6 = new QHBoxLayout(frame);
+        hboxLayout6->setSpacing(6);
+        hboxLayout6->setContentsMargins(0, 0, 0, 0);
+        hboxLayout6->setObjectName(QString::fromUtf8("hboxLayout6"));
+        cbDistanceCutOff = new QCheckBox(frame);
+        cbDistanceCutOff->setObjectName(QString::fromUtf8("cbDistanceCutOff"));
+
+        hboxLayout6->addWidget(cbDistanceCutOff);
+
+        editDistanceCutOff = new QLineEdit(frame);
+        editDistanceCutOff->setObjectName(QString::fromUtf8("editDistanceCutOff"));
+        editDistanceCutOff->setEnabled(false);
+        editDistanceCutOff->setMinimumSize(QSize(60, 0));
+        editDistanceCutOff->setMaximumSize(QSize(60, 16777215));
+        editDistanceCutOff->setAlignment(Qt::AlignRight);
+
+        hboxLayout6->addWidget(editDistanceCutOff);
+
+        label = new QLabel(frame);
+        label->setObjectName(QString::fromUtf8("label"));
+
+        hboxLayout6->addWidget(label);
+
+        spacerItem6 = new QSpacerItem(20, 27, QSizePolicy::Fixed, QSizePolicy::Minimum);
+
+        hboxLayout6->addItem(spacerItem6);
+
+        cbIgnoreInitialLocation = new QCheckBox(frame);
+        cbIgnoreInitialLocation->setObjectName(QString::fromUtf8("cbIgnoreInitialLocation"));
+
+        hboxLayout6->addWidget(cbIgnoreInitialLocation);
+
+        spacerItem7 = new QSpacerItem(120, 27, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout6->addItem(spacerItem7);
+
+        buttonEditComment = new QToolButton(frame);
+        buttonEditComment->setObjectName(QString::fromUtf8("buttonEditComment"));
+        buttonEditComment->setEnabled(false);
+        buttonEditComment->setMaximumSize(QSize(25, 25));
+        const QIcon icon1 = QIcon(QString::fromUtf8(":/icons/icons/comment.png"));
+        buttonEditComment->setIcon(icon1);
+        buttonEditComment->setIconSize(QSize(24, 24));
+        buttonEditComment->setAutoRaise(true);
+
+        hboxLayout6->addWidget(buttonEditComment);
+
+
+        gridLayout1->addWidget(frame, 0, 2, 1, 1);
+
+        frameActionsRight = new QFrame(toolButtonGroupBox);
+        frameActionsRight->setObjectName(QString::fromUtf8("frameActionsRight"));
+        sizePolicy10.setHeightForWidth(frameActionsRight->sizePolicy().hasHeightForWidth());
+        frameActionsRight->setSizePolicy(sizePolicy10);
+        frameActionsRight->setFrameShape(QFrame::NoFrame);
+        frameActionsRight->setFrameShadow(QFrame::Raised);
+        hboxLayout7 = new QHBoxLayout(frameActionsRight);
+        hboxLayout7->setSpacing(6);
+        hboxLayout7->setContentsMargins(0, 0, 0, 0);
+        hboxLayout7->setObjectName(QString::fromUtf8("hboxLayout7"));
+        spacerItem8 = new QSpacerItem(40, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout7->addItem(spacerItem8);
+
+        btnShowWaveforms = new QToolButton(frameActionsRight);
+        btnShowWaveforms->setObjectName(QString::fromUtf8("btnShowWaveforms"));
+        btnShowWaveforms->setEnabled(false);
+
+        hboxLayout7->addWidget(btnShowWaveforms);
+
+        btnImportAllArrivals = new QToolButton(frameActionsRight);
+        btnImportAllArrivals->setObjectName(QString::fromUtf8("btnImportAllArrivals"));
+        btnImportAllArrivals->setEnabled(false);
+
+        hboxLayout7->addWidget(btnImportAllArrivals);
+
+        btnMagnitudes = new QToolButton(frameActionsRight);
+        btnMagnitudes->setObjectName(QString::fromUtf8("btnMagnitudes"));
+        btnMagnitudes->setEnabled(false);
+
+        hboxLayout7->addWidget(btnMagnitudes);
+
+        btnCommit = new QToolButton(frameActionsRight);
+        btnCommit->setObjectName(QString::fromUtf8("btnCommit"));
+        btnCommit->setEnabled(false);
+
+        hboxLayout7->addWidget(btnCommit);
+
+
+        gridLayout1->addWidget(frameActionsRight, 1, 2, 1, 1);
+
+
+        vboxLayout->addWidget(toolButtonGroupBox);
+
+        QWidget::setTabOrder(tableArrivals, cbLocator);
+        QWidget::setTabOrder(cbLocator, btnLocatorSettings);
+        QWidget::setTabOrder(btnLocatorSettings, cbLocatorProfile);
+        QWidget::setTabOrder(cbLocatorProfile, cbFixedDepth);
+        QWidget::setTabOrder(cbFixedDepth, editFixedDepth);
+        QWidget::setTabOrder(editFixedDepth, cbDistanceCutOff);
+        QWidget::setTabOrder(cbDistanceCutOff, editDistanceCutOff);
+
+        retranslateUi(OriginLocatorView);
+        QObject::connect(cbFixedDepth, SIGNAL(toggled(bool)), editFixedDepth, SLOT(setEnabled(bool)));
+        QObject::connect(cbFixedDepth, SIGNAL(toggled(bool)), cbDepthType, SLOT(setEnabled(bool)));
+        QObject::connect(cbDistanceCutOff, SIGNAL(toggled(bool)), editDistanceCutOff, SLOT(setEnabled(bool)));
+
+        QMetaObject::connectSlotsByName(OriginLocatorView);
+    } // setupUi
+
+    void retranslateUi(QWidget *OriginLocatorView)
+    {
+        OriginLocatorView->setWindowTitle(QCoreApplication::translate("OriginLocatorView", "OriginLocatorView", nullptr));
+        labelRegion->setText(QCoreApplication::translate("OriginLocatorView", "Region", nullptr));
+        labelNumPhases->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        labelAgency->setText(QCoreApplication::translate("OriginLocatorView", "GFZ Potsdam", nullptr));
+        labelMinDistUnit->setText(QCoreApplication::translate("OriginLocatorView", "\302\260", nullptr));
+        labelDepth->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        labelStdErrorUnit->setText(QCoreApplication::translate("OriginLocatorView", "s", nullptr));
+        lbEventID->setText(QCoreApplication::translate("OriginLocatorView", "EventID:", nullptr));
+        labelLatitudeErrorUnit->setText(QCoreApplication::translate("OriginLocatorView", "km", nullptr));
+        labelLatitudeError->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        label_13->setText(QCoreApplication::translate("OriginLocatorView", "RMS Res.:", nullptr));
+        labelLongitude->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        labelCreated->setText(QString());
+        label_11->setText(QCoreApplication::translate("OriginLocatorView", "Lon:", nullptr));
+        labelLongitudeErrorUnit->setText(QCoreApplication::translate("OriginLocatorView", "km", nullptr));
+        labelUser->setText(QString());
+        labelEarthModel->setText(QString());
+        labelNumPhasesError->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        labelLatitudeUnit->setText(QCoreApplication::translate("OriginLocatorView", "\302\260", nullptr));
+        labelStdError->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        labelLatitude->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        label_7->setText(QCoreApplication::translate("OriginLocatorView", " Az. Gap:", nullptr));
+        labelEventID->setText(QString());
+        labelDepthErrorUnit->setText(QString());
+        labelTime->setText(QString());
+        label_12->setText(QCoreApplication::translate("OriginLocatorView", "Depth:", nullptr));
+        lbEarthModel->setText(QCoreApplication::translate("OriginLocatorView", "Earth model:", nullptr));
+        lbMethod->setText(QCoreApplication::translate("OriginLocatorView", "Method:", nullptr));
+        labelMinDist->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        lbAgencyID->setText(QCoreApplication::translate("OriginLocatorView", "Agency:", nullptr));
+        label_8->setText(QCoreApplication::translate("OriginLocatorView", "Phases:", nullptr));
+        labelMethod->setText(QString());
+        label_10->setText(QCoreApplication::translate("OriginLocatorView", "Lat:", nullptr));
+        label_16->setText(QCoreApplication::translate("OriginLocatorView", "Updated:", nullptr));
+        labelNumPhasesUnit->setText(QCoreApplication::translate("OriginLocatorView", "/", nullptr));
+        lbUser->setText(QCoreApplication::translate("OriginLocatorView", "Author:", nullptr));
+        label_9->setText(QCoreApplication::translate("OriginLocatorView", "Min. Dist.:", nullptr));
+        labelLongitudeError->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        labelDepthError->setText(QString());
+        labelEvaluation->setText(QCoreApplication::translate("OriginLocatorView", "- (-)", nullptr));
+        labelLongitudeUnit->setText(QCoreApplication::translate("OriginLocatorView", "\302\260", nullptr));
+        label_15->setText(QCoreApplication::translate("OriginLocatorView", "Time:", nullptr));
+        labelAzimuthGap->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        labelDepthUnit->setText(QCoreApplication::translate("OriginLocatorView", "km", nullptr));
+        labelAzimuthGapUnit->setText(QCoreApplication::translate("OriginLocatorView", "\302\260", nullptr));
+        lbEvaluation->setText(QCoreApplication::translate("OriginLocatorView", "Evaluation:", nullptr));
+        lbComment->setText(QCoreApplication::translate("OriginLocatorView", "Custom:", nullptr));
+        labelComment->setText(QCoreApplication::translate("OriginLocatorView", "-", nullptr));
+        label_5->setText(QCoreApplication::translate("OriginLocatorView", "Filter is", nullptr));
+        labelPlotFilter->setText(QCoreApplication::translate("OriginLocatorView", "<a href=\"filter\">not active</a>", nullptr));
+        btnRelocate->setText(QCoreApplication::translate("OriginLocatorView", "Relocate", nullptr));
+        btnCustom0->setText(QCoreApplication::translate("OriginLocatorView", "Custom1", nullptr));
+        btnCustom1->setText(QCoreApplication::translate("OriginLocatorView", "Custom2", nullptr));
+#if QT_CONFIG(tooltip)
+        btnLocatorSettings->setToolTip(QCoreApplication::translate("OriginLocatorView", "Change locator settings", nullptr));
+#endif // QT_CONFIG(tooltip)
+        btnLocatorSettings->setText(QCoreApplication::translate("OriginLocatorView", "...", nullptr));
+        label_2->setText(QCoreApplication::translate("OriginLocatorView", "Profile:", nullptr));
+        cbFixedDepth->setText(QCoreApplication::translate("OriginLocatorView", "Fix depth", nullptr));
+        label_3->setText(QCoreApplication::translate("OriginLocatorView", "km", nullptr));
+        cbDistanceCutOff->setText(QCoreApplication::translate("OriginLocatorView", "Distance cutoff", nullptr));
+        label->setText(QCoreApplication::translate("OriginLocatorView", "km", nullptr));
+#if QT_CONFIG(tooltip)
+        cbIgnoreInitialLocation->setToolTip(QCoreApplication::translate("OriginLocatorView", "Instructs the locator to ignore the passed initial location and to try to locate the event based on the given phases only.", nullptr));
+#endif // QT_CONFIG(tooltip)
+#if QT_CONFIG(whatsthis)
+        cbIgnoreInitialLocation->setWhatsThis(QCoreApplication::translate("OriginLocatorView", "Instructs the locator to ignore the passed initial location and to try to locate the event based on the given phases only.", nullptr));
+#endif // QT_CONFIG(whatsthis)
+        cbIgnoreInitialLocation->setText(QCoreApplication::translate("OriginLocatorView", "Ignore initial location", nullptr));
+#if QT_CONFIG(tooltip)
+        buttonEditComment->setToolTip(QCoreApplication::translate("OriginLocatorView", "Create a new comment on this event or edit an existing one.", nullptr));
+#endif // QT_CONFIG(tooltip)
+        buttonEditComment->setText(QString());
+        btnShowWaveforms->setText(QCoreApplication::translate("OriginLocatorView", "Picker", nullptr));
+        btnImportAllArrivals->setText(QCoreApplication::translate("OriginLocatorView", "Import picks", nullptr));
+        btnMagnitudes->setText(QCoreApplication::translate("OriginLocatorView", "Compute magnitudes", nullptr));
+        btnCommit->setText(QCoreApplication::translate("OriginLocatorView", "Commit", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class OriginLocatorView: public Ui_OriginLocatorView {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_ORIGINLOCATORVIEW_H

include/seiscomp/gui/datamodel/ui_originlocatorview_comment.h

@@ -0,0 +1,205 @@
+/********************************************************************************
+** Form generated from reading UI file 'originlocatorview_comment.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_ORIGINLOCATORVIEW_COMMENT_H
+#define UI_ORIGINLOCATORVIEW_COMMENT_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTextEdit>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_OriginCommentOptions
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QHBoxLayout *hboxLayout;
+    QVBoxLayout *vboxLayout1;
+    QLabel *labelHeadline;
+    QSpacerItem *spacerItem;
+    QVBoxLayout *vboxLayout2;
+    QSpacerItem *verticalSpacerTop;
+    QHBoxLayout *hboxLayout1;
+    QLabel *labelAuthor;
+    QSpacerItem *spacerItem1;
+    QLabel *labelDate;
+    QSpacerItem *verticalSpacerBottom;
+    QFrame *frame;
+    QTextEdit *editComment;
+    QHBoxLayout *hboxLayout2;
+    QSpacerItem *spacerItem2;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *OriginCommentOptions)
+    {
+        if (OriginCommentOptions->objectName().isEmpty())
+            OriginCommentOptions->setObjectName(QString::fromUtf8("OriginCommentOptions"));
+        OriginCommentOptions->resize(546, 320);
+        vboxLayout = new QVBoxLayout(OriginCommentOptions);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        hboxLayout = new QHBoxLayout();
+        hboxLayout->setSpacing(12);
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        vboxLayout1 = new QVBoxLayout();
+#ifndef Q_OS_MAC
+        vboxLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+#endif
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        labelHeadline = new QLabel(OriginCommentOptions);
+        labelHeadline->setObjectName(QString::fromUtf8("labelHeadline"));
+        labelHeadline->setEnabled(false);
+        QSizePolicy sizePolicy(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(labelHeadline->sizePolicy().hasHeightForWidth());
+        labelHeadline->setSizePolicy(sizePolicy);
+        labelHeadline->setPixmap(QPixmap(QString::fromUtf8(":/icons/icons/comment.png")));
+        labelHeadline->setScaledContents(false);
+
+        vboxLayout1->addWidget(labelHeadline);
+
+        spacerItem = new QSpacerItem(20, 0, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout1->addItem(spacerItem);
+
+
+        hboxLayout->addLayout(vboxLayout1);
+
+        vboxLayout2 = new QVBoxLayout();
+        vboxLayout2->setSpacing(0);
+        vboxLayout2->setContentsMargins(0, 0, 0, 0);
+        vboxLayout2->setObjectName(QString::fromUtf8("vboxLayout2"));
+        verticalSpacerTop = new QSpacerItem(10, 0, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout2->addItem(verticalSpacerTop);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        labelAuthor = new QLabel(OriginCommentOptions);
+        labelAuthor->setObjectName(QString::fromUtf8("labelAuthor"));
+
+        hboxLayout1->addWidget(labelAuthor);
+
+        spacerItem1 = new QSpacerItem(40, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem1);
+
+        labelDate = new QLabel(OriginCommentOptions);
+        labelDate->setObjectName(QString::fromUtf8("labelDate"));
+
+        hboxLayout1->addWidget(labelDate);
+
+
+        vboxLayout2->addLayout(hboxLayout1);
+
+        verticalSpacerBottom = new QSpacerItem(10, 0, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout2->addItem(verticalSpacerBottom);
+
+
+        hboxLayout->addLayout(vboxLayout2);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        frame = new QFrame(OriginCommentOptions);
+        frame->setObjectName(QString::fromUtf8("frame"));
+        frame->setFrameShape(QFrame::HLine);
+        frame->setFrameShadow(QFrame::Plain);
+
+        vboxLayout->addWidget(frame);
+
+        editComment = new QTextEdit(OriginCommentOptions);
+        editComment->setObjectName(QString::fromUtf8("editComment"));
+        QSizePolicy sizePolicy1(QSizePolicy::Expanding, QSizePolicy::Expanding);
+        sizePolicy1.setHorizontalStretch(0);
+        sizePolicy1.setVerticalStretch(1);
+        sizePolicy1.setHeightForWidth(editComment->sizePolicy().hasHeightForWidth());
+        editComment->setSizePolicy(sizePolicy1);
+        editComment->setFrameShape(QFrame::StyledPanel);
+        editComment->setFrameShadow(QFrame::Plain);
+
+        vboxLayout->addWidget(editComment);
+
+        hboxLayout2 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout2->setSpacing(6);
+#endif
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        spacerItem2 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout2->addItem(spacerItem2);
+
+        okButton = new QPushButton(OriginCommentOptions);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout2->addWidget(okButton);
+
+        cancelButton = new QPushButton(OriginCommentOptions);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout2->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout2);
+
+
+        retranslateUi(OriginCommentOptions);
+        QObject::connect(okButton, SIGNAL(clicked()), OriginCommentOptions, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), OriginCommentOptions, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(OriginCommentOptions);
+    } // setupUi
+
+    void retranslateUi(QDialog *OriginCommentOptions)
+    {
+        OriginCommentOptions->setWindowTitle(QCoreApplication::translate("OriginCommentOptions", "Edit comment", nullptr));
+        labelHeadline->setText(QString());
+        labelAuthor->setText(QString());
+        labelDate->setText(QString());
+        okButton->setText(QCoreApplication::translate("OriginCommentOptions", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("OriginCommentOptions", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class OriginCommentOptions: public Ui_OriginCommentOptions {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_ORIGINLOCATORVIEW_COMMENT_H

include/seiscomp/gui/datamodel/ui_originlocatorview_commit.h

@@ -0,0 +1,300 @@
+/********************************************************************************
+** Form generated from reading UI file 'originlocatorview_commit.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_ORIGINLOCATORVIEW_COMMIT_H
+#define UI_ORIGINLOCATORVIEW_COMMIT_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QCheckBox>
+#include <QtWidgets/QComboBox>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QFrame>
+#include <QtWidgets/QGridLayout>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QLineEdit>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTextEdit>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_OriginCommitOptions
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QCheckBox *cbAssociate;
+    QFrame *frameEventOptions;
+    QVBoxLayout *vboxLayout1;
+    QHBoxLayout *hboxLayout;
+    QCheckBox *cbFixSolution;
+    QCheckBox *cbFixMagnitudeType;
+    QGridLayout *gridLayout;
+    QLabel *label_21;
+    QLabel *label_2;
+    QComboBox *comboOriginStates;
+    QComboBox *comboEventTypes;
+    QLabel *label_3;
+    QComboBox *comboEventTypeCertainty;
+    QLabel *labelPreferredMagnitude;
+    QComboBox *comboPreferredMagnitude;
+    QFrame *line;
+    QLabel *label;
+    QFrame *line_3;
+    QLabel *labelEQName;
+    QLineEdit *editEQName;
+    QLabel *labelEQComment;
+    QTextEdit *editEQComment;
+    QComboBox *comboEQComment;
+    QSpacerItem *spacerItem;
+    QFrame *line_2;
+    QCheckBox *cbBackToEventList;
+    QHBoxLayout *hboxLayout1;
+    QSpacerItem *spacerItem1;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *OriginCommitOptions)
+    {
+        if (OriginCommitOptions->objectName().isEmpty())
+            OriginCommitOptions->setObjectName(QString::fromUtf8("OriginCommitOptions"));
+        OriginCommitOptions->resize(607, 746);
+        vboxLayout = new QVBoxLayout(OriginCommitOptions);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        cbAssociate = new QCheckBox(OriginCommitOptions);
+        cbAssociate->setObjectName(QString::fromUtf8("cbAssociate"));
+        cbAssociate->setChecked(true);
+
+        vboxLayout->addWidget(cbAssociate);
+
+        frameEventOptions = new QFrame(OriginCommitOptions);
+        frameEventOptions->setObjectName(QString::fromUtf8("frameEventOptions"));
+        frameEventOptions->setFrameShape(QFrame::NoFrame);
+        frameEventOptions->setFrameShadow(QFrame::Raised);
+        vboxLayout1 = new QVBoxLayout(frameEventOptions);
+#ifndef Q_OS_MAC
+        vboxLayout1->setSpacing(6);
+#endif
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        cbFixSolution = new QCheckBox(frameEventOptions);
+        cbFixSolution->setObjectName(QString::fromUtf8("cbFixSolution"));
+        cbFixSolution->setChecked(true);
+
+        hboxLayout->addWidget(cbFixSolution);
+
+
+        vboxLayout1->addLayout(hboxLayout);
+
+        cbFixMagnitudeType = new QCheckBox(frameEventOptions);
+        cbFixMagnitudeType->setObjectName(QString::fromUtf8("cbFixMagnitudeType"));
+        cbFixMagnitudeType->setChecked(true);
+
+        vboxLayout1->addWidget(cbFixMagnitudeType);
+
+        gridLayout = new QGridLayout();
+#ifndef Q_OS_MAC
+        gridLayout->setSpacing(6);
+#endif
+        gridLayout->setContentsMargins(0, 0, 0, 0);
+        gridLayout->setObjectName(QString::fromUtf8("gridLayout"));
+        label_21 = new QLabel(frameEventOptions);
+        label_21->setObjectName(QString::fromUtf8("label_21"));
+        QSizePolicy sizePolicy(QSizePolicy::Maximum, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(label_21->sizePolicy().hasHeightForWidth());
+        label_21->setSizePolicy(sizePolicy);
+
+        gridLayout->addWidget(label_21, 2, 0, 1, 1);
+
+        label_2 = new QLabel(frameEventOptions);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+        sizePolicy.setHeightForWidth(label_2->sizePolicy().hasHeightForWidth());
+        label_2->setSizePolicy(sizePolicy);
+
+        gridLayout->addWidget(label_2, 0, 0, 1, 1);
+
+        comboOriginStates = new QComboBox(frameEventOptions);
+        comboOriginStates->setObjectName(QString::fromUtf8("comboOriginStates"));
+
+        gridLayout->addWidget(comboOriginStates, 2, 1, 1, 1);
+
+        comboEventTypes = new QComboBox(frameEventOptions);
+        comboEventTypes->setObjectName(QString::fromUtf8("comboEventTypes"));
+
+        gridLayout->addWidget(comboEventTypes, 0, 1, 1, 1);
+
+        label_3 = new QLabel(frameEventOptions);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+
+        gridLayout->addWidget(label_3, 1, 0, 1, 1);
+
+        comboEventTypeCertainty = new QComboBox(frameEventOptions);
+        comboEventTypeCertainty->setObjectName(QString::fromUtf8("comboEventTypeCertainty"));
+
+        gridLayout->addWidget(comboEventTypeCertainty, 1, 1, 1, 1);
+
+        labelPreferredMagnitude = new QLabel(frameEventOptions);
+        labelPreferredMagnitude->setObjectName(QString::fromUtf8("labelPreferredMagnitude"));
+
+        gridLayout->addWidget(labelPreferredMagnitude, 3, 0, 1, 1);
+
+        comboPreferredMagnitude = new QComboBox(frameEventOptions);
+        comboPreferredMagnitude->setObjectName(QString::fromUtf8("comboPreferredMagnitude"));
+
+        gridLayout->addWidget(comboPreferredMagnitude, 3, 1, 1, 1);
+
+
+        vboxLayout1->addLayout(gridLayout);
+
+        line = new QFrame(frameEventOptions);
+        line->setObjectName(QString::fromUtf8("line"));
+        line->setFrameShape(QFrame::HLine);
+        line->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout1->addWidget(line);
+
+        label = new QLabel(frameEventOptions);
+        label->setObjectName(QString::fromUtf8("label"));
+        label->setWordWrap(true);
+
+        vboxLayout1->addWidget(label);
+
+        line_3 = new QFrame(frameEventOptions);
+        line_3->setObjectName(QString::fromUtf8("line_3"));
+        line_3->setFrameShape(QFrame::HLine);
+        line_3->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout1->addWidget(line_3);
+
+        labelEQName = new QLabel(frameEventOptions);
+        labelEQName->setObjectName(QString::fromUtf8("labelEQName"));
+
+        vboxLayout1->addWidget(labelEQName);
+
+        editEQName = new QLineEdit(frameEventOptions);
+        editEQName->setObjectName(QString::fromUtf8("editEQName"));
+
+        vboxLayout1->addWidget(editEQName);
+
+        labelEQComment = new QLabel(frameEventOptions);
+        labelEQComment->setObjectName(QString::fromUtf8("labelEQComment"));
+
+        vboxLayout1->addWidget(labelEQComment);
+
+        editEQComment = new QTextEdit(frameEventOptions);
+        editEQComment->setObjectName(QString::fromUtf8("editEQComment"));
+
+        vboxLayout1->addWidget(editEQComment);
+
+        comboEQComment = new QComboBox(frameEventOptions);
+        comboEQComment->setObjectName(QString::fromUtf8("comboEQComment"));
+
+        vboxLayout1->addWidget(comboEQComment);
+
+
+        vboxLayout->addWidget(frameEventOptions);
+
+        spacerItem = new QSpacerItem(20, 40, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout->addItem(spacerItem);
+
+        line_2 = new QFrame(OriginCommitOptions);
+        line_2->setObjectName(QString::fromUtf8("line_2"));
+        line_2->setFrameShape(QFrame::HLine);
+        line_2->setFrameShadow(QFrame::Sunken);
+
+        vboxLayout->addWidget(line_2);
+
+        cbBackToEventList = new QCheckBox(OriginCommitOptions);
+        cbBackToEventList->setObjectName(QString::fromUtf8("cbBackToEventList"));
+        cbBackToEventList->setChecked(true);
+
+        vboxLayout->addWidget(cbBackToEventList);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        spacerItem1 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem1);
+
+        okButton = new QPushButton(OriginCommitOptions);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout1->addWidget(okButton);
+
+        cancelButton = new QPushButton(OriginCommitOptions);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout1->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout1);
+
+
+        retranslateUi(OriginCommitOptions);
+        QObject::connect(okButton, SIGNAL(clicked()), OriginCommitOptions, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), OriginCommitOptions, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(OriginCommitOptions);
+    } // setupUi
+
+    void retranslateUi(QDialog *OriginCommitOptions)
+    {
+        OriginCommitOptions->setWindowTitle(QCoreApplication::translate("OriginCommitOptions", "Commit location", nullptr));
+#if QT_CONFIG(tooltip)
+        cbAssociate->setToolTip(QCoreApplication::translate("OriginCommitOptions", "If checked this origin will be associated with the current event. If unchecked, scevent will decide whether to assoiciate the origin with the current event or to create a new one.", nullptr));
+#endif // QT_CONFIG(tooltip)
+        cbAssociate->setText(QCoreApplication::translate("OriginCommitOptions", "Force association with event %1", nullptr));
+#if QT_CONFIG(tooltip)
+        cbFixSolution->setToolTip(QCoreApplication::translate("OriginCommitOptions", "If checked this origin will be fixed as preferred solution.", nullptr));
+#endif // QT_CONFIG(tooltip)
+        cbFixSolution->setText(QCoreApplication::translate("OriginCommitOptions", "Fix this origin as preferred location.", nullptr));
+        cbFixMagnitudeType->setText(QCoreApplication::translate("OriginCommitOptions", "Fix event preferred magnitude type  %1", nullptr));
+        label_21->setText(QCoreApplication::translate("OriginCommitOptions", "Set origin status to", nullptr));
+        label_2->setText(QCoreApplication::translate("OriginCommitOptions", "Set event type to", nullptr));
+        label_3->setText(QCoreApplication::translate("OriginCommitOptions", "Set event certainty to", nullptr));
+        labelPreferredMagnitude->setText(QCoreApplication::translate("OriginCommitOptions", "Set preferred magnitude type to ", nullptr));
+        label->setText(QCoreApplication::translate("OriginCommitOptions", "<b><u>NOTE</u></b> To fix the origin involves that successive origins are not considered as preferred origins by the event associator (scevent) until another origin is fixed again. Fixing an origin overrides the automatic rules of setting an origin as preferred origin.", nullptr));
+        labelEQName->setText(QCoreApplication::translate("OriginCommitOptions", "Earthquake name:", nullptr));
+        labelEQComment->setText(QCoreApplication::translate("OriginCommitOptions", "Event comment 'Operator':", nullptr));
+        cbBackToEventList->setText(QCoreApplication::translate("OriginCommitOptions", "Return to event list after commit", nullptr));
+        okButton->setText(QCoreApplication::translate("OriginCommitOptions", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("OriginCommitOptions", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class OriginCommitOptions: public Ui_OriginCommitOptions {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_ORIGINLOCATORVIEW_COMMIT_H

include/seiscomp/gui/datamodel/ui_origintime.h

@@ -0,0 +1,225 @@
+/********************************************************************************
+** Form generated from reading UI file 'origintime.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_ORIGINTIME_H
+#define UI_ORIGINTIME_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QDateEdit>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QGroupBox>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTimeEdit>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_OriginTimeDialog
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QGroupBox *groupBox;
+    QHBoxLayout *hboxLayout;
+    QVBoxLayout *vboxLayout1;
+    QLabel *label;
+    QLabel *label_2;
+    QVBoxLayout *vboxLayout2;
+    QLabel *labelLatitude;
+    QLabel *labelLongitude;
+    QGroupBox *groupBox_2;
+    QHBoxLayout *hboxLayout1;
+    QTimeEdit *timeEdit;
+    QDateEdit *dateEdit;
+    QSpacerItem *spacerItem;
+    QHBoxLayout *hboxLayout2;
+    QSpacerItem *spacerItem1;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *OriginTimeDialog)
+    {
+        if (OriginTimeDialog->objectName().isEmpty())
+            OriginTimeDialog->setObjectName(QString::fromUtf8("OriginTimeDialog"));
+        OriginTimeDialog->resize(229, 209);
+        vboxLayout = new QVBoxLayout(OriginTimeDialog);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        groupBox = new QGroupBox(OriginTimeDialog);
+        groupBox->setObjectName(QString::fromUtf8("groupBox"));
+        hboxLayout = new QHBoxLayout(groupBox);
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        vboxLayout1 = new QVBoxLayout();
+#ifndef Q_OS_MAC
+        vboxLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+#endif
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        label = new QLabel(groupBox);
+        label->setObjectName(QString::fromUtf8("label"));
+        QFont font;
+        font.setFamily(QString::fromUtf8("Verdana"));
+        font.setPointSize(12);
+        font.setBold(false);
+        font.setItalic(false);
+        font.setUnderline(false);
+        font.setWeight(50);
+        font.setStrikeOut(false);
+        label->setFont(font);
+        label->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        vboxLayout1->addWidget(label);
+
+        label_2 = new QLabel(groupBox);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+        label_2->setFont(font);
+        label_2->setAlignment(Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter);
+
+        vboxLayout1->addWidget(label_2);
+
+
+        hboxLayout->addLayout(vboxLayout1);
+
+        vboxLayout2 = new QVBoxLayout();
+#ifndef Q_OS_MAC
+        vboxLayout2->setSpacing(6);
+#endif
+        vboxLayout2->setContentsMargins(0, 0, 0, 0);
+        vboxLayout2->setObjectName(QString::fromUtf8("vboxLayout2"));
+        labelLatitude = new QLabel(groupBox);
+        labelLatitude->setObjectName(QString::fromUtf8("labelLatitude"));
+        QSizePolicy sizePolicy(QSizePolicy::Preferred, QSizePolicy::Preferred);
+        sizePolicy.setHorizontalStretch(0);
+        sizePolicy.setVerticalStretch(0);
+        sizePolicy.setHeightForWidth(labelLatitude->sizePolicy().hasHeightForWidth());
+        labelLatitude->setSizePolicy(sizePolicy);
+        QFont font1;
+        font1.setFamily(QString::fromUtf8("Verdana"));
+        font1.setPointSize(12);
+        font1.setBold(true);
+        font1.setItalic(false);
+        font1.setUnderline(false);
+        font1.setWeight(75);
+        font1.setStrikeOut(false);
+        labelLatitude->setFont(font1);
+
+        vboxLayout2->addWidget(labelLatitude);
+
+        labelLongitude = new QLabel(groupBox);
+        labelLongitude->setObjectName(QString::fromUtf8("labelLongitude"));
+        sizePolicy.setHeightForWidth(labelLongitude->sizePolicy().hasHeightForWidth());
+        labelLongitude->setSizePolicy(sizePolicy);
+        labelLongitude->setFont(font1);
+
+        vboxLayout2->addWidget(labelLongitude);
+
+
+        hboxLayout->addLayout(vboxLayout2);
+
+
+        vboxLayout->addWidget(groupBox);
+
+        groupBox_2 = new QGroupBox(OriginTimeDialog);
+        groupBox_2->setObjectName(QString::fromUtf8("groupBox_2"));
+        hboxLayout1 = new QHBoxLayout(groupBox_2);
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout1->setContentsMargins(9, 9, 9, 9);
+#endif
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        timeEdit = new QTimeEdit(groupBox_2);
+        timeEdit->setObjectName(QString::fromUtf8("timeEdit"));
+
+        hboxLayout1->addWidget(timeEdit);
+
+        dateEdit = new QDateEdit(groupBox_2);
+        dateEdit->setObjectName(QString::fromUtf8("dateEdit"));
+        dateEdit->setCurrentSection(QDateTimeEdit::DaySection);
+
+        hboxLayout1->addWidget(dateEdit);
+
+
+        vboxLayout->addWidget(groupBox_2);
+
+        spacerItem = new QSpacerItem(211, 16, QSizePolicy::Minimum, QSizePolicy::Expanding);
+
+        vboxLayout->addItem(spacerItem);
+
+        hboxLayout2 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout2->setSpacing(6);
+#endif
+        hboxLayout2->setContentsMargins(0, 0, 0, 0);
+        hboxLayout2->setObjectName(QString::fromUtf8("hboxLayout2"));
+        spacerItem1 = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout2->addItem(spacerItem1);
+
+        okButton = new QPushButton(OriginTimeDialog);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout2->addWidget(okButton);
+
+        cancelButton = new QPushButton(OriginTimeDialog);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout2->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout2);
+
+
+        retranslateUi(OriginTimeDialog);
+        QObject::connect(okButton, SIGNAL(clicked()), OriginTimeDialog, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), OriginTimeDialog, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(OriginTimeDialog);
+    } // setupUi
+
+    void retranslateUi(QDialog *OriginTimeDialog)
+    {
+        OriginTimeDialog->setWindowTitle(QCoreApplication::translate("OriginTimeDialog", "OriginTime", nullptr));
+        groupBox->setTitle(QCoreApplication::translate("OriginTimeDialog", "Location", nullptr));
+        label->setText(QCoreApplication::translate("OriginTimeDialog", "Latitude:", nullptr));
+        label_2->setText(QCoreApplication::translate("OriginTimeDialog", "Longitude:", nullptr));
+        labelLatitude->setText(QCoreApplication::translate("OriginTimeDialog", "--.- \302\260", nullptr));
+        labelLongitude->setText(QCoreApplication::translate("OriginTimeDialog", "--.- \302\260", nullptr));
+        groupBox_2->setTitle(QCoreApplication::translate("OriginTimeDialog", "Time", nullptr));
+        timeEdit->setDisplayFormat(QCoreApplication::translate("OriginTimeDialog", "hh:mm:ss", nullptr));
+        dateEdit->setDisplayFormat(QCoreApplication::translate("OriginTimeDialog", "dd-MM-yyyy", nullptr));
+        okButton->setText(QCoreApplication::translate("OriginTimeDialog", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("OriginTimeDialog", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class OriginTimeDialog: public Ui_OriginTimeDialog {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_ORIGINTIME_H

include/seiscomp/gui/datamodel/ui_renamephases.h

@@ -0,0 +1,160 @@
+/********************************************************************************
+** Form generated from reading UI file 'renamephases.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_RENAMEPHASES_H
+#define UI_RENAMEPHASES_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QListWidget>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_RenamePhases
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QHBoxLayout *hboxLayout;
+    QVBoxLayout *vboxLayout1;
+    QLabel *label;
+    QListWidget *listSourcePhases;
+    QLabel *label_3;
+    QVBoxLayout *vboxLayout2;
+    QLabel *label_2;
+    QListWidget *listTargetPhase;
+    QHBoxLayout *hboxLayout1;
+    QSpacerItem *spacerItem;
+    QPushButton *okButton;
+    QPushButton *cancelButton;
+
+    void setupUi(QDialog *RenamePhases)
+    {
+        if (RenamePhases->objectName().isEmpty())
+            RenamePhases->setObjectName(QString::fromUtf8("RenamePhases"));
+        RenamePhases->resize(378, 213);
+        vboxLayout = new QVBoxLayout(RenamePhases);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+#endif
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        vboxLayout1 = new QVBoxLayout();
+#ifndef Q_OS_MAC
+        vboxLayout1->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout1->setContentsMargins(0, 0, 0, 0);
+#endif
+        vboxLayout1->setObjectName(QString::fromUtf8("vboxLayout1"));
+        label = new QLabel(RenamePhases);
+        label->setObjectName(QString::fromUtf8("label"));
+
+        vboxLayout1->addWidget(label);
+
+        listSourcePhases = new QListWidget(RenamePhases);
+        listSourcePhases->setObjectName(QString::fromUtf8("listSourcePhases"));
+        listSourcePhases->setSelectionMode(QAbstractItemView::ExtendedSelection);
+
+        vboxLayout1->addWidget(listSourcePhases);
+
+
+        hboxLayout->addLayout(vboxLayout1);
+
+        label_3 = new QLabel(RenamePhases);
+        label_3->setObjectName(QString::fromUtf8("label_3"));
+
+        hboxLayout->addWidget(label_3);
+
+        vboxLayout2 = new QVBoxLayout();
+#ifndef Q_OS_MAC
+        vboxLayout2->setSpacing(6);
+#endif
+        vboxLayout2->setContentsMargins(0, 0, 0, 0);
+        vboxLayout2->setObjectName(QString::fromUtf8("vboxLayout2"));
+        label_2 = new QLabel(RenamePhases);
+        label_2->setObjectName(QString::fromUtf8("label_2"));
+
+        vboxLayout2->addWidget(label_2);
+
+        listTargetPhase = new QListWidget(RenamePhases);
+        listTargetPhase->setObjectName(QString::fromUtf8("listTargetPhase"));
+
+        vboxLayout2->addWidget(listTargetPhase);
+
+
+        hboxLayout->addLayout(vboxLayout2);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+        hboxLayout1 = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout1->setSpacing(6);
+#endif
+        hboxLayout1->setContentsMargins(0, 0, 0, 0);
+        hboxLayout1->setObjectName(QString::fromUtf8("hboxLayout1"));
+        spacerItem = new QSpacerItem(131, 31, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout1->addItem(spacerItem);
+
+        okButton = new QPushButton(RenamePhases);
+        okButton->setObjectName(QString::fromUtf8("okButton"));
+
+        hboxLayout1->addWidget(okButton);
+
+        cancelButton = new QPushButton(RenamePhases);
+        cancelButton->setObjectName(QString::fromUtf8("cancelButton"));
+
+        hboxLayout1->addWidget(cancelButton);
+
+
+        vboxLayout->addLayout(hboxLayout1);
+
+
+        retranslateUi(RenamePhases);
+        QObject::connect(okButton, SIGNAL(clicked()), RenamePhases, SLOT(accept()));
+        QObject::connect(cancelButton, SIGNAL(clicked()), RenamePhases, SLOT(reject()));
+
+        QMetaObject::connectSlotsByName(RenamePhases);
+    } // setupUi
+
+    void retranslateUi(QDialog *RenamePhases)
+    {
+        RenamePhases->setWindowTitle(QCoreApplication::translate("RenamePhases", "Rename phases", nullptr));
+        label->setText(QCoreApplication::translate("RenamePhases", "Source:", nullptr));
+        label_3->setText(QCoreApplication::translate("RenamePhases", ">", nullptr));
+        label_2->setText(QCoreApplication::translate("RenamePhases", "Target:", nullptr));
+        okButton->setText(QCoreApplication::translate("RenamePhases", "OK", nullptr));
+        cancelButton->setText(QCoreApplication::translate("RenamePhases", "Cancel", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class RenamePhases: public Ui_RenamePhases {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_RENAMEPHASES_H

include/seiscomp/gui/datamodel/ui_selectstation.h

@@ -0,0 +1,107 @@
+/********************************************************************************
+** Form generated from reading UI file 'selectstation.ui'
+**
+** Created by: Qt User Interface Compiler version 5.15.13
+**
+** WARNING! All changes made in this file will be lost when recompiling UI file!
+********************************************************************************/
+
+#ifndef UI_SELECTSTATION_H
+#define UI_SELECTSTATION_H
+
+#include <QtCore/QVariant>
+#include <QtWidgets/QApplication>
+#include <QtWidgets/QDialog>
+#include <QtWidgets/QHBoxLayout>
+#include <QtWidgets/QHeaderView>
+#include <QtWidgets/QLabel>
+#include <QtWidgets/QLineEdit>
+#include <QtWidgets/QPushButton>
+#include <QtWidgets/QSpacerItem>
+#include <QtWidgets/QTableView>
+#include <QtWidgets/QVBoxLayout>
+
+QT_BEGIN_NAMESPACE
+
+class Ui_SelectStation
+{
+public:
+    QVBoxLayout *vboxLayout;
+    QLabel *stationListLabel;
+    QLineEdit *stationLineEdit;
+    QTableView *table;
+    QHBoxLayout *hboxLayout;
+    QSpacerItem *spacerItem;
+    QPushButton *btnAdd;
+
+    void setupUi(QDialog *SelectStation)
+    {
+        if (SelectStation->objectName().isEmpty())
+            SelectStation->setObjectName(QString::fromUtf8("SelectStation"));
+        SelectStation->resize(400, 400);
+        vboxLayout = new QVBoxLayout(SelectStation);
+#ifndef Q_OS_MAC
+        vboxLayout->setSpacing(6);
+#endif
+#ifndef Q_OS_MAC
+        vboxLayout->setContentsMargins(9, 9, 9, 9);
+#endif
+        vboxLayout->setObjectName(QString::fromUtf8("vboxLayout"));
+        stationListLabel = new QLabel(SelectStation);
+        stationListLabel->setObjectName(QString::fromUtf8("stationListLabel"));
+
+        vboxLayout->addWidget(stationListLabel);
+
+        stationLineEdit = new QLineEdit(SelectStation);
+        stationLineEdit->setObjectName(QString::fromUtf8("stationLineEdit"));
+
+        vboxLayout->addWidget(stationLineEdit);
+
+        table = new QTableView(SelectStation);
+        table->setObjectName(QString::fromUtf8("table"));
+        table->setAlternatingRowColors(true);
+        table->setSelectionBehavior(QAbstractItemView::SelectRows);
+
+        vboxLayout->addWidget(table);
+
+        hboxLayout = new QHBoxLayout();
+#ifndef Q_OS_MAC
+        hboxLayout->setSpacing(6);
+#endif
+        hboxLayout->setContentsMargins(0, 0, 0, 0);
+        hboxLayout->setObjectName(QString::fromUtf8("hboxLayout"));
+        spacerItem = new QSpacerItem(40, 20, QSizePolicy::Expanding, QSizePolicy::Minimum);
+
+        hboxLayout->addItem(spacerItem);
+
+        btnAdd = new QPushButton(SelectStation);
+        btnAdd->setObjectName(QString::fromUtf8("btnAdd"));
+
+        hboxLayout->addWidget(btnAdd);
+
+
+        vboxLayout->addLayout(hboxLayout);
+
+
+        retranslateUi(SelectStation);
+        QObject::connect(btnAdd, SIGNAL(clicked()), SelectStation, SLOT(accept()));
+
+        QMetaObject::connectSlotsByName(SelectStation);
+    } // setupUi
+
+    void retranslateUi(QDialog *SelectStation)
+    {
+        SelectStation->setWindowTitle(QCoreApplication::translate("SelectStation", "Add station(s)", nullptr));
+        stationListLabel->setText(QCoreApplication::translate("SelectStation", "Station List:", nullptr));
+        btnAdd->setText(QCoreApplication::translate("SelectStation", "Add", nullptr));
+    } // retranslateUi
+
+};
+
+namespace Ui {
+    class SelectStation: public Ui_SelectStation {};
+} // namespace Ui
+
+QT_END_NAMESPACE
+
+#endif // UI_SELECTSTATION_H

include/seiscomp/gui/datamodel/utils.h

@@ -0,0 +1,63 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_DATAMODEL_UTIL_H
+#define SEISCOMP_GUI_DATAMODEL_UTIL_H
+
+
+#include <seiscomp/gui/qt.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/datamodel/utils.h>
+#endif
+#include <seiscomp/gui/core/utils.h>
+#include <QCheckBox>
+
+
+namespace Seiscomp {
+namespace Gui {
+
+
+class CheckBox : public QCheckBox {
+	Q_OBJECT
+
+	public:
+		explicit CheckBox(QWidget *parent=0)
+		: QCheckBox(parent) {}
+
+		explicit CheckBox(const QString &text, QWidget *parent=0)
+		: QCheckBox(text, parent) {}
+
+
+	public slots:
+		void check() {
+			setChecked(true);
+		}
+
+		void unCheck() {
+			setChecked(false);
+		}
+};
+
+
+}
+}
+
+
+#endif

include/seiscomp/gui/map/annotationlayer.h

@@ -0,0 +1,65 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MAP_LAYERS_ANNOTATION_LAYER_H__
+#define SEISCOMP_GUI_MAP_LAYERS_ANNOTATION_LAYER_H__
+
+
+#include <seiscomp/gui/map/annotations.h>
+#include <seiscomp/gui/map/layer.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+namespace Map {
+
+
+class Canvas;
+
+
+class AnnotationLayer : public Layer {
+	public:
+		AnnotationLayer(QObject* parent = nullptr,
+		                Annotations *annotations = nullptr);
+
+		void setAnnotations(Annotations *annotations) {
+			_annotations = annotations;
+		}
+
+		Annotations *annotations() const {
+			return _annotations;
+		}
+
+		void draw(const Seiscomp::Gui::Map::Canvas*, QPainter &painter);
+
+	private:
+		typedef QList<QRect> Row;
+		typedef QVector<Row> Grid;
+
+		Annotations *_annotations;
+};
+
+
+} // ns Map
+} // ns Gui
+} // ns Seiscomp
+
+
+#endif

include/seiscomp/gui/map/annotations.h

@@ -0,0 +1,173 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MAP_ANNOTATIONS_H
+#define SEISCOMP_GUI_MAP_ANNOTATIONS_H
+
+
+#include <QColor>
+#include <QFont>
+#include <QPen>
+#include <QPoint>
+#include <QString>
+#include <QVariant>
+
+
+namespace Seiscomp {
+namespace Gui {
+namespace Map {
+
+
+class Annotations;
+class AnnotationItem;
+
+
+struct AnnotationStyle : public QObject {
+	AnnotationStyle(QObject *parent = nullptr);
+	virtual ~AnnotationStyle() {}
+
+	virtual void draw(QPainter &painter, const AnnotationItem &item);
+
+	virtual QRect itemRect(QPainter &painter, const AnnotationItem &item,
+	                       const QPoint &pos) const;
+
+	struct Palette {
+		QPen   textPen;
+		QPen   borderPen;
+		QBrush brush;
+	};
+
+	// One for normal (0) and one for highlighted (1)
+	Palette palette[2];
+	QFont   font;
+};
+
+
+/**
+ * @brief The AnnotationItem struct holds properties like text, text color etc.
+ *        which might be used when rendering an item on a map.
+*/
+class AnnotationItem {
+	private:
+		AnnotationItem(Annotations *parent) : pool(parent) {}
+		AnnotationItem(Annotations *parent, const QString &text)
+		: pool(parent), text(text) {}
+
+	public:
+		~AnnotationItem();
+
+	public:
+		/**
+		 * @brief Updates the label rect of the item based on the given position
+		 *        and style
+		 * @param pos The position of the label rect
+		 */
+		void updateLabelRect(QPainter &painter, const QPoint &pos) {
+			if ( style ) {
+				labelRect = style->itemRect(painter, *this, pos);
+			}
+			else {
+				labelRect = QRect();
+			}
+		}
+
+	public:
+		Annotations     *pool{nullptr};
+		QString          text;
+		AnnotationStyle *style{nullptr};
+		bool             visible{true};
+		bool             highlighted{false};
+		QRect            labelRect;
+		QVariant         data;
+
+	friend class Annotations;
+};
+
+
+class Annotations : public QObject {
+	public:
+		typedef QList<AnnotationItem*> Items;
+		typedef Items::const_iterator const_iterator;
+
+	public:
+		Annotations(QObject *parent = nullptr);
+		~Annotations();
+
+		const_iterator begin() const {
+			return _items.begin();
+		}
+
+		const_iterator end() const {
+			return _items.end();
+		}
+
+		/**
+		 * @brief Clears the annotation pool
+		 * This call calls delete for each AnnotationItem.
+		 */
+		void clear();
+
+		int size() { return _items.size(); }
+
+		/**
+		 * @brief Adds a new object to the annotation pool
+		 * @param text The annotation text
+		 * @return Link to an annotation item which is owned by this instance
+		 */
+		AnnotationItem *add(const QString &text);
+
+		/**
+		 * @brief Removes annotation item from annotation pool and deletes it
+		 * @param item The annotation item to remove
+		 * @return true if removed, false otherwise
+		 */
+		bool remove(const AnnotationItem *item);
+
+		/**
+		 * @brief Removes annotation item from annotation pool but does not delete
+		 *        it. The pool member in the item will be set to nullptr.
+		 * @param item The annotation item to be taken
+		 * @return true if taken, false otherwise
+		 */
+		bool take(const AnnotationItem *item);
+
+		/**
+		 * @brief Sets the default annotation style used while
+		 * creating annotation items
+		 * @param style The annotation style to set
+		 */
+		void setDefaultStyle(AnnotationStyle *style) {
+			_style = style;
+		}
+
+
+	private:
+		Items            _items;
+		AnnotationStyle  _defaultStyle;
+		AnnotationStyle *_style{nullptr};
+};
+
+
+} // ns Map
+} // ns Gui
+} // ns Seiscomp
+
+
+#endif

include/seiscomp/gui/map/canvas.h

@@ -0,0 +1,495 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MAP_CANVAS_H
+#define SEISCOMP_GUI_MAP_CANVAS_H
+
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/gui/core/maps.h>
+#include <seiscomp/gui/map/projection.h>
+#include <seiscomp/gui/map/legend.h>
+#include <seiscomp/gui/map/imagetree.h>
+#include <seiscomp/gui/map/layers/citieslayer.h>
+#include <seiscomp/gui/map/layers/gridlayer.h>
+#include <seiscomp/gui/map/layers/geofeaturelayer.h>
+#include <seiscomp/gui/map/layers/symbollayer.h>
+#include <seiscomp/math/coord.h>
+#include <seiscomp/geo/feature.h>
+#include <seiscomp/utils/timer.h>
+#endif
+
+#include <QHash>
+#include <QObject>
+#include <QPolygon>
+
+class QMouseEvent;
+class QMenu;
+
+
+namespace Seiscomp {
+namespace Gui {
+namespace Map {
+
+
+class Layer;
+
+DEFINE_SMARTPOINTER(TextureCache);
+
+// For backward compatibility
+typedef SymbolLayer SymbolCollection;
+
+
+class SC_GUI_API Canvas : public QObject {
+	Q_OBJECT
+
+	public:
+		Canvas(const MapsDesc &);
+		Canvas(ImageTree *mapTree);
+		~Canvas();
+
+
+	public:
+		void setFont(QFont f);
+		QFont font() const { return _font; }
+
+		void setBackgroundColor(QColor c);
+		bool setProjectionByName(const char *name);
+		const std::string &projectionName() const { return _projectionName; }
+
+		void setSize(int w, int h);
+		QSize size() const { return _buffer.size(); }
+
+		int width() const { return _buffer.width(); }
+		int height() const { return _buffer.height(); }
+
+		/**
+		 * @brief Sets the margin of the legend area with respect to the
+		 *        canvas border. The default value is 10 pixels. This methods
+		 *        was added with API 11.
+		 * @param margin The margin in pixels.
+		 */
+		void setLegendMargin(int margin);
+
+		/**
+		 * @brief Returns the margin of the legend area with respect to the
+		 *        canvas border. This methods was added with API 11.
+		 * @return The margin in pixels
+		 */
+		int legendMargin() const { return _margin; }
+
+		void setGrayScale(bool);
+		bool isGrayScale() const;
+
+		/**
+		 * @brief Sets bilinear filtering for map tile interpolation. This is
+		 *        only used if not in preview mode.
+		 * @param enable Boolean flag
+		 */
+		void setBilinearFilter(bool enable);
+
+		/**
+		 * @brief Enables the preview mode. The preview mode is meant to be
+		 *        used for fast rendering the map, e.g. with antialiasing
+		 *        switched of. This is mainly used while dragging the map.
+		 * @param enable Boolean flag
+		 */
+		void setPreviewMode(bool enable);
+
+		/**
+		 * @brief Returns whether the canvas rendering is currently in preview
+		 *        mode or not.
+		 * @return A boolean flag
+		 */
+		bool previewMode() const;
+
+		void setDrawGrid(bool);
+		bool isDrawGridEnabled() const;
+
+		void setDrawLayers(bool);
+		bool isDrawLayersEnabled() const;
+
+		void setDrawCities(bool);
+		bool isDrawCitiesEnabled() const;
+
+		bool isDrawLegendsEnabled() const;
+
+		void setImageFilter(bool);
+		bool isImageFilterEnabled() const;
+
+		bool displayRect(const QRectF& rect);
+
+		void setMapCenter(QPointF c);
+		const QPointF& mapCenter() const;
+
+		bool setZoomLevel(float);
+		float zoomLevel() const;
+
+		float pixelPerDegree() const;
+
+		void setView(QPoint c, float zoom);
+		void setView(QPointF c, float zoom);
+
+		/**
+		 * @brief Sets the minimum pixel distance of two adjacent vertices
+		 *        to be rendered as a line when rendering GeoFeatures and polylines.
+		 * Or in other words, if the pixel distance of two adjacent vertices is
+		 * less than the given distance, both vertices collapse into a single
+		 * vertex. The greater the distance the less details the rendered shape
+		 * will have.
+		 * @param pixel The distance in pixels
+		 */
+		void setPolygonRoughness(uint pixel);
+		uint polygonRoughness() const;
+
+		/**
+		 * @brief Sets the polygon clip hint.
+		 *
+		 * The hint might or might not be interpreted by projections. If the
+		 * clipHint is DoClip then polygons are clipped against the viewport
+		 * before rendering them. This will reduce the number of vertices
+		 * significantly but also increases processing time. The default
+		 * is DoClip.
+		 * @param hint The clipping hint
+		 */
+		void setPolygonClipHint(ClipHint hint);
+		ClipHint polygonClipHint() const;
+
+		Map::Projection *projection() const { return _projection; }
+
+		bool isVisible(double lon, double lat) const;
+
+		void setSelectedCity(const Math::Geo::CityD*);
+
+		//! Draws a geometric line (great circle) given in geographical coordinates (lon, lat)
+		//! Returns the distance in degree of the line
+		double drawLine(QPainter &painter, const QPointF &start, const QPointF &end) const;
+
+		//! Draws a polyline in geographical coordinates (lon, lat).
+		//! Returns number of line segments drawn.
+		//! Does not check for clipping
+		size_t drawPolyline(QPainter &painter, size_t n, const Geo::GeoCoordinate *line,
+		                    bool isClosedPolygon, bool interpolate = false,
+		                    int roughness = -1) const;
+
+		//! Does not check for clipping
+		size_t drawPolygon(QPainter &painter, size_t n, const Geo::GeoCoordinate *line,
+		                   bool isClosedPolygon = true, int roughness = -1,
+		                   ClipHint clipHint = DoClip) const;
+
+		//! Draws a GeoFeature as either polyline or filled polygon and
+		//! checks for clipping
+		size_t drawFeature(QPainter &painter, const Geo::GeoFeature *feature,
+		                   bool filled = false, int roughness = -1,
+		                   ClipHint clipHint = DoClip) const;
+
+		/**
+		 * @brief Draws an image onto the current map buffer. If this function
+		 *        is called *after* @drawImageLayer then it does not have an
+		 *        effect because the map buffer has been rendered already onto
+		 *        the painter device.
+		 * @param geoReference The geo reference of the image.
+		 * @param image The image to be rendered.
+		 * @param compositionMode The composition mode which will be used to
+		 *                        combine the current base layer (tiles) with
+		 *                        the image.
+		 * @param filterMode The filter mode used to render the image.
+		 */
+		void drawImage(const QRectF &geoReference, const QImage &image,
+		               CompositionMode compositionMode = CompositionMode_Default,
+		               FilterMode filterMode = FilterMode_Auto);
+
+		void draw(QPainter &p);
+
+		void centerMap(const QPoint &centerPnt);
+		void translate(const QPoint &delta);
+		void translate(const QPointF &delta);
+
+		void drawImageLayer(QPainter &painter);
+		void drawVectorLayer(QPainter &painter);
+
+		void drawLayers(QPainter &painter);
+
+		void updateBuffer();
+
+		void setBuffer(QImage buffer) { _buffer = buffer; }
+		QImage &buffer() { return _buffer; }
+
+		//! Returns the number of layers
+		int layerCount() const { return _layers.count(); }
+
+		//! Returns the i-th layer if the index is valid
+		Layer* layer(int i) const {
+			if ( i < 0 || i >= _layers.count() ) return nullptr;
+
+			return _layers[i];
+		}
+
+		//! Canvas does take ownership of layer if the layer does not
+		//! have a parent at the time of appending or prepending.
+		bool prependLayer(Layer*);
+		bool addLayer(Layer*);
+		bool insertLayerBefore(const Layer*, Layer*);
+
+		void removeLayer(Layer*);
+
+		void lower(Layer*);
+		void raise(Layer*);
+
+		Layer *hoverLayer() const;
+
+		bool filterContextMenuEvent(QContextMenuEvent*, QWidget*);
+		bool filterKeyPressEvent(QKeyEvent *event);
+		bool filterKeyReleaseEvent(QKeyEvent *event);
+		bool filterMouseMoveEvent(QMouseEvent*);
+		bool filterMousePressEvent(QMouseEvent*);
+		bool filterMouseReleaseEvent(QMouseEvent*);
+		bool filterMouseDoubleClickEvent(QMouseEvent*);
+
+		QMenu* menu(QMenu*) const;
+
+		//! Returns whether the rendering is complete or if there are
+		//! still some updates in the pipeline that updated later. If this
+		//! function return false, the signal renderingCompleted() is emitted
+		//! once it is done.
+		//! This function was introduced in API 1.1.
+		bool renderingComplete() const;
+
+
+	public:
+		GridLayer *gridLayer();
+		const GridLayer *gridLayer() const;
+
+		CitiesLayer *citiesLayer();
+		const CitiesLayer *citiesLayer() const;
+
+		GeoFeatureLayer *geoFeatureLayer();
+		const GeoFeatureLayer *geoFeatureLayer() const;
+
+		SymbolLayer *symbolCollection();
+		const SymbolLayer *symbolCollection() const;
+
+
+	public slots:
+		//! Reloads all tiles and empties the texture cache
+		//! This slot was introduced in API 1.1.
+		void reload();
+
+		//! This slot was added in API 11
+		void setDrawLegends(bool);
+
+		//! This slot was added in API 11
+		void showLegends();
+
+		//! This slot was added in API 11
+		void hideLegends();
+
+		/**
+		 * @brief Enables/disables legend stacking.
+		 *
+		 * If legend stacking is enabled then two toggle buttons will be
+		 * rendered in the legends title bar to swap the visible legend. If
+		 * stacking is disabled then all legends of a particular edge will
+		 * be rendered next to each other. This slot was added in API 11.
+		 */
+		void setLegendStacking(bool);
+
+		void bringToFront(Seiscomp::Gui::Map::Legend*);
+		void setLegendEnabled(Seiscomp::Gui::Map::Legend*, bool);
+
+		/**
+		 * @brief This handler is called when a new legend is
+		 * added to a layer.
+		 * This slot was introduced with API XX
+		 * @param legend The legend
+		 */
+		void onLegendAdded(Legend *legend);
+
+		/**
+		 * @brief This handler is called when a legend is removed
+		 * from a layer.
+		 * This slot was introduced with API XX
+		 * @param legend
+		 */
+		void onLegendRemoved(Legend *legend);
+
+	signals:
+		//! This signal is emitted if draw() caused asynchronous data requests
+		//! and when those requests are finished.
+		//! This signal was introduced with API 1.1.
+		void renderingCompleted();
+
+		void bufferUpdated();
+		void projectionChanged(Seiscomp::Gui::Map::Projection*);
+		void legendVisibilityChanged(bool);
+		void updateRequested();
+		void customLayer(QPainter*);
+
+
+	private:
+		void init();
+
+		void drawCity(QPainter &painter, const Math::Geo::CityD &,
+		              QVector< QList<QRect> > &grid,
+		              QFont &font, QFontMetrics &fontMetrics,
+		              int rowHeight,
+		              bool &lastUnderline, bool &lastBold);
+
+		void drawLegends(QPainter &painter);
+		void setupLayer(Layer *layer);
+
+
+	private slots:
+		void updatedTiles();
+		void completeTiles();
+		void updateLayer(const Layer::UpdateHints&);
+
+
+	private:
+		struct LegendItem {
+			LegendItem() : legend(0), dirty(true) {}
+			LegendItem(Legend *legend) : legend(legend), dirty(true) {}
+			Legend *legend;
+			bool    dirty;
+		};
+
+		typedef QVector<LegendItem> Legends;
+		struct LegendArea : public Legends {
+			LegendArea() : currentIndex(-1) {}
+
+			int find(Legend *legend) const {
+				for ( int i = 0; i < count(); ++i ) {
+					if ( at(i).legend == legend )
+						return i;
+				}
+				return -1;
+			}
+
+			bool hasIndex(int index) {
+				return ( index >= 0 && index < count() );
+			}
+
+			bool mousePressEvent(QMouseEvent *e);
+			bool mouseReleaseEvent(QMouseEvent *e);
+			int findNext(bool forward = true) const;
+
+			QRect      header;
+			QRect      decorationRects[2];
+			int        currentIndex;
+		};
+
+		typedef QHash<Qt::Alignment, LegendArea> LegendAreas;
+
+		typedef QList<Layer*> Layers;
+		typedef QList<LayerPtr> CustomLayers;
+
+	private:
+		QFont                         _font;
+		Projection*                   _projection;
+		ImageTreePtr                  _maptree;
+
+		std::string                   _projectionName;
+
+		QImage                        _buffer;
+		QColor                        _backgroundColor{Qt::lightGray};
+
+		uint                          _polygonRoughness;
+		double                        _maxZoom;
+		QPointF                       _center;
+		float                         _zoomLevel{1.0f};
+		bool                          _grayScale{false};
+		bool                          _filterMap;
+		bool                          _dirtyRasterLayer{true};
+		bool                          _dirtyVectorLayers{true};
+		bool                          _previewMode{false};
+		bool                          _stackLegends{true};
+
+
+		Layers                        _layers;
+		Layer                        *_hoverLayer{nullptr};
+		CustomLayers                  _customLayers;
+		CitiesLayer                   _citiesLayer;
+		GridLayer                     _gridLayer;
+		GeoFeatureLayer               _geoFeatureLayer;
+		SymbolLayer                   _symbolLayer;
+
+		LegendAreas                   _legendAreas;
+		int                           _margin{10};
+		bool                          _isDrawLegendsEnabled{true};
+
+		Util::StopWatch               _tileUpdateTimer;
+};
+
+
+inline bool Canvas::previewMode() const {
+	return _previewMode;
+}
+
+inline Layer *Canvas::hoverLayer() const {
+	return _hoverLayer;
+}
+
+inline GridLayer *Canvas::gridLayer() {
+	return &_gridLayer;
+}
+
+inline const GridLayer *Canvas::gridLayer() const {
+	return &_gridLayer;
+}
+
+inline CitiesLayer *Canvas::citiesLayer() {
+	return &_citiesLayer;
+}
+
+inline const CitiesLayer *Canvas::citiesLayer() const {
+	return &_citiesLayer;
+}
+
+inline GeoFeatureLayer *Canvas::geoFeatureLayer() {
+	return &_geoFeatureLayer;
+}
+
+inline const GeoFeatureLayer *Canvas::geoFeatureLayer() const {
+	return &_geoFeatureLayer;
+}
+
+inline SymbolLayer *Canvas::symbolCollection() {
+	return &_symbolLayer;
+}
+
+inline const SymbolLayer *Canvas::symbolCollection() const {
+	return &_symbolLayer;
+}
+
+inline uint Canvas::polygonRoughness() const {
+	return _polygonRoughness;
+}
+
+inline void Canvas::setPolygonRoughness(uint pixel) {
+	_polygonRoughness = pixel;
+}
+
+
+}
+}
+}
+
+
+#endif

include/seiscomp/gui/map/citieslayer.h

@@ -0,0 +1,68 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MAP_LAYERS_CITIESLAYER_H
+#define SEISCOMP_GUI_MAP_LAYERS_CITIESLAYER_H
+
+
+#include <seiscomp/gui/qt.h>
+#include <seiscomp/gui/map/layer.h>
+#include <seiscomp/math/coord.h>
+
+namespace Seiscomp {
+namespace Gui {
+namespace Map {
+
+
+class Canvas;
+class Projection;
+
+
+class SC_GUI_API CitiesLayer : public Layer {
+	public:
+		CitiesLayer(QObject* = nullptr);
+		virtual ~CitiesLayer();
+
+		virtual void init(const Config::Config&);
+		virtual void draw(const Canvas*, QPainter&);
+
+		void setSelectedCity(const Math::Geo::CityD*);
+		const Math::Geo::CityD* selectedCity() const;
+
+	private:
+		typedef QList<QRect> Row;
+		typedef QVector<Row> Grid;
+
+	private:
+		bool drawCity(QPainter&, Grid&, QFont&, bool&, bool&,
+		              const Projection*, const Math::Geo::CityD&,
+		              const QFontMetrics&, int, int);
+
+	private:
+		const Math::Geo::CityD *_selectedCity;
+		int _topPopulatedPlaces;
+};
+
+
+} // namespace Map
+} // namespce Gui
+} // namespace Seiscomp
+
+#endif

include/seiscomp/gui/map/decorator.h

@@ -0,0 +1,104 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_DECORATOR_H
+#define SEISCOMP_GUI_DECORATOR_H
+
+
+#include <memory>
+
+#include <QPainter>
+
+#include <seiscomp/gui/qt.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+namespace Map {
+
+class Canvas;
+
+
+/** \class Decorator
+ *
+ * Abstract class to decorate a Symbol derived class. When a derived decorator is
+ * passed to a symbol the map and baseObject member are automatically set by the
+ * respective symbol. The same is true for all other (nested) decorator which are
+ * associated whith the passed decorator. Therefore the user is obliged to assure
+ * that the other decorator operate on the same type of datamodel object (pick, origin...)
+ */
+
+class SC_GUI_API Decorator {
+
+		// ------------------------------------------------------------------
+		// X'struction
+		// ------------------------------------------------------------------
+	public:
+		Decorator(Decorator* decorator = nullptr)
+		 : _decorator(decorator),
+		   _visible(true) {
+		}
+
+		virtual ~Decorator() {}
+
+
+		// ------------------------------------------------------------------
+		// Public Interface
+		// ------------------------------------------------------------------
+	public:
+		void draw(const Canvas *canvas, QPainter &painter) {
+			if ( _decorator.get() )
+				_decorator->draw(canvas, painter);
+			customDraw(canvas, painter);
+		}
+
+		void setVisible(bool visible) {
+			if ( _decorator.get() )
+				_decorator->setVisible(visible);
+			_visible = visible;
+		}
+
+		bool isVisible() const {
+			return _visible;
+		}
+
+
+		// ------------------------------------------------------------------
+		// Protected Interface
+		// ------------------------------------------------------------------
+	protected:
+		virtual void customDraw(const Canvas *canvas, QPainter &painter) = 0;
+
+
+		// ------------------------------------------------------------------
+		// Private Members
+		// ------------------------------------------------------------------
+	private:
+		std::unique_ptr<Decorator> _decorator;
+		bool                       _visible;
+
+};
+
+
+} // namespace Map
+} // namespace Gui
+} // namespace Seiscomp
+
+#endif

include/seiscomp/gui/map/geofeaturelayer.h

@@ -0,0 +1,202 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MAP_LAYERS_GEOFEATURELAYER_H
+#define SEISCOMP_GUI_MAP_LAYERS_GEOFEATURELAYER_H
+
+
+#include <seiscomp/gui/map/layer.h>
+#ifndef Q_MOC_RUN
+#include <seiscomp/geo/featureset.h>
+#include <seiscomp/geo/index/quadtree.h>
+#endif
+
+
+#include <QImage>
+
+
+namespace Seiscomp {
+namespace Gui {
+namespace Map {
+
+
+class Canvas;
+
+
+class SC_GUI_API GeoFeatureLayer : public Layer,
+                                   virtual public Geo::GeoFeatureSetObserver {
+	Q_OBJECT
+
+
+	public:
+		GeoFeatureLayer(QObject *parent = nullptr);
+		virtual ~GeoFeatureLayer();
+
+
+	public:
+		/**
+		 * @brief Returns a feature under the given coordinate.
+		 * @param coord The coordinate.
+		 * @return A pointer to the feature instance or nullptr. Do not delete
+		 *         the feature, its ownership is still at the global
+		 *         GeoFeatureSet.
+		 */
+		const Geo::GeoFeature *findFeature(const Geo::GeoCoordinate &coord) const;
+
+		/**
+		 * @brief Convenience function for @findFeature(const Geo::GeoCoordinate &coord).
+		 * @param lat The latitude of the coordinate
+		 * @param lon The longitude of the coordinate
+		 * @return See @findFeature(const Geo::GeoCoordinate &coord).
+		 */
+		const Geo::GeoFeature *findFeature(qreal lat, qreal lon) const;
+
+		/**
+		 * @brief Renders the geofeatures on a given canvas with a given
+		 *        painter. This function is called from bufferUpdated.
+		 * @param canvas The target canvas
+		 * @param painter The painter to paint with
+		 */
+		void renderFeatures(Canvas *canvas, QPainter &painter);
+
+		virtual void setVisible(bool flag);
+		virtual void bufferUpdated(Canvas *canvas, QPainter &painter);
+
+		virtual QMenu *menu(QMenu*) const;
+
+		virtual void geoFeatureSetUpdated();
+
+
+	private slots:
+		void toggleFeatureVisibility(bool);
+		void disableFeatureVisibility();
+		void showFeatures();
+		void hideFeatures();
+		void reloadFeatures();
+
+
+	private:
+		void initLayerProperites();
+
+
+	private:
+		struct SC_GUI_API LayerProperties {
+			enum SymbolShape {
+				Disabled,
+				None,
+				Circle,
+				Triangle,
+				Square,
+				Diamond
+			};
+
+			const LayerProperties     *parent{nullptr};
+			std::string                name;
+			std::string                title;
+			Qt::Orientation            orientation{Qt::Vertical};
+			Qt::Alignment              legendArea{Qt::AlignTop | Qt::AlignLeft};
+			QPainter::CompositionMode  compositionMode{QPainter::CompositionMode_SourceOver};
+			std::string                label;
+			int                        index{0};
+			bool                       visible{true};
+			QPen                       pen;
+			QBrush                     brush;
+			QFont                      font;
+			bool                       drawName{false};
+			bool                       debug{false};
+			int                        rank{-1};
+			int                        roughness{-1};
+			bool                       filled{false};
+			int                        symbolSize{8};
+			QImage                     symbolIcon;
+			QPoint                     symbolIconHotspot;
+			SymbolShape                symbolShape{Disabled};
+			QPolygon                   symbolPolygon;
+			Qt::Alignment              symbolNameAlignment{Qt::AlignTop | Qt::AlignHCenter};
+			int                        symbolNameMargin{3};
+
+			// derived members
+			QRect                      symbolRect;
+
+			LayerProperties(const std::string &name) : name(name) {}
+			LayerProperties(const std::string &name,
+			                const LayerProperties *parent) {
+				*this = *parent;
+				this->name = name;
+				this->parent = parent;
+				this->title = std::string(); // Reset the legend title
+			}
+
+			bool isChild(const LayerProperties* child) const;
+			void read(const std::string &dataDir = "");
+
+			static SymbolShape getSymbolShape(const std::string &type);
+		};
+
+
+		struct CategoryNode {
+			CategoryNode(const Geo::Category*);
+			~CategoryNode();
+
+			CategoryNode *nodeForCategory(const Geo::Category *cat);
+			CategoryNode *nodeForProperties(const LayerProperties *props);
+
+			const Geo::Category           *category;
+			LayerProperties               *properties{nullptr};
+			std::vector<CategoryNode*>     childs;
+			std::vector<CategoryNode*>     childsByName;
+			Geo::QuadTree                  quadtree;
+			Geo::GeoBoundingBox            bbox;
+		};
+
+		static bool compareByIndex(const LayerProperties *p1,
+		                           const LayerProperties *p2);
+
+		static bool compareNodeByIndex(const GeoFeatureLayer::CategoryNode *n1,
+		                               const GeoFeatureLayer::CategoryNode *n2);
+		static bool compareNodeByName(const GeoFeatureLayer::CategoryNode *n1,
+		                              const GeoFeatureLayer::CategoryNode *n2);
+
+		CategoryNode *createOrGetNodeForCategory(const Geo::Category *cat);
+		void buildLegends(CategoryNode *node);
+		QMenu *buildMenu(CategoryNode *node, QMenu *parentMenu) const;
+		void collectLegendItems(CategoryNode *node, QVector<LayerProperties*> &items);
+		void orderTree(CategoryNode *node);
+		void updateBbox(CategoryNode *node);
+		const Geo::GeoFeature *findFeature(CategoryNode *node,
+		                                   const Geo::GeoCoordinate &coord) const;
+		bool toggleVisibility(CategoryNode *node, bool visible);
+		void drawFeatures(CategoryNode *node, Canvas *canvas,
+		                  QPainter &painter, const QPen &debugPen);
+		bool drawFeature(Canvas *canvas, QPainter *painter,
+		                 const QPen *debugPen, const LayerProperties *props,
+		                 const Geo::GeoFeature *f);
+
+		bool                       _initialized;
+		CategoryNode              *_root;
+};
+
+
+}
+}
+}
+
+
+#endif

include/seiscomp/gui/map/gridlayer.h

@@ -0,0 +1,56 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MAP_LAYERS_GRIDLAYER_H
+#define SEISCOMP_GUI_MAP_LAYERS_GRIDLAYER_H
+
+
+#include <seiscomp/gui/qt.h>
+#include <seiscomp/gui/map/layer.h>
+#include <seiscomp/math/coord.h>
+
+
+namespace Seiscomp {
+namespace Gui {
+namespace Map {
+
+
+class Canvas;
+
+
+class SC_GUI_API GridLayer : public Layer {
+	public:
+		GridLayer(QObject* = nullptr);
+		virtual ~GridLayer();
+
+		virtual void draw(const Canvas*, QPainter&);
+
+		void setGridDistance(const QPointF&);
+		const QPointF& gridDistance() const;
+	private:
+		QPointF                _gridDistance;
+};
+
+
+} // namespace Map
+} // namespce Gui
+} // namespace Seiscomp
+
+#endif

include/seiscomp/gui/map/imagetree.h

@@ -0,0 +1,254 @@
+/***************************************************************************
+ * Copyright (C) gempa GmbH                                                *
+ * All rights reserved.                                                    *
+ * Contact: gempa GmbH (seiscomp-dev@gempa.de)                             *
+ *                                                                         *
+ * GNU Affero General Public License Usage                                 *
+ * This file may be used under the terms of the GNU Affero                 *
+ * Public License version 3.0 as published by the Free Software Foundation *
+ * and appearing in the file LICENSE included in the packaging of this     *
+ * file. Please review the following information to ensure the GNU Affero  *
+ * Public License version 3.0 requirements will be met:                    *
+ * https://www.gnu.org/licenses/agpl-3.0.html.                             *
+ *                                                                         *
+ * Other Usage                                                             *
+ * Alternatively, this file may be used in accordance with the terms and   *
+ * conditions contained in a signed written agreement between you and      *
+ * gempa GmbH.                                                             *
+ ***************************************************************************/
+
+
+#ifndef SEISCOMP_GUI_MAP_IMAGETREE_H
+#define SEISCOMP_GUI_MAP_IMAGETREE_H
+
+
+#ifndef Q_MOC_RUN
+#include <seiscomp/core/interfacefactory.h>
+#include <seiscomp/core/baseobject.h>
+#endif
+#include <seiscomp/gui/core/maps.h>
+
+#include <QImage>
+
+
+namespace Seiscomp {
+namespace Gui {
+namespace Map {
+
+
+DEFINE_SMARTPOINTER(TextureCache);
+class ImageTree;
+
+
+struct SC_GUI_API TileIndex {
+	typedef uint64_t Storage;
+	enum Traits {
+		Invalid = uint64_t(-1),
+		MaxLevel = 29,
+		LevelBits = 5,
+		RowBits = MaxLevel,
+		ColumnBits = MaxLevel
+	};
+
+	Storage id;
+
+	TileIndex();
+	TileIndex(uint8_t level, uint32_t row, uint32_t column);
+
+	uint8_t level() const;
+	uint32_t row() const;
+	uint32_t column() const;
+
+	TileIndex parent() const;
+
+	bool operator==(const TileIndex &other) const;
+	bool operator!=(const TileIndex &other) const;
+	bool operator<(const TileIndex &other) const;
+
+	operator bool() const;
+};
+
+
+std::ostream &operator<<(std::ostream &os, const TileIndex &index);
+
+
+DEFINE_SMARTPOINTER(TileStore);
+class SC_GUI_API TileStore : public Core::BaseObject {
+	public:
+		enum LoadResult {
+			OK,
+			Deferred,
+			Error
+		};
+
+		TileStore();
+
+	public:
+		const QSize &tileSize() const { return _tilesize; }
+
+		//! Sets the parent image tree that gets notificiations about
+		//! state changed, e.g. finishedLoading.
+		void setImageTree(ImageTree *tree);
+
+	public:
+		virtual int maxLevel() const = 0;
+
+		//! Opens a tile repository and sets the desc flags accordingly
+		//! if necessary.
+		virtual bool open(MapsDesc &desc) = 0;
+
+		/**
+		 * @brief Load a tile for a given index.
+		 * Loading can happen synchronously or asynchronously. The later case
+		 * should return the status LoadResult::Deferred and an invalid
+		 * image. If a deferred image could not be loaded by the store it
+		 * should then call invalidate with the failed index.
+		 * @param img The image to be populated.
+		 * @param tile The tile index
+		 * @return Success flag.
+		 */
+		virtual LoadResult load(QImage &img, const TileIndex &tile) = 0;
+
+		//! Return a unique ID for a node
+		virtual QString getID(const TileIndex &tile) const = 0;
+
+		//! Validate the existance of a tile
+		virtual bool validate(int level, int column, int row) const = 0;
+
+		virtual bool hasPendingRequests() const = 0;
+
+		//! Refresh the image store, e.g. invalidate its cache
+		virtual void refresh() = 0;
+
+
+	protected:
+		//! Async notification that a tile has been loaded.
+		void finishedLoading(QImage &img, const TileIndex &tile);
+
+		//! Async notification that a tile has been loaded.
+		void loadingComplete(QImage &img, TileIndex tile);
+		//! Async notification that loading a tile has been aborted
+		void loadingCancelled(TileIndex tile);
+
+		//! Invalidates the tile of a particular node
+		void invalidate(const TileIndex &tile);
+
+
+	protected:
+		ImageTree *_tree;
+		QSize      _tilesize;
+
+};
+
+
+DEFINE_INTERFACE_FACTORY(TileStore);
+
+#define REGISTER_TILESTORE_INTERFACE(Class, Service) \
+Seiscomp::Core::Generic::InterfaceFactory<Seiscomp::Gui::Map::TileStore, Class> __##Class##InterfaceFactory__(Service)
+
+
+DEFINE_SMARTPOINTER(ImageTree);
+class SC_GUI_API ImageTree : public QObject, public Core::BaseObject {
+	Q_OBJECT
+
+	public:
+		ImageTree(const MapsDesc &desc);
+		~ImageTree();
+
+
+	public:
+		bool valid() const { return _store.get(); }
+
+		//! This function was introduced in API 1.1
+		bool hasPendingRequests() const { return _store && _store->hasPendingRequests(); }
+
+		//! Returns the currently attached cache instance.
+		//! If no cache is yet attached a new cache is
+		//! created and stored in the object.
+		TextureCache *getCache();
+
+		//! Empties the texture cache and tells the store to do a refresh
+		//! as well.
+		//! This function was introduced in API 1.1.
+		void refresh();
+
+
+	public:
+		void finishedLoading(QImage &img, const TileIndex &tile);
+		void loadingComplete(QImage &img, TileIndex tile);
+		void loadingCancelled(TileIndex tile);
+		void invalidate(const TileIndex &tile);
+
+
+	signals:
+		void tilesUpdated();
+
+		//! Emitted when all tiles are loaded and no asynchronous requests
+		//! are still pending.
+		//! This signal was introduced in API 1.1.
+		void tilesComplete();
+
+
+	protected:
+		TextureCachePtr _cache;
+		TileStorePtr    _store;
+		bool            _isMercatorProjected;
+		size_t          _cacheSize;
+
+
+	friend class TileStore;
+};
+
+
+inline TileIndex::TileIndex() : id(Invalid) {}
+inline TileIndex::TileIndex(uint8_t level, uint32_t row, uint32_t column) {
+	id = ((Storage(level) & ((1 << LevelBits) - 1)) << (RowBits + ColumnBits)) |
+	     ((Storage(row) & ((1 << RowBits) - 1)) << ColumnBits) |
+	     (Storage(column) & ((1 << ColumnBits) - 1));
+}
+
+inline uint8_t TileIndex::level() const {
+	return (id >> (RowBits + ColumnBits)) & ((1 << LevelBits) - 1);
+}
+
+inline uint32_t TileIndex::row() const {
+	return (id >> ColumnBits) & ((1 << RowBits) - 1);
+}
+
+inline uint32_t TileIndex::column() const {
+	return id & ((1 << ColumnBits) - 1);
+}
+
+inline TileIndex TileIndex::parent() const {
+	auto l = level();
+	return l ? TileIndex(l-1, row() >> 1, column() >> 1) : TileIndex();
+}
+
+inline bool TileIndex::operator==(const TileIndex &other) const {
+	return id == other.id;
+}
+
+inline bool TileIndex::operator!=(const TileIndex &other) const {
+	return id != other.id;
+}
+
+inline bool TileIndex::operator<(const TileIndex &other) const {
+	return id < other.id;
+}
+
+inline TileIndex::operator bool() const {
+	return id != Invalid;
+}
+
+inline std::ostream &operator<<(std::ostream &os, const TileIndex &index) {
+	os << static_cast<int>(index.level()) << "/" << index.row() << "/" << index.column();
+	return os;
+}
+
+
+}
+}
+}
+
+
+#endif